Last active
December 4, 2018 15:05
-
-
Save jdanders/245bfbc4cdd9c97474207fc0fc557fb6 to your computer and use it in GitHub Desktop.
opensc_debug_logs
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| P:16463; T:0x140367463017984 12:09:19.078 [opensc-pkcs11] ctx.c:869:sc_context_create: =================================== | |
| P:16463; T:0x140367463017984 12:09:19.078 [opensc-pkcs11] ctx.c:870:sc_context_create: opensc version: 0.19.0 | |
| P:16463; T:0x140367463017984 12:09:19.078 [opensc-pkcs11] reader-pcsc.c:829:pcsc_init: PC/SC options: connect_exclusive=0 disconnect_action=0 transaction_end_action=0 reconnect_action=0 enable_pinpad=1 enable_pace=1 | |
| P:16463; T:0x140367463017984 12:09:19.078 [opensc-pkcs11] reader-pcsc.c:1311:pcsc_detect_readers: called | |
| P:16463; T:0x140367463017984 12:09:19.078 [opensc-pkcs11] reader-pcsc.c:1324:pcsc_detect_readers: Probing PC/SC readers | |
| P:16463; T:0x140367463017984 12:09:19.078 [opensc-pkcs11] reader-pcsc.c:1352:pcsc_detect_readers: Establish PC/SC context | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:1260:pcsc_add_reader: Adding new PC/SC reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:358:refresh_attributes: current state: 0x00000022 | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:359:refresh_attributes: previous state: 0x00000000 | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:414:refresh_attributes: card present, changed | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:1441:pcsc_detect_readers: Yubico Yubikey NEO OTP+U2F+CCID 00 00:SCardConnect(SHARED): 0x00000000 | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:1078:detect_reader_features: called | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:1080:detect_reader_features: Requesting reader features ... | |
| P:16463; T:0x140367463017984 12:09:19.220 [opensc-pkcs11] reader-pcsc.c:1101:detect_reader_features: Reader feature 12 found | |
| P:16463; T:0x140367463017984 12:09:19.221 [opensc-pkcs11] reader-pcsc.c:1018:part10_detect_max_data: get dwMaxAPDUDataSize property returned 65536 | |
| P:16463; T:0x140367463017984 12:09:19.221 [opensc-pkcs11] reader-pcsc.c:1211:detect_reader_features: Reader supports transceiving 65536 bytes of data | |
| P:16463; T:0x140367463017984 12:09:19.221 [opensc-pkcs11] reader-pcsc.c:1057:part10_get_vendor_product: id_vendor=1050 id_product=0116 | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] reader-pcsc.c:1456:pcsc_detect_readers: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x0 | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x1 | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x2 | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x3 | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] slot.c:164:initialize_reader: Initialize reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00': detect SC card presence | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.223 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] slot.c:166:initialize_reader: Initialize reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00': detect PKCS11 card presence | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] slot.c:256:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: First seen the card | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] slot.c:265:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Connecting ... | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] card.c:196:sc_connect_card: called | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:544:pcsc_connect: called | |
| P:16463; T:0x140367463017984 12:09:19.224 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] reader-pcsc.c:576:pcsc_connect: Initial protocol: T=1 | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:221:sc_connect_card: matching configured ATRs | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:265:sc_connect_card: matching built-in ATRs | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'cardos' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'flex' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'cyberflex' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'gpk' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'gemsafeV1' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'asepcos' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'starcos' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'tcos' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'oberthur' | |
| P:16463; T:0x140367463017984 12:09:19.225 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'authentic' | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card-authentic.c:416:authentic_match_card: | |
| try to match card with ATR (22 bytes): | |
| 3B FC 13 00 00 81 31 FE 15 59 75 62 69 6B 65 79 ;.....1..Yubikey | |
| 4E 45 4F 72 33 E1 NEOr3. | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card-authentic.c:419:authentic_match_card: card not matched | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'iasecc' | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card-iasecc.c:345:iasecc_match_card: card not matched | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'belpic' | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'incrypto34' | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'acos5' | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'akis' | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'entersafe' | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card-entersafe.c:138:entersafe_match_card: called | |
| P:16463; T:0x140367463017984 12:09:19.226 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'epass2003' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card-epass2003.c:1143:epass2003_match_card: called | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'rutoken' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card-rutoken.c:103:rutoken_match_card: called | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card-rutoken.c:109:rutoken_match_card: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'rutoken_ecp' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card-rtecp.c:62:rtecp_match_card: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'myeid' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'dnie' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card-dnie.c:739:dnie_match_card: called | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card-dnie.c:742:dnie_match_card: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'MaskTech' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'atrust-acos' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'westcos' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'coolkey' | |
| P:16463; T:0x140367463017984 12:09:19.227 [opensc-pkcs11] card-coolkey.c:2240:coolkey_match_card: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] card-coolkey.c:942:coolkey_apdu_io: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] card-coolkey.c:947:coolkey_apdu_io: a4 04 00 7 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] card-coolkey.c:1011:coolkey_apdu_io: calling sc_transmit_apdu flags=0 le=0, resplen=0, resp=0x7ffe6e140700 | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] card-coolkey.c:2385:coolkey_card_reader_lock_obtained: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] card-coolkey.c:2391:coolkey_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(7) 0x7ffe6e142781 | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (12 bytes): | |
| 00 A4 04 00 07 62 76 01 FF 00 00 00 .....bv..... | |
| P:16463; T:0x140367463017984 12:09:19.228 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.241 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.241 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.241 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.241 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.241 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card-coolkey.c:1018:coolkey_apdu_io: result r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card-coolkey.c:898:coolkey_check_sw: sw1 = 0x6a, sw2 = 0x82 | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card-coolkey.c:1026:coolkey_apdu_io: Transmit failed | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card-coolkey.c:1044:coolkey_apdu_io: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'muscle' | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card-muscle.c:829:muscle_card_reader_lock_obtained: called | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card-muscle.c:837:muscle_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(6) 0x7fa9d8c124f0 | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 A4 04 00 06 A0 00 00 00 01 01 ........... | |
| P:16463; T:0x140367463017984 12:09:19.247 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.256 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.256 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.256 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.256 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.256 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] muscle.c:276:msc_select_applet: returning with: -1200 (Card command failed) | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'sc-hsm' | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(11) 0x7ffe6e1425a0 | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (17 bytes): | |
| 00 A4 04 00 0B E8 2B 06 01 04 01 81 C3 1F 02 01 ......+......... | |
| 00 . | |
| P:16463; T:0x140367463017984 12:09:19.258 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.267 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.267 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.267 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.267 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.267 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] iso7816.c:578:iso7816_select_file: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] card-sc-hsm.c:179:sc_hsm_select_file_ex: Could not select SmartCard-HSM application: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] card-sc-hsm.c:257:sc_hsm_match_card: Could not select SmartCard-HSM application: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'mcrd' | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] card-mcrd.c:297:mcrd_match_card: called | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:C, data(15) 0x7fa9d8b980e0 | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (20 bytes): | |
| 00 A4 04 0C 0F D2 33 00 00 00 45 73 74 45 49 44 ......3...EstEID | |
| 20 76 33 35 v35 | |
| P:16463; T:0x140367463017984 12:09:19.273 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.281 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 86 j. | |
| P:16463; T:0x140367463017984 12:09:19.281 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.281 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.281 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.281 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Incorrect parameters P1-P2 | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'setcos' | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CA, P1:DF, P2:30, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 CA DF 30 05 ...0. | |
| P:16463; T:0x140367463017984 12:09:19.287 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.295 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 67 00 g. | |
| P:16463; T:0x140367463017984 12:09:19.295 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.295 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.295 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.295 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.297 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'PIV-II' | |
| P:16463; T:0x140367463017984 12:09:19.297 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.297 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.297 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:16463; T:0x140367463017984 12:09:19.297 [opensc-pkcs11] card-piv.c:3553:piv_card_reader_lock_obtained: PIV_STATE_MATCH | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #10 | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #10 | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e142568 | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 08 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.298 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6D 00 m. | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Instruction code not supported or invalid | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:16463; T:0x140367463017984 12:09:19.307 [opensc-pkcs11] card-piv.c:760:piv_find_aid: called | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] card-piv.c:726:piv_select_aid: called | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(9) 0x7fa9d8b9f080 | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (15 bytes): | |
| 00 A4 04 00 09 A0 00 00 03 08 00 00 10 00 00 ............... | |
| P:16463; T:0x140367463017984 12:09:19.308 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (21 bytes): | |
| 61 11 4F 06 00 00 10 00 01 00 79 07 4F 05 A0 00 a.O.......y.O... | |
| 00 03 08 90 00 ..... | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:742:piv_select_aid: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:772:piv_find_aid: found PIX | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:786:piv_find_aid: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #10 | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.316 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #10 | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e142568 | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 08 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.317 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe6e142572 | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x(nil) len=20 | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e142568 | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 14 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.326 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x55665f6cae42 | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #10 0x55665f6cae40:20 (nil):0 | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x55665f6cae42:18 | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:2603:piv_parse_discovery: Discovery pinp flags=0x40 0x00 | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.335 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.339 [opensc-pkcs11] card-piv.c:2904:piv_finish: called | |
| P:16463; T:0x140367463017984 12:09:19.339 [opensc-pkcs11] card.c:297:sc_connect_card: matched: Personal Identity Verification Card | |
| P:16463; T:0x140367463017984 12:09:19.339 [opensc-pkcs11] card-piv.c:3122:piv_init: called | |
| P:16463; T:0x140367463017984 12:09:19.339 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.339 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:3553:piv_card_reader_lock_obtained: PIV_STATE_MATCH | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #10 | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #10 | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e1424d8 | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 08 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.340 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe6e1424e2 | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x(nil) len=20 | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e1424d8 | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 14 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.349 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.358 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:19.358 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.358 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.358 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x55665f6cae42 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #10 0x55665f6cae40:20 (nil):0 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x55665f6cae42:18 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:2603:piv_parse_discovery: Discovery pinp flags=0x40 0x00 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe6e142610 len=256 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e1425a8 | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.359 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe6e142612 | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe6e142612:18 | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card-piv.c:3141:piv_init: Max send = 0 recv = 0 card->type = 14003 | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:FD, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 FD 00 00 03 ..... | |
| P:16463; T:0x140367463017984 12:09:19.368 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (5 bytes): | |
| 01 00 04 90 00 ..... | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:3162:piv_init: Yubico card->type=14003, r=0x00000000 version=0x00010004 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:3221:piv_init: PIV card-type=14003 card_issues=0x00020313 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:2708:piv_process_history: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #11 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #11 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:913:piv_get_data: #11 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #11 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 0 0 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141578 | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0C 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.375 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:2894:piv_process_history: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:1003:piv_get_cached_data: found #10 0x55665f6cae40:20 (nil):0 | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x55665f6cae42:18 | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:2603:piv_parse_discovery: Discovery pinp flags=0x40 0x00 | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.382 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:3260:piv_init: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:327:sc_connect_card: card info name:'Personal Identity Verification Card', type:14003, flags:0x0, max_send/recv_size:255/256 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:1462:sc_card_sm_check: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:1463:sc_card_sm_check: card->sm_ctx.ops.open (nil) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:1468:sc_card_sm_check: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:339:sc_connect_card: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] slot.c:285:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Connected SC card 0x55665f6cdaa0 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] dir.c:163:sc_enum_apps: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=3f002f00 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x2F00 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:420:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:2515:piv_select_file: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:776:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] dir.c:171:sc_enum_apps: Cannot select EF.DIR file: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] slot.c:292:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting Framework. 0 on-card applications | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] slot.c:293:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: generic application <none> | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] slot.c:307:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detected framework 0. Creating tokens. | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] slot.c:322:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Try to bind 'generic' token. | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] framework-pkcs15.c:308:pkcs15_bind: Bind PKCS#15 '<anonymous>' application | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] pkcs15.c:1192:sc_pkcs15_bind: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] pkcs15.c:1193:sc_pkcs15_bind: application(aid:'empty') | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] pkcs15.c:1219:sc_pkcs15_bind: PKCS#15 options: use_file_cache=0 use_pin_cache=1 pin_cache_counter=10 pin_cache_ignore_user_consent=0 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe6e142a80 len=256 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.388 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e142a18 | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.389 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe6e142a82 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe6e142a82:18 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15.c:1230:sc_pkcs15_bind: PKCS#15 emulation enabled | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:111:sc_pkcs15_bind_synthetic: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:152:sc_pkcs15_bind_synthetic: no emulator list in config file, trying all builtin emulators | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying westcos | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-westcos.c:255:sc_pkcs15emu_westcos_init_ex: sc_pkcs15_init_func_ex westcos | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-westcos.c:241:westcos_detect_card: westcos_detect_card (Personal Identity Verification Card) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying openpgp | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying infocamere | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying starcert | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying tcos | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying esteid | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying itacns | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-itacns.c:866:sc_pkcs15emu_itacns_init_ex: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying postecert | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying PIV-II | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-piv.c:1213:sc_pkcs15emu_piv_init_ex: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-piv.c:238:piv_detect_card: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] pkcs15-piv.c:618:sc_pkcs15emu_piv_init: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:2080:piv_get_serial_nr_from_CHUI: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #1 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #1 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:913:piv_get_data: #1 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #1 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141678 | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 02 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.398 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (63 bytes): | |
| 53 3B 30 19 D4 E7 39 DA 73 9C ED 39 CE 73 9D 83 S;0...9.s..9.s.. | |
| 68 58 21 08 42 10 84 21 38 42 10 C3 F5 34 10 8C hX!.B..!8B...4.. | |
| 38 0F CE 70 91 41 FE 54 8B DE 42 E2 29 03 B0 35 8..p.A.T..B.)..5 | |
| 08 32 30 33 30 30 31 30 31 3E 00 FE 00 90 00 .20300101>..... | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe6e141682 | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 61 | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #1 *buf=0x(nil) len=61 | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.411 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141678 | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 02 3D ..?..\._..= | |
| P:16463; T:0x140367463017984 12:09:19.412 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (63 bytes): | |
| 53 3B 30 19 D4 E7 39 DA 73 9C ED 39 CE 73 9D 83 S;0...9.s..9.s.. | |
| 68 58 21 08 42 10 84 21 38 42 10 C3 F5 34 10 8C hX!.B..!8B...4.. | |
| 38 0F CE 70 91 41 FE 54 8B DE 42 E2 29 03 B0 35 8..p.A.T..B.)..5 | |
| 08 32 30 33 30 30 31 30 31 3E 00 FE 00 90 00 .20300101>..... | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x55665f6ca972 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 61 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 61 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #1 0x55665f6ca970:61 (nil):0 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 61 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2111:piv_get_serial_nr_from_CHUI: fascn=0x55665f6ca974,fascnlen=25,guid=0x55665f6ca98f,guidlen=16,gbits=ff | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2134:piv_get_serial_nr_from_CHUI: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] pkcs15-piv.c:648:sc_pkcs15emu_piv_init: PIV-II adding objects... | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0xDB00 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x3000 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x3010 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:420:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0101 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 2 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6010 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 3 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x3001 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 4 | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.425 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6030 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 5 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0100 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 6 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0102 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 7 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0500 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 8 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x9000 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 9 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6050 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 10 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6060 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 11 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1015 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 32 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1001 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 12 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1002 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 13 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1003 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 14 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1004 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 15 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1005 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 16 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1006 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 17 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.426 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1007 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 18 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1008 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 19 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1009 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100A | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 21 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100B | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 22 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100C | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 23 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100D | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 24 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100E | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 25 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100F | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 26 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1010 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 27 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1011 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 28 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1012 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 29 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1013 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 30 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1014 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 31 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] pkcs15-piv.c:708:sc_pkcs15emu_piv_init: PIV-II adding certs... | |
| P:16463; T:0x140367463017984 12:09:19.427 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0101 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 2 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0101cece, index=0, count=-1 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0101cece | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0101 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 2 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #2 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #2 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:913:piv_get_data: #2 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #2 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141588 | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 05 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.428 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:2535:piv_select_file: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:776:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] pkcs15.c:2407:sc_pkcs15_read_file: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] pkcs15-piv.c:746:sc_pkcs15emu_piv_init: No cert found,i=0 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0100 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 6 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0100cece, index=0, count=-1 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0100cece | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0100 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 6 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #6 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #6 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:913:piv_get_data: #6 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #6 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141588 | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0A 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.435 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.466 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 05 28 70 82 05 1F 30 82 05 1B 30 82 03 03 S..(p...0...0... | |
| A0 03 02 01 02 02 01 51 30 0D 06 09 2A 86 48 86 .......Q0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .CA1.0...U....as | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfasdfasdfasdf | |
| 22 30 20 06 09 2A 86 48 86 F7 0D 01 09 01 16 13 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfasdfasfdsad. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 com0...112121212 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..1212121212 | |
| 30 30 5A 30 50 31 0B 30 09 06 03 55 04 06 13 02 00Z0P1.0...U.... | |
| 55 53 31 0B 30 09 06 03 55 04 08 0C 02 61 61 31 US1.0...U....CA1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdfdf | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfdfs1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....asdfsadffd | |
| 65 61 61 61 61 30 82 01 22 30 0D 06 09 61 FD asdfa0.."0...a. | |
| P:16463; T:0x140367463017984 12:09:19.466 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.466 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.466 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe6e141594 | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1324 | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #6 *buf=0x(nil) len=1324 | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141588 | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0A 00 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.467 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.498 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 05 28 70 82 05 1F 30 82 05 1B 30 82 03 03 S..(p...0...0... | |
| A0 03 02 01 02 02 01 51 30 0D 06 09 2A 86 48 86 .......Q0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 02 61 61 31 1A 30 18 06 03 55 04 0A 0C 11 61 61 .AZ1.0...U....sd | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfasdfasdf | |
| 22 30 20 06 09 2A 86 48 86 F7 0D 01 09 01 16 13 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aasdfsadfassdfn. | |
| 63 6F 6D 30 1E 17 0D 31 37 31 31 31 31 31 31 31 com0...123123122 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..2123123134 | |
| 30 30 5A 30 50 31 0B 30 09 06 03 55 04 06 13 02 00Z0P1.0...U.... | |
| 55 53 31 0B 30 09 06 03 55 04 08 0C 02 61 61 31 US1.0...U....AZ1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdfaf | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfasdffsa1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....fasdfasdff | |
| 61 61 61 61 61 30 82 01 22 30 0D 06 09 61 FD asdff0.."0...a. | |
| P:16463; T:0x140367463017984 12:09:19.498 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.498 [opensc-pkcs11] apdu.c:434:sc_get_response: called | |
| P:16463; T:0x140367463017984 12:09:19.498 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.498 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.498 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.499 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.499 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.499 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.499 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.499 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.499 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 2A 86 48 86 F7 0D 01 01 01 05 00 03 82 01 0F 00 *.H............. | |
| 30 82 01 0A 02 82 01 01 00 90 B7 F4 83 61 61 5F 0............aa_ | |
| CB 5E 50 19 4F FA 1D B0 DA 65 B8 42 E3 B9 82 02 .^P.O....e.B.... | |
| 59 29 4D 76 91 45 65 DD FA C2 42 36 81 B5 A4 DE Y)Mv.Ee...B6.... | |
| FD EC 05 58 E7 E9 4D BE 69 F2 8F E1 15 79 DC 3B ...X..M.i....y.; | |
| E6 1D B7 ED AC A9 A5 AF D0 B9 4D C2 4C 40 40 70 ..........M.L@@p | |
| BB 75 29 7E C4 39 AB AA BC D3 98 D8 60 6C 83 CF .u)~.9......`l.. | |
| E7 D1 2B ED 5A 1F 33 91 3D DA 26 47 86 B3 6F 22 ..+.Z.3.=.&G..o" | |
| 27 87 DC E0 7C DB EF 74 0A A9 BE D9 14 E7 CE 4F '...|..t.......O | |
| C3 6B EC B8 6F EE F6 74 C5 83 C7 61 F3 64 96 0B .k..o..t...a.d.. | |
| 10 F0 FA EF 93 B1 87 97 2D B9 0C 17 9F DA EF AD ........-....... | |
| 51 B0 6E 08 00 64 47 32 66 76 DD 5B 28 C1 E5 51 Q.n..dG2fv.[(..Q | |
| 0B 82 57 40 FE 78 C1 AA 89 A1 65 9B 28 5C EE 51 ..W@.x....e.(\.Q | |
| 69 1A 84 CF 0F D8 05 24 A5 9F 50 D6 B3 39 1F D2 i......$..P..9.. | |
| 10 CD D2 9A 20 A8 0A 9F 5A 51 85 47 9F FF 1A 00 .... ...ZQ.G.... | |
| 15 33 7F 4B 63 21 02 5A 86 56 09 50 26 61 FD .3.Kc!.Z.V.P&a. | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.527 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 50 7F 71 77 C7 4F 9D 08 B3 31 08 25 96 0F 7F 49 P.qw.O...1.%...I | |
| B8 B3 6F 93 79 E0 21 AC 8C 01 7D 99 02 03 01 00 ..o.y.!...}..... | |
| 01 A3 81 F5 30 81 F2 30 09 06 03 55 1D 13 04 02 ....0..0...U.... | |
| 30 00 30 11 06 09 60 86 48 01 86 F8 42 01 01 04 0.0...`.H...B... | |
| 04 03 02 05 A0 30 33 06 09 60 86 48 01 86 F8 42 .....03..`.H...B | |
| 01 0D 04 26 16 24 4F 70 65 6E 53 53 4C 20 47 65 ...&.$OpenSSL Ge | |
| 6E 65 72 61 74 65 64 20 43 6C 69 65 6E 74 20 43 nerated Client C | |
| 65 72 74 69 66 69 63 61 74 65 30 1D 06 03 55 1D ertificate0...U. | |
| 0E 04 16 04 14 AD 41 CD 8A 71 8E 8B D7 F8 7A F7 ......A..q....z. | |
| 45 4D E5 47 55 AB AC AB 54 30 1F 06 03 55 1D 23 EM.GU...T0...U.# | |
| 04 18 30 16 80 14 AF F5 8E B7 63 53 AC A9 F3 49 ..0.......cS...I | |
| BF 09 D6 58 79 D3 97 85 11 7F 30 0E 06 03 55 1D ...Xy.....0...U. | |
| 0F 01 01 FF 04 04 03 02 06 C0 30 29 06 03 55 1D ..........0)..U. | |
| 25 04 22 30 20 06 08 2B 06 01 05 05 07 03 02 06 %."0 ..+........ | |
| 08 2B 06 01 05 05 07 03 04 06 0A 2B 06 01 04 01 .+.........+.... | |
| 82 37 14 02 02 30 22 06 03 55 1D 11 04 61 FD .7...0"..U...a. | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.556 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...asdfasdff@s | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadf.com0... | |
| 2A 86 48 86 F7 0D 01 01 0D 05 00 03 82 02 01 00 *.H............. | |
| C1 5E 49 BE D7 BF 36 70 78 1D DB 5A 79 48 E2 0F .^I...6px..ZyH.. | |
| E5 9C 9D CE B8 7F B8 4B AD F2 CB 80 57 08 39 5E .......K....W.9^ | |
| 85 ED 2B CE 65 55 C3 15 3F FF 62 88 63 2C 4C 24 ..+.eU..?.b.c,L$ | |
| FA EA B2 EE 4D 4F 38 19 0D 03 EF DA 03 85 D0 95 ....MO8......... | |
| A5 52 81 FA A6 38 0E B4 85 4F 27 52 AC 4C 29 58 .R...8...O'R.L)X | |
| FB 39 62 D8 30 4B 65 1C 95 07 A1 C4 E4 E4 CA 5A .9b.0Ke........Z | |
| C8 D3 01 6C 60 A4 16 AF 0E 2A 05 F7 28 4E 9B 33 ...l`....*..(N.3 | |
| F3 70 3B 7A 1E 64 A1 99 12 5A 7B C3 25 CC E2 EF .p;z.d...Z{.%... | |
| 34 52 41 C5 F1 B2 7A D5 67 BA 9C 19 1C CA 4C 68 4RA...z.g.....Lh | |
| C7 9E D3 5A D6 9D 1E CE CF 3D 00 C0 8F 52 61 2C ...Z.....=...Ra, | |
| 2B 6E 36 FF C6 39 70 FB 5B FE 3F 9D 93 F1 85 D2 +n6..9p.[.?..... | |
| 90 80 D7 E0 E5 70 1A 52 49 3C 86 7D 67 53 94 AD .....p.RI<.}gS.. | |
| 11 7E EA CF 95 3A 8F 7D 40 5B AD AC 8C 61 FD .~...:.}@[...a. | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.585 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| D2 2E 2B 20 E8 6F 30 B6 79 60 AA 60 96 A2 1D 58 ..+ .o0.y`.`...X | |
| 2E 83 B8 2F 9C E0 08 BB E5 BE D9 E2 06 4F 83 B5 .../.........O.. | |
| 01 43 A5 9F 85 91 54 61 B5 97 AE CD 57 BB E6 C7 .C....Ta....W... | |
| 0D 4B CE 22 29 C2 9C 33 01 CE 78 F7 E3 88 93 C0 .K.")..3..x..... | |
| A1 AC 8E 2F 4C 49 02 30 E6 98 F1 EB DE 7E AB 10 .../LI.0.....~.. | |
| C2 C7 C4 06 D5 46 3B 89 66 AE AA 05 AD EF 23 5B .....F;.f.....#[ | |
| 6B 03 03 8A 87 D1 8B E6 D6 A8 EE 08 A0 6E E1 55 k............n.U | |
| 0F EA DD 86 75 31 46 AE 03 FC E3 86 91 3C E7 C6 ....u1F......<.. | |
| C7 6D 60 21 2B 29 BE 13 C4 42 84 61 AD 2C 2C 76 .m`!+)...B.a.,,v | |
| 7C 28 F1 84 E6 1E 36 D0 4C 2D 44 08 B6 81 93 40 |(....6.L-D....@ | |
| 89 C4 7F E6 33 8E 6E 0D B9 2A C0 AD E5 67 59 FA ....3.n..*...gY. | |
| 91 C0 8E 09 FE AF 50 4D 79 23 BC 0D 3D 27 B4 CC ......PMy#..='.. | |
| A3 73 93 4B 7D 93 7F 3E 3B B4 5F C9 E8 FE 07 33 .s.K}..>;._....3 | |
| 2F 92 54 27 D9 B1 55 EA 5F E4 C7 0C A2 7B D2 48 /.T'..U._....{.H | |
| A8 F4 75 6E AF 9D 5B A1 B0 94 DC E5 ED A2 B4 3C ..un..[........< | |
| 76 61 AF 53 BA 8B F7 63 13 C8 F1 1D 27 61 3B va.S...c....'a; | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 3B ....; | |
| P:16463; T:0x140367463017984 12:09:19.614 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (61 bytes): | |
| 7D 1C 21 EC 6E E9 2A D2 F2 4B C4 66 B8 8C F6 DB }.!.n.*..K.f.... | |
| 4D 55 CD E0 54 41 61 A3 81 5B CE 97 CB C2 0A 8E MU..TAa..[...... | |
| D4 70 E9 53 8F 56 AE D9 07 40 E5 58 92 9C B3 8C .p.S.V...@.X.... | |
| C9 7A A4 92 03 89 71 01 00 FE 00 90 00 .z....q...... | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] apdu.c:505:sc_get_response: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x55665f6da6a4 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1324 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 1324 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #6 0x55665f6da6a0:1324 (nil):0 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1324 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1153:piv_cache_internal_data: added #6 internal 0x55665f6dabe0:1311 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1155:piv_cache_internal_data: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:2563:piv_select_file: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:789:sc_select_file: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:571:sc_read_binary: called; 1311 bytes at index 0 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 0 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #6 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1003:piv_get_cached_data: found #6 0x55665f6da6a0:1324 0x55665f6dabe0:1311 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1324 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1078:piv_cache_internal_data: #6 found internal 0x55665f6dabe0:1311 | |
| P:16463; T:0x140367463017984 12:09:19.625 [opensc-pkcs11] card-piv.c:1079:piv_cache_internal_data: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 512 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 768 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 1024 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:571:sc_read_binary: called; 31 bytes at index 1280 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 31 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 31 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:608:sc_read_binary: returning with: 1311 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15.c:2400:sc_pkcs15_read_file: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x55665f6db901:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A028201010090B7F4 8361615FCB5E50194FFA1DB0DA65B842 | |
| E3B9820259294D76914565DDFAC24236 81B5A4DEFDEC0558E7E94DBE69F28FE1 1579DC3BE61DB7EDACA9A5AFD0B94DC2 | |
| 4C404070BB75297EC439ABAABCD398D8 606C83CFE7D12BED5A1F33913DDA2647 86B36F222787DCE07CDBEF740AA9BED9 | |
| 14E7CE4FC36BECB86FEEF674C583C761 F364960B10F0FAEF93B187972DB90C17 9FDAEFAD51B06E08006447326676DD5B | |
| 28C1E5510B825740FE78C1AA89A1659B 285CEE51691A84CF0FD80524A59F50D6 B3391FD210CDD29A20A80A9F5A518547 | |
| 9FFF1A0015337F4B6321025A86560950 26507F7177C74F9D08B3310825960F7F 49B8B36F9379E021AC8C017D99020301 | |
| 0001 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-cert.c:214:sc_pkcs15_get_name_from_dn: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-cert.c:295:sc_pkcs15_get_extension: returning with: 4 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15-cert.c:332:sc_pkcs15_get_bitstring_extension: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0102 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 7 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0102cece, index=0, count=-1 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0102cece | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0102 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 7 | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.626 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #7 | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #7 | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card-piv.c:913:piv_get_data: #7 | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #7 | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141588 | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0B 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.627 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 04 FD 70 82 04 F4 30 82 04 F0 30 82 02 D8 S...p...0...0... | |
| A0 03 02 01 02 02 01 50 30 0D 06 09 2A 86 48 86 .......P0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 02 61 61 31 1A 30 18 06 03 55 04 0A 0C 11 61 61 .ID1.0...U....as | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfasdfsdfsadf1 | |
| 22 30 20 06 09 2A 86 48 86 F7 0D 01 09 01 16 13 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfsadfasd. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 com0...171128132 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..2211271324 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 00Z0P1.0...U.... | |
| 55 53 31 0B 30 09 06 03 55 04 08 0C 02 61 61 31 US1.0...U....CA1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdffd | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfasd1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....fsadfasdfs | |
| 65 72 73 6F 6E 30 82 01 22 30 0D 06 09 61 FD fasdf0.."0...a. | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe6e141594 | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1281 | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #7 *buf=0x(nil) len=1281 | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141588 | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0B 00 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.658 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 04 FD 70 82 04 F4 30 82 04 F0 30 82 02 D8 S...p...0...0... | |
| A0 03 02 01 02 02 01 50 30 0D 06 09 2A 86 48 86 .......P0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .MO1.0...U....sd | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfasdfsdfa | |
| 22 30 20 06 09 2A 86 48 86 F7 0D 01 09 01 16 13 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfasdfsadfsdf. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 com0...112121212 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..1212121212 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 1210P1.0...U.... | |
| 55 53 31 0B 30 09 06 03 55 04 08 0C 02 61 61 31 US1.0...U....CA1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdffd | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aasdfsadffd1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....asdfsadfsd | |
| 65 72 73 6F 6E 30 82 01 22 30 0D 06 09 61 FD asdfsa.."0...a. | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] apdu.c:434:sc_get_response: called | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.690 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.718 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 2A 86 48 86 F7 0D 01 01 01 05 00 03 82 01 0F 00 *.H............. | |
| 30 82 01 0A 02 82 01 01 00 B8 5F 4D 18 A7 06 06 0........._M.... | |
| D7 A5 1F 75 08 F1 D9 1E 05 72 7C E2 AB BC D9 D0 ...u.....r|..... | |
| 90 F8 60 9A CE C6 0C A2 44 08 EA 1B 10 B8 50 DC ..`.....D.....P. | |
| DA 77 E7 95 90 84 43 2E 61 2A 3C 8A DE 37 AB F8 .w....C.a*<..7.. | |
| 4F F9 DF A1 C3 EC A6 C9 F2 85 1E A0 EF 16 45 CD O.............E. | |
| D6 DD 75 11 56 22 DE 76 D8 44 D5 9F A3 CF 9F D1 ..u.V".v.D...... | |
| 68 2D 83 C2 DA CB 43 9B 58 4B D3 2C 2A D8 2B E4 h-....C.XK.,*.+. | |
| 8C 5C CA 33 02 7A CD 69 72 78 95 23 50 D8 71 3F .\.3.z.irx.#P.q? | |
| 8F A0 AE 5C C2 39 03 41 CD 14 19 8E 88 8E E1 AE ...\.9.A........ | |
| 46 34 4F 07 18 BB 92 FB 3E D8 AD 83 08 DD 63 BA F4O.....>.....c. | |
| EA 62 77 CC 8A C8 19 01 73 EC 8E A3 59 EE 77 0D .bw.....s...Y.w. | |
| BC C8 8E 59 7C 36 EB 9D 60 67 01 F5 A0 E7 B3 29 ...Y|6..`g.....) | |
| 6D 60 27 0B D5 B4 7D 5F F3 6A 77 50 61 E8 45 A3 m`'...}_.jwPa.E. | |
| FD D6 25 E3 A4 CE ED 49 4E B2 66 CE 06 16 88 B9 ..%....IN.f..... | |
| E9 52 20 A4 8F 55 E6 E9 D8 89 46 17 FE 61 FD .R ..U....F..a. | |
| P:16463; T:0x140367463017984 12:09:19.718 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.718 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.718 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.719 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.747 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| C3 AB 72 E3 2A 82 4B 9A 02 C7 46 A8 00 92 BE 27 ..r.*.K...F....' | |
| C5 DB 63 99 D8 4B 0F 86 31 53 3D 3D 02 03 01 00 ..c..K..1S==.... | |
| 01 A3 81 CA 30 81 C7 30 09 06 03 55 1D 13 04 02 ....0..0...U.... | |
| 30 00 30 11 06 09 60 86 48 01 86 F8 42 01 01 04 0.0...`.H...B... | |
| 04 03 02 05 A0 30 33 06 09 60 86 48 01 86 F8 42 .....03..`.H...B | |
| 01 0D 04 26 16 24 4F 70 65 6E 53 53 4C 20 47 65 ...&.$OpenSSL Ge | |
| 6E 65 72 61 74 65 64 20 43 6C 69 65 6E 74 20 43 nerated Client C | |
| 65 72 74 69 66 69 63 61 74 65 30 1D 06 03 55 1D ertificate0...U. | |
| 0E 04 16 04 14 1D A5 C9 31 09 F1 47 34 5B 60 91 ........1..G4[`. | |
| D0 E2 64 0A 9D 8C 24 E4 1B 30 1F 06 03 55 1D 23 ..d...$..0...U.# | |
| 04 18 30 16 80 14 AF F5 8E B7 63 53 AC A9 F3 49 ..0.......cS...I | |
| BF 09 D6 58 79 D3 97 85 11 7F 30 0E 06 03 55 1D ...Xy.....0...U. | |
| 0F 01 01 FF 04 04 03 02 05 20 30 22 06 03 55 1D ......... 0"..U. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 ...0...asdfsdffs | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 @asdfasdfs.com0. | |
| 06 09 2A 86 48 86 F7 0D 01 01 0D 05 00 61 FD ..*.H........a. | |
| P:16463; T:0x140367463017984 12:09:19.747 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.747 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.748 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 03 82 02 01 00 80 A0 53 CF 43 AE 8C 71 52 CF A6 .......S.C..qR.. | |
| 84 25 91 50 9A 77 52 C8 EC A6 1B 5C D8 6C 27 4E .%.P.wR....\.l'N | |
| 3A 8B D6 CA 05 47 4B D4 D0 36 08 3E FA CA C8 EC :....GK..6.>.... | |
| 58 BC 44 34 9E 30 84 8F C3 7C A9 F3 72 44 15 22 X.D4.0...|..rD." | |
| 5C 6E 6F 9F BC 59 6C 03 6C 4F AD 8E 08 0A 28 45 \no..Yl.lO....(E | |
| 07 1D CB AE BC 0A 81 26 DA A2 42 40 F1 97 7A 84 .......&..B@..z. | |
| CA 5A 01 0A C5 4F 1C 6B 79 26 D8 2A 90 2D 04 E9 .Z...O.ky&.*.-.. | |
| DB A1 A1 12 F6 64 BA F2 8F 57 47 87 13 24 79 3E .....d...WG..$y> | |
| 96 DE A2 EB C7 F8 2A 80 31 C5 B4 CE E7 C6 9F 22 ......*.1......" | |
| 43 D3 69 50 4A 32 10 A5 DB 61 B5 2D 41 16 26 9C C.iPJ2...a.-A.&. | |
| 73 E5 CB B3 7D F1 95 47 D9 CA 37 40 7B E0 5E 85 s...}..G..7@{.^. | |
| C3 19 C3 9E 12 C8 40 33 AF 46 62 01 4B A0 E0 8D ......@3.Fb.K... | |
| EF 95 DD 36 DE 14 A2 81 04 8C A7 FB EB DC B1 EE ...6............ | |
| D7 A3 43 60 CB 6B FF 67 6A F4 0A 08 37 17 E0 46 ..C`.k.gj...7..F | |
| DC B9 CC 1E 51 D8 DD FC 52 B7 4D 0F 8B 01 21 6D ....Q...R.M...!m | |
| 54 4D 51 75 0E 0D FD 12 FB 0F 24 95 D7 61 FD TMQu......$..a. | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:16463; T:0x140367463017984 12:09:19.776 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 1C D9 72 89 D3 9F A4 BC 0F 4A 64 9E 8A 55 55 FA ..r......Jd..UU. | |
| 78 F6 9F 68 61 8E 80 2E 3D B6 64 B2 12 D1 A2 DE x..ha...=.d..... | |
| EA 7B BF 38 F2 2D CC A9 B3 AA 3D 85 45 02 0D FB .{.8.-....=.E... | |
| 4C 9C F2 36 14 46 F9 03 54 F2 36 0D EE F6 53 FD L..6.F..T.6...S. | |
| 58 E3 85 F6 AE A2 96 59 7D 8A 57 BA 61 B1 01 6A X......Y}.W.a..j | |
| 59 BA 5F 68 53 A7 A2 C6 D6 14 E0 36 0B 11 E5 6C Y._hS......6...l | |
| 76 FD 89 60 14 C6 89 7D 63 79 BE 28 88 95 66 F6 v..`...}cy.(..f. | |
| F4 1A E0 C4 A1 6C 66 FB 34 97 EF B7 99 07 C3 02 .....lf.4....... | |
| 0E 27 57 DA AF D4 B6 32 6F AC 04 55 C6 F3 91 12 .'W....2o..U.... | |
| C3 71 DD A3 52 60 41 10 FC DA BB 00 56 E3 67 DB .q..R`A.....V.g. | |
| EF 96 70 18 47 26 62 07 A0 A7 52 FB 13 AB 68 D5 ..p.G&b...R...h. | |
| DB EB DB 2F 93 7B 7F F3 4D A6 00 86 F7 B4 31 8A .../.{..M.....1. | |
| 31 82 4B 10 21 B8 9C 91 BC 39 14 3E A0 BF 3A A8 1.K.!....9.>..:. | |
| AE 53 FB 3F 9B 95 84 B4 78 B7 DA 32 A9 93 01 BA .S.?....x..2.... | |
| 6B 49 FE CF D8 A7 35 A0 51 40 34 77 69 D6 CB F9 kI....5.Q@4wi... | |
| DC 70 6E B3 B8 07 AE BC 8C 27 A1 BD C8 61 10 .pn......'...a. | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 10 ..... | |
| P:16463; T:0x140367463017984 12:09:19.805 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (18 bytes): | |
| 6B 22 FB 2F 66 50 28 2D 23 45 B9 71 01 00 FE 00 k"./fP(-#E.q.... | |
| 90 00 .. | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] apdu.c:505:sc_get_response: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x55665f6dbdb4 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1281 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 1281 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #7 0x55665f6dbdb0:1281 (nil):0 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1281 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1153:piv_cache_internal_data: added #7 internal 0x55665f6dd140:1268 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1155:piv_cache_internal_data: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:2563:piv_select_file: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:789:sc_select_file: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:571:sc_read_binary: called; 1268 bytes at index 0 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 0 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #7 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1003:piv_get_cached_data: found #7 0x55665f6dbdb0:1281 0x55665f6dd140:1268 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1281 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1078:piv_cache_internal_data: #7 found internal 0x55665f6dd140:1268 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1079:piv_cache_internal_data: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 512 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 768 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:571:sc_read_binary: called; 244 bytes at index 1024 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 244 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 244 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:608:sc_read_binary: returning with: 1268 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15.c:2400:sc_pkcs15_read_file: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x55665f6dde01:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A0282010100B85F4D 18A70606D7A51F7508F1D91E05727CE2 | |
| ABBCD9D090F8609ACEC60CA24408EA1B 10B850DCDA77E7959084432E612A3C8A DE37ABF84FF9DFA1C3ECA6C9F2851EA0 | |
| EF1645CDD6DD75115622DE76D844D59F A3CF9FD1682D83C2DACB439B584BD32C 2AD82BE48C5CCA33027ACD6972789523 | |
| 50D8713F8FA0AE5CC2390341CD14198E 888EE1AE46344F0718BB92FB3ED8AD83 08DD63BAEA6277CC8AC8190173EC8EA3 | |
| 59EE770DBCC88E597C36EB9D606701F5 A0E7B3296D60270BD5B47D5FF36A7750 61E845A3FDD625E3A4CEED494EB266CE | |
| 061688B9E95220A48F55E6E9D8894617 FEC3AB72E32A824B9A02C746A80092BE 27C5DB6399D84B0F8631533D3D020301 | |
| 0001 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:16463; T:0x140367463017984 12:09:19.812 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-cert.c:295:sc_pkcs15_get_extension: returning with: 4 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15-cert.c:332:sc_pkcs15_get_bitstring_extension: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0500 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 8 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0500cece, index=0, count=-1 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0500cece | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0500 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 8 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #8 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #8 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:913:piv_get_data: #8 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #8 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e141588 | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 01 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.813 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:2535:piv_select_file: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:776:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] pkcs15.c:2407:sc_pkcs15_read_file: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] pkcs15-piv.c:746:sc_pkcs15emu_piv_init: No cert found,i=3 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1001 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 12 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=4 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1002 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 13 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=5 | |
| P:16463; T:0x140367463017984 12:09:19.820 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1003 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 14 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=6 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1004 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 15 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=7 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1005 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 16 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=8 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1006 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 17 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=9 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1007 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 18 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=10 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1008 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 19 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=11 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1009 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=12 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100A | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 21 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.821 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=13 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100B | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 22 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=14 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100C | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 23 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=15 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100D | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 24 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=16 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100E | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 25 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=17 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100F | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 26 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=18 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1010 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 27 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=19 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1011 | |
| P:16463; T:0x140367463017984 12:09:19.822 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 28 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=20 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1012 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 29 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=21 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1013 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 30 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=22 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1014 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 31 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=23 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:927:sc_pkcs15emu_piv_init: PIV-II adding pins... | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card-piv.c:2171:piv_get_pin_preference: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:958:sc_pkcs15emu_piv_init: DEE Adding pin 0 label=PIN | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:958:sc_pkcs15emu_piv_init: DEE Adding pin 1 label=PIV PUK | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:982:sc_pkcs15emu_piv_init: PIV-II adding pub keys... | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=0 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env PIV_9A_KEY | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:1033:sc_pkcs15emu_piv_init: DEE look for file NULL | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-pubkey.c:807:sc_pkcs15_encode_pubkey_as_spki: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-pubkey.c:811:sc_pkcs15_encode_pubkey_as_spki: Encoding public key with algorithm 0 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-pubkey.c:601:sc_pkcs15_encode_pubkey_rsa: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-pubkey.c:612:sc_pkcs15_encode_pubkey_rsa: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-pubkey.c:877:sc_pkcs15_encode_pubkey_as_spki: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.823 [opensc-pkcs11] pkcs15-piv.c:1085:sc_pkcs15emu_piv_init: adding pubkey for 1 keyalg=0 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1122:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x000002d1 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-pubkey.c:807:sc_pkcs15_encode_pubkey_as_spki: called | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-pubkey.c:811:sc_pkcs15_encode_pubkey_as_spki: Encoding public key with algorithm 0 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-pubkey.c:601:sc_pkcs15_encode_pubkey_rsa: called | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-pubkey.c:612:sc_pkcs15_encode_pubkey_rsa: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-pubkey.c:877:sc_pkcs15_encode_pubkey_as_spki: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1085:sc_pkcs15emu_piv_init: adding pubkey for 2 keyalg=0 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1122:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x00000011 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=3 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env PIV_9E_KEY | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1033:sc_pkcs15emu_piv_init: DEE look for file NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=4 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=5 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=6 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=7 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=8 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=9 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=10 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=11 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=12 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=13 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=14 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=15 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=16 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=17 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=18 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=19 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=20 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=21 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=22 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=23 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1127:sc_pkcs15emu_piv_init: PIV-II adding private keys... | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1197:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x0000022e | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1197:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x00000022 | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-piv.c:1204:sc_pkcs15emu_piv_init: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] pkcs15-syn.c:188:sc_pkcs15_bind_synthetic: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.824 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] pkcs15.c:1256:sc_pkcs15_bind: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] slot.c:335:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Creating 'generic' token. | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:1421:pkcs15_create_tokens: create PKCS#15 tokens; fws:0x55665f6cee20,(nil),(nil) | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:1422:pkcs15_create_tokens: create slots flags 0x8 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:1431:pkcs15_create_tokens: Use FW data with index 0; fw_data->p15_card 0x55665f6cf080 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] pkcs15.c:1697:sc_pkcs15_find_pin_by_flags: called | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] pkcs15.c:1698:sc_pkcs15_find_pin_by_flags: Find PIN flags:0x10, mask:0xD2, index:-1 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] pkcs15.c:1724:sc_pkcs15_find_pin_by_flags: returning with: -1407 (Requested object not found) | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] pkcs15.c:1697:sc_pkcs15_find_pin_by_flags: called | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] pkcs15.c:1698:sc_pkcs15_find_pin_by_flags: Find PIN flags:0x12, mask:0xD2, index:-1 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] pkcs15.c:1721:sc_pkcs15_find_pin_by_flags: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:1437:pkcs15_create_tokens: Flags:0x8; Auth User/Sign PINs 0x55665f6df2e0/(nil) | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 2 RSA private keys | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 2 RSA public keys | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:715:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() called, pubkey 0x55665f6e09d0, data 0x55665f6e14b0 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:728:__pkcs15_create_pubkey_object: Use emulated pubkey | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:757:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() returns pubkey object 0x55665f6e6830 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:715:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() called, pubkey 0x55665f6e1ab0, data 0x55665f6e2590 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:728:__pkcs15_create_pubkey_object: Use emulated pubkey | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:757:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() returns pubkey object 0x55665f6e6890 | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 EC private keys | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 EC public keys | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 GOSTR3410 private keys | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 GOSTR3410 public keys | |
| P:16463; T:0x140367463017984 12:09:19.829 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 2 certificates | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x55665f6e69e1:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A028201010090B7F4 8361615FCB5E50194FFA1DB0DA65B842 | |
| E3B9820259294D76914565DDFAC24236 81B5A4DEFDEC0558E7E94DBE69F28FE1 1579DC3BE61DB7EDACA9A5AFD0B94DC2 | |
| 4C404070BB75297EC439ABAABCD398D8 606C83CFE7D12BED5A1F33913DDA2647 86B36F222787DCE07CDBEF740AA9BED9 | |
| 14E7CE4FC36BECB86FEEF674C583C761 F364960B10F0FAEF93B187972DB90C17 9FDAEFAD51B06E08006447326676DD5B | |
| 28C1E5510B825740FE78C1AA89A1659B 285CEE51691A84CF0FD80524A59F50D6 B3391FD210CDD29A20A80A9F5A518547 | |
| 9FFF1A0015337F4B6321025A86560950 26507F7177C74F9D08B3310825960F7F 49B8B36F9379E021AC8C017D99020301 | |
| 0001 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:624:pkcs15_cert_extract_label: pkcs15_cert_extract_label() called. Current label: Certificate for Digital Signature | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x55665f6e76c1:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A0282010100B85F4D 18A70606D7A51F7508F1D91E05727CE2 | |
| ABBCD9D090F8609ACEC60CA24408EA1B 10B850DCDA77E7959084432E612A3C8A DE37ABF84FF9DFA1C3ECA6C9F2851EA0 | |
| EF1645CDD6DD75115622DE76D844D59F A3CF9FD1682D83C2DACB439B584BD32C 2AD82BE48C5CCA33027ACD6972789523 | |
| 50D8713F8FA0AE5CC2390341CD14198E 888EE1AE46344F0718BB92FB3ED8AD83 08DD63BAEA6277CC8AC8190173EC8EA3 | |
| 59EE770DBCC88E597C36EB9D606701F5 A0E7B3296D60270BD5B47D5FF36A7750 61E845A3FDD625E3A4CEED494EB266CE | |
| 061688B9E95220A48F55E6E9D8894617 FEC3AB72E32A824B9A02C746A80092BE 27C5DB6399D84B0F8631533D3D020301 | |
| 0001 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:624:pkcs15_cert_extract_label: pkcs15_cert_extract_label() called. Current label: Certificate for Key Management | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 13 data objects | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 Generic secret keys | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 0 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:846:__pkcs15_prkey_bind_related: Object is a private key and has id 02 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:871:__pkcs15_prkey_bind_related: Associating object 2 as public key | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1159:sc_pkcs15_dup_pubkey: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 1 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:846:__pkcs15_prkey_bind_related: Object is a private key and has id 03 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:871:__pkcs15_prkey_bind_related: Associating object 3 as public key | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] pkcs15-pubkey.c:1159:sc_pkcs15_dup_pubkey: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 2 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 3 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 4 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:891:__pkcs15_cert_bind_related: Object is a certificate and has id 02 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:920:__pkcs15_cert_bind_related: Associating object 0 as private key | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 5 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:891:__pkcs15_cert_bind_related: Object is a certificate and has id 03 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:920:__pkcs15_cert_bind_related: Associating object 1 as private key | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 6 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 7 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 8 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 9 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 10 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 11 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 12 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 13 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 14 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 15 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 16 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 17 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 18 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1201:_pkcs15_create_typed_objects: found 19 FW objects | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1443:pkcs15_create_tokens: Found 19 FW objects objects | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1459:pkcs15_create_tokens: Found 2 authentication objects | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1468:pkcs15_create_tokens: Found authentication object 'PIN' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1132:pkcs15_create_slot: Create slot (p11card 0x55665f6cda50, fw_data 0x55665f6cee20, auth 0x55665f6df2e0, app_info (nil)) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] slot.c:430:slot_allocate: Allocated slot 0x0 for card in reader Yubico Yubikey NEO OTP+U2F+CCID 00 00 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1056:pkcs15_init_slot: Called | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1120:pkcs15_init_slot: Initialized token 'asdfsd asdfsadf' in slot 0x0 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1324:_add_pin_related_objects: Add objects related to PIN('PIN',ID:01) | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x55665f6e6770,SIGN key,101):01 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1343:_add_pin_related_objects: Slot:0x55665f6cce90, obj:0x55665f6e6770 Adding private key 0 to PIN 'PIN' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e6770 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e6830 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e68f0 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x55665f6e67d0,KEY MAN key,101):01 | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1343:_add_pin_related_objects: Slot:0x55665f6cce90, obj:0x55665f6e67d0 Adding private key 1 to PIN 'PIN' | |
| P:16463; T:0x140367463017984 12:09:19.830 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e67d0 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e6890 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e6cf0 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x55665f6e7690,Cardholder Fingerprints,500):01 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1347:_add_pin_related_objects: Slot:0x55665f6cce90 Adding data object 10 to PIN 'PIN' | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e7690 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x55665f6e76f0,Printed Information,500):01 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1347:_add_pin_related_objects: Slot:0x55665f6cce90 Adding data object 11 to PIN 'PIN' | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e76f0 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x55665f6e7750,Cardholder Facial Image,500):01 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1347:_add_pin_related_objects: Slot:0x55665f6cce90 Adding data object 12 to PIN 'PIN' | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e7750 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x55665f6e7990,Cardholder Iris Image,500): | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1338:_add_pin_related_objects: Ignoring object 18 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1517:pkcs15_create_tokens: Add public objects to slot 0x55665f6cce90 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1384:_add_public_objects: 19 public objects to process | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e6d50,Card Capability Container,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e6d50 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e6db0,Card Holder Unique Identifier,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e6db0 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e75d0,Unsigned Card Holder Unique Identifier,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e75d0 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e7630,X.509 Certificate for PIV Authentication,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e7630 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e77b0,X.509 Certificate for Digital Signature,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e77b0 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e7810,X.509 Certificate for Key Management,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e7810 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e7870,X.509 Certificate for Card Authentication,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e7870 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e78d0,Security Object,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e78d0 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x55665f6e7930,Discovery Object,500) | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x55665f6e7930 | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] framework-pkcs15.c:1521:pkcs15_create_tokens: All tokens created | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] slot.c:170:initialize_reader: Reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' initialized | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] pkcs11-global.c:314:C_Initialize: C_Initialize() = CKR_OK | |
| P:16463; T:0x140367463017984 12:09:19.831 [opensc-pkcs11] pkcs11-global.c:389:C_GetInfo: C_GetInfo() | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, plug-n-play) | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:1311:pcsc_detect_readers: called | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:1324:pcsc_detect_readers: Probing PC/SC readers | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:1456:pcsc_detect_readers: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] pkcs11-global.c:471:C_GetSlotList: was only a size inquiry (1) | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, refresh) | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] pkcs11-global.c:488:C_GetSlotList: returned 1 slots | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] framework-pkcs15.c:538:C_GetTokenInfo: C_GetTokenInfo(0) | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] framework-pkcs15.c:569:C_GetTokenInfo: C_GetTokenInfo() auth. object 0x55665f6df2e0, token-info flags 0x40D | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] pkcs15-pin.c:689:sc_pkcs15_get_pin_info: called | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.832 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe6e13de50 len=256 | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e13dde8 | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:19.833 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe6e13de52 | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe6e13de52:18 | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] sec.c:200:sc_pin_cmd: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:3394:piv_pin_cmd: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card-piv.c:3395:piv_pin_cmd: piv_pin_cmd tries_left=10, logged_in=-1 | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.842 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.843 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.843 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(0) 0x7ffe6e13df10 | |
| P:16463; T:0x140367463017984 12:09:19.843 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.843 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (4 bytes): | |
| 00 20 00 80 . .. | |
| P:16463; T:0x140367463017984 12:09:19.843 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 63 C3 c. | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] iso7816.c:123:iso7816_check_sw: PIN not verified (remaining tries: 3) | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card-piv.c:3319:piv_check_protected_objects: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card-piv.c:913:piv_get_data: #4 | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #4 *buf=0x0x7ffe6e13e090 len=8 | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e13e008 | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.848 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 09 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.849 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:913:piv_get_data: #3 | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #3 *buf=0x0x7ffe6e13e090 len=8 | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.855 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.856 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.856 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.856 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.856 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e13e008 | |
| P:16463; T:0x140367463017984 12:09:19.856 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.856 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 03 08 ..?..\._... | |
| P:16463; T:0x140367463017984 12:09:19.856 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:19.862 [opensc-pkcs11] card-piv.c:913:piv_get_data: #32 | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #32 *buf=0x0x7ffe6e13e090 len=8 | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe6e13e008 | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 21 08 ..?..\._.!. | |
| P:16463; T:0x140367463017984 12:09:19.863 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:19.869 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:3358:piv_check_protected_objects: No protected objects found, setting CI_CANT_USE_GETDATA_FOR_STATE | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:3377:piv_check_protected_objects: object_test_verify=0, card_issues = 0x0002031b | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:3378:piv_check_protected_objects: returning with: -1214 (PIN code or key incorrect) | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:3512:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card-piv.c:3513:piv_pin_cmd: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] sec.c:247:sc_pin_cmd: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.870 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:19.878 [opensc-pkcs11] pkcs15-pin.c:717:sc_pkcs15_get_pin_info: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:19.878 [opensc-pkcs11] framework-pkcs15.c:587:C_GetTokenInfo: C_GetTokenInfo(0) returns 0x0 | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, plug-n-play) | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] reader-pcsc.c:1311:pcsc_detect_readers: called | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] reader-pcsc.c:1324:pcsc_detect_readers: Probing PC/SC readers | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] reader-pcsc.c:1456:pcsc_detect_readers: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:21.037 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] pkcs11-global.c:471:C_GetSlotList: was only a size inquiry (1) | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, refresh) | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.038 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] pkcs11-global.c:488:C_GetSlotList: returned 1 slots | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] framework-pkcs15.c:538:C_GetTokenInfo: C_GetTokenInfo(0) | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] framework-pkcs15.c:569:C_GetTokenInfo: C_GetTokenInfo() auth. object 0x55665f6df2e0, token-info flags 0x40D | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] pkcs15-pin.c:689:sc_pkcs15_get_pin_info: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe6e13de50 len=256 | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe6e13dde8 | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:16463; T:0x140367463017984 12:09:21.039 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe6e13de52 | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe6e13de52:18 | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.049 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] sec.c:200:sc_pin_cmd: called | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] card-piv.c:3394:piv_pin_cmd: called | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] card-piv.c:3395:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(0) 0x7ffe6e13df10 | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (4 bytes): | |
| 00 20 00 80 . .. | |
| P:16463; T:0x140367463017984 12:09:21.050 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 63 C3 c. | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] iso7816.c:123:iso7816_check_sw: PIN not verified (remaining tries: 3) | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] card-piv.c:3489:piv_pin_cmd: CI_CANT_USE_GETDATA_FOR_STATE set, assume logged_in=-1 | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] card-piv.c:3512:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] card-piv.c:3513:piv_pin_cmd: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] sec.c:247:sc_pin_cmd: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:21.056 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:16463; T:0x140367463017984 12:09:21.066 [opensc-pkcs11] pkcs15-pin.c:717:sc_pkcs15_get_pin_info: returning with: 0 (Success) | |
| P:16463; T:0x140367463017984 12:09:21.066 [opensc-pkcs11] framework-pkcs15.c:587:C_GetTokenInfo: C_GetTokenInfo(0) returns 0x0 |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| *************** OpenSC PKCS#11 spy ***************** | |
| Loaded: "/usr/lib/pkcs11/opensc-pkcs11.so" | |
| 0: C_GetFunctionList | |
| 2018-12-03 20:42:34.662 | |
| Returned: 0 CKR_OK | |
| 1: C_Initialize | |
| 2018-12-03 20:42:34.662 | |
| [in] pInitArgs = (nil) | |
| Returned: 0 CKR_OK | |
| 2: C_GetInfo | |
| 2018-12-03 20:42:35.424 | |
| [out] pInfo: | |
| cryptokiVersion: 2.20 | |
| manufacturerID: 'OpenSC Project ' | |
| flags: 0 | |
| libraryDescription: 'OpenSC smartcard framework ' | |
| libraryVersion: 0.19 | |
| Returned: 0 CKR_OK | |
| 3: C_GetSlotList | |
| 2018-12-03 20:42:35.425 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Count is 1 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 4: C_GetSlotList | |
| 2018-12-03 20:42:35.426 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Slot 0 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 5: C_GetTokenInfo | |
| 2018-12-03 20:42:35.426 | |
| [in] slotID = 0x0 | |
| [out] pInfo: | |
| label: 'My Real Name ' | |
| manufacturerID: 'piv_II ' | |
| model: 'PKCS#15 emulated' | |
| serialNumber: '123abd32f34666f3' | |
| ulMaxSessionCount: 0 | |
| ulSessionCount: 0 | |
| ulMaxRwSessionCount: 0 | |
| ulRwSessionCount: 0 | |
| ulMaxPinLen: 8 | |
| ulMinPinLen: 4 | |
| ulTotalPublicMemory: -1 | |
| ulFreePublicMemory: -1 | |
| ulTotalPrivateMemory: -1 | |
| ulFreePrivateMemory: -1 | |
| hardwareVersion: 0.0 | |
| firmwareVersion: 0.0 | |
| time: ' ' | |
| flags: 40d | |
| CKF_RNG | |
| CKF_LOGIN_REQUIRED | |
| CKF_USER_PIN_INITIALIZED | |
| CKF_TOKEN_INITIALIZED | |
| Returned: 0 CKR_OK | |
| 6: C_GetSlotList | |
| 2018-12-03 20:42:36.605 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Count is 1 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 7: C_GetSlotList | |
| 2018-12-03 20:42:36.606 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Slot 0 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 8: C_GetTokenInfo | |
| 2018-12-03 20:42:36.606 | |
| [in] slotID = 0x0 | |
| [out] pInfo: | |
| label: 'My Real Name ' | |
| manufacturerID: 'piv_II ' | |
| model: 'PKCS#15 emulated' | |
| serialNumber: '123abd32f34666f3' | |
| ulMaxSessionCount: 0 | |
| ulSessionCount: 0 | |
| ulMaxRwSessionCount: 0 | |
| ulRwSessionCount: 0 | |
| ulMaxPinLen: 8 | |
| ulMinPinLen: 4 | |
| ulTotalPublicMemory: -1 | |
| ulFreePublicMemory: -1 | |
| ulTotalPrivateMemory: -1 | |
| ulFreePrivateMemory: -1 | |
| hardwareVersion: 0.0 | |
| firmwareVersion: 0.0 | |
| time: ' ' | |
| flags: 40d | |
| CKF_RNG | |
| CKF_LOGIN_REQUIRED | |
| CKF_USER_PIN_INITIALIZED | |
| CKF_TOKEN_INITIALIZED | |
| Returned: 0 CKR_OK | |
| 9: C_GetSlotList | |
| 2018-12-03 20:42:36.839 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Count is 1 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 10: C_GetSlotList | |
| 2018-12-03 20:42:36.840 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Slot 0 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 11: C_GetTokenInfo | |
| 2018-12-03 20:42:36.840 | |
| [in] slotID = 0x0 | |
| [out] pInfo: | |
| label: 'My Real Name ' | |
| manufacturerID: 'piv_II ' | |
| model: 'PKCS#15 emulated' | |
| serialNumber: '123abd32f34666f3' | |
| ulMaxSessionCount: 0 | |
| ulSessionCount: 0 | |
| ulMaxRwSessionCount: 0 | |
| ulRwSessionCount: 0 | |
| ulMaxPinLen: 8 | |
| ulMinPinLen: 4 | |
| ulTotalPublicMemory: -1 | |
| ulFreePublicMemory: -1 | |
| ulTotalPrivateMemory: -1 | |
| ulFreePrivateMemory: -1 | |
| hardwareVersion: 0.0 | |
| firmwareVersion: 0.0 | |
| time: ' ' | |
| flags: 40d | |
| CKF_RNG | |
| CKF_LOGIN_REQUIRED | |
| CKF_USER_PIN_INITIALIZED | |
| CKF_TOKEN_INITIALIZED | |
| Returned: 0 CKR_OK |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| P:32260; T:0x140540021001728 07:52:40.852 [opensc-pkcs11] ctx.c:869:sc_context_create: =================================== | |
| P:32260; T:0x140540021001728 07:52:40.852 [opensc-pkcs11] ctx.c:870:sc_context_create: opensc version: 0.19.0 | |
| P:32260; T:0x140540021001728 07:52:40.852 [opensc-pkcs11] reader-pcsc.c:829:pcsc_init: PC/SC options: connect_exclusive=0 disconnect_action=0 transaction_end_action=0 reconnect_action=0 enable_pinpad=1 enable_pace=1 | |
| P:32260; T:0x140540021001728 07:52:40.852 [opensc-pkcs11] reader-pcsc.c:1311:pcsc_detect_readers: called | |
| P:32260; T:0x140540021001728 07:52:40.852 [opensc-pkcs11] reader-pcsc.c:1324:pcsc_detect_readers: Probing PC/SC readers | |
| P:32260; T:0x140540021001728 07:52:40.852 [opensc-pkcs11] reader-pcsc.c:1352:pcsc_detect_readers: Establish PC/SC context | |
| P:32260; T:0x140540021001728 07:52:40.966 [opensc-pkcs11] reader-pcsc.c:1260:pcsc_add_reader: Adding new PC/SC reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:40.966 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:40.967 [opensc-pkcs11] reader-pcsc.c:358:refresh_attributes: current state: 0x00000022 | |
| P:32260; T:0x140540021001728 07:52:40.967 [opensc-pkcs11] reader-pcsc.c:359:refresh_attributes: previous state: 0x00000000 | |
| P:32260; T:0x140540021001728 07:52:40.967 [opensc-pkcs11] reader-pcsc.c:414:refresh_attributes: card present, changed | |
| P:32260; T:0x140540021001728 07:52:40.967 [opensc-pkcs11] reader-pcsc.c:1441:pcsc_detect_readers: Yubico Yubikey NEO OTP+U2F+CCID 00 00:SCardConnect(SHARED): 0x00000000 | |
| P:32260; T:0x140540021001728 07:52:40.967 [opensc-pkcs11] reader-pcsc.c:1078:detect_reader_features: called | |
| P:32260; T:0x140540021001728 07:52:40.967 [opensc-pkcs11] reader-pcsc.c:1080:detect_reader_features: Requesting reader features ... | |
| P:32260; T:0x140540021001728 07:52:40.968 [opensc-pkcs11] reader-pcsc.c:1101:detect_reader_features: Reader feature 12 found | |
| P:32260; T:0x140540021001728 07:52:40.968 [opensc-pkcs11] reader-pcsc.c:1018:part10_detect_max_data: get dwMaxAPDUDataSize property returned 65536 | |
| P:32260; T:0x140540021001728 07:52:40.968 [opensc-pkcs11] reader-pcsc.c:1211:detect_reader_features: Reader supports transceiving 65536 bytes of data | |
| P:32260; T:0x140540021001728 07:52:40.968 [opensc-pkcs11] reader-pcsc.c:1057:part10_get_vendor_product: id_vendor=1050 id_product=0116 | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] reader-pcsc.c:1456:pcsc_detect_readers: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x0 | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x1 | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x2 | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x3 | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] slot.c:164:initialize_reader: Initialize reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00': detect SC card presence | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] slot.c:166:initialize_reader: Initialize reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00': detect PKCS11 card presence | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:40.969 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] slot.c:256:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: First seen the card | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] slot.c:265:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Connecting ... | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] card.c:196:sc_connect_card: called | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] reader-pcsc.c:544:pcsc_connect: called | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] reader-pcsc.c:576:pcsc_connect: Initial protocol: T=1 | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] card.c:221:sc_connect_card: matching configured ATRs | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] card.c:265:sc_connect_card: matching built-in ATRs | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'cardos' | |
| P:32260; T:0x140540021001728 07:52:40.970 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'flex' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'cyberflex' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'gpk' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'gemsafeV1' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'asepcos' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'starcos' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'tcos' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'oberthur' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'authentic' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-authentic.c:416:authentic_match_card: | |
| try to match card with ATR (22 bytes): | |
| 3B FC 13 00 00 81 31 FE 15 59 75 62 69 6B 65 79 ;.....1..Yubikey | |
| 4E 45 4F 72 33 E1 NEOr3. | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-authentic.c:419:authentic_match_card: card not matched | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'iasecc' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-iasecc.c:345:iasecc_match_card: card not matched | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'belpic' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'incrypto34' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'acos5' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'akis' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'entersafe' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-entersafe.c:138:entersafe_match_card: called | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'epass2003' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-epass2003.c:1143:epass2003_match_card: called | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'rutoken' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-rutoken.c:103:rutoken_match_card: called | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-rutoken.c:109:rutoken_match_card: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'rutoken_ecp' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-rtecp.c:62:rtecp_match_card: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'myeid' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'dnie' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-dnie.c:739:dnie_match_card: called | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card-dnie.c:742:dnie_match_card: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'MaskTech' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'atrust-acos' | |
| P:32260; T:0x140540021001728 07:52:40.971 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'westcos' | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'coolkey' | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card-coolkey.c:2240:coolkey_match_card: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card-coolkey.c:942:coolkey_apdu_io: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card-coolkey.c:947:coolkey_apdu_io: a4 04 00 7 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card-coolkey.c:1011:coolkey_apdu_io: calling sc_transmit_apdu flags=0 le=0, resplen=0, resp=0x7ffe5c5ca590 | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card-coolkey.c:2385:coolkey_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card-coolkey.c:2391:coolkey_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(7) 0x7ffe5c5cc611 | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (12 bytes): | |
| 00 A4 04 00 07 62 76 01 FF 00 00 00 .....bv..... | |
| P:32260; T:0x140540021001728 07:52:40.972 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:40.984 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:40.984 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.984 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.984 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:40.984 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:40.990 [opensc-pkcs11] card-coolkey.c:1018:coolkey_apdu_io: result r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| P:32260; T:0x140540021001728 07:52:40.990 [opensc-pkcs11] card-coolkey.c:898:coolkey_check_sw: sw1 = 0x6a, sw2 = 0x82 | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] card-coolkey.c:1026:coolkey_apdu_io: Transmit failed | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] card-coolkey.c:1044:coolkey_apdu_io: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'muscle' | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] card-muscle.c:829:muscle_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] card-muscle.c:837:muscle_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(6) 0x7fd2060304f0 | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 A4 04 00 06 A0 00 00 00 01 01 ........... | |
| P:32260; T:0x140540021001728 07:52:40.991 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.001 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.001 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.001 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.001 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.001 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] muscle.c:276:msc_select_applet: returning with: -1200 (Card command failed) | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'sc-hsm' | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(11) 0x7ffe5c5cc430 | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (17 bytes): | |
| 00 A4 04 00 0B E8 2B 06 01 04 01 81 C3 1F 02 01 ......+......... | |
| 00 . | |
| P:32260; T:0x140540021001728 07:52:41.008 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.018 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.018 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.018 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.018 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.018 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] iso7816.c:578:iso7816_select_file: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] card-sc-hsm.c:179:sc_hsm_select_file_ex: Could not select SmartCard-HSM application: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] card-sc-hsm.c:257:sc_hsm_match_card: Could not select SmartCard-HSM application: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'mcrd' | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] card-mcrd.c:297:mcrd_match_card: called | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:C, data(15) 0x7fd205fb60e0 | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.020 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (20 bytes): | |
| 00 A4 04 0C 0F D2 33 00 00 00 45 73 74 45 49 44 ......3...EstEID | |
| 20 76 33 35 v35 | |
| P:32260; T:0x140540021001728 07:52:41.021 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.028 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 86 j. | |
| P:32260; T:0x140540021001728 07:52:41.028 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.029 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.029 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.029 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Incorrect parameters P1-P2 | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'setcos' | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CA, P1:DF, P2:30, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 CA DF 30 05 ...0. | |
| P:32260; T:0x140540021001728 07:52:41.039 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.048 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 67 00 g. | |
| P:32260; T:0x140540021001728 07:52:41.048 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.048 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.048 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.048 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.054 [opensc-pkcs11] card.c:283:sc_connect_card: trying driver 'PIV-II' | |
| P:32260; T:0x140540021001728 07:52:41.054 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.054 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:3553:piv_card_reader_lock_obtained: PIV_STATE_MATCH | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #10 | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #10 | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc3f8 | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 08 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.055 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6D 00 m. | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Instruction code not supported or invalid | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: -1204 (Unsupported INS byte in APDU) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:760:piv_find_aid: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card-piv.c:726:piv_select_aid: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(9) 0x7fd205fbd080 | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (15 bytes): | |
| 00 A4 04 00 09 A0 00 00 03 08 00 00 10 00 00 ............... | |
| P:32260; T:0x140540021001728 07:52:41.066 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (21 bytes): | |
| 61 11 4F 06 00 00 10 00 01 00 79 07 4F 05 A0 00 a.O.......y.O... | |
| 00 03 08 90 00 ..... | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:742:piv_select_aid: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:772:piv_find_aid: found PIX | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:786:piv_find_aid: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #10 | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #10 | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:41.076 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc3f8 | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 08 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.077 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.086 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:41.086 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.086 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.086 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe5c5cc402 | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x(nil) len=20 | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc3f8 | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 14 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.087 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.096 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x5573462b9712 | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #10 0x5573462b9710:20 (nil):0 | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x5573462b9712:18 | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:2603:piv_parse_discovery: Discovery pinp flags=0x40 0x00 | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.097 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.103 [opensc-pkcs11] card-piv.c:2904:piv_finish: called | |
| P:32260; T:0x140540021001728 07:52:41.103 [opensc-pkcs11] card.c:297:sc_connect_card: matched: Personal Identity Verification Card | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:3122:piv_init: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:3553:piv_card_reader_lock_obtained: PIV_STATE_MATCH | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #10 | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #10 | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.104 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.105 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc368 | |
| P:32260; T:0x140540021001728 07:52:41.105 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.105 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 08 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.105 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe5c5cc372 | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x(nil) len=20 | |
| P:32260; T:0x140540021001728 07:52:41.114 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc368 | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 14 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.115 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.124 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:41.124 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x5573462b9712 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #10 0x5573462b9710:20 (nil):0 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x5573462b9712:18 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:2603:piv_parse_discovery: Discovery pinp flags=0x40 0x00 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5cc4a0 len=256 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc438 | |
| P:32260; T:0x140540021001728 07:52:41.125 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.126 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.126 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.135 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:41.135 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.135 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.135 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5cc4a2 | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5cc4a2:18 | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card-piv.c:3141:piv_init: Max send = 0 recv = 0 card->type = 14003 | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:FD, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 FD 00 00 03 ..... | |
| P:32260; T:0x140540021001728 07:52:41.136 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (5 bytes): | |
| 01 00 04 90 00 ..... | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] card-piv.c:3162:piv_init: Yubico card->type=14003, r=0x00000000 version=0x00010004 | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] card-piv.c:3221:piv_init: PIV card-type=14003 card_issues=0x00020313 | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] card-piv.c:2708:piv_process_history: called | |
| P:32260; T:0x140540021001728 07:52:41.143 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #11 | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #11 | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card-piv.c:913:piv_get_data: #11 | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #11 | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 0 0 | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb408 | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0C 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.144 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.151 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:2894:piv_process_history: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:1003:piv_get_cached_data: found #10 0x5573462b9710:20 (nil):0 | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x5573462b9712:18 | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:2603:piv_parse_discovery: Discovery pinp flags=0x40 0x00 | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card-piv.c:2635:piv_process_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.152 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card-piv.c:3260:piv_init: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card.c:327:sc_connect_card: card info name:'Personal Identity Verification Card', type:14003, flags:0x0, max_send/recv_size:255/256 | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card.c:1462:sc_card_sm_check: called | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card.c:1463:sc_card_sm_check: card->sm_ctx.ops.open (nil) | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card.c:1468:sc_card_sm_check: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card.c:339:sc_connect_card: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] slot.c:285:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Connected SC card 0x5573462bdcb0 | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] dir.c:163:sc_enum_apps: called | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=3f002f00 | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:32260; T:0x140540021001728 07:52:41.158 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x2F00 | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card-piv.c:420:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card-piv.c:2515:piv_select_file: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card.c:776:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] dir.c:171:sc_enum_apps: Cannot select EF.DIR file: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] slot.c:292:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting Framework. 0 on-card applications | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] slot.c:293:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: generic application <none> | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] slot.c:307:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detected framework 0. Creating tokens. | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] slot.c:322:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Try to bind 'generic' token. | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] framework-pkcs15.c:308:pkcs15_bind: Bind PKCS#15 '<anonymous>' application | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] pkcs15.c:1192:sc_pkcs15_bind: called | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] pkcs15.c:1193:sc_pkcs15_bind: application(aid:'empty') | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] pkcs15.c:1219:sc_pkcs15_bind: PKCS#15 options: use_file_cache=0 use_pin_cache=1 pin_cache_counter=10 pin_cache_ignore_user_consent=0 | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.159 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5cc910 len=256 | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc8a8 | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.160 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5cc912 | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5cc912:18 | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15.c:1230:sc_pkcs15_bind: PKCS#15 emulation enabled | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:111:sc_pkcs15_bind_synthetic: called | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:152:sc_pkcs15_bind_synthetic: no emulator list in config file, trying all builtin emulators | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying westcos | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-westcos.c:255:sc_pkcs15emu_westcos_init_ex: sc_pkcs15_init_func_ex westcos | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-westcos.c:241:westcos_detect_card: westcos_detect_card (Personal Identity Verification Card) | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying openpgp | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying infocamere | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying starcert | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying tcos | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying esteid | |
| P:32260; T:0x140540021001728 07:52:41.170 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying itacns | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] pkcs15-itacns.c:866:sc_pkcs15emu_itacns_init_ex: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying postecert | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] pkcs15-syn.c:154:sc_pkcs15_bind_synthetic: trying PIV-II | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] pkcs15-piv.c:1213:sc_pkcs15emu_piv_init_ex: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] pkcs15-piv.c:238:piv_detect_card: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] pkcs15-piv.c:618:sc_pkcs15emu_piv_init: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:2080:piv_get_serial_nr_from_CHUI: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #1 | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #1 | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:913:piv_get_data: #1 | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #1 | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb508 | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 02 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.171 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (63 bytes): | |
| 53 3B 30 19 D4 E7 39 DA 73 9C ED 39 CE 73 9D 83 S;0...9.s..9.s.. | |
| 68 58 21 08 42 10 84 21 38 42 10 C3 F5 34 10 8C hX!.B..!8B...4.. | |
| 38 0F CE 70 91 41 FE 54 8B DE 42 E2 29 03 B0 35 8..p.A.T..B.)..5 | |
| 08 32 30 33 30 30 31 30 31 3E 00 FE 00 90 00 .20300101>..... | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe5c5cb512 | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 61 | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #1 *buf=0x(nil) len=61 | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.185 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb508 | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 02 3D ..?..\._..= | |
| P:32260; T:0x140540021001728 07:52:41.186 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (63 bytes): | |
| 53 3B 30 19 D4 E7 39 DA 73 9C ED 39 CE 73 9D 83 S;0...9.s..9.s.. | |
| 68 58 21 08 42 10 84 21 38 42 10 C3 F5 34 10 8C hX!.B..!8B...4.. | |
| 38 0F CE 70 91 41 FE 54 8B DE 42 E2 29 03 B0 35 8..p.A.T..B.)..5 | |
| 08 32 30 33 30 30 31 30 31 3E 00 FE 00 90 00 .20300101>..... | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x5573462b9162 | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 61 | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 61 | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #1 0x5573462b9160:61 (nil):0 | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 61 | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:2111:piv_get_serial_nr_from_CHUI: fascn=0x5573462b9164,fascnlen=25,guid=0x5573462b917f,guidlen=16,gbits=ff | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:2134:piv_get_serial_nr_from_CHUI: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] pkcs15-piv.c:648:sc_pkcs15emu_piv_init: PIV-II adding objects... | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0xDB00 | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.200 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x3000 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x3010 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:420:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0101 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 2 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6010 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 3 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x3001 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 4 | |
| P:32260; T:0x140540021001728 07:52:41.201 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6030 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 5 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0100 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 6 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0102 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 7 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0500 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 8 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x9000 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 9 | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.202 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6050 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 10 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x6060 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 11 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1015 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 32 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1001 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 12 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1002 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 13 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.203 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1003 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 14 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1004 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 15 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1005 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 16 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1006 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 17 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1007 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 18 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.204 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1008 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 19 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1009 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100A | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 21 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100B | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 22 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100C | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 23 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100D | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 24 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.205 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100E | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 25 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100F | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 26 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1010 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 27 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1011 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 28 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1012 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 29 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.206 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1013 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 30 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1014 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 31 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] pkcs15-piv.c:708:sc_pkcs15emu_piv_init: PIV-II adding certs... | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0101 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 2 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0101cece, index=0, count=-1 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0101cece | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0101 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 2 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #2 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #2 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:913:piv_get_data: #2 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #2 | |
| P:32260; T:0x140540021001728 07:52:41.207 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb418 | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 05 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.208 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.215 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:2535:piv_select_file: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:776:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] pkcs15.c:2407:sc_pkcs15_read_file: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] pkcs15-piv.c:746:sc_pkcs15emu_piv_init: No cert found,i=0 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0100 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 6 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0100cece, index=0, count=-1 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0100cece | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0100 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 6 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #6 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #6 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card-piv.c:913:piv_get_data: #6 | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.216 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #6 | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb418 | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0A 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.217 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.248 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| [cert dump here] | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe5c5cb424 | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1324 | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #6 *buf=0x(nil) len=1324 | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb418 | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0A 00 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.249 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.280 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| [cert dump here] | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] apdu.c:434:sc_get_response: called | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.281 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 2A 86 48 86 F7 0D 01 01 01 05 00 03 82 01 0F 00 *.H............. | |
| 30 82 01 0A 02 82 01 01 00 90 B7 F4 83 61 61 5F 0............aa_ | |
| CB 5E 50 19 4F FA 1D B0 DA 65 B8 42 E3 B9 82 02 .^P.O....e.B.... | |
| 59 29 4D 76 91 45 65 DD FA C2 42 36 81 B5 A4 DE Y)Mv.Ee...B6.... | |
| FD EC 05 58 E7 E9 4D BE 69 F2 8F E1 15 79 DC 3B ...X..M.i....y.; | |
| E6 1D B7 ED AC A9 A5 AF D0 B9 4D C2 4C 40 40 70 ..........M.L@@p | |
| BB 75 29 7E C4 39 AB AA BC D3 98 D8 60 6C 83 CF .u)~.9......`l.. | |
| E7 D1 2B ED 5A 1F 33 91 3D DA 26 47 86 B3 6F 22 ..+.Z.3.=.&G..o" | |
| 27 87 DC E0 7C DB EF 74 0A A9 BE D9 14 E7 CE 4F '...|..t.......O | |
| C3 6B EC B8 6F EE F6 74 C5 83 C7 61 F3 64 96 0B .k..o..t...a.d.. | |
| 10 F0 FA EF 93 B1 87 97 2D B9 0C 17 9F DA EF AD ........-....... | |
| 51 B0 6E 08 00 64 47 32 66 76 DD 5B 28 C1 E5 51 Q.n..dG2fv.[(..Q | |
| 0B 82 57 40 FE 78 C1 AA 89 A1 65 9B 28 5C EE 51 ..W@.x....e.(\.Q | |
| 69 1A 84 CF 0F D8 05 24 A5 9F 50 D6 B3 39 1F D2 i......$..P..9.. | |
| 10 CD D2 9A 20 A8 0A 9F 5A 51 85 47 9F FF 1A 00 .... ...ZQ.G.... | |
| 15 33 7F 4B 63 21 02 5A 86 56 09 50 26 61 FD .3.Kc!.Z.V.P&a. | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.310 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 50 7F 71 77 C7 4F 9D 08 B3 31 08 25 96 0F 7F 49 P.qw.O...1.%...I | |
| B8 B3 6F 93 79 E0 21 AC 8C 01 7D 99 02 03 01 00 ..o.y.!...}..... | |
| 01 A3 81 F5 30 81 F2 30 09 06 03 55 1D 13 04 02 ....0..0...U.... | |
| 30 00 30 11 06 09 60 86 48 01 86 F8 42 01 01 04 0.0...`.H...B... | |
| 04 03 02 05 A0 30 33 06 09 60 86 48 01 86 F8 42 .....03..`.H...B | |
| 01 0D 04 26 16 24 4F 70 65 6E 53 53 4C 20 47 65 ...&.$OpenSSL Ge | |
| 6E 65 72 61 74 65 64 20 43 6C 69 65 6E 74 20 43 nerated Client C | |
| 65 72 74 69 66 69 63 61 74 65 30 1D 06 03 55 1D ertificate0...U. | |
| 0E 04 16 04 14 AD 41 CD 8A 71 8E 8B D7 F8 7A F7 ......A..q....z. | |
| 45 4D E5 47 55 AB AC AB 54 30 1F 06 03 55 1D 23 EM.GU...T0...U.# | |
| 04 18 30 16 80 14 AF F5 8E B7 63 53 AC A9 F3 49 ..0.......cS...I | |
| BF 09 D6 58 79 D3 97 85 11 7F 30 0E 06 03 55 1D ...Xy.....0...U. | |
| 0F 01 01 FF 04 04 03 02 06 C0 30 29 06 03 55 1D ..........0)..U. | |
| 25 04 22 30 20 06 08 2B 06 01 05 05 07 03 02 06 %."0 ..+........ | |
| 08 2B 06 01 05 05 07 03 04 06 0A 2B 06 01 04 01 .+.........+.... | |
| 82 37 14 02 02 30 22 06 03 55 1D 11 04 61 FD .7...0"..U...a. | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.339 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 1B 30 19 81 17 6A 61 61 61 61 61 61 61 61 40 61 .0...aaaaaaaaa@a | |
| 61 61 61 61 61 61 61 61 2E 63 6F 6D 30 0D 06 09 aaaaaaaa.com0... | |
| 2A 86 48 86 F7 0D 01 01 0D 05 00 03 82 02 01 00 *.H............. | |
| C1 5E 49 BE D7 BF 36 70 78 1D DB 5A 79 48 E2 0F .^I...6px..ZyH.. | |
| E5 9C 9D CE B8 7F B8 4B AD F2 CB 80 57 08 39 5E .......K....W.9^ | |
| 85 ED 2B CE 65 55 C3 15 3F FF 62 88 63 2C 4C 24 ..+.eU..?.b.c,L$ | |
| FA EA B2 EE 4D 4F 38 19 0D 03 EF DA 03 85 D0 95 ....MO8......... | |
| A5 52 81 FA A6 38 0E B4 85 4F 27 52 AC 4C 29 58 .R...8...O'R.L)X | |
| FB 39 62 D8 30 4B 65 1C 95 07 A1 C4 E4 E4 CA 5A .9b.0Ke........Z | |
| C8 D3 01 6C 60 A4 16 AF 0E 2A 05 F7 28 4E 9B 33 ...l`....*..(N.3 | |
| F3 70 3B 7A 1E 64 A1 99 12 5A 7B C3 25 CC E2 EF .p;z.d...Z{.%... | |
| 34 52 41 C5 F1 B2 7A D5 67 BA 9C 19 1C CA 4C 68 4RA...z.g.....Lh | |
| C7 9E D3 5A D6 9D 1E CE CF 3D 00 C0 8F 52 61 2C ...Z.....=...Ra, | |
| 2B 6E 36 FF C6 39 70 FB 5B FE 3F 9D 93 F1 85 D2 +n6..9p.[.?..... | |
| 90 80 D7 E0 E5 70 1A 52 49 3C 86 7D 67 53 94 AD .....p.RI<.}gS.. | |
| 11 7E EA CF 95 3A 8F 7D 40 5B AD AC 8C 61 FD .~...:.}@[...a. | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.368 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.369 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.369 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.369 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| D2 2E 2B 20 E8 6F 30 B6 79 60 AA 60 96 A2 1D 58 ..+ .o0.y`.`...X | |
| 2E 83 B8 2F 9C E0 08 BB E5 BE D9 E2 06 4F 83 B5 .../.........O.. | |
| 01 43 A5 9F 85 91 54 61 B5 97 AE CD 57 BB E6 C7 .C....Ta....W... | |
| 0D 4B CE 22 29 C2 9C 33 01 CE 78 F7 E3 88 93 C0 .K.")..3..x..... | |
| A1 AC 8E 2F 4C 49 02 30 E6 98 F1 EB DE 7E AB 10 .../LI.0.....~.. | |
| C2 C7 C4 06 D5 46 3B 89 66 AE AA 05 AD EF 23 5B .....F;.f.....#[ | |
| 6B 03 03 8A 87 D1 8B E6 D6 A8 EE 08 A0 6E E1 55 k............n.U | |
| 0F EA DD 86 75 31 46 AE 03 FC E3 86 91 3C E7 C6 ....u1F......<.. | |
| C7 6D 60 21 2B 29 BE 13 C4 42 84 61 AD 2C 2C 76 .m`!+)...B.a.,,v | |
| 7C 28 F1 84 E6 1E 36 D0 4C 2D 44 08 B6 81 93 40 |(....6.L-D....@ | |
| 89 C4 7F E6 33 8E 6E 0D B9 2A C0 AD E5 67 59 FA ....3.n..*...gY. | |
| 91 C0 8E 09 FE AF 50 4D 79 23 BC 0D 3D 27 B4 CC ......PMy#..='.. | |
| A3 73 93 4B 7D 93 7F 3E 3B B4 5F C9 E8 FE 07 33 .s.K}..>;._....3 | |
| 2F 92 54 27 D9 B1 55 EA 5F E4 C7 0C A2 7B D2 48 /.T'..U._....{.H | |
| A8 F4 75 6E AF 9D 5B A1 B0 94 DC E5 ED A2 B4 3C ..un..[........< | |
| 76 61 AF 53 BA 8B F7 63 13 C8 F1 1D 27 61 3B va.S...c....'a; | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 3B ....; | |
| P:32260; T:0x140540021001728 07:52:41.398 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.409 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (61 bytes): | |
| 7D 1C 21 EC 6E E9 2A D2 F2 4B C4 66 B8 8C F6 DB }.!.n.*..K.f.... | |
| 4D 55 CD E0 54 41 61 A3 81 5B CE 97 CB C2 0A 8E MU..TAa..[...... | |
| D4 70 E9 53 8F 56 AE D9 07 40 E5 58 92 9C B3 8C .p.S.V...@.X.... | |
| C9 7A A4 92 03 89 71 01 00 FE 00 90 00 .z....q...... | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] apdu.c:505:sc_get_response: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x5573462ca914 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1324 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 1324 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #6 0x5573462ca910:1324 (nil):0 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1324 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1153:piv_cache_internal_data: added #6 internal 0x5573462cb010:1311 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1155:piv_cache_internal_data: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:2563:piv_select_file: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:789:sc_select_file: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:571:sc_read_binary: called; 1311 bytes at index 0 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 0 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #6 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1003:piv_get_cached_data: found #6 0x5573462ca910:1324 0x5573462cb010:1311 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1324 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1078:piv_cache_internal_data: #6 found internal 0x5573462cb010:1311 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1079:piv_cache_internal_data: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.410 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 512 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 768 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 1024 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:571:sc_read_binary: called; 31 bytes at index 1280 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 31 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 31 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:608:sc_read_binary: returning with: 1311 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] pkcs15.c:2400:sc_pkcs15_read_file: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5573462cbd31:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A028201010090B7F4 8361615FCB5E50194FFA1DB0DA65B842 | |
| E3B9820259294D76914565DDFAC24236 81B5A4DEFDEC0558E7E94DBE69F28FE1 1579DC3BE61DB7EDACA9A5AFD0B94DC2 | |
| 4C404070BB75297EC439ABAABCD398D8 606C83CFE7D12BED5A1F33913DDA2647 86B36F222787DCE07CDBEF740AA9BED9 | |
| 14E7CE4FC36BECB86FEEF674C583C761 F364960B10F0FAEF93B187972DB90C17 9FDAEFAD51B06E08006447326676DD5B | |
| 28C1E5510B825740FE78C1AA89A1659B 285CEE51691A84CF0FD80524A59F50D6 B3391FD210CDD29A20A80A9F5A518547 | |
| 9FFF1A0015337F4B6321025A86560950 26507F7177C74F9D08B3310825960F7F 49B8B36F9379E021AC8C017D99020301 | |
| 0001 | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.411 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-cert.c:214:sc_pkcs15_get_name_from_dn: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-cert.c:295:sc_pkcs15_get_extension: returning with: 4 | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15-cert.c:332:sc_pkcs15_get_bitstring_extension: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0102 | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 7 | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0102cece, index=0, count=-1 | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0102cece | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0102 | |
| P:32260; T:0x140540021001728 07:52:41.412 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 7 | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #7 | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #7 | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:913:piv_get_data: #7 | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #7 | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb418 | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0B 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.413 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| [cert dump here] | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:-1403 body:0x7ffe5c5cb424 | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1281 | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #7 *buf=0x(nil) len=1281 | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb418 | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0B 00 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.445 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.477 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| [cert dump here] | |
| P:32260; T:0x140540021001728 07:52:41.477 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.477 [opensc-pkcs11] apdu.c:434:sc_get_response: called | |
| P:32260; T:0x140540021001728 07:52:41.477 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.477 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.478 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.478 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.478 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.478 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.478 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.478 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.478 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 2A 86 48 86 F7 0D 01 01 01 05 00 03 82 01 0F 00 *.H............. | |
| 30 82 01 0A 02 82 01 01 00 B8 5F 4D 18 A7 06 06 0........._M.... | |
| D7 A5 1F 75 08 F1 D9 1E 05 72 7C E2 AB BC D9 D0 ...u.....r|..... | |
| 90 F8 60 9A CE C6 0C A2 44 08 EA 1B 10 B8 50 DC ..`.....D.....P. | |
| DA 77 E7 95 90 84 43 2E 61 2A 3C 8A DE 37 AB F8 .w....C.a*<..7.. | |
| 4F F9 DF A1 C3 EC A6 C9 F2 85 1E A0 EF 16 45 CD O.............E. | |
| D6 DD 75 11 56 22 DE 76 D8 44 D5 9F A3 CF 9F D1 ..u.V".v.D...... | |
| 68 2D 83 C2 DA CB 43 9B 58 4B D3 2C 2A D8 2B E4 h-....C.XK.,*.+. | |
| 8C 5C CA 33 02 7A CD 69 72 78 95 23 50 D8 71 3F .\.3.z.irx.#P.q? | |
| 8F A0 AE 5C C2 39 03 41 CD 14 19 8E 88 8E E1 AE ...\.9.A........ | |
| 46 34 4F 07 18 BB 92 FB 3E D8 AD 83 08 DD 63 BA F4O.....>.....c. | |
| EA 62 77 CC 8A C8 19 01 73 EC 8E A3 59 EE 77 0D .bw.....s...Y.w. | |
| BC C8 8E 59 7C 36 EB 9D 60 67 01 F5 A0 E7 B3 29 ...Y|6..`g.....) | |
| 6D 60 27 0B D5 B4 7D 5F F3 6A 77 50 61 E8 45 A3 m`'...}_.jwPa.E. | |
| FD D6 25 E3 A4 CE ED 49 4E B2 66 CE 06 16 88 B9 ..%....IN.f..... | |
| E9 52 20 A4 8F 55 E6 E9 D8 89 46 17 FE 61 FD .R ..U....F..a. | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.507 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| [cert dump here] | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.536 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 03 82 02 01 00 80 A0 53 CF 43 AE 8C 71 52 CF A6 .......S.C..qR.. | |
| 84 25 91 50 9A 77 52 C8 EC A6 1B 5C D8 6C 27 4E .%.P.wR....\.l'N | |
| 3A 8B D6 CA 05 47 4B D4 D0 36 08 3E FA CA C8 EC :....GK..6.>.... | |
| 58 BC 44 34 9E 30 84 8F C3 7C A9 F3 72 44 15 22 X.D4.0...|..rD." | |
| 5C 6E 6F 9F BC 59 6C 03 6C 4F AD 8E 08 0A 28 45 \no..Yl.lO....(E | |
| 07 1D CB AE BC 0A 81 26 DA A2 42 40 F1 97 7A 84 .......&..B@..z. | |
| CA 5A 01 0A C5 4F 1C 6B 79 26 D8 2A 90 2D 04 E9 .Z...O.ky&.*.-.. | |
| DB A1 A1 12 F6 64 BA F2 8F 57 47 87 13 24 79 3E .....d...WG..$y> | |
| 96 DE A2 EB C7 F8 2A 80 31 C5 B4 CE E7 C6 9F 22 ......*.1......" | |
| 43 D3 69 50 4A 32 10 A5 DB 61 B5 2D 41 16 26 9C C.iPJ2...a.-A.&. | |
| 73 E5 CB B3 7D F1 95 47 D9 CA 37 40 7B E0 5E 85 s...}..G..7@{.^. | |
| C3 19 C3 9E 12 C8 40 33 AF 46 62 01 4B A0 E0 8D ......@3.Fb.K... | |
| EF 95 DD 36 DE 14 A2 81 04 8C A7 FB EB DC B1 EE ...6............ | |
| D7 A3 43 60 CB 6B FF 67 6A F4 0A 08 37 17 E0 46 ..C`.k.gj...7..F | |
| DC B9 CC 1E 51 D8 DD FC 52 B7 4D 0F 8B 01 21 6D ....Q...R.M...!m | |
| 54 4D 51 75 0E 0D FD 12 FB 0F 24 95 D7 61 FD TMQu......$..a. | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.565 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| P:32260; T:0x140540021001728 07:52:41.566 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.594 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 1C D9 72 89 D3 9F A4 BC 0F 4A 64 9E 8A 55 55 FA ..r......Jd..UU. | |
| 78 F6 9F 68 61 8E 80 2E 3D B6 64 B2 12 D1 A2 DE x..ha...=.d..... | |
| EA 7B BF 38 F2 2D CC A9 B3 AA 3D 85 45 02 0D FB .{.8.-....=.E... | |
| 4C 9C F2 36 14 46 F9 03 54 F2 36 0D EE F6 53 FD L..6.F..T.6...S. | |
| 58 E3 85 F6 AE A2 96 59 7D 8A 57 BA 61 B1 01 6A X......Y}.W.a..j | |
| 59 BA 5F 68 53 A7 A2 C6 D6 14 E0 36 0B 11 E5 6C Y._hS......6...l | |
| 76 FD 89 60 14 C6 89 7D 63 79 BE 28 88 95 66 F6 v..`...}cy.(..f. | |
| F4 1A E0 C4 A1 6C 66 FB 34 97 EF B7 99 07 C3 02 .....lf.4....... | |
| 0E 27 57 DA AF D4 B6 32 6F AC 04 55 C6 F3 91 12 .'W....2o..U.... | |
| C3 71 DD A3 52 60 41 10 FC DA BB 00 56 E3 67 DB .q..R`A.....V.g. | |
| EF 96 70 18 47 26 62 07 A0 A7 52 FB 13 AB 68 D5 ..p.G&b...R...h. | |
| DB EB DB 2F 93 7B 7F F3 4D A6 00 86 F7 B4 31 8A .../.{..M.....1. | |
| 31 82 4B 10 21 B8 9C 91 BC 39 14 3E A0 BF 3A A8 1.K.!....9.>..:. | |
| AE 53 FB 3F 9B 95 84 B4 78 B7 DA 32 A9 93 01 BA .S.?....x..2.... | |
| 6B 49 FE CF D8 A7 35 A0 51 40 34 77 69 D6 CB F9 kI....5.Q@4wi... | |
| DC 70 6E B3 B8 07 AE BC 8C 27 A1 BD C8 61 10 .pn......'...a. | |
| P:32260; T:0x140540021001728 07:52:41.594 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.594 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.594 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 10 ..... | |
| P:32260; T:0x140540021001728 07:52:41.595 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.602 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (18 bytes): | |
| 6B 22 FB 2F 66 50 28 2D 23 45 B9 71 01 00 FE 00 k"./fP(-#E.q.... | |
| 90 00 .. | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] apdu.c:505:sc_get_response: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x5573462cc1e4 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1281 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 1281 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1046:piv_get_cached_data: added #7 0x5573462cc1e0:1281 (nil):0 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1281 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1153:piv_cache_internal_data: added #7 internal 0x5573462cd460:1268 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1155:piv_cache_internal_data: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:2563:piv_select_file: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:789:sc_select_file: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:571:sc_read_binary: called; 1268 bytes at index 0 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 0 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #7 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1003:piv_get_cached_data: found #7 0x5573462cc1e0:1281 0x5573462cd460:1268 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: 1281 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1078:piv_cache_internal_data: #7 found internal 0x5573462cd460:1268 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1079:piv_cache_internal_data: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 256 | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.603 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 512 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:571:sc_read_binary: called; 256 bytes at index 768 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 256 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:571:sc_read_binary: called; 244 bytes at index 1024 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card-piv.c:1175:piv_read_binary: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card-piv.c:1236:piv_read_binary: returning with: 244 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:611:sc_read_binary: returning with: 244 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:608:sc_read_binary: returning with: 1268 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15.c:2400:sc_pkcs15_read_file: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5573462ce121:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A0282010100B85F4D 18A70606D7A51F7508F1D91E05727CE2 | |
| ABBCD9D090F8609ACEC60CA24408EA1B 10B850DCDA77E7959084432E612A3C8A DE37ABF84FF9DFA1C3ECA6C9F2851EA0 | |
| EF1645CDD6DD75115622DE76D844D59F A3CF9FD1682D83C2DACB439B584BD32C 2AD82BE48C5CCA33027ACD6972789523 | |
| 50D8713F8FA0AE5CC2390341CD14198E 888EE1AE46344F0718BB92FB3ED8AD83 08DD63BAEA6277CC8AC8190173EC8EA3 | |
| 59EE770DBCC88E597C36EB9D606701F5 A0E7B3296D60270BD5B47D5FF36A7750 61E845A3FDD625E3A4CEED494EB266CE | |
| 061688B9E95220A48F55E6E9D8894617 FEC3AB72E32A824B9A02C746A80092BE 27C5DB6399D84B0F8631533D3D020301 | |
| 0001 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:32260; T:0x140540021001728 07:52:41.604 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15-cert.c:295:sc_pkcs15_get_extension: returning with: 4 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15-cert.c:332:sc_pkcs15_get_bitstring_extension: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0500 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 8 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15.c:2304:sc_pkcs15_read_file: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] pkcs15.c:2305:sc_pkcs15_read_file: path=0500cece, index=0, count=-1 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card.c:754:sc_select_file: called; type=2, path=0500cece | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:2491:piv_select_file: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x0500 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 8 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:989:piv_get_cached_data: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:990:piv_get_cached_data: #8 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:1030:piv_get_cached_data: get #8 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:913:piv_get_data: #8 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:938:piv_get_data: get len of #8 | |
| P:32260; T:0x140540021001728 07:52:41.605 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5cb418 | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 01 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.606 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card-piv.c:1058:piv_get_cached_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card-piv.c:2535:piv_select_file: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card.c:776:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] pkcs15.c:2407:sc_pkcs15_read_file: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] pkcs15-piv.c:746:sc_pkcs15emu_piv_init: No cert found,i=3 | |
| P:32260; T:0x140540021001728 07:52:41.613 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1001 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 12 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=4 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1002 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 13 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=5 | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.614 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1003 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 14 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=6 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1004 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 15 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=7 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1005 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 16 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=8 | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.615 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1006 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 17 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=9 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1007 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 18 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=10 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1008 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 19 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=11 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1009 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=12 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100A | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 21 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=13 | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.616 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100B | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 22 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=14 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100C | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 23 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=15 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100D | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 24 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=16 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100E | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 25 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=17 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x100F | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 26 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.617 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=18 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1010 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 27 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=19 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1011 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 28 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=20 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1012 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 29 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=21 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1013 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 30 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=22 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:412:piv_find_obj_by_containerid: called | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:413:piv_find_obj_by_containerid: str=0x1014 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:417:piv_find_obj_by_containerid: returning with: 31 | |
| P:32260; T:0x140540021001728 07:52:41.618 [opensc-pkcs11] card-piv.c:2158:piv_is_object_present: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=23 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:927:sc_pkcs15emu_piv_init: PIV-II adding pins... | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] card.c:951:sc_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] card-piv.c:2171:piv_get_pin_preference: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] card.c:961:sc_card_ctl: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:958:sc_pkcs15emu_piv_init: DEE Adding pin 0 label=PIN | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:958:sc_pkcs15emu_piv_init: DEE Adding pin 1 label=PIV PUK | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:982:sc_pkcs15emu_piv_init: PIV-II adding pub keys... | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=0 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env PIV_9A_KEY | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:1033:sc_pkcs15emu_piv_init: DEE look for file NULL | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:807:sc_pkcs15_encode_pubkey_as_spki: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:811:sc_pkcs15_encode_pubkey_as_spki: Encoding public key with algorithm 0 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:601:sc_pkcs15_encode_pubkey_rsa: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:612:sc_pkcs15_encode_pubkey_rsa: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:877:sc_pkcs15_encode_pubkey_as_spki: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:1085:sc_pkcs15emu_piv_init: adding pubkey for 1 keyalg=0 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-piv.c:1122:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x000002d1 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:807:sc_pkcs15_encode_pubkey_as_spki: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:811:sc_pkcs15_encode_pubkey_as_spki: Encoding public key with algorithm 0 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:601:sc_pkcs15_encode_pubkey_rsa: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-pubkey.c:612:sc_pkcs15_encode_pubkey_rsa: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:32260; T:0x140540021001728 07:52:41.619 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-pubkey.c:877:sc_pkcs15_encode_pubkey_as_spki: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1085:sc_pkcs15emu_piv_init: adding pubkey for 2 keyalg=0 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1122:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x00000011 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=3 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env PIV_9E_KEY | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1033:sc_pkcs15emu_piv_init: DEE look for file NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=4 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=5 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=6 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=7 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=8 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=9 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=10 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=11 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=12 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=13 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=14 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=15 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=16 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=17 | |
| P:32260; T:0x140540021001728 07:52:41.620 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=18 | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=19 | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=20 | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=21 | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=22 | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1015:sc_pkcs15emu_piv_init: No cert for this pub key i=23 | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1027:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1127:sc_pkcs15emu_piv_init: PIV-II adding private keys... | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1197:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x0000022e | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1197:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x00000022 | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-piv.c:1204:sc_pkcs15emu_piv_init: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] pkcs15-syn.c:188:sc_pkcs15_bind_synthetic: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.621 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.625 [opensc-pkcs11] pkcs15.c:1256:sc_pkcs15_bind: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] slot.c:335:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Creating 'generic' token. | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:1421:pkcs15_create_tokens: create PKCS#15 tokens; fws:0x5573462beec0,(nil),(nil) | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:1422:pkcs15_create_tokens: create slots flags 0x8 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:1431:pkcs15_create_tokens: Use FW data with index 0; fw_data->p15_card 0x5573462bf120 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] pkcs15.c:1697:sc_pkcs15_find_pin_by_flags: called | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] pkcs15.c:1698:sc_pkcs15_find_pin_by_flags: Find PIN flags:0x10, mask:0xD2, index:-1 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] pkcs15.c:1724:sc_pkcs15_find_pin_by_flags: returning with: -1407 (Requested object not found) | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] pkcs15.c:1697:sc_pkcs15_find_pin_by_flags: called | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] pkcs15.c:1698:sc_pkcs15_find_pin_by_flags: Find PIN flags:0x12, mask:0xD2, index:-1 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] pkcs15.c:1721:sc_pkcs15_find_pin_by_flags: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:1437:pkcs15_create_tokens: Flags:0x8; Auth User/Sign PINs 0x5573462cf600/(nil) | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 2 RSA private keys | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 2 RSA public keys | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:715:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() called, pubkey 0x5573462d0cf0, data 0x5573462d17d0 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:728:__pkcs15_create_pubkey_object: Use emulated pubkey | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:757:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() returns pubkey object 0x5573462d6d90 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:715:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() called, pubkey 0x5573462d1dd0, data 0x5573462d28b0 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:728:__pkcs15_create_pubkey_object: Use emulated pubkey | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:757:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() returns pubkey object 0x5573462d6df0 | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 EC private keys | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 EC public keys | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 GOSTR3410 private keys | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 GOSTR3410 public keys | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 2 certificates | |
| P:32260; T:0x140540021001728 07:52:41.626 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5573462d6f41:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A028201010090B7F4 8361615FCB5E50194FFA1DB0DA65B842 | |
| E3B9820259294D76914565DDFAC24236 81B5A4DEFDEC0558E7E94DBE69F28FE1 1579DC3BE61DB7EDACA9A5AFD0B94DC2 | |
| 4C404070BB75297EC439ABAABCD398D8 606C83CFE7D12BED5A1F33913DDA2647 86B36F222787DCE07CDBEF740AA9BED9 | |
| 14E7CE4FC36BECB86FEEF674C583C761 F364960B10F0FAEF93B187972DB90C17 9FDAEFAD51B06E08006447326676DD5B | |
| 28C1E5510B825740FE78C1AA89A1659B 285CEE51691A84CF0FD80524A59F50D6 B3391FD210CDD29A20A80A9F5A518547 | |
| 9FFF1A0015337F4B6321025A86560950 26507F7177C74F9D08B3310825960F7F 49B8B36F9379E021AC8C017D99020301 | |
| 0001 | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] framework-pkcs15.c:624:pkcs15_cert_extract_label: pkcs15_cert_extract_label() called. Current label: Certificate for Digital Signature | |
| P:32260; T:0x140540021001728 07:52:41.627 [opensc-pkcs11] pkcs15-cert.c:370:sc_pkcs15_read_certificate: called | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-pubkey.c:1329:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5573462d7bc1:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A0282010100B85F4D 18A70606D7A51F7508F1D91E05727CE2 | |
| ABBCD9D090F8609ACEC60CA24408EA1B 10B850DCDA77E7959084432E612A3C8A DE37ABF84FF9DFA1C3ECA6C9F2851EA0 | |
| EF1645CDD6DD75115622DE76D844D59F A3CF9FD1682D83C2DACB439B584BD32C 2AD82BE48C5CCA33027ACD6972789523 | |
| 50D8713F8FA0AE5CC2390341CD14198E 888EE1AE46344F0718BB92FB3ED8AD83 08DD63BAEA6277CC8AC8190173EC8EA3 | |
| 59EE770DBCC88E597C36EB9D606701F5 A0E7B3296D60270BD5B47D5FF36A7750 61E845A3FDD625E3A4CEED494EB266CE | |
| 061688B9E95220A48F55E6E9D8894617 FEC3AB72E32A824B9A02C746A80092BE 27C5DB6399D84B0F8631533D3D020301 | |
| 0001 | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-pubkey.c:1366:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-pubkey.c:1413:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-cert.c:397:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] framework-pkcs15.c:624:pkcs15_cert_extract_label: pkcs15_cert_extract_label() called. Current label: Certificate for Key Management | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 13 data objects | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] framework-pkcs15.c:831:pkcs15_create_pkcs11_objects: Found 0 Generic secret keys | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 0 | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] framework-pkcs15.c:846:__pkcs15_prkey_bind_related: Object is a private key and has id 02 | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] framework-pkcs15.c:871:__pkcs15_prkey_bind_related: Associating object 2 as public key | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:32260; T:0x140540021001728 07:52:41.628 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-pubkey.c:1159:sc_pkcs15_dup_pubkey: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 1 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:846:__pkcs15_prkey_bind_related: Object is a private key and has id 03 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:871:__pkcs15_prkey_bind_related: Associating object 3 as public key | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] pkcs15-pubkey.c:1159:sc_pkcs15_dup_pubkey: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 2 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 3 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 4 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:891:__pkcs15_cert_bind_related: Object is a certificate and has id 02 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:920:__pkcs15_cert_bind_related: Associating object 0 as private key | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 5 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:891:__pkcs15_cert_bind_related: Object is a certificate and has id 03 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:920:__pkcs15_cert_bind_related: Associating object 1 as private key | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 6 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 7 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 8 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 9 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 10 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 11 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 12 | |
| P:32260; T:0x140540021001728 07:52:41.629 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 13 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 14 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 15 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 16 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 17 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:941:pkcs15_bind_related_objects: Looking for objects related to object 18 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1201:_pkcs15_create_typed_objects: found 19 FW objects | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1443:pkcs15_create_tokens: Found 19 FW objects objects | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1459:pkcs15_create_tokens: Found 2 authentication objects | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1468:pkcs15_create_tokens: Found authentication object 'PIN' | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1132:pkcs15_create_slot: Create slot (p11card 0x5573462bdc60, fw_data 0x5573462beec0, auth 0x5573462cf600, app_info (nil)) | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] slot.c:430:slot_allocate: Allocated slot 0x0 for card in reader Yubico Yubikey NEO OTP+U2F+CCID 00 00 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1056:pkcs15_init_slot: Called | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1120:pkcs15_init_slot: Initialized token '[My CN name]' in slot 0x0 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1324:_add_pin_related_objects: Add objects related to PIN('PIN',ID:01) | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x5573462d6cd0,SIGN key,101):01 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1343:_add_pin_related_objects: Slot:0x5573462bd0a0, obj:0x5573462d6cd0 Adding private key 0 to PIN 'PIN' | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d6cd0 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d6d90 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d6e50 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x5573462d6d30,KEY MAN key,101):01 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1343:_add_pin_related_objects: Slot:0x5573462bd0a0, obj:0x5573462d6d30 Adding private key 1 to PIN 'PIN' | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d6d30 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d6df0 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d71f0 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x5573462d7b30,Cardholder Fingerprints,500):01 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1347:_add_pin_related_objects: Slot:0x5573462bd0a0 Adding data object 10 to PIN 'PIN' | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7b30 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x5573462d7b90,Printed Information,500):01 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1347:_add_pin_related_objects: Slot:0x5573462bd0a0 Adding data object 11 to PIN 'PIN' | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7b90 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x5573462d7bf0,Cardholder Facial Image,500):01 | |
| P:32260; T:0x140540021001728 07:52:41.630 [opensc-pkcs11] framework-pkcs15.c:1347:_add_pin_related_objects: Slot:0x5573462bd0a0 Adding data object 12 to PIN 'PIN' | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7bf0 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1336:_add_pin_related_objects: ObjID(0x5573462d7e30,Cardholder Iris Image,500): | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1338:_add_pin_related_objects: Ignoring object 18 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1517:pkcs15_create_tokens: Add public objects to slot 0x5573462bd0a0 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1384:_add_public_objects: 19 public objects to process | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7250,Card Capability Container,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7250 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d72b0,Card Holder Unique Identifier,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d72b0 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7310,Unsigned Card Holder Unique Identifier,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7310 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7ad0,X.509 Certificate for PIV Authentication,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7ad0 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7c50,X.509 Certificate for Digital Signature,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7c50 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7cb0,X.509 Certificate for Key Management,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7cb0 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7d10,X.509 Certificate for Card Authentication,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7d10 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7d70,Security Object,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7d70 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1405:_add_public_objects: Add public object(0x5573462d7dd0,Discovery Object,500) | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1004:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5573462d7dd0 | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] framework-pkcs15.c:1521:pkcs15_create_tokens: All tokens created | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] slot.c:170:initialize_reader: Reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' initialized | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] pkcs11-global.c:314:C_Initialize: C_Initialize() = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:41.631 [opensc-pkcs11] pkcs11-global.c:389:C_GetInfo: C_GetInfo() | |
| P:32260; T:0x140540021001728 07:52:41.632 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, plug-n-play) | |
| P:32260; T:0x140540021001728 07:52:41.632 [opensc-pkcs11] reader-pcsc.c:1311:pcsc_detect_readers: called | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] reader-pcsc.c:1324:pcsc_detect_readers: Probing PC/SC readers | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] reader-pcsc.c:1456:pcsc_detect_readers: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] pkcs11-global.c:471:C_GetSlotList: was only a size inquiry (1) | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, refresh) | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:41.633 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] pkcs11-global.c:488:C_GetSlotList: returned 1 slots | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] framework-pkcs15.c:538:C_GetTokenInfo: C_GetTokenInfo(0) | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] framework-pkcs15.c:569:C_GetTokenInfo: C_GetTokenInfo() auth. object 0x5573462cf600, token-info flags 0x40D | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] pkcs15-pin.c:689:sc_pkcs15_get_pin_info: called | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:41.634 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5c7ce0 len=256 | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5c7c78 | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:41.635 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.644 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:41.644 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.644 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.644 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.644 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5c7ce2 | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5c7ce2:18 | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] sec.c:200:sc_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:3394:piv_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card-piv.c:3395:piv_pin_cmd: piv_pin_cmd tries_left=10, logged_in=-1 | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.645 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.646 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.646 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.646 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.646 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(0) 0x7ffe5c5c7da0 | |
| P:32260; T:0x140540021001728 07:52:41.646 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.646 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (4 bytes): | |
| 00 20 00 80 . .. | |
| P:32260; T:0x140540021001728 07:52:41.646 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 63 C3 c. | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] iso7816.c:123:iso7816_check_sw: PIN not verified (remaining tries: 3) | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card-piv.c:3319:piv_check_protected_objects: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card-piv.c:913:piv_get_data: #4 | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #4 *buf=0x0x7ffe5c5c7f20 len=8 | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5c7e98 | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.652 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 09 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.653 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.660 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.660 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.660 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.660 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.660 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:913:piv_get_data: #3 | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #3 *buf=0x0x7ffe5c5c7f20 len=8 | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5c7e98 | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 03 08 ..?..\._... | |
| P:32260; T:0x140540021001728 07:52:41.661 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:913:piv_get_data: #32 | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #32 *buf=0x0x7ffe5c5c7f20 len=8 | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 5 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffe5c5c7e98 | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 21 08 ..?..\._.!. | |
| P:32260; T:0x140540021001728 07:52:41.669 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: File or application not found | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: -1201 (File not found) | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card-piv.c:3358:piv_check_protected_objects: No protected objects found, setting CI_CANT_USE_GETDATA_FOR_STATE | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card-piv.c:3377:piv_check_protected_objects: object_test_verify=0, card_issues = 0x0002031b | |
| P:32260; T:0x140540021001728 07:52:41.677 [opensc-pkcs11] card-piv.c:3378:piv_check_protected_objects: returning with: -1214 (PIN code or key incorrect) | |
| P:32260; T:0x140540021001728 07:52:41.678 [opensc-pkcs11] card-piv.c:3512:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| P:32260; T:0x140540021001728 07:52:41.678 [opensc-pkcs11] card-piv.c:3513:piv_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.678 [opensc-pkcs11] sec.c:247:sc_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.678 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.678 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs15-pin.c:717:sc_pkcs15_get_pin_info: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] framework-pkcs15.c:587:C_GetTokenInfo: C_GetTokenInfo(0) returns 0x0 | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-session.c:58:C_OpenSession: C_OpenSession(0x0) | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-session.c:94:C_OpenSession: C_OpenSession handle: 0x5573462e1c00 | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-session.c:97:C_OpenSession: C_OpenSession() = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-object.c:351:C_FindObjectsInit: C_FindObjectsInit(slot = 0) | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_CLASS = CKO_CERTIFICATE | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_ID = 02 | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x5573462e1c00, type 0 | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6cd0 | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.683 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586982096: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d90 | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982288: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6e50 | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:408:C_FindObjectsInit: Object 0/93953586982480 matches | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:412:C_FindObjectsInit: realloc for 32 handles | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d30 | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586982192: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6df0 | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982384: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d71f0 | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983408: Attribute 0x102 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b30 | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586985776: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b90 | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586985872: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:41.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7bf0 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586985968: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7250 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983504: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d72b0 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983600: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7310 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983696: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7ad0 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985680: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7c50 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986064: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7cb0 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986160: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d10 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986256: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d70 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986352: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7dd0 | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986448: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] pkcs11-object.c:425:C_FindObjectsInit: 1 matching objects | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] pkcs11-object.c:61:sc_find_release: freeing 32 handles used 1 at 0x5573462e1ad0 | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982480: CKA_VALUE = <size inquiry> | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] pkcs11-object.c:274:C_GetAttributeValue: C_GetAttributeValue(hSession=0x5573462e1c00, hObject=0x5573462d6e50) = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982480: CKA_VALUE = 3082051B30820303A003020102020151300D06092A864886F70D01010D050030 | |
| P:32260; T:0x140540021001728 07:52:41.686 [opensc-pkcs11] pkcs11-object.c:274:C_GetAttributeValue: C_GetAttributeValue(hSession=0x5573462e1c00, hObject=0x5573462d6e50) = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:351:C_FindObjectsInit: C_FindObjectsInit(slot = 0) | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_CLASS = CKO_PRIVATE_KEY | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_ID = 02 | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x5573462e1c00, type 0 | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6cd0 | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586982096: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d90 | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982288: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6e50 | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.000 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982480: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d30 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586982192: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6df0 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982384: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d71f0 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983408: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b30 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586985776: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b90 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586985872: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7bf0 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:382:C_FindObjectsInit: Object 0/93953586985968: Private object and not logged in. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7250 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983504: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d72b0 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983600: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7310 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983696: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7ad0 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985680: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7c50 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986064: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7cb0 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986160: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d10 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986256: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d70 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986352: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7dd0 | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986448: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:425:C_FindObjectsInit: 0 matching objects | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-object.c:61:sc_find_release: freeing 0 handles used 0 at (nil) | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-session.c:342:C_Logout: C_Logout(hSession:0x5573462e1c00) | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-session.c:158:C_CloseSession: C_CloseSession(0x5573462e1c00) | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-session.c:109:sc_pkcs11_close_session: real C_CloseSession(0x5573462e1c00) | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, plug-n-play) | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] reader-pcsc.c:1311:pcsc_detect_readers: called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] reader-pcsc.c:1324:pcsc_detect_readers: Probing PC/SC readers | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] reader-pcsc.c:1456:pcsc_detect_readers: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:42.001 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] pkcs11-global.c:471:C_GetSlotList: was only a size inquiry (1) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, refresh) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] pkcs11-global.c:488:C_GetSlotList: returned 1 slots | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] framework-pkcs15.c:538:C_GetTokenInfo: C_GetTokenInfo(0) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] framework-pkcs15.c:569:C_GetTokenInfo: C_GetTokenInfo() auth. object 0x5573462cf600, token-info flags 0x40D | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] pkcs15-pin.c:689:sc_pkcs15_get_pin_info: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5c99f0 len=256 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5c9988 | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:42.002 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5c99f2 | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5c99f2:18 | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] sec.c:200:sc_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:3394:piv_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card-piv.c:3395:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(0) 0x7ffe5c5c9ab0 | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (4 bytes): | |
| 00 20 00 80 . .. | |
| P:32260; T:0x140540021001728 07:52:42.012 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 63 C3 c. | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] iso7816.c:123:iso7816_check_sw: PIN not verified (remaining tries: 3) | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] card-piv.c:3489:piv_pin_cmd: CI_CANT_USE_GETDATA_FOR_STATE set, assume logged_in=-1 | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] card-piv.c:3512:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] card-piv.c:3513:piv_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] sec.c:247:sc_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:42.018 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:42.027 [opensc-pkcs11] pkcs15-pin.c:717:sc_pkcs15_get_pin_info: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:42.027 [opensc-pkcs11] framework-pkcs15.c:587:C_GetTokenInfo: C_GetTokenInfo(0) returns 0x0 | |
| P:32260; T:0x140540021001728 07:52:42.027 [opensc-pkcs11] pkcs11-session.c:58:C_OpenSession: C_OpenSession(0x0) | |
| P:32260; T:0x140540021001728 07:52:42.027 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:32260; T:0x140540021001728 07:52:42.027 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:32260; T:0x140540021001728 07:52:42.027 [opensc-pkcs11] pkcs11-session.c:94:C_OpenSession: C_OpenSession handle: 0x557346315990 | |
| P:32260; T:0x140540021001728 07:52:42.027 [opensc-pkcs11] pkcs11-session.c:97:C_OpenSession: C_OpenSession() = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:45.959 [opensc-pkcs11] pkcs11-session.c:276:C_Login: C_Login(0x557346315990, 1) | |
| P:32260; T:0x140540021001728 07:52:45.959 [opensc-pkcs11] pkcs11-session.c:298:C_Login: C_Login() slot->login_user -1 | |
| P:32260; T:0x140540021001728 07:52:45.959 [opensc-pkcs11] pkcs11-session.c:309:C_Login: C_Login() userType 1 | |
| P:32260; T:0x140540021001728 07:52:45.959 [opensc-pkcs11] framework-pkcs15.c:1551:pkcs15_login: pkcs15-login: userType 0x1, PIN length 6 | |
| P:32260; T:0x140540021001728 07:52:45.959 [opensc-pkcs11] pkcs15-pin.c:302:sc_pkcs15_verify_pin: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] pkcs15-pin.c:357:sc_pkcs15_verify_pin_with_session_pin: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] pkcs15-pin.c:361:sc_pkcs15_verify_pin_with_session_pin: PIN(type:0; method:1; value(0x7ffe5c5cc1c0:6) | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5c9a20 len=256 | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:45.960 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.961 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:45.961 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:45.961 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5c99b8 | |
| P:32260; T:0x140540021001728 07:52:45.961 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:45.961 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:45.961 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:45.970 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:45.970 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.970 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.970 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:45.970 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5c9a22 | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5c9a22:18 | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] sec.c:200:sc_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:3394:piv_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card-piv.c:3395:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(8) 0x7ffe5c5c9ae0 | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (13 bytes): | |
| 00 20 00 80 08 61 61 61 71 61 61 FF FF . ...my_pin.. | |
| P:32260; T:0x140540021001728 07:52:45.971 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 90 00 .. | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] card-piv.c:3512:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=1 | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] card-piv.c:3513:piv_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] sec.c:247:sc_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] pkcs15-pin.c:449:sc_pkcs15_verify_pin_with_session_pin: PIN cmd result 0 | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] pkcs15-pin.c:736:sc_pkcs15_pincache_add: called | |
| P:32260; T:0x140540021001728 07:52:46.002 [opensc-pkcs11] pkcs15-pin.c:764:sc_pkcs15_pincache_add: caching refused (user consent) | |
| P:32260; T:0x140540021001728 07:52:46.003 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.003 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs15-pin.c:471:sc_pkcs15_verify_pin_with_session_pin: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs15-pin.c:736:sc_pkcs15_pincache_add: called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs15-pin.c:764:sc_pkcs15_pincache_add: caching refused (user consent) | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs15-pin.c:327:sc_pkcs15_verify_pin: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:1661:pkcs15_login: PKCS15 verify PIN returned 0 | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:1670:pkcs15_login: Check if pkcs15 object list can be completed. | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-session.c:311:C_Login: fLogin() rv 0 | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:351:C_FindObjectsInit: C_FindObjectsInit(slot = 0) | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_CLASS = CKO_PRIVATE_KEY | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_ID = 02 | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x557346315990, type 0 | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6cd0 | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:408:C_FindObjectsInit: Object 0/93953586982096 matches | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:412:C_FindObjectsInit: realloc for 32 handles | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d90 | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.006 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982288: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6e50 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982480: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d30 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982192: Attribute 0x102 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6df0 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982384: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d71f0 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983408: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b30 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985776: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b90 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985872: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7bf0 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985968: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7250 | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.007 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983504: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d72b0 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983600: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7310 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983696: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7ad0 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985680: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7c50 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986064: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7cb0 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986160: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d10 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986256: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d70 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986352: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7dd0 | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986448: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:425:C_FindObjectsInit: 1 matching objects | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.008 [opensc-pkcs11] pkcs11-object.c:61:sc_find_release: freeing 32 handles used 1 at 0x557346304110 | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_SIGN = <size inquiry> | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_SIGN_RECOVER = <size inquiry> | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_DECRYPT = <size inquiry> | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_UNWRAP = <size inquiry> | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:274:C_GetAttributeValue: C_GetAttributeValue(hSession=0x557346315990, hObject=0x5573462d6cd0) = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_SIGN = TRUE | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_SIGN_RECOVER = TRUE | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_DECRYPT = TRUE | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:252:C_GetAttributeValue: Object 93953586982096: CKA_UNWRAP = TRUE | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:274:C_GetAttributeValue: C_GetAttributeValue(hSession=0x557346315990, hObject=0x5573462d6cd0) = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:250:sc_pkcs11_sign_init: called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:256:sc_pkcs11_sign_init: mechanism 0x1, key-type 0x0 | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x557346315990, type 1 | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:376:sc_pkcs11_signature_init: called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:430:sc_pkcs11_signature_init: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:283:sc_pkcs11_sign_init: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] pkcs11-object.c:668:C_SignInit: C_SignInit() = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:521:sc_pkcs11_signature_size: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:361:sc_pkcs11_sign_size: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.009 [opensc-pkcs11] mechanism.c:293:sc_pkcs11_sign_update: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] mechanism.c:439:sc_pkcs11_signature_update: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] mechanism.c:440:sc_pkcs11_signature_update: data part length 51 | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] mechanism.c:452:sc_pkcs11_signature_update: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] mechanism.c:309:sc_pkcs11_sign_update: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] mechanism.c:319:sc_pkcs11_sign_final: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] mechanism.c:462:sc_pkcs11_signature_final: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] framework-pkcs15.c:3816:pkcs15_prkey_sign: Initiating signing operation, mechanism 0x1. | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5cc100 len=256 | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:46.010 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc098 | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:46.011 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.020 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5cc102 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5cc102:18 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] framework-pkcs15.c:3945:pkcs15_prkey_sign: Selected flags 102. Now computing signature for 51 bytes. 256 bytes reserved. | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] pkcs15-sec.c:579:sc_pkcs15_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] pkcs15-sec.c:627:sc_pkcs15_compute_signature: supported algorithm flags 0x1, private key usage 0x22E | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] padding.c:468:sc_get_encoding_flags: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] padding.c:472:sc_get_encoding_flags: iFlags 0x102, card capabilities 0x1 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] padding.c:523:sc_get_encoding_flags: pad flags 0x102, secure algorithm flags 0x1 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] padding.c:524:sc_get_encoding_flags: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] pkcs15-sec.c:684:sc_pkcs15_compute_signature: DEE flags:0x00000102 alg_info->flags:0x00000001 pad:0x00000102 sec:0x00000001 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] padding.c:409:sc_pkcs1_encode: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] padding.c:413:sc_pkcs1_encode: hash algorithm 0x100, pad algorithm 0x2 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] padding.c:437:sc_pkcs1_encode: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] sec.c:105:sc_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:2264:piv_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:2269:piv_set_security_env: flags=00000014 op=2 alg=0 algf=00000001 algr=00000000 kr0=9c, krfl=1 | |
| P:32260; T:0x140540021001728 07:52:46.021 [opensc-pkcs11] card-piv.c:2296:piv_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] sec.c:109:sc_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] sec.c:59:sc_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card-piv.c:2397:piv_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card-piv.c:2325:piv_validate_general_authentication: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card-piv.c:499:piv_general_io: 87 07 9c 266 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:10, INS:87, P1:7, P2:9C, data(255) 0x7ffe5c5ca780 | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (260 bytes): | |
| 10 87 07 9C FF 7C 82 01 06 82 00 81 82 01 00 00 .....|.......... | |
| 01 FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF 00 30 31 30 0D ............010. | |
| 06 09 60 86 48 01 65 03 04 02 01 05 00 04 20 FA ..`.H.e....... . | |
| B2 35 84 7E A6 17 B3 5D 50 C3 F3 45 00 66 A0 4D .5.~...]P..E.f.M | |
| DB A2 CC 9A .... | |
| P:32260; T:0x140540021001728 07:52:46.022 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.049 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 90 00 .. | |
| P:32260; T:0x140540021001728 07:52:46.049 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.049 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.050 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.050 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.050 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:87, P1:7, P2:9C, data(11) 0x7ffe5c5ca87f | |
| P:32260; T:0x140540021001728 07:52:46.050 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:46.050 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (17 bytes): | |
| 00 87 07 9C 0B 20 5B 38 CE 52 6D 5F E3 64 86 42 ..... [8.Rm_.d.B | |
| 00 . | |
| P:32260; T:0x140540021001728 07:52:46.050 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 69 82 i. | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Security status not satisfied | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] card-piv.c:2378:piv_validate_general_authentication: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.063 [opensc-pkcs11] card-piv.c:2457:piv_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] sec.c:63:sc_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] pkcs15-pin.c:791:sc_pkcs15_pincache_revalidate: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] pkcs15-sec.c:720:sc_pkcs15_compute_signature: use_key() failed: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] pkcs15-sec.c:579:sc_pkcs15_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] pkcs15-sec.c:627:sc_pkcs15_compute_signature: supported algorithm flags 0x1, private key usage 0x22E | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] padding.c:468:sc_get_encoding_flags: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] padding.c:472:sc_get_encoding_flags: iFlags 0x102, card capabilities 0x1 | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] padding.c:523:sc_get_encoding_flags: pad flags 0x102, secure algorithm flags 0x1 | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] padding.c:524:sc_get_encoding_flags: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] pkcs15-sec.c:684:sc_pkcs15_compute_signature: DEE flags:0x00000102 alg_info->flags:0x00000001 pad:0x00000102 sec:0x00000001 | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] padding.c:409:sc_pkcs1_encode: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] padding.c:413:sc_pkcs1_encode: hash algorithm 0x100, pad algorithm 0x2 | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] padding.c:437:sc_pkcs1_encode: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] sec.c:105:sc_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card-piv.c:2264:piv_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card-piv.c:2269:piv_set_security_env: flags=00000014 op=2 alg=0 algf=00000001 algr=00000000 kr0=9c, krfl=1 | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card-piv.c:2296:piv_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] sec.c:109:sc_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] sec.c:59:sc_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card-piv.c:2397:piv_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card-piv.c:2325:piv_validate_general_authentication: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card-piv.c:499:piv_general_io: 87 07 9c 266 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.064 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.065 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:10, INS:87, P1:7, P2:9C, data(255) 0x7ffe5c5ca780 | |
| P:32260; T:0x140540021001728 07:52:46.065 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:46.065 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (260 bytes): | |
| 10 87 07 9C FF 7C 82 01 06 82 00 81 82 01 00 00 .....|.......... | |
| 01 FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF 00 30 31 30 0D ............010. | |
| 06 09 60 86 48 01 65 03 04 02 01 05 00 04 20 FA ..`.H.e....... . | |
| B2 35 84 7E A6 17 B3 5D 50 C3 F3 45 00 66 A0 4D .5.~...]P..E.f.M | |
| DB A2 CC 9A .... | |
| P:32260; T:0x140540021001728 07:52:46.065 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 90 00 .. | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:87, P1:7, P2:9C, data(11) 0x7ffe5c5ca87f | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (17 bytes): | |
| 00 87 07 9C 0B 20 5B 38 CE 52 6D 5F E3 64 86 42 ..... [8.Rm_.d.B | |
| 00 . | |
| P:32260; T:0x140540021001728 07:52:46.092 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.105 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 69 82 i. | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Security status not satisfied | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card-piv.c:2378:piv_validate_general_authentication: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card-piv.c:2457:piv_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] sec.c:63:sc_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] pkcs15-pin.c:791:sc_pkcs15_pincache_revalidate: called | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] pkcs15-sec.c:720:sc_pkcs15_compute_signature: use_key() failed: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.106 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] framework-pkcs15.c:3962:pkcs15_prkey_sign: Sign complete. Result -1211. | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] misc.c:61:sc_to_cryptoki_error_common: libopensc return value: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] mechanism.c:478:sc_pkcs11_signature_final: returning with: 257 | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] mechanism.c:336:sc_pkcs11_sign_final: returning with: 257 | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] pkcs11-object.c:716:C_Sign: C_Sign() = CKR_USER_NOT_LOGGED_IN | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] pkcs11-session.c:342:C_Logout: C_Logout(hSession:0x557346315990) | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] pkcs11-session.c:158:C_CloseSession: C_CloseSession(0x557346315990) | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] pkcs11-session.c:109:sc_pkcs11_close_session: real C_CloseSession(0x557346315990) | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, plug-n-play) | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] reader-pcsc.c:1311:pcsc_detect_readers: called | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] reader-pcsc.c:1324:pcsc_detect_readers: Probing PC/SC readers | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] reader-pcsc.c:1456:pcsc_detect_readers: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:46.111 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] pkcs11-global.c:471:C_GetSlotList: was only a size inquiry (1) | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] pkcs11-global.c:435:C_GetSlotList: C_GetSlotList(token=1, refresh) | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] slot.c:393:card_detect_all: Detect all cards | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] slot.c:219:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:46.112 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] slot.c:372:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] slot.c:412:card_detect_all: All cards detected | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] pkcs11-global.c:488:C_GetSlotList: returned 1 slots | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] framework-pkcs15.c:538:C_GetTokenInfo: C_GetTokenInfo(0) | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:32260; T:0x140540021001728 07:52:46.113 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] framework-pkcs15.c:569:C_GetTokenInfo: C_GetTokenInfo() auth. object 0x5573462cf600, token-info flags 0x40D | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] pkcs15-pin.c:689:sc_pkcs15_get_pin_info: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5c98f0 len=256 | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5c9888 | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:46.114 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:46.124 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:46.124 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.124 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.124 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.124 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5c98f2 | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5c98f2:18 | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] sec.c:200:sc_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:3394:piv_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:3395:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=1 | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card-piv.c:3434:piv_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] sec.c:247:sc_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.125 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:46.128 [opensc-pkcs11] pkcs15-pin.c:717:sc_pkcs15_get_pin_info: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:46.128 [opensc-pkcs11] framework-pkcs15.c:587:C_GetTokenInfo: C_GetTokenInfo(0) returns 0x0 | |
| P:32260; T:0x140540021001728 07:52:46.128 [opensc-pkcs11] pkcs11-session.c:58:C_OpenSession: C_OpenSession(0x0) | |
| P:32260; T:0x140540021001728 07:52:46.128 [opensc-pkcs11] slot.c:452:slot_get_token: Slot(id=0x0): get token | |
| P:32260; T:0x140540021001728 07:52:46.128 [opensc-pkcs11] slot.c:470:slot_get_token: Slot-get-token returns OK | |
| P:32260; T:0x140540021001728 07:52:46.128 [opensc-pkcs11] pkcs11-session.c:94:C_OpenSession: C_OpenSession handle: 0x557346302760 | |
| P:32260; T:0x140540021001728 07:52:46.128 [opensc-pkcs11] pkcs11-session.c:97:C_OpenSession: C_OpenSession() = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] pkcs11-session.c:276:C_Login: C_Login(0x557346302760, 1) | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] pkcs11-session.c:298:C_Login: C_Login() slot->login_user -1 | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] pkcs11-session.c:309:C_Login: C_Login() userType 1 | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] framework-pkcs15.c:1551:pkcs15_login: pkcs15-login: userType 0x1, PIN length 6 | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] pkcs15-pin.c:302:sc_pkcs15_verify_pin: called | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] pkcs15-pin.c:357:sc_pkcs15_verify_pin_with_session_pin: called | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] pkcs15-pin.c:361:sc_pkcs15_verify_pin_with_session_pin: PIN(type:0; method:1; value(0x7ffe5c5cc0c0:6) | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.635 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5c9920 len=256 | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5c98b8 | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:52.636 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5c9922 | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:52.646 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5c9922:18 | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] sec.c:200:sc_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card-piv.c:3394:piv_pin_cmd: called | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card-piv.c:3395:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=1 | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(8) 0x7ffe5c5c99e0 | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (13 bytes): | |
| 00 20 00 80 08 61 61 61 71 61 61 FF FF . ...my_pin.. | |
| P:32260; T:0x140540021001728 07:52:52.647 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 90 00 .. | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] card-piv.c:3512:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=1 | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] card-piv.c:3513:piv_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] sec.c:247:sc_pin_cmd: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] pkcs15-pin.c:449:sc_pkcs15_verify_pin_with_session_pin: PIN cmd result 0 | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] pkcs15-pin.c:736:sc_pkcs15_pincache_add: called | |
| P:32260; T:0x140540021001728 07:52:52.679 [opensc-pkcs11] pkcs15-pin.c:764:sc_pkcs15_pincache_add: caching refused (user consent) | |
| P:32260; T:0x140540021001728 07:52:52.680 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.680 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs15-pin.c:471:sc_pkcs15_verify_pin_with_session_pin: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs15-pin.c:736:sc_pkcs15_pincache_add: called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs15-pin.c:764:sc_pkcs15_pincache_add: caching refused (user consent) | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs15-pin.c:327:sc_pkcs15_verify_pin: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:1661:pkcs15_login: PKCS15 verify PIN returned 0 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:1670:pkcs15_login: Check if pkcs15 object list can be completed. | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-session.c:311:C_Login: fLogin() rv 0 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:351:C_FindObjectsInit: C_FindObjectsInit(slot = 0) | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_CLASS = CKO_PRIVATE_KEY | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:352:C_FindObjectsInit: C_FindObjectsInit(): CKA_ID = 02 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x557346302760, type 0 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6cd0 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:408:C_FindObjectsInit: Object 0/93953586982096 matches | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:412:C_FindObjectsInit: realloc for 32 handles | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d90 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982288: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6e50 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982480: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6d30 | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.683 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982192: Attribute 0x102 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d6df0 | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4348:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586982384: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d71f0 | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:3475:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:3372:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983408: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b30 | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985776: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7b90 | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985872: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7bf0 | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985968: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7250 | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.684 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983504: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d72b0 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983600: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7310 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586983696: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7ad0 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586985680: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7c50 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986064: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7cb0 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986160: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d10 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986256: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7d70 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986352: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:373:C_FindObjectsInit: Object with handle 0x5573462d7dd0 | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] framework-pkcs15.c:4636:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:394:C_FindObjectsInit: Object 0/93953586986448: Attribute 0x0 does NOT match. | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] pkcs11-object.c:425:C_FindObjectsInit: 1 matching objects | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.685 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] pkcs11-object.c:61:sc_find_release: freeing 32 handles used 1 at 0x557346304110 | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:250:sc_pkcs11_sign_init: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:256:sc_pkcs11_sign_init: mechanism 0x1, key-type 0x0 | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x557346302760, type 1 | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:376:sc_pkcs11_signature_init: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:430:sc_pkcs11_signature_init: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:283:sc_pkcs11_sign_init: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] pkcs11-object.c:668:C_SignInit: C_SignInit() = CKR_OK | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] framework-pkcs15.c:3574:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:521:sc_pkcs11_signature_size: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:361:sc_pkcs11_sign_size: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:293:sc_pkcs11_sign_update: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:439:sc_pkcs11_signature_update: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:440:sc_pkcs11_signature_update: data part length 51 | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:452:sc_pkcs11_signature_update: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:309:sc_pkcs11_sign_update: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:319:sc_pkcs11_sign_final: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] mechanism.c:462:sc_pkcs11_signature_final: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] framework-pkcs15.c:3816:pkcs15_prkey_sign: Initiating signing operation, mechanism 0x1. | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] reader-pcsc.c:623:pcsc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.686 [opensc-pkcs11] card-piv.c:3548:piv_card_reader_lock_obtained: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card-piv.c:2647:piv_find_discovery: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card-piv.c:963:piv_get_data: buffer for #10 *buf=0x0x7ffe5c5cc100 len=256 | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card-piv.c:499:piv_general_io: cb 3f ff 3 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffe5c5cc098 | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 00 ..?..\.~. | |
| P:32260; T:0x140540021001728 07:52:52.687 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card-piv.c:570:piv_general_io: r_tag:0 body:0x7ffe5c5cc102 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card-piv.c:976:piv_get_data: returning with: 20 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card-piv.c:2590:piv_parse_discovery: Discovery 0x60 0x1e 0x7ffe5c5cc102:18 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card-piv.c:2615:piv_parse_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card-piv.c:2666:piv_find_discovery: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card-piv.c:3587:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] framework-pkcs15.c:3945:pkcs15_prkey_sign: Selected flags 102. Now computing signature for 51 bytes. 256 bytes reserved. | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] pkcs15-sec.c:579:sc_pkcs15_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] pkcs15-sec.c:627:sc_pkcs15_compute_signature: supported algorithm flags 0x1, private key usage 0x22E | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] padding.c:468:sc_get_encoding_flags: called | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] padding.c:472:sc_get_encoding_flags: iFlags 0x102, card capabilities 0x1 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] padding.c:523:sc_get_encoding_flags: pad flags 0x102, secure algorithm flags 0x1 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] padding.c:524:sc_get_encoding_flags: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] pkcs15-sec.c:684:sc_pkcs15_compute_signature: DEE flags:0x00000102 alg_info->flags:0x00000001 pad:0x00000102 sec:0x00000001 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] padding.c:409:sc_pkcs1_encode: called | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] padding.c:413:sc_pkcs1_encode: hash algorithm 0x100, pad algorithm 0x2 | |
| P:32260; T:0x140540021001728 07:52:52.697 [opensc-pkcs11] padding.c:437:sc_pkcs1_encode: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] sec.c:105:sc_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card-piv.c:2264:piv_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card-piv.c:2269:piv_set_security_env: flags=00000014 op=2 alg=0 algf=00000001 algr=00000000 kr0=9c, krfl=1 | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card-piv.c:2296:piv_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] sec.c:109:sc_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] sec.c:59:sc_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card-piv.c:2397:piv_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card-piv.c:2325:piv_validate_general_authentication: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card-piv.c:499:piv_general_io: 87 07 9c 266 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:10, INS:87, P1:7, P2:9C, data(255) 0x7ffe5c5ca780 | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (260 bytes): | |
| 10 87 07 9C FF 7C 82 01 06 82 00 81 82 01 00 00 .....|.......... | |
| 01 FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF 00 30 31 30 0D ............010. | |
| 06 09 60 86 48 01 65 03 04 02 01 05 00 04 20 FA ..`.H.e....... . | |
| B2 35 84 7E A6 17 B3 5D 50 C3 F3 45 00 66 A0 4D .5.~...]P..E.f.M | |
| DB A2 CC 9A .... | |
| P:32260; T:0x140540021001728 07:52:52.698 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 90 00 .. | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:87, P1:7, P2:9C, data(11) 0x7ffe5c5ca87f | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (17 bytes): | |
| 00 87 07 9C 0B 20 5B 38 CE 52 6D 5F E3 64 86 42 ..... [8.Rm_.d.B | |
| 00 . | |
| P:32260; T:0x140540021001728 07:52:52.726 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.739 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 69 82 i. | |
| P:32260; T:0x140540021001728 07:52:52.739 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.739 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.739 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Security status not satisfied | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:2378:piv_validate_general_authentication: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:2457:piv_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] sec.c:63:sc_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] pkcs15-pin.c:791:sc_pkcs15_pincache_revalidate: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] pkcs15-sec.c:720:sc_pkcs15_compute_signature: use_key() failed: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] pkcs15-sec.c:579:sc_pkcs15_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] pkcs15-sec.c:627:sc_pkcs15_compute_signature: supported algorithm flags 0x1, private key usage 0x22E | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] padding.c:468:sc_get_encoding_flags: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] padding.c:472:sc_get_encoding_flags: iFlags 0x102, card capabilities 0x1 | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] padding.c:523:sc_get_encoding_flags: pad flags 0x102, secure algorithm flags 0x1 | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] padding.c:524:sc_get_encoding_flags: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] pkcs15-sec.c:684:sc_pkcs15_compute_signature: DEE flags:0x00000102 alg_info->flags:0x00000001 pad:0x00000102 sec:0x00000001 | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] padding.c:409:sc_pkcs1_encode: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] padding.c:413:sc_pkcs1_encode: hash algorithm 0x100, pad algorithm 0x2 | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] padding.c:437:sc_pkcs1_encode: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] sec.c:105:sc_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:2264:piv_set_security_env: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:2269:piv_set_security_env: flags=00000014 op=2 alg=0 algf=00000001 algr=00000000 kr0=9c, krfl=1 | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:2296:piv_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] sec.c:109:sc_set_security_env: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] sec.c:59:sc_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:2397:piv_compute_signature: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:2325:piv_validate_general_authentication: called | |
| P:32260; T:0x140540021001728 07:52:52.740 [opensc-pkcs11] card-piv.c:494:piv_general_io: called | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] card-piv.c:499:piv_general_io: 87 07 9c 266 : 255 256 | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] card.c:415:sc_lock: called | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] card.c:455:sc_lock: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:10, INS:87, P1:7, P2:9C, data(255) 0x7ffe5c5ca780 | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (260 bytes): | |
| 10 87 07 9C FF 7C 82 01 06 82 00 81 82 01 00 00 .....|.......... | |
| 01 FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF FF ................ | |
| FF FF FF FF FF FF FF FF FF FF FF 00 30 31 30 0D ............010. | |
| 06 09 60 86 48 01 65 03 04 02 01 05 00 04 20 FA ..`.H.e....... . | |
| B2 35 84 7E A6 17 B3 5D 50 C3 F3 45 00 66 A0 4D .5.~...]P..E.f.M | |
| DB A2 CC 9A .... | |
| P:32260; T:0x140540021001728 07:52:52.741 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.768 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 90 00 .. | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:87, P1:7, P2:9C, data(11) 0x7ffe5c5ca87f | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] reader-pcsc.c:285:pcsc_transmit: | |
| Outgoing APDU (17 bytes): | |
| 00 87 07 9C 0B 20 5B 38 CE 52 6D 5F E3 64 86 42 ..... [8.Rm_.d.B | |
| 00 . | |
| P:32260; T:0x140540021001728 07:52:52.769 [opensc-pkcs11] reader-pcsc.c:213:pcsc_internal_transmit: called | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] reader-pcsc.c:294:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 69 82 i. | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] iso7816.c:128:iso7816_check_sw: Security status not satisfied | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card-piv.c:551:piv_general_io: Card returned error | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card-piv.c:2378:piv_validate_general_authentication: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card-piv.c:2457:piv_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] sec.c:63:sc_compute_signature: returning with: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] pkcs15-pin.c:791:sc_pkcs15_pincache_revalidate: called | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] pkcs15-sec.c:720:sc_pkcs15_compute_signature: use_key() failed: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] card.c:465:sc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.782 [opensc-pkcs11] reader-pcsc.c:673:pcsc_unlock: called | |
| P:32260; T:0x140540021001728 07:52:52.784 [opensc-pkcs11] framework-pkcs15.c:3962:pkcs15_prkey_sign: Sign complete. Result -1211. | |
| P:32260; T:0x140540021001728 07:52:52.784 [opensc-pkcs11] misc.c:61:sc_to_cryptoki_error_common: libopensc return value: -1211 (Security status not satisfied) | |
| P:32260; T:0x140540021001728 07:52:52.784 [opensc-pkcs11] mechanism.c:478:sc_pkcs11_signature_final: returning with: 257 | |
| P:32260; T:0x140540021001728 07:52:52.784 [opensc-pkcs11] mechanism.c:336:sc_pkcs11_sign_final: returning with: 257 | |
| P:32260; T:0x140540021001728 07:52:52.784 [opensc-pkcs11] pkcs11-object.c:716:C_Sign: C_Sign() = CKR_USER_NOT_LOGGED_IN | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] pkcs11-global.c:349:C_Finalize: C_Finalize() | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] ctx.c:919:sc_cancel: called | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] reader-pcsc.c:723:pcsc_cancel: called | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] slot.c:180:card_removed: Yubico Yubikey NEO OTP+U2F+CCID 00 00: card removed | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] slot.c:481:slot_token_removed: slot_token_removed(0x0) | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x0) 1 | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] pkcs11-session.c:109:sc_pkcs11_close_session: real C_CloseSession(0x557346302760) | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] framework-pkcs15.c:1529:pkcs15_release_token: pkcs15_release_token() not implemented | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] slot.c:481:slot_token_removed: slot_token_removed(0x1) | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x1) 0 | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] slot.c:481:slot_token_removed: slot_token_removed(0x2) | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x2) 0 | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] slot.c:481:slot_token_removed: slot_token_removed(0x3) | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x3) 0 | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] sc.c:289:sc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] reader-pcsc.c:422:pcsc_detect_card_presence: called | |
| P:32260; T:0x140540021001728 07:52:54.090 [opensc-pkcs11] reader-pcsc.c:320:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| P:32260; T:0x140540021001728 07:52:54.091 [opensc-pkcs11] reader-pcsc.c:340:refresh_attributes: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:54.091 [opensc-pkcs11] reader-pcsc.c:427:pcsc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:54.091 [opensc-pkcs11] sc.c:294:sc_detect_card_presence: returning with: 1 | |
| P:32260; T:0x140540021001728 07:52:54.091 [opensc-pkcs11] pkcs15.c:1271:sc_pkcs15_unbind: called | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] pkcs15-pin.c:838:sc_pkcs15_pincache_clear: called | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] misc.c:61:sc_to_cryptoki_error_common: libopensc return value: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] card.c:356:sc_disconnect_card: called | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] card-piv.c:2904:piv_finish: called | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] reader-pcsc.c:608:pcsc_disconnect: Yubico Yubikey NEO OTP+U2F+CCID 00 00:SCardDisconnect returned: 0x00000000 | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] card.c:378:sc_disconnect_card: returning with: 0 (Success) | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] ctx.c:944:sc_release_context: called | |
| P:32260; T:0x140540021001728 07:52:54.092 [opensc-pkcs11] reader-pcsc.c:910:pcsc_finish: called |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| *************** OpenSC PKCS#11 spy ***************** | |
| Loaded: "/usr/lib/pkcs11/opensc-pkcs11.so" | |
| 0: C_GetFunctionList | |
| 2018-12-03 20:40:54.240 | |
| Returned: 0 CKR_OK | |
| 1: C_Initialize | |
| 2018-12-03 20:40:54.240 | |
| [in] pInitArgs = (nil) | |
| Returned: 0 CKR_OK | |
| 2: C_GetInfo | |
| 2018-12-03 20:40:54.948 | |
| [out] pInfo: | |
| cryptokiVersion: 2.20 | |
| manufacturerID: 'OpenSC Project ' | |
| flags: 0 | |
| libraryDescription: 'OpenSC smartcard framework ' | |
| libraryVersion: 0.17 | |
| Returned: 0 CKR_OK | |
| 3: C_GetSlotList | |
| 2018-12-03 20:40:54.949 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Count is 1 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 4: C_GetSlotList | |
| 2018-12-03 20:40:54.950 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Slot 0 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 5: C_GetTokenInfo | |
| 2018-12-03 20:40:54.950 | |
| [in] slotID = 0x0 | |
| [out] pInfo: | |
| label: 'PIV Card Holder pin (PIV_II) ' | |
| manufacturerID: 'piv_II ' | |
| model: 'PKCS#15 emulated' | |
| serialNumber: '123abd32f34666f3' | |
| ulMaxSessionCount: 0 | |
| ulSessionCount: 0 | |
| ulMaxRwSessionCount: 0 | |
| ulRwSessionCount: 0 | |
| ulMaxPinLen: 8 | |
| ulMinPinLen: 4 | |
| ulTotalPublicMemory: -1 | |
| ulFreePublicMemory: -1 | |
| ulTotalPrivateMemory: -1 | |
| ulFreePrivateMemory: -1 | |
| hardwareVersion: 0.0 | |
| firmwareVersion: 0.0 | |
| time: ' ' | |
| flags: 40d | |
| CKF_RNG | |
| CKF_LOGIN_REQUIRED | |
| CKF_USER_PIN_INITIALIZED | |
| CKF_TOKEN_INITIALIZED | |
| Returned: 0 CKR_OK | |
| 6: C_OpenSession | |
| 2018-12-03 20:40:54.983 | |
| [in] slotID = 0x0 | |
| [in] flags = 0x4 | |
| pApplication=(nil) | |
| Notify=(nil) | |
| [out] *phSession = 0x563c3dd73950 | |
| Returned: 0 CKR_OK | |
| 7: C_FindObjectsInit | |
| 2018-12-03 20:40:54.983 | |
| [in] hSession = 0x563c3dd73950 | |
| [in] pTemplate[2]: | |
| CKA_CLASS CKO_CERTIFICATE | |
| CKA_ID 0000561231323350 / 1 | |
| 00000000 02 . | |
| Returned: 0 CKR_OK | |
| 8: C_FindObjects | |
| 2018-12-03 20:40:54.983 | |
| [in] hSession = 0x563c3dd73950 | |
| [in] ulMaxObjectCount = 0x64 | |
| [out] ulObjectCount = 0x1 | |
| Object 0x563c3dd67df0 matches | |
| Returned: 0 CKR_OK | |
| 9: C_FindObjects | |
| 2018-12-03 20:40:54.983 | |
| [in] hSession = 0x563c3dd73950 | |
| [in] ulMaxObjectCount = 0x64 | |
| [out] ulObjectCount = 0x0 | |
| Returned: 0 CKR_OK | |
| 10: C_FindObjectsFinal | |
| 2018-12-03 20:40:54.983 | |
| [in] hSession = 0x563c3dd73950 | |
| Returned: 0 CKR_OK | |
| 11: C_GetAttributeValue | |
| 2018-12-03 20:40:54.983 | |
| [in] hSession = 0x563c3dd73950 | |
| [in] hObject = 0x563c3dd67df0 | |
| [in] pTemplate[1]: | |
| CKA_VALUE 0000000000000000 / 0 | |
| [out] pTemplate[1]: | |
| CKA_VALUE 0000000000000000 / 1311 | |
| Returned: 0 CKR_OK | |
| 12: C_GetAttributeValue | |
| 2018-12-03 20:40:54.983 | |
| [in] hSession = 0x563c3dd73950 | |
| [in] hObject = 0x563c3dd67df0 | |
| [in] pTemplate[1]: | |
| CKA_VALUE 0000563c3dd73a00 / 1311 | |
| [out] pTemplate[1]: | |
| CKA_VALUE 0000563c3dd73a00 / 1311 | |
| 00000000 30 82 05 1B 30 82 03 03 A0 03 02 01 02 02 01 51 0...0..........Q | |
| 00000010 30 0D 06 09 2A 86 48 86 F7 0D 01 01 0D 05 00 30 0...*.H........0 | |
| 00000020 5A 31 0B 30 09 06 03 55 04 06 13 02 55 53 31 0B Z1.0...U....US1. | |
| 00000030 30 09 06 03 55 04 08 0C 02 55 54 31 1A 30 18 06 0...U....UT1.0.. | |
| 00000040 03 55 04 0A 0C 61 61 61 61 61 61 61 61 61 61 20 .U....asdfasdfd | |
| 00000050 61 61 61 61 61 61 61 31 22 30 20 06 09 2A 86 48 fdsasdf1"0 ..*.H | |
| 00000060 86 F7 0D 01 09 01 16 13 61 61 61 61 61 40 61 61 ........asdfs@as | |
| 00000070 61 61 61 61 61 61 61 2E 63 6F 6D 30 1E 17 0D 31 asdfdsf.com0...1 | |
| 00000080 61 61 61 61 61 61 61 61 34 30 30 5A 17 0D 32 32 23123123200Z..22 | |
| 00000090 61 61 61 61 61 61 61 61 61 30 5A 30 50 31 0B 30 1231233200Z0P1.0 | |
| 000000A0 09 06 03 55 04 06 13 02 55 53 31 0B 30 09 06 03 ...U....US1.0... | |
| 000000B0 55 04 08 0C 02 61 61 31 1A 30 18 06 03 55 04 0A U....CA1.0...U.. | |
| 000000C0 0C 11 61 61 61 61 61 61 61 61 61 61 61 61 61 61 ..sdfasdfaasdffd | |
| 000000D0 61 61 61 31 18 30 16 06 03 55 04 03 0C 0F 61 61 sdf1.0...U....my | |
| 000000E0 61 61 61 61 61 61 61 61 61 61 61 61 61 30 82 01 real namefds0.. | |
| 000000F0 22 30 0D 06 09 2A 86 48 86 F7 0D 01 01 01 05 00 "0...*.H........ | |
| 00000100 03 82 01 0F 00 30 82 01 0A 02 82 01 01 00 90 B7 .....0.......... | |
| 00000110 F4 83 61 61 5F CB 5E 50 19 4F FA 1D B0 DA 65 B8 ..aa_.^P.O....e. | |
| 00000120 42 E3 B9 82 02 59 29 4D 76 91 45 65 DD FA C2 42 B....Y)Mv.Ee...B | |
| 00000130 36 81 B5 A4 DE FD EC 05 58 E7 E9 4D BE 69 F2 8F 6.......X..M.i.. | |
| 00000140 E1 15 79 DC 3B E6 1D B7 ED AC A9 A5 AF D0 B9 4D ..y.;..........M | |
| 00000150 C2 4C 40 40 70 BB 75 29 7E C4 39 AB AA BC D3 98 .L@@p.u)~.9..... | |
| 00000160 D8 60 6C 83 CF E7 D1 2B ED 5A 1F 33 91 3D DA 26 .`l....+.Z.3.=.& | |
| 00000170 47 86 B3 6F 22 27 87 DC E0 7C DB EF 74 0A A9 BE G..o"'...|..t... | |
| 00000180 D9 14 E7 CE 4F C3 6B EC B8 6F EE F6 74 C5 83 C7 ....O.k..o..t... | |
| 00000190 61 F3 64 96 0B 10 F0 FA EF 93 B1 87 97 2D B9 0C a.d..........-.. | |
| 000001A0 17 9F DA EF AD 51 B0 6E 08 00 64 47 32 66 76 DD .....Q.n..dG2fv. | |
| 000001B0 5B 28 C1 E5 51 0B 82 57 40 FE 78 C1 AA 89 A1 65 [(..Q..W@.x....e | |
| 000001C0 9B 28 5C EE 51 69 1A 84 CF 0F D8 05 24 A5 9F 50 .(\.Qi......$..P | |
| 000001D0 D6 B3 39 1F D2 10 CD D2 9A 20 A8 0A 9F 5A 51 85 ..9...... ...ZQ. | |
| 000001E0 47 9F FF 1A 00 15 33 7F 4B 63 21 02 5A 86 56 09 G.....3Kc!.Z.V. | |
| 000001F0 50 26 50 7F 71 77 C7 4F 9D 08 B3 31 08 25 96 0F P&Pqw.O...1.%.. | |
| 00000200 7F 49 B8 B3 6F 93 79 E0 21 AC 8C 01 7D 99 02 03 I..o.y.!...}... | |
| 00000210 01 00 01 A3 81 F5 30 81 F2 30 09 06 03 55 1D 13 ......0..0...U.. | |
| 00000220 04 02 30 00 30 11 06 09 60 86 48 01 86 F8 42 01 ..0.0...`.H...B. | |
| 00000230 01 04 04 03 02 05 A0 30 33 06 09 60 86 48 01 86 .......03..`.H.. | |
| 00000240 F8 42 01 0D 04 26 16 24 4F 70 65 6E 53 53 4C 20 .B...&.$OpenSSL | |
| 00000250 47 65 6E 65 72 61 74 65 64 20 43 6C 69 65 6E 74 Generated Client | |
| 00000260 20 43 65 72 74 69 66 69 63 61 74 65 30 1D 06 03 Certificate0... | |
| 00000270 55 1D 0E 04 16 04 14 AD 41 CD 8A 71 8E 8B D7 F8 U.......A..q.... | |
| 00000280 7A F7 45 4D E5 47 55 AB AC AB 54 30 1F 06 03 55 z.EM.GU...T0...U | |
| 00000290 1D 23 04 18 30 16 80 14 AF F5 8E B7 63 53 AC A9 .#..0.......cS.. | |
| 000002A0 F3 49 BF 09 D6 58 79 D3 97 85 11 7F 30 0E 06 03 .I...Xy....0... | |
| 000002B0 55 1D 0F 01 01 FF 04 04 03 02 06 C0 30 29 06 03 U...........0).. | |
| 000002C0 55 1D 25 04 22 30 20 06 08 2B 06 01 05 05 07 03 U.%."0 ..+...... | |
| 000002D0 02 06 08 2B 06 01 05 05 07 03 04 06 0A 2B 06 01 ...+.........+.. | |
| 000002E0 04 01 82 37 14 02 02 30 22 06 03 55 1D 11 04 1B ...7...0"..U.... | |
| 000002F0 30 19 81 17 61 61 61 61 61 61 61 61 61 40 61 61 0...asdfasdfd@sd | |
| 00000300 61 61 61 61 61 61 61 2E 63 6F 6D 30 0D 06 09 2A asdfsad.com0...* | |
| 00000310 86 48 86 F7 0D 01 01 0D 05 00 03 82 02 01 00 C1 .H.............. | |
| 00000320 5E 49 BE D7 BF 36 70 78 1D DB 5A 79 48 E2 0F E5 ^I...6px..ZyH... | |
| 00000330 9C 9D CE B8 7F B8 4B AD F2 CB 80 57 08 39 5E 85 .....K....W.9^. | |
| 00000340 ED 2B CE 65 55 C3 15 3F FF 62 88 63 2C 4C 24 FA .+.eU..?.b.c,L$. | |
| 00000350 EA B2 EE 4D 4F 38 19 0D 03 EF DA 03 85 D0 95 A5 ...MO8.......... | |
| 00000360 52 81 FA A6 38 0E B4 85 4F 27 52 AC 4C 29 58 FB R...8...O'R.L)X. | |
| 00000370 39 62 D8 30 4B 65 1C 95 07 A1 C4 E4 E4 CA 5A C8 9b.0Ke........Z. | |
| 00000380 D3 01 6C 60 A4 16 AF 0E 2A 05 F7 28 4E 9B 33 F3 ..l`....*..(N.3. | |
| 00000390 70 3B 7A 1E 64 A1 99 12 5A 7B C3 25 CC E2 EF 34 p;z.d...Z{.%...4 | |
| 000003A0 52 41 C5 F1 B2 7A D5 67 BA 9C 19 1C CA 4C 68 C7 RA...z.g.....Lh. | |
| 000003B0 9E D3 5A D6 9D 1E CE CF 3D 00 C0 8F 52 61 2C 2B ..Z.....=...Ra,+ | |
| 000003C0 6E 36 FF C6 39 70 FB 5B FE 3F 9D 93 F1 85 D2 90 n6..9p.[.?...... | |
| 000003D0 80 D7 E0 E5 70 1A 52 49 3C 86 7D 67 53 94 AD 11 ....p.RI<.}gS... | |
| 000003E0 7E EA CF 95 3A 8F 7D 40 5B AD AC 8C D2 2E 2B 20 ~...:.}@[.....+ | |
| 000003F0 E8 6F 30 B6 79 60 AA 60 96 A2 1D 58 2E 83 B8 2F .o0.y`.`...X.../ | |
| 00000400 9C E0 08 BB E5 BE D9 E2 06 4F 83 B5 01 43 A5 9F .........O...C.. | |
| 00000410 85 91 54 61 B5 97 AE CD 57 BB E6 C7 0D 4B CE 22 ..Ta....W....K." | |
| 00000420 29 C2 9C 33 01 CE 78 F7 E3 88 93 C0 A1 AC 8E 2F )..3..x......../ | |
| 00000430 4C 49 02 30 E6 98 F1 EB DE 7E AB 10 C2 C7 C4 06 LI.0.....~...... | |
| 00000440 D5 46 3B 89 66 AE AA 05 AD EF 23 5B 6B 03 03 8A .F;.f.....#[k... | |
| 00000450 87 D1 8B E6 D6 A8 EE 08 A0 6E E1 55 0F EA DD 86 .........n.U.... | |
| 00000460 75 31 46 AE 03 FC E3 86 91 3C E7 C6 C7 6D 60 21 u1F......<...m`! | |
| 00000470 2B 29 BE 13 C4 42 84 61 AD 2C 2C 76 7C 28 F1 84 +)...B.a.,,v|(.. | |
| 00000480 E6 1E 36 D0 4C 2D 44 08 B6 81 93 40 89 C4 7F E6 ..6.L-D....@... | |
| 00000490 33 8E 6E 0D B9 2A C0 AD E5 67 59 FA 91 C0 8E 09 3.n..*...gY..... | |
| 000004A0 FE AF 50 4D 79 23 BC 0D 3D 27 B4 CC A3 73 93 4B ..PMy#..='...s.K | |
| 000004B0 7D 93 7F 3E 3B B4 5F C9 E8 FE 07 33 2F 92 54 27 }.>;._....3/.T' | |
| 000004C0 D9 B1 55 EA 5F E4 C7 0C A2 7B D2 48 A8 F4 75 6E ..U._....{.H..un | |
| 000004D0 AF 9D 5B A1 B0 94 DC E5 ED A2 B4 3C 76 61 AF 53 ..[........<va.S | |
| 000004E0 BA 8B F7 63 13 C8 F1 1D 27 7D 1C 21 EC 6E E9 2A ...c....'}.!.n.* | |
| 000004F0 D2 F2 4B C4 66 B8 8C F6 DB 4D 55 CD E0 54 41 61 ..K.f....MU..TAa | |
| 00000500 A3 81 5B CE 97 CB C2 0A 8E D4 70 E9 53 8F 56 AE ..[.......p.S.V. | |
| 00000510 D9 07 40 E5 58 92 9C B3 8C C9 7A A4 92 03 89 ..@.X.....z.... | |
| Returned: 0 CKR_OK | |
| 13: C_FindObjectsInit | |
| 2018-12-03 20:40:55.299 | |
| [in] hSession = 0x563c3dd73950 | |
| [in] pTemplate[2]: | |
| CKA_CLASS CKO_PRIVATE_KEY | |
| CKA_ID 0000563c3dd73050 / 1 | |
| 00000000 02 . | |
| Returned: 0 CKR_OK | |
| 14: C_FindObjects | |
| 2018-12-03 20:40:55.299 | |
| [in] hSession = 0x563c3dd73950 | |
| [in] ulMaxObjectCount = 0x64 | |
| [out] ulObjectCount = 0x0 | |
| Returned: 0 CKR_OK | |
| 15: C_FindObjectsFinal | |
| 2018-12-03 20:40:55.299 | |
| [in] hSession = 0x563c3dd73950 | |
| Returned: 0 CKR_OK | |
| 16: C_Logout | |
| 2018-12-03 20:40:55.299 | |
| [in] hSession = 0x563c3dd73950 | |
| Returned: 257 CKR_USER_NOT_LOGGED_IN | |
| 17: C_CloseSession | |
| 2018-12-03 20:40:55.299 | |
| [in] hSession = 0x563c3dd73950 | |
| Returned: 0 CKR_OK | |
| 18: C_GetSlotList | |
| 2018-12-03 20:40:55.299 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Count is 1 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 19: C_GetSlotList | |
| 2018-12-03 20:40:55.299 | |
| [in] tokenPresent = 0x1 | |
| [out] pSlotList: | |
| Slot 0 | |
| [out] *pulCount = 0x1 | |
| Returned: 0 CKR_OK | |
| 20: C_GetTokenInfo | |
| 2018-12-03 20:40:55.299 | |
| [in] slotID = 0x0 | |
| [out] pInfo: | |
| label: 'PIV Card Holder pin (PIV_II) ' | |
| manufacturerID: 'piv_II ' | |
| model: 'PKCS#15 emulated' | |
| serialNumber: '123abd32f34666f3' | |
| ulMaxSessionCount: 0 | |
| ulSessionCount: 0 | |
| ulMaxRwSessionCount: 0 | |
| ulRwSessionCount: 0 | |
| ulMaxPinLen: 8 | |
| ulMinPinLen: 4 | |
| ulTotalPublicMemory: -1 | |
| ulFreePublicMemory: -1 | |
| ulTotalPrivateMemory: -1 | |
| ulFreePrivateMemory: -1 | |
| hardwareVersion: 0.0 | |
| firmwareVersion: 0.0 | |
| time: ' ' | |
| flags: 40d | |
| CKF_RNG | |
| CKF_LOGIN_REQUIRED | |
| CKF_USER_PIN_INITIALIZED | |
| CKF_TOKEN_INITIALIZED | |
| Returned: 0 CKR_OK | |
| 21: C_OpenSession | |
| 2018-12-03 20:40:55.315 | |
| [in] slotID = 0x0 | |
| [in] flags = 0x4 | |
| pApplication=(nil) | |
| Notify=(nil) | |
| [out] *phSession = 0x563c3dd97b10 | |
| Returned: 0 CKR_OK | |
| 22: C_Login | |
| 2018-12-03 20:41:01.562 | |
| [in] hSession = 0x563c3dd97b10 | |
| [in] userType = CKU_USER | |
| [in] pPin[ulPinLen] 00007fffcc407220 / 6 | |
| 00000000 61 61 61 61 61 61 mypin0 | |
| Returned: 0 CKR_OK | |
| 23: C_FindObjectsInit | |
| 2018-12-03 20:41:01.594 | |
| [in] hSession = 0x563c3dd97b10 | |
| [in] pTemplate[2]: | |
| CKA_CLASS CKO_PRIVATE_KEY | |
| CKA_ID 000051343dd13240 / 1 | |
| 00000000 02 . | |
| Returned: 0 CKR_OK | |
| 24: C_FindObjects | |
| 2018-12-03 20:41:01.594 | |
| [in] hSession = 0x563c3dd97b10 | |
| [in] ulMaxObjectCount = 0x64 | |
| [out] ulObjectCount = 0x1 | |
| Object 0x563c3dd67c70 matches | |
| Returned: 0 CKR_OK | |
| 25: C_FindObjects | |
| 2018-12-03 20:41:01.594 | |
| [in] hSession = 0x563c3dd97b10 | |
| [in] ulMaxObjectCount = 0x64 | |
| [out] ulObjectCount = 0x0 | |
| Returned: 0 CKR_OK | |
| 26: C_FindObjectsFinal | |
| 2018-12-03 20:41:01.595 | |
| [in] hSession = 0x563c3dd97b10 | |
| Returned: 0 CKR_OK | |
| 27: C_GetAttributeValue | |
| 2018-12-03 20:41:01.595 | |
| [in] hSession = 0x563c3dd97b10 | |
| [in] hObject = 0x563c3dd67c70 | |
| [in] pTemplate[4]: | |
| CKA_SIGN 0000000000000000 / 0 | |
| CKA_SIGN_RECOVER 0000000000000000 / 0 | |
| CKA_DECRYPT 0000000000000000 / 0 | |
| CKA_UNWRAP 0000000000000000 / 0 | |
| [out] pTemplate[4]: | |
| CKA_SIGN 0000000000000000 / 1 | |
| CKA_SIGN_RECOVER 0000000000000000 / 1 | |
| CKA_DECRYPT 0000000000000000 / 1 | |
| CKA_UNWRAP 0000000000000000 / 1 | |
| Returned: 0 CKR_OK | |
| 28: C_GetAttributeValue | |
| 2018-12-03 20:41:01.595 | |
| [in] hSession = 0x563c3dd97b10 | |
| [in] hObject = 0x563c3dd67c70 | |
| [in] pTemplate[4]: | |
| CKA_SIGN 0000563c3dda67e0 / 1 | |
| CKA_SIGN_RECOVER 0000563c3dd97bd0 / 1 | |
| CKA_DECRYPT 0000563c3dda67a0 / 1 | |
| CKA_UNWRAP 0000563c3dda8e50 / 1 | |
| [out] pTemplate[4]: | |
| CKA_SIGN True | |
| CKA_SIGN_RECOVER True | |
| CKA_DECRYPT True | |
| CKA_UNWRAP True | |
| Returned: 0 CKR_OK | |
| 29: C_SignInit | |
| 2018-12-03 20:41:01.595 | |
| [in] hSession = 0x563c3dd97b10 | |
| pMechanism->type=CKM_RSA_PKCS | |
| [in] hKey = 0x563c3dd67c70 | |
| Returned: 0 CKR_OK | |
| 30: C_Sign | |
| 2018-12-03 20:41:01.595 | |
| [in] hSession = 0x563c3dd97b10 | |
| [in] pData[ulDataLen] 0000563c3dda9cd0 / 51 | |
| 00000000 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000010 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000020 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000030 61 61 61 aaa | |
| [out] pSignature[*pulSignatureLen] 0000563c3dd71ee0 / 256 | |
| 00000000 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000010 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000020 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000030 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000040 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000050 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000060 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000070 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000080 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 00000090 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 000000A0 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 000000B0 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 000000C0 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 000000D0 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 000000E0 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| 000000F0 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 aaaaaaaaaaaaaaaa | |
| Returned: 0 CKR_OK | |
| 31: C_Finalize | |
| 2018-12-03 20:41:04.796 | |
| Returned: 0 CKR_OK |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| 0x7f07e7ba4e00 18:37:53.109 [opensc-pkcs11] ctx.c:792:sc_context_create: =================================== | |
| 0x7f07e7ba4e00 18:37:53.109 [opensc-pkcs11] ctx.c:793:sc_context_create: opensc version: 0.17.0 | |
| 0x7f07e7ba4e00 18:37:53.109 [opensc-pkcs11] reader-pcsc.c:815:pcsc_init: PC/SC options: connect_exclusive=0 disconnect_action=1 transaction_end_action=0 reconnect_action=0 enable_pinpad=0 enable_pace=1 | |
| 0x7f07e7ba4e00 18:37:53.109 [opensc-pkcs11] reader-pcsc.c:1283:pcsc_detect_readers: called | |
| 0x7f07e7ba4e00 18:37:53.110 [opensc-pkcs11] reader-pcsc.c:1302:pcsc_detect_readers: Probing PC/SC readers | |
| 0x7f07e7ba4e00 18:37:53.110 [opensc-pkcs11] reader-pcsc.c:1330:pcsc_detect_readers: Establish PC/SC context | |
| 0x7f07e7ba4e00 18:37:53.227 [opensc-pkcs11] reader-pcsc.c:1242:pcsc_add_reader: Adding new PC/SC reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.227 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:53.228 [opensc-pkcs11] reader-pcsc.c:347:refresh_attributes: current state: 0x00000022 | |
| 0x7f07e7ba4e00 18:37:53.228 [opensc-pkcs11] reader-pcsc.c:348:refresh_attributes: previous state: 0x00000000 | |
| 0x7f07e7ba4e00 18:37:53.228 [opensc-pkcs11] reader-pcsc.c:403:refresh_attributes: card present, changed | |
| 0x7f07e7ba4e00 18:37:53.228 [opensc-pkcs11] reader-pcsc.c:1408:pcsc_detect_readers: Yubico Yubikey NEO OTP+U2F+CCID 00 00:SCardConnect(SHARED): 0x00000000 | |
| 0x7f07e7ba4e00 18:37:53.228 [opensc-pkcs11] reader-pcsc.c:1063:detect_reader_features: called | |
| 0x7f07e7ba4e00 18:37:53.228 [opensc-pkcs11] reader-pcsc.c:1065:detect_reader_features: Requesting reader features ... | |
| 0x7f07e7ba4e00 18:37:53.229 [opensc-pkcs11] reader-pcsc.c:1086:detect_reader_features: Reader feature 12 found | |
| 0x7f07e7ba4e00 18:37:53.229 [opensc-pkcs11] reader-pcsc.c:1004:part10_detect_max_data: get dwMaxAPDUDataSize property returned 65536 | |
| 0x7f07e7ba4e00 18:37:53.229 [opensc-pkcs11] reader-pcsc.c:1192:detect_reader_features: Reader supports transceiving 65536 bytes of data | |
| 0x7f07e7ba4e00 18:37:53.229 [opensc-pkcs11] reader-pcsc.c:1197:detect_reader_features: Sending is limited to 255 bytes of data in configuration file | |
| 0x7f07e7ba4e00 18:37:53.229 [opensc-pkcs11] reader-pcsc.c:1043:part10_get_vendor_product: id_vendor=1050 id_product=0116 | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] reader-pcsc.c:1423:pcsc_detect_readers: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] misc.c:509:load_pkcs11_parameters: PKCS#11 options: max_virtual_slots=16 slots_per_card=4 hide_empty_tokens=1 lock_login=0 atomic=0 pin_unblock_style=0 zero_ckaid_for_ca_certs=0 create_slots_flags=0x8 | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x0 | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x1 | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x2 | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] slot.c:120:create_slot: Initializing slot with id 0x3 | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] slot.c:179:initialize_reader: Initialize reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00': detect SC card presence | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] sc.c:275:sc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] reader-pcsc.c:411:pcsc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.230 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] reader-pcsc.c:339:refresh_attributes: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] reader-pcsc.c:416:pcsc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] sc.c:280:sc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] slot.c:181:initialize_reader: Initialize reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00': detect PKCS11 card presence | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] slot.c:235:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] sc.c:275:sc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] reader-pcsc.c:411:pcsc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.231 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] reader-pcsc.c:339:refresh_attributes: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] reader-pcsc.c:416:pcsc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] sc.c:280:sc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] slot.c:272:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: First seen the card | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] slot.c:280:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Connecting ... | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] card.c:200:sc_connect_card: called | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] reader-pcsc.c:533:pcsc_connect: called | |
| 0x7f07e7ba4e00 18:37:53.232 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] reader-pcsc.c:339:refresh_attributes: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] reader-pcsc.c:565:pcsc_connect: Initial protocol: T=1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DD:18:00:81:31:FE:45:80:F9:A0:00:00:00:77:01:00:70:0A:90:00:8B | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:96:00:00:00:31:B9:64:40:70:14:10:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:96:00:00:00:31:B8:64:40:70:14:10:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DF:18:FF:81:91:FE:1F:C3:00:31:B8:64:0C:01:EC:C1:73:94:01:80:82:90:00:B3 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DC:18:FF:81:91:FE:1F:C3:80:73:C8:21:13:66:01:0B:03:52:00:05:38 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FE:18:00:00:81:31:FE:45:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:FA | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8E:80:01:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:18 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6e:00:ff:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fe:94:00:ff:80:b1:fa:45:1f:03:45:73:74:45:49:44:20:76:65:72:20:31:2e:30:43 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:5e:11:ff:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:de:18:ff:c0:80:b1:fe:45:1f:03:45:73:74:45:49:44:20:76:65:72:20:31:2e:30:2b | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6e:00:00:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:ff:94:00:ff:80:b1:fe:45:1f:03:00:68:d2:76:00:00:28:ff:05:1e:31:80:00:90:00:23 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:ff:11:00:ff:80:b1:fe:45:1f:03:00:68:d2:76:00:00:28:ff:05:1e:31:80:00:90:00:a6 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:225:sc_connect_card: matching configured ATRs | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:234:sc_connect_card: trying driver 'authentic' | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DD:18:00:81:31:FE:45:80:F9:A0:00:00:00:77:01:00:70:0A:90:00:8B | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:234:sc_connect_card: trying driver 'iasecc' | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:96:00:00:00:31:B9:64:40:70:14:10:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:96:00:00:00:31:B8:64:40:70:14:10:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DF:18:FF:81:91:FE:1F:C3:00:31:B8:64:0C:01:EC:C1:73:94:01:80:82:90:00:B3 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DC:18:FF:81:91:FE:1F:C3:80:73:C8:21:13:66:01:0B:03:52:00:05:38 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:234:sc_connect_card: trying driver 'sc-hsm' | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.233 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FE:18:00:00:81:31:FE:45:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:FA | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8E:80:01:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:18 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:268:sc_connect_card: matching built-in ATRs | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'npa' | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8A:80:01:80:31:F8:73:F7:41:E0:82:90:00:75 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:88:80:01:00:00:00:00:00:00:00:00:09 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:87:80:01:80:31:B8:73:84:01:E0:19 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:84:80:01:00:00:90:00:95 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:88:80:01:00:E1:F3:5E:13:77:83:00:00 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'cardos' | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:e2:00:ff:c1:10:31:fe:55:c8:02:9c | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:e9:00:ff:c1:10:31:fe:55:00:64:05:00:c8:02:31:80:00:47 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fb:98:00:ff:c1:10:31:fe:55:00:64:05:20:47:03:31:80:00:90:00:f3 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fc:98:00:ff:c1:10:31:fe:55:c8:03:49:6e:66:6f:63:61:6d:65:72:65:28 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:f4:98:00:ff:c1:10:31:fe:55:4d:34:63:76:b4 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:f2:18:00:ff:c1:0a:31:fe:55:c8:06:8a | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:d2:18:02:c1:0a:31:fe:58:c8:0d:51 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:d2:18:00:81:31:fe:58:c9:01:14 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:d2:18:00:81:31:fe:58:c9:03:16 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'flex' | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:95:15:40:20:68:01:02:00:00 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:15:40:FF:68:01:02:02:01 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:15:40:FF:68:01:02:02:04 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:85:40:20:68:01:01:05:01 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:94:40:FF:63:01:01:02:01 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:15:40:FF:63:01:01:02:01 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:64:02:01:01:02 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:62:01:01:00:00 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:62:01:02:01:04 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:62:04:01:01:05 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:95:15:40:ff:68:01:02:45:47 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:E2:00:00:40:20:49:06 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:E2:00:00:40:20:49:05 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:E2:00:00:40:20:49:07 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:85:40:20:68:01:01:03:05 | |
| 0x7f07e7ba4e00 18:37:53.234 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:02:14:50 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:19:14:55:90:01:02:01:00:05:04:B0 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:32:15:00:06:80 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:32:15:00:06:95 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:19:14:59:01:01:0F:01:00:05:08:B0 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:19:14:55:90:01:01:01:00:05:08:B0 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:16:94:81:10:06:01:81:3F | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:16:94:81:10:06:01:81:2F | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'cyberflex' | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:95:15:40:20:68:01:02:00:00 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:15:40:FF:68:01:02:02:01 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:15:40:FF:68:01:02:02:04 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:85:40:20:68:01:01:05:01 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:94:40:FF:63:01:01:02:01 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:15:40:FF:63:01:01:02:01 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:64:02:01:01:02 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:62:01:01:00:00 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:62:01:02:01:04 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:18:40:FF:62:04:01:01:05 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:95:15:40:ff:68:01:02:45:47 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:E2:00:00:40:20:49:06 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:E2:00:00:40:20:49:05 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:E2:00:00:40:20:49:07 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:85:40:20:68:01:01:03:05 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:02:14:50 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:19:14:55:90:01:02:01:00:05:04:B0 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:32:15:00:06:80 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:32:15:00:06:95 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:19:14:59:01:01:0F:01:00:05:08:B0 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:19:14:55:90:01:01:01:00:05:08:B0 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:16:94:81:10:06:01:81:3F | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:16:94:81:10:06:01:81:2F | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'gpk' | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:27:00:80:65:A2:04:01:01:37 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:27:00:80:65:A2:05:01:01:37 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:27:00:80:65:A2:0C:01:01:37 | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.235 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:A7:00:40:14:80:65:A2:14:01:01:37 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:A7:00:40:18:80:65:A2:08:01:01:52 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:A7:00:40:18:80:65:A2:09:01:01:52 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:A7:00:40:18:80:65:A2:09:01:02:52 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:A7:00:40:18:80:65:A2:09:01:03:52 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'gemsafeV1' | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7B:94:00:00:80:65:B0:83:01:01:74:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:6B:00:00:80:65:B0:83:01:01:74:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6d:00:00:80:31:80:65:b0:83:01:02:90:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:6B:00:00:80:65:B0:83:01:03:74:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7A:94:00:00:80:65:A2:01:01:01:3D:72:D6:43 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:94:00:00:80:31:80:65:B0:83:01:01:90:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:96:00:00:80:31:80:65:B0:83:11:48:C8:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:95:00:00:80:31:80:65:B0:83:11:C0:A9:83:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:95:00:00:80:31:80:65:B0:83:11:C0:A9:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:95:00:00:80:31:80:65:B0:83:11:00:C8:83:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:95:00:00:80:31:80:65:B0:83:11:00:C8:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:96:00:00:80:31:80:65:B0:83:11:00:C8:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:7d:96:00:00:80:31:80:65:b0:83:02:01:f3:83:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'miocos' | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:9D:94:40:23:00:68:10:11:4D:69:6F:43:4F:53:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:9D:94:40:23:00:68:20:01:4D:69:6F:43:4F:53:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'asepcos' | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:d6:18:00:81:b1:80:7d:1f:03:80:51:00:61:10:30:8f | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:d6:18:00:81:b1:fe:7d:1f:03:41:53:45:37:35:35:01 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'starcos' | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:B7:94:00:c0:24:31:fe:65:53:50:4b:32:33:90:00:b4 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:B7:94:00:81:31:fe:65:53:50:4b:32:33:90:00:d1 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:b7:18:00:c0:3e:31:fe:65:53:50:4b:32:34:90:00:25 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:d8:18:ff:81:b1:fe:45:1f:03:80:64:04:1a:b4:03:81:05:61 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'tcos' | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:BA:13:00:81:31:86:5D:00:64:05:0A:02:01:31:80:90:00:8B | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:BA:14:00:81:31:86:5D:00:64:05:14:02:02:31:80:90:00:91 | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.236 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:BA:96:00:81:31:86:5D:00:64:05:60:02:03:31:80:90:00:66 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:BA:96:00:81:31:86:5D:00:64:05:7B:02:03:31:80:90:00:7D | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:BF:96:00:81:31:FE:5D:00:64:04:11:03:01:31:C0:73:F7:01:D0:00:90:00:7D | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:BF:B6:00:81:31:FE:5D:00:64:04:28:03:02:31:C0:73:F7:01:D0:00:90:00:67 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'jcop' | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:E6:00:FF:81:31:FE:45:4A:43:4F:50:33:31:06 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'oberthur' | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:18:00:00:00:31:80:71:8E:64:77:E3:01:00:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:18:00:00:00:31:80:71:8E:64:77:E3:02:00:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:11:00:00:00:31:80:71:8E:64:77:E3:01:00:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:11:00:00:00:31:80:71:8E:64:77:E3:02:00:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7B:18:00:00:00:31:C0:64:77:E3:03:00:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FB:11:00:00:81:31:FE:45:00:31:C0:64:77:E9:10:00:00:90:00:6A | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'authentic' | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card-authentic.c:416:authentic_match_card: try to match card with ATR 3BFC1300008131FE15597562696B6579 4E454F7233E1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DD:18:00:81:31:FE:45:80:F9:A0:00:00:00:77:01:00:70:0A:90:00:8B | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card-authentic.c:419:authentic_match_card: card not matched | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'iasecc' | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card-iasecc.c:345:iasecc_match_card: iasecc_match_card(3BFC1300008131FE15597562696B6579 4E454F7233E1) called | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:96:00:00:00:31:B8:64:40:70:14:10:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DD:18:00:81:31:FE:45:80:F9:A0:00:00:00:77:01:08:00:07:90:00:FE | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7D:13:00:00:4D:44:57:2D:49:41:53:2D:43:41:52:44:32 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:18:00:00:00:31:B8:64:50:23:EC:C1:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DF:96:00:80:31:FE:45:00:31:B8:64:04:1F:EC:C1:73:94:01:80:82:90:00:EC | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DF:18:FF:81:91:FE:1F:C3:00:31:B8:64:0C:01:EC:C1:73:94:01:80:82:90:00:B3 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DC:18:FF:81:91:FE:1F:C3:80:73:C8:21:13:66:02:04:03:55:00:02:34 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DC:18:FF:81:91:FE:1F:C3:80:73:C8:21:13:66:01:0B:03:52:00:05:38 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card-iasecc.c:348:iasecc_match_card: card not matched | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'belpic' | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:98:13:40:0A:A5:03:01:01:01:AD:13:11 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:98:94:40:0A:A5:03:01:01:01:AD:13:10 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:98:94:40:FF:A5:03:01:01:01:AD:13:10 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'incrypto34' | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:ff:18:00:ff:81:31:fe:55:00:6b:02:09:02:00:01:01:01:44:53:44:10:31:80:92 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'acos5' | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:be:96:00:00:41:05:20:00:00:00:00:00:00:00:00:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:be:18:00:00:41:05:10:00:00:00:00:00:00:00:00:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.237 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'akis' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:ba:11:00:81:31:fe:4d:55:45:4b:41:45:20:56:31:2e:30:ae | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'entersafe' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card-entersafe.c:138:entersafe_match_card: called | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:0f:00:65:46:53:05:19:05:71:df:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:9f:95:81:31:fe:9f:00:65:46:53:05:30:06:71:df:00:00:00:80:6a:82:5e | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fc:18:00:00:81:31:80:45:90:67:46:4a:00:64:18:14:00:00:00:00:02 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1075:match_atr_table: ATR mask: ff:00:00:00:00:00:00:00:00:ff:ff:ff:ff:00:00:00:00:ff:ff:ff:ff:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:7c:18:00:00:90:67:46:4a:20:28:8c:58:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FC:18:00:00:81:31:80:45:90:67:46:4A:21:28:8C:58:00:00:00:00:B7 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1075:match_atr_table: ATR mask: ff:00:00:00:00:00:00:00:00:ff:ff:ff:ff:00:00:00:00:ff:ff:ff:ff:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FC:18:00:00:81:31:80:45:90:67:46:4A:20:25:c3:30:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FC:18:00:00:81:31:80:45:90:67:46:4A:00:6A:04:24:00:00:00:00:20 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1075:match_atr_table: ATR mask: ff:00:00:00:00:00:00:00:00:ff:ff:ff:ff:00:00:00:00:ff:ff:ff:ff:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FC:18:00:00:81:31:80:45:90:67:46:4A:00:68:08:04:00:00:00:00:0E | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1075:match_atr_table: ATR mask: ff:00:00:00:00:00:00:00:00:ff:ff:ff:ff:00:00:00:00:ff:ff:ff:ff:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FC:18:00:00:81:31:80:45:90:67:46:4A:10:27:61:30:00:00:00:00:0C | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1075:match_atr_table: ATR mask: ff:00:00:00:00:00:00:00:00:ff:ff:ff:ff:00:00:00:00:ff:ff:ff:ff:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fc:18:00:00:81:31:80:45:90:67:46:4a:00:68:08:06:00:00:00:00:0c | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1075:match_atr_table: ATR mask: FF:FF:FF:FF:FF:FF:FF:FF:FF:FF:FF:FF:00:FF:FF:FF:FF:FF:FF:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'epass2003' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card-epass2003.c:1130:epass2003_match_card: called | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:9F:95:81:31:FE:9F:00:66:46:53:05:10:00:11:71:df:00:00:00:6a:82:5e | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'rutoken' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card-rutoken.c:103:rutoken_match_card: called | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6f:00:ff:00:56:72:75:54:6f:6b:6e:73:30:20:00:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6f:00:ff:00:56:75:61:54:6f:6b:6e:73:30:20:00:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card-rutoken.c:109:rutoken_match_card: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'rutoken_ecp' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8B:01:52:75:74:6F:6B:65:6E:20:45:43:50:A0 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8B:01:52:75:74:6F:6B:65:6E:20:44:53:20:C1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card-rtecp.c:62:rtecp_match_card: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'westcos' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3F:69:00:00:00:64:01:00:00:00:80:90:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:95:94:80:1F:C3:80:73:C8:21:13:54 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'myeid' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'sc-hsm' | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FE:18:00:00:81:31:FE:45:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:FA | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8E:80:01:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:18 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:80:80:01:01 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:84:80:01:47:6f:49:44:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:85:80:01:47:6f:49:44:00:00 | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.238 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:86:80:01:47:6f:49:44:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:87:80:01:47:6f:49:44:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:88:80:01:47:6f:49:44:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:89:80:01:47:6f:49:44:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8a:80:01:47:6f:49:44:00:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8b:80:01:47:6f:49:44:00:00:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8c:80:01:47:6f:49:44:00:00:00:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8d:80:01:47:6f:49:44:00:00:00:00:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8e:80:01:47:6f:49:44:00:00:00:00:00:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8f:80:01:47:6f:49:44:00:00:00:00:00:00:00:00:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(11) 0x7ffd0ab165b0 | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (17 bytes): | |
| 00 A4 04 00 0B E8 2B 06 01 04 01 81 C3 1F 02 01 ......+......... | |
| 00 . | |
| 0x7f07e7ba4e00 18:37:53.239 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.251 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.252 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.252 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.252 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.252 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] iso7816.c:124:iso7816_check_sw: File not found | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] iso7816.c:562:iso7816_select_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card-sc-hsm.c:177:sc_hsm_select_file_ex: Could not select SmartCard-HSM application: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card-sc-hsm.c:239:sc_hsm_match_card: Could not select SmartCard-HSM application: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'dnie' | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card-dnie.c:740:dnie_match_card: called | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:00:00:00:00:6A:44:4E:49:65:00:00:00:00:00:00:03:90:00 | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.262 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:00:00:00:00:6A:44:4E:49:65:00:00:00:00:00:00:0F:65:81 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card-dnie.c:743:dnie_match_card: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'MaskTech' | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:89:80:01:4D:54:43:4F:53:70:02:00:04:31 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:88:80:01:00:00:00:00:77:81:80:00:6E | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:9D:13:81:31:60:35:80:31:C0:69:4D:54:43:4F:53:73:02:00:00:40 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'mcrd' | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FF:94:00:FF:80:B1:FE:45:1F:03:00:68:D2:76:00:00:28:FF:05:1E:31:80:00:90:00:23 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6f:00:ff:00:68:d2:76:00:00:28:ff:05:1e:31:80:00:90:00 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:ff:11:00:ff:80:b1:fe:45:1f:03:00:68:d2:76:00:00:28:ff:05:1e:31:80:00:90:00:a6 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FE:94:00:FF:80:B1:FA:45:1F:03:45:73:74:45:49:44:20 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fe:94:00:ff:80:b1:fa:45:1f:03:45:73:74:45:49:44:20:76:65:72:20:31:2e:30:43 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6e:00:ff:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:de:18:ff:c0:80:b1:fe:45:1f:03:45:73:74:45:49:44:20:76:65:72:20:31:2e:30:2b | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:5e:11:ff:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6e:00:00:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FE:18:00:00:80:31:FE:45:45:73:74:45:49:44:20:76:65:72:20:31:2E:30:A8 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FE:18:00:00:80:31:FE:45:80:31:80:66:40:90:A4:56:1B:16:83:01:90:00:86 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fe:18:00:00:80:31:fe:45:80:31:80:66:40:90:a4:16:2a:00:83:01:90:00:e1 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fe:18:00:00:80:31:fe:45:80:31:80:66:40:90:a4:16:2a:00:83:0f:90:00:ef | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fa:18:00:00:80:31:fe:45:fe:65:49:44:20:2f:20:50:4b:49:03 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:f8:18:00:00:80:31:fe:45:fe:41:5a:45:20:44:49:54:33 | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.263 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.264 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.264 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.264 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(15) 0x7f07e7963de0 | |
| 0x7f07e7ba4e00 18:37:53.264 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.264 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (20 bytes): | |
| 00 A4 04 00 0F D2 33 00 00 00 45 73 74 45 49 44 ......3...EstEID | |
| 20 76 33 35 v35 | |
| 0x7f07e7ba4e00 18:37:53.264 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.273 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.273 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.273 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.273 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.273 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card-mcrd.c:296:mcrd_match_card: SELECT AID: 6A82 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'setcos' | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:1F:11:00:67:80:42:46:49:53:45:10:52:66:FF:81:90:00 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:9F:94:40:1E:00:67:16:43:46:49:53:45:10:52:66:FF:81:90:00 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:9f:94:40:1e:00:67:00:43:46:49:53:45:10:52:66:ff:81:90:00 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6b:00:ff:80:62:00:a2:56:46:69:6e:45:49:44 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:64:00:ff:80:62:00:a2 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:7b:00:00:00:80:62:00:51:56:46:69:6e:45:49:44 | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.277 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:64:00:00:80:62:00:51 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6e:00:00:00:62:00:00:57:41:56:41:4e:54:10:81:90:00 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:7b:94:00:00:80:62:11:51:56:46:69:6e:45:49:44 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:7b:94:00:00:80:62:12:51:56:46:69:6e:45:49:44 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:7b:18:00:00:80:62:01:54:56:46:69:6e:45:49:44 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:9f:94:80:1f:c3:00:68:10:44:05:01:46:49:53:45:31:c8:07:90:00:18 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:9f:94:80:1f:c3:00:68:11:44:05:01:46:49:53:45:31:c8:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:1075:match_atr_table: ATR mask: ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:ff:00:00:00:00 | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CA, P1:DF, P2:30, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 CA DF 30 05 ...0. | |
| 0x7f07e7ba4e00 18:37:53.278 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.286 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 67 00 g. | |
| 0x7f07e7ba4e00 18:37:53.286 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.287 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.287 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.287 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.289 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'muscle' | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(6) 0x7f07e7965950 | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 A4 04 00 06 A0 00 00 00 01 01 ........... | |
| 0x7f07e7ba4e00 18:37:53.290 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.299 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.300 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.300 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.300 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.300 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] muscle.c:276:msc_select_applet: returning with: -1200 (Card command failed) | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'atrust-acos' | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] card.c:273:sc_connect_card: trying driver 'PIV-II' | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] card-piv.c:2919:piv_match_card: called | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] card-piv.c:761:piv_find_aid: called | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] card-piv.c:723:piv_select_aid: called | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] card-piv.c:726:piv_select_aid: Got args: aid=0x7f07e76fac60, aidlen=9, response=0x7ffd0ab165a0, responselen=261 | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.302 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(9) 0x7f07e76fac60 | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (15 bytes): | |
| 00 A4 04 00 09 A0 00 00 03 08 00 00 10 00 00 ............... | |
| 0x7f07e7ba4e00 18:37:53.303 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.312 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (21 bytes): | |
| 61 11 4F 06 00 00 10 00 01 00 79 07 4F 05 A0 00 a.O.......y.O... | |
| 00 03 08 90 00 ..... | |
| 0x7f07e7ba4e00 18:37:53.313 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.313 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.313 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.313 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card-piv.c:742:piv_select_aid: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card-piv.c:773:piv_find_aid: found PIX | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card-piv.c:787:piv_find_aid: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card.c:287:sc_connect_card: matched: PIV-II for multiple cards | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card-piv.c:3021:piv_init: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card-piv.c:3030:piv_init: Max send = 0 recv = 0 card->type = 14003 | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:FD, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 FD 00 00 03 ..... | |
| 0x7f07e7ba4e00 18:37:53.321 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.328 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (5 bytes): | |
| 01 00 04 90 00 ..... | |
| 0x7f07e7ba4e00 18:37:53.329 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.329 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.329 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.329 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.338 [opensc-pkcs11] card-piv.c:3051:piv_init: NEO card->type=14003, r=0x00000000 version=0x00010004 | |
| 0x7f07e7ba4e00 18:37:53.338 [opensc-pkcs11] card-piv.c:3095:piv_init: PIV card-type=14003 card_issues=0x00020313 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:2688:piv_process_history: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #11 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:1020:piv_get_cached_data: get #11 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:913:piv_get_data: #11 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:932:piv_get_data: get len of #11 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 0 0 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab155f0 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab155e8 | |
| 0x7f07e7ba4e00 18:37:53.339 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.340 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0C 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.340 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] iso7816.c:124:iso7816_check_sw: File not found | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] card-piv.c:548:piv_general_io: Card returned error | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.347 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:2874:piv_process_history: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #10 | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:1020:piv_get_cached_data: get #10 | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:913:piv_get_data: #10 | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:932:piv_get_data: get len of #10 | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 3 : 0 0 | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab16710 | |
| 0x7f07e7ba4e00 18:37:53.353 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffd0ab16708 | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 08 ..?..\.~. | |
| 0x7f07e7ba4e00 18:37:53.354 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.363 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| 0x7f07e7ba4e00 18:37:53.363 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.364 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.364 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.364 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=8 sw1=90 sw2=00 | |
| 0x7f07e7ba4e00 18:37:53.364 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.364 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.368 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| 0x7f07e7ba4e00 18:37:53.368 [opensc-pkcs11] card-piv.c:954:piv_get_data: buffer for #10 *buf=0x(nil) len=20 | |
| 0x7f07e7ba4e00 18:37:53.368 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.368 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 3 : 0 0 | |
| 0x7f07e7ba4e00 18:37:53.368 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.368 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=1 le=20, resplen=20, resp=0x5585c146f200 | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(3) 0x7ffd0ab16708 | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (9 bytes): | |
| 00 CB 3F FF 03 5C 01 7E 14 ..?..\.~. | |
| 0x7f07e7ba4e00 18:37:53.369 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.379 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (22 bytes): | |
| 7E 12 4F 0B A0 00 00 03 08 00 00 10 00 01 00 5F ~.O............_ | |
| 2F 02 40 00 90 00 /.@... | |
| 0x7f07e7ba4e00 18:37:53.379 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.379 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.379 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.379 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=20 sw1=90 sw2=00 | |
| 0x7f07e7ba4e00 18:37:53.379 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.379 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 20 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: 20 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:1036:piv_get_cached_data: added #10 0x5585c146f200:20 (nil):0 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: 20 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:2607:piv_process_discovery: Discovery = 0x5585c146f200:20 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:2619:piv_process_discovery: Discovery 0x60 0x1e 0x5585c146f202:18 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:2624:piv_process_discovery: Discovery aid=0x5585c146f204:11 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:2634:piv_process_discovery: Discovery pinp=0x5585c146f212:2 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:2636:piv_process_discovery: Discovery pinp flags=0x40 0x00 | |
| 0x7f07e7ba4e00 18:37:53.383 [opensc-pkcs11] card-piv.c:2647:piv_process_discovery: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card-piv.c:3131:piv_init: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:317:sc_connect_card: card info name:'PIV-II card', type:14003, flags:0x0, max_send/recv_size:255/256 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1414:sc_card_sm_check: called | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1415:sc_card_sm_check: card->sm_ctx.ops.open (nil) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1420:sc_card_sm_check: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:329:sc_connect_card: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] slot.c:299:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Connected SC card 0x5585c147ec40 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] dir.c:163:sc_enum_apps: called | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:748:sc_select_file: called; type=2, path=3f002f00 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card-piv.c:2504:piv_select_file: called | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x2F00 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card-piv.c:411:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card-piv.c:2528:piv_select_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:770:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] dir.c:171:sc_enum_apps: Cannot select EF.DIR file: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] slot.c:306:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting Framework. 0 on-card applications | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] slot.c:307:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: generic application <none> | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] slot.c:319:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detected framework 0. Creating tokens. | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DD:18:00:81:31:FE:45:80:F9:A0:00:00:00:77:01:00:70:0A:90:00:8B | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:96:00:00:00:31:B9:64:40:70:14:10:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:7F:96:00:00:00:31:B8:64:40:70:14:10:73:94:01:80:82:90:00 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DF:18:FF:81:91:FE:1F:C3:00:31:B8:64:0C:01:EC:C1:73:94:01:80:82:90:00:B3 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:DC:18:FF:81:91:FE:1F:C3:80:73:C8:21:13:66:01:0B:03:52:00:05:38 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:FE:18:00:00:81:31:FE:45:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:FA | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3B:8E:80:01:80:31:81:54:48:53:4D:31:73:80:21:40:81:07:18 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1057:match_atr_table: ATR : 3b:fc:13:00:00:81:31:fe:15:59:75:62:69:6b:65:79:4e:45:4f:72:33:e1 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6e:00:ff:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:fe:94:00:ff:80:b1:fa:45:1f:03:45:73:74:45:49:44:20:76:65:72:20:31:2e:30:43 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:5e:11:ff:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:de:18:ff:c0:80:b1:fe:45:1f:03:45:73:74:45:49:44:20:76:65:72:20:31:2e:30:2b | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:6e:00:00:45:73:74:45:49:44:20:76:65:72:20:31:2e:30 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:ff:94:00:ff:80:b1:fe:45:1f:03:00:68:d2:76:00:00:28:ff:05:1e:31:80:00:90:00:23 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1068:match_atr_table: ATR try : 3b:ff:11:00:ff:80:b1:fe:45:1f:03:00:68:d2:76:00:00:28:ff:05:1e:31:80:00:90:00:a6 | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] card.c:1071:match_atr_table: ignored - wrong length | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] slot.c:329:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Try to bind 'generic' token. | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] framework-pkcs15.c:303:pkcs15_bind: Bind PKCS#15 '<anonymous>' application | |
| 0x7f07e7ba4e00 18:37:53.384 [opensc-pkcs11] pkcs15.c:1192:sc_pkcs15_bind: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:1193:sc_pkcs15_bind: application(aid:'empty') | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:1219:sc_pkcs15_bind: PKCS#15 options: use_file_cache=0 use_pin_cache=1 pin_cache_counter=10 pin_cache_ignore_user_consent=0 | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:1230:sc_pkcs15_bind: PKCS#15 emulation enabled | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:968:sc_pkcs15_bind_internal: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:1004:sc_pkcs15_bind_internal: application path '3f005015' | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card.c:748:sc_select_file: called; type=2, path=3f005015 | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:2504:piv_select_file: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x5015 | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:411:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:2528:piv_select_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card.c:770:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:1030:sc_pkcs15_bind_internal: absolute path to EF(ODF) 3f005031 | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card.c:748:sc_select_file: called; type=2, path=3f005031 | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:2504:piv_select_file: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x5031 | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:411:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card-piv.c:2528:piv_select_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] card.c:770:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:1041:sc_pkcs15_bind_internal: EF(ODF) not found in '3f005031' | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15.c:1176:sc_pkcs15_bind_internal: returning with: -1413 (Unsupported card) | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15-syn.c:106:sc_pkcs15_bind_synthetic: called | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15-syn.c:147:sc_pkcs15_bind_synthetic: no emulator list in config file, trying all builtin emulators | |
| 0x7f07e7ba4e00 18:37:53.385 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying westcos | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-westcos.c:253:sc_pkcs15emu_westcos_init_ex: sc_pkcs15_init_func_ex westcos | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-westcos.c:239:westcos_detect_card: westcos_detect_card (PIV-II card) | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying openpgp | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying infocamere | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying starcert | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying tcos | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying esteid | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying itacns | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-itacns.c:863:sc_pkcs15emu_itacns_init_ex: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying postecert | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-syn.c:149:sc_pkcs15_bind_synthetic: trying PIV-II | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-piv.c:1183:sc_pkcs15emu_piv_init_ex: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-piv.c:238:piv_detect_card: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] pkcs15-piv.c:618:sc_pkcs15emu_piv_init: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card.c:920:sc_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=5 ptr=0x7ffd0ab15340 | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card-piv.c:2078:piv_get_serial_nr_from_CHUI: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card-piv.c:723:piv_select_aid: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card-piv.c:726:piv_select_aid: Got args: aid=0x7f07e76fac60, aidlen=9, response=0x7ffd0ab14a00, responselen=2000 | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:A4, P1:4, P2:0, data(9) 0x7f07e76fac60 | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (15 bytes): | |
| 00 A4 04 00 09 A0 00 00 03 08 00 00 10 00 00 ............... | |
| 0x7f07e7ba4e00 18:37:53.386 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (21 bytes): | |
| 61 11 4F 06 00 00 10 00 01 00 79 07 4F 05 A0 00 a.O.......y.O... | |
| 00 03 08 90 00 ..... | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:742:piv_select_aid: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #1 | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:1020:piv_get_cached_data: get #1 | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:913:piv_get_data: #1 | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:932:piv_get_data: get len of #1 | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.396 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab14900 | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab148f8 | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 02 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.397 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.410 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (63 bytes): | |
| 53 3B 30 19 D4 E7 39 DA 73 9C ED 39 CE 73 9D 83 S;0...9.s..9.s.. | |
| 68 58 21 08 42 10 84 21 38 42 10 C3 F5 34 10 8C hX!.B..!8B...4.. | |
| 38 0F CE 70 91 41 FE 54 8B DE 42 E2 29 03 B0 35 8..p.A.T..B.)..5 | |
| 08 32 30 33 30 30 31 30 31 3E 00 FE 00 90 00 .20300101>..... | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=8 sw1=90 sw2=00 | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 61 | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card-piv.c:954:piv_get_data: buffer for #1 *buf=0x(nil) len=61 | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=1 le=61, resplen=61, resp=0x5585c1480b30 | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab148f8 | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 02 3D ..?..\._..= | |
| 0x7f07e7ba4e00 18:37:53.411 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (63 bytes): | |
| 53 3B 30 19 D4 E7 39 DA 73 9C ED 39 CE 73 9D 83 S;0...9.s..9.s.. | |
| 68 58 21 08 42 10 84 21 38 42 10 C3 F5 34 10 8C hX!.B..!8B...4.. | |
| 38 0F CE 70 91 41 FE 54 8B DE 42 E2 29 03 B0 35 8..p.A.T..B.)..5 | |
| 08 32 30 33 30 30 31 30 31 3E 00 FE 00 90 00 .20300101>..... | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=61 sw1=90 sw2=00 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 61 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: 61 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:1036:piv_get_cached_data: added #1 0x5585c1480b30:61 (nil):0 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: 61 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2112:piv_get_serial_nr_from_CHUI: fascn=0x5585c1480b34,fascnlen=25,guid=0x5585c1480b4f,guidlen=16,gbits=ff | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2133:piv_get_serial_nr_from_CHUI: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card.c:930:sc_card_ctl: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] pkcs15-piv.c:648:sc_pkcs15emu_piv_init: PIV-II adding objects... | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0xDB00 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x3000 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.425 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x3010 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:411:piv_find_obj_by_containerid: returning with: -1 (Unknown error) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0101 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 2 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x6010 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 3 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x3001 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 4 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x6030 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 5 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0100 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 6 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0102 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 7 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0500 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 8 | |
| 0x7f07e7ba4e00 18:37:53.426 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x9000 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 9 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x6050 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 10 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x6060 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 11 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1015 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 32 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1001 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 12 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1002 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 13 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1003 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 14 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1004 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 15 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1005 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 16 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1006 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 17 | |
| 0x7f07e7ba4e00 18:37:53.427 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1007 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 18 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1008 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 19 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1009 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 20 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100A | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 21 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100B | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 22 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100C | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 23 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100D | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 24 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100E | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 25 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100F | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 26 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1010 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 27 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.428 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1011 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 28 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1012 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 29 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1013 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 30 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab15888 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1014 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 31 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] pkcs15-piv.c:708:sc_pkcs15emu_piv_init: PIV-II adding certs... | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0101 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 2 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] pkcs15.c:2306:sc_pkcs15_read_file: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] pkcs15.c:2307:sc_pkcs15_read_file: path=0101cece, index=0, count=-1 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card.c:748:sc_select_file: called; type=2, path=0101cece | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:2504:piv_select_file: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0101 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 2 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #2 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:1020:piv_get_cached_data: get #2 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:913:piv_get_data: #2 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:932:piv_get_data: get len of #2 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab15050 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab15048 | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.429 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 05 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.430 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] iso7816.c:124:iso7816_check_sw: File not found | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:548:piv_general_io: Card returned error | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:2548:piv_select_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card.c:770:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] pkcs15.c:2407:sc_pkcs15_read_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] pkcs15-piv.c:746:sc_pkcs15emu_piv_init: No cert found,i=0 | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0100 | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 6 | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] pkcs15.c:2306:sc_pkcs15_read_file: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] pkcs15.c:2307:sc_pkcs15_read_file: path=0100cece, index=0, count=-1 | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card.c:748:sc_select_file: called; type=2, path=0100cece | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:2504:piv_select_file: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0100 | |
| 0x7f07e7ba4e00 18:37:53.437 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 6 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #6 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:1020:piv_get_cached_data: get #6 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:913:piv_get_data: #6 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:932:piv_get_data: get len of #6 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab15050 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab15048 | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0A 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.438 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.469 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 05 28 70 82 05 1F 30 82 05 1B 30 82 03 03 S..(p...0...0... | |
| A0 03 02 01 02 02 01 51 30 0D 06 09 2A 86 48 86 .......Q0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 02 55 54 31 1A 30 18 06 03 55 04 0A 0C 11 61 61 .CA1.0...U....as | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 sadfsadfasdfsdf1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 usern@company_n. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 com0...122121222 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..2211212124 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 00Z0P1.0...U.... | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 US1.0...U....CA1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdfsr | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfsas1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....asdfsadfsa | |
| 61 61 61 61 61 61 61 61 22 30 0D 06 09 61 FD asdfa0.."0...a. | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=8 sw1=61 sw2=fd | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1324 | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card-piv.c:954:piv_get_data: buffer for #6 *buf=0x(nil) len=1324 | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=1 le=256, resplen=1324, resp=0x5585c148bd70 | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab15048 | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0A 00 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.470 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 05 28 70 82 05 1F 30 82 05 1B 30 82 03 03 S..(p...0...0... | |
| A0 03 02 01 02 02 01 51 30 0D 06 09 2A 86 48 86 .......Q0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 02 55 54 31 1A 30 18 06 03 55 04 0A 0C 11 61 61 .CA1.0...U....as | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 sadfsadfasdfsdf1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 usern@company_n. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 com0...122121222 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..2211212124 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 00Z0P1.0...U.... | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 US1.0...U....CA1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdfsr | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfsas1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....asdfsadfsa | |
| 61 61 61 61 61 61 61 61 22 30 0D 06 09 61 FD asdfa0.."0...a. | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] apdu.c:434:sc_get_response: called | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.501 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.502 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.502 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.502 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.502 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 2A 86 48 86 F7 0D 01 01 01 05 00 03 82 01 0F 00 *.H............. | |
| 30 82 01 0A 02 82 01 01 00 90 B7 F4 83 61 61 5F 0............aa_ | |
| CB 5E 50 19 4F FA 1D B0 DA 65 B8 42 E3 B9 82 02 .^P.O....e.B.... | |
| 59 29 4D 76 91 45 65 DD FA C2 42 36 81 B5 A4 DE Y)Mv.Ee...B6.... | |
| FD EC 05 58 E7 E9 4D BE 69 F2 8F E1 15 79 DC 3B ...X..M.i....y.; | |
| E6 1D B7 ED AC A9 A5 AF D0 B9 4D C2 4C 40 40 70 ..........M.L@@p | |
| BB 75 29 7E C4 39 AB AA BC D3 98 D8 60 6C 83 CF .u)~.9......`l.. | |
| E7 D1 2B ED 5A 1F 33 91 3D DA 26 47 86 B3 6F 22 ..+.Z.3.=.&G..o" | |
| 27 87 DC E0 7C DB EF 74 0A A9 BE D9 14 E7 CE 4F '...|..t.......O | |
| C3 6B EC B8 6F EE F6 74 C5 83 C7 61 F3 64 96 0B .k..o..t...a.d.. | |
| 10 F0 FA EF 93 B1 87 97 2D B9 0C 17 9F DA EF AD ........-....... | |
| 51 B0 6E 08 00 64 47 32 66 76 DD 5B 28 C1 E5 51 Q.n..dG2fv.[(..Q | |
| 0B 82 57 40 FE 78 C1 AA 89 A1 65 9B 28 5C EE 51 ..W@.x....e.(\.Q | |
| 69 1A 84 CF 0F D8 05 24 A5 9F 50 D6 B3 39 1F D2 i......$..P..9.. | |
| 10 CD D2 9A 20 A8 0A 9F 5A 51 85 47 9F FF 1A 00 .... ...ZQ.G.... | |
| 15 33 7F 4B 63 21 02 5A 86 56 09 50 26 61 FD .3.Kc!.Z.V.P&a. | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.530 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 50 7F 71 77 C7 4F 9D 08 B3 31 08 25 96 0F 7F 49 P.qw.O...1.%...I | |
| B8 B3 6F 93 79 E0 21 AC 8C 01 7D 99 02 03 01 00 ..o.y.!...}..... | |
| 01 A3 81 F5 30 81 F2 30 09 06 03 55 1D 13 04 02 ....0..0...U.... | |
| 30 00 30 11 06 09 60 86 48 01 86 F8 42 01 01 04 0.0...`.H...B... | |
| 04 03 02 05 A0 30 33 06 09 60 86 48 01 86 F8 42 .....03..`.H...B | |
| 01 0D 04 26 16 24 4F 70 65 6E 53 53 4C 20 47 65 ...&.$OpenSSL Ge | |
| 6E 65 72 61 74 65 64 20 43 6C 69 65 6E 74 20 43 nerated Client C | |
| 65 72 74 69 66 69 63 61 74 65 30 1D 06 03 55 1D ertificate0...U. | |
| 0E 04 16 04 14 AD 41 CD 8A 71 8E 8B D7 F8 7A F7 ......A..q....z. | |
| 45 4D E5 47 55 AB AC AB 54 30 1F 06 03 55 1D 23 EM.GU...T0...U.# | |
| 04 18 30 16 80 14 AF F5 8E B7 63 53 AC A9 F3 49 ..0.......cS...I | |
| BF 09 D6 58 79 D3 97 85 11 7F 30 0E 06 03 55 1D ...Xy.....0...U. | |
| 0F 01 01 FF 04 04 03 02 06 C0 30 29 06 03 55 1D ..........0)..U. | |
| 25 04 22 30 20 06 08 2B 06 01 05 05 07 03 02 06 %."0 ..+........ | |
| 08 2B 06 01 05 05 07 03 04 06 0A 2B 06 01 04 01 .+.........+.... | |
| 82 37 14 02 02 30 22 06 03 55 1D 11 04 61 FD .7...0"..U...a. | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.559 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.560 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.560 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.560 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.560 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.560 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 1B 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...asdasdffdsd | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 06 09 asdfsdfasdfds... | |
| 2A 86 48 86 F7 0D 01 01 0D 05 00 03 82 02 01 00 *.H............. | |
| C1 5E 49 BE D7 BF 36 70 78 1D DB 5A 79 48 E2 0F .^I...6px..ZyH.. | |
| E5 9C 9D CE B8 7F B8 4B AD F2 CB 80 57 08 39 5E .......K....W.9^ | |
| 85 ED 2B CE 65 55 C3 15 3F FF 62 88 63 2C 4C 24 ..+.eU..?.b.c,L$ | |
| FA EA B2 EE 4D 4F 38 19 0D 03 EF DA 03 85 D0 95 ....MO8......... | |
| A5 52 81 FA A6 38 0E B4 85 4F 27 52 AC 4C 29 58 .R...8...O'R.L)X | |
| FB 39 62 D8 30 4B 65 1C 95 07 A1 C4 E4 E4 CA 5A .9b.0Ke........Z | |
| C8 D3 01 6C 60 A4 16 AF 0E 2A 05 F7 28 4E 9B 33 ...l`....*..(N.3 | |
| F3 70 3B 7A 1E 64 A1 99 12 5A 7B C3 25 CC E2 EF .p;z.d...Z{.%... | |
| 34 52 41 C5 F1 B2 7A D5 67 BA 9C 19 1C CA 4C 68 4RA...z.g.....Lh | |
| C7 9E D3 5A D6 9D 1E CE CF 3D 00 C0 8F 52 61 2C ...Z.....=...Ra, | |
| 2B 6E 36 FF C6 39 70 FB 5B FE 3F 9D 93 F1 85 D2 +n6..9p.[.?..... | |
| 90 80 D7 E0 E5 70 1A 52 49 3C 86 7D 67 53 94 AD .....p.RI<.}gS.. | |
| 11 7E EA CF 95 3A 8F 7D 40 5B AD AC 8C 61 FD .~...:.}@[...a. | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.589 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| D2 2E 2B 20 E8 6F 30 B6 79 60 AA 60 96 A2 1D 58 ..+ .o0.y`.`...X | |
| 2E 83 B8 2F 9C E0 08 BB E5 BE D9 E2 06 4F 83 B5 .../.........O.. | |
| 01 43 A5 9F 85 91 54 61 B5 97 AE CD 57 BB E6 C7 .C....Ta....W... | |
| 0D 4B CE 22 29 C2 9C 33 01 CE 78 F7 E3 88 93 C0 .K.")..3..x..... | |
| A1 AC 8E 2F 4C 49 02 30 E6 98 F1 EB DE 7E AB 10 .../LI.0.....~.. | |
| C2 C7 C4 06 D5 46 3B 89 66 AE AA 05 AD EF 23 5B .....F;.f.....#[ | |
| 6B 03 03 8A 87 D1 8B E6 D6 A8 EE 08 A0 6E E1 55 k............n.U | |
| 0F EA DD 86 75 31 46 AE 03 FC E3 86 91 3C E7 C6 ....u1F......<.. | |
| C7 6D 60 21 2B 29 BE 13 C4 42 84 61 AD 2C 2C 76 .m`!+)...B.a.,,v | |
| 7C 28 F1 84 E6 1E 36 D0 4C 2D 44 08 B6 81 93 40 |(....6.L-D....@ | |
| 89 C4 7F E6 33 8E 6E 0D B9 2A C0 AD E5 67 59 FA ....3.n..*...gY. | |
| 91 C0 8E 09 FE AF 50 4D 79 23 BC 0D 3D 27 B4 CC ......PMy#..='.. | |
| A3 73 93 4B 7D 93 7F 3E 3B B4 5F C9 E8 FE 07 33 .s.K}..>;._....3 | |
| 2F 92 54 27 D9 B1 55 EA 5F E4 C7 0C A2 7B D2 48 /.T'..U._....{.H | |
| A8 F4 75 6E AF 9D 5B A1 B0 94 DC E5 ED A2 B4 3C ..un..[........< | |
| 76 61 AF 53 BA 8B F7 63 13 C8 F1 1D 27 61 3B va.S...c....'a; | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 3B ....; | |
| 0x7f07e7ba4e00 18:37:53.618 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (61 bytes): | |
| 7D 1C 21 EC 6E E9 2A D2 F2 4B C4 66 B8 8C F6 DB }.!.n.*..K.f.... | |
| 4D 55 CD E0 54 41 61 A3 81 5B CE 97 CB C2 0A 8E MU..TAa..[...... | |
| D4 70 E9 53 8F 56 AE D9 07 40 E5 58 92 9C B3 8C .p.S.V...@.X.... | |
| C9 7A A4 92 03 89 71 01 00 FE 00 90 00 .z....q...... | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] apdu.c:505:sc_get_response: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=1324 sw1=90 sw2=00 | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1324 | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: 1324 | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card-piv.c:1036:piv_get_cached_data: added #6 0x5585c148bd70:1324 (nil):0 | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: 1324 | |
| 0x7f07e7ba4e00 18:37:53.629 [opensc-pkcs11] card-piv.c:1143:piv_cache_internal_data: added #6 internal 0x5585c148c470:1311 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1145:piv_cache_internal_data: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:2576:piv_select_file: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:783:sc_select_file: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:565:sc_read_binary: called; 1311 bytes at index 0 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 0 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #6 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:993:piv_get_cached_data: found #6 0x5585c148bd70:1324 0x5585c148c470:1311 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: 1324 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1182:piv_read_binary: DEE rbuf=0x5585c148bd70,rbuflen=1324, | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1068:piv_cache_internal_data: #6 found internal 0x5585c148c470:1311 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1069:piv_cache_internal_data: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 512 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 768 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 1024 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:565:sc_read_binary: called; 31 bytes at index 1280 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 31 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 31 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:602:sc_read_binary: returning with: 1311 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] pkcs15.c:2401:sc_pkcs15_read_file: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] pkcs15-cert.c:368:sc_pkcs15_read_certificate: called | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] pkcs15-pubkey.c:1327:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5585c148d191:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A028201010090B7F4 8361615FCB5E50194FFA1DB0DA65B842 | |
| E3B9820259294D76914565DDFAC24236 81B5A4DEFDEC0558E7E94DBE69F28FE1 1579DC3BE61DB7EDACA9A5AFD0B94DC2 | |
| 4C404070BB75297EC439ABAABCD398D8 606C83CFE7D12BED5A1F33913DDA2647 86B36F222787DCE07CDBEF740AA9BED9 | |
| 14E7CE4FC36BECB86FEEF674C583C761 F364960B10F0FAEF93B187972DB90C17 9FDAEFAD51B06E08006447326676DD5B | |
| 28C1E5510B825740FE78C1AA89A1659B 285CEE51691A84CF0FD80524A59F50D6 B3391FD210CDD29A20A80A9F5A518547 | |
| 9FFF1A0015337F4B6321025A86560950 26507F7177C74F9D08B3310825960F7F 49B8B36F9379E021AC8C017D99020301 | |
| 0001 | |
| 0x7f07e7ba4e00 18:37:53.630 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-pubkey.c:1364:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-pubkey.c:1409:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-cert.c:395:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-cert.c:293:sc_pkcs15_get_extension: returning with: 4 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15-cert.c:330:sc_pkcs15_get_bitstring_extension: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0102 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 7 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15.c:2306:sc_pkcs15_read_file: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] pkcs15.c:2307:sc_pkcs15_read_file: path=0102cece, index=0, count=-1 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card.c:748:sc_select_file: called; type=2, path=0102cece | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:2504:piv_select_file: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0102 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 7 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #7 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:1020:piv_get_cached_data: get #7 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:913:piv_get_data: #7 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:932:piv_get_data: get len of #7 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab15050 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab15048 | |
| 0x7f07e7ba4e00 18:37:53.631 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.632 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0B 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.632 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 05 28 70 82 05 1F 30 82 05 1B 30 82 03 03 S..(p...0...0... | |
| A0 03 02 01 02 02 01 51 30 0D 06 09 2A 86 48 86 .......Q0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 02 55 54 31 1A 30 18 06 03 55 04 0A 0C 11 61 61 .CA1.0...U....as | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 sadfsadfasdfsdf1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 usern@company_n. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 com0...122121222 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..2211212124 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 00Z0P1.0...U.... | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 US1.0...U....CA1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdfsr | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfsas1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....asdfsadfsa | |
| 61 61 61 61 61 61 61 61 22 30 0D 06 09 61 FD asdfa0.."0...a. | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=8 sw1=61 sw2=fd | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1281 | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card-piv.c:954:piv_get_data: buffer for #7 *buf=0x(nil) len=1281 | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=1 le=256, resplen=1281, resp=0x5585c148d640 | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab15048 | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 0B 00 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.663 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 53 82 05 28 70 82 05 1F 30 82 05 1B 30 82 03 03 S..(p...0...0... | |
| A0 03 02 01 02 02 01 51 30 0D 06 09 2A 86 48 86 .......Q0...*.H. | |
| F7 0D 01 01 0D 05 00 30 5A 31 0B 30 09 06 03 55 .......0Z1.0...U | |
| 04 06 13 02 55 53 31 0B 30 09 06 03 55 04 08 0C ....US1.0...U... | |
| 02 55 54 31 1A 30 18 06 03 55 04 0A 0C 11 61 61 .CA1.0...U....as | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 sadfsadfasdfsdf1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 "0 ..*.H........ | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 usern@company_n. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 com0...122121222 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 400Z..2211212124 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 00Z0P1.0...U.... | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 US1.0...U....CA1 | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .0...U....asdfsr | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 asdfsadfsas1.0.. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 .U....asdfsadfsa | |
| 61 61 61 61 61 61 61 61 22 30 0D 06 09 61 FD asdfa0.."0...a. | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] apdu.c:434:sc_get_response: called | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.695 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 2A 86 48 86 F7 0D 01 01 01 05 00 03 82 01 0F 00 *.H............. | |
| 30 82 01 0A 02 82 01 01 00 B8 5F 4D 18 A7 06 06 0........._M.... | |
| D7 A5 1F 75 08 F1 D9 1E 05 72 7C E2 AB BC D9 D0 ...u.....r|..... | |
| 90 F8 60 9A CE C6 0C A2 44 08 EA 1B 10 B8 50 DC ..`.....D.....P. | |
| DA 77 E7 95 90 84 43 2E 61 2A 3C 8A DE 37 AB F8 .w....C.a*<..7.. | |
| 4F F9 DF A1 C3 EC A6 C9 F2 85 1E A0 EF 16 45 CD O.............E. | |
| D6 DD 75 11 56 22 DE 76 D8 44 D5 9F A3 CF 9F D1 ..u.V".v.D...... | |
| 68 2D 83 C2 DA CB 43 9B 58 4B D3 2C 2A D8 2B E4 h-....C.XK.,*.+. | |
| 8C 5C CA 33 02 7A CD 69 72 78 95 23 50 D8 71 3F .\.3.z.irx.#P.q? | |
| 8F A0 AE 5C C2 39 03 41 CD 14 19 8E 88 8E E1 AE ...\.9.A........ | |
| 46 34 4F 07 18 BB 92 FB 3E D8 AD 83 08 DD 63 BA F4O.....>.....c. | |
| EA 62 77 CC 8A C8 19 01 73 EC 8E A3 59 EE 77 0D .bw.....s...Y.w. | |
| BC C8 8E 59 7C 36 EB 9D 60 67 01 F5 A0 E7 B3 29 ...Y|6..`g.....) | |
| 6D 60 27 0B D5 B4 7D 5F F3 6A 77 50 61 E8 45 A3 m`'...}_.jwPa.E. | |
| FD D6 25 E3 A4 CE ED 49 4E B2 66 CE 06 16 88 B9 ..%....IN.f..... | |
| E9 52 20 A4 8F 55 E6 E9 D8 89 46 17 FE 61 FD .R ..U....F..a. | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.724 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| C3 AB 72 E3 2A 82 4B 9A 02 C7 46 A8 00 92 BE 27 ..r.*.K...F....' | |
| C5 DB 63 99 D8 4B 0F 86 31 53 3D 3D 02 03 01 00 ..c..K..1S==.... | |
| 01 A3 81 CA 30 81 C7 30 09 06 03 55 1D 13 04 02 ....0..0...U.... | |
| 30 00 30 11 06 09 60 86 48 01 86 F8 42 01 01 04 0.0...`.H...B... | |
| 04 03 02 05 A0 30 33 06 09 60 86 48 01 86 F8 42 .....03..`.H...B | |
| 01 0D 04 26 16 24 4F 70 65 6E 53 53 4C 20 47 65 ...&.$OpenSSL Ge | |
| 6E 65 72 61 74 65 64 20 43 6C 69 65 6E 74 20 43 nerated Client C | |
| 65 72 74 69 66 69 63 61 74 65 30 1D 06 03 55 1D ertificate0...U. | |
| 0E 04 16 04 14 1D A5 C9 31 09 F1 47 34 5B 60 91 ........1..G4[`. | |
| D0 E2 64 0A 9D 8C 24 E4 1B 30 1F 06 03 55 1D 23 ..d...$..0...U.# | |
| 04 18 30 16 80 14 AF F5 8E B7 63 53 AC A9 F3 49 ..0.......cS...I | |
| BF 09 D6 58 79 D3 97 85 11 7F 30 0E 06 03 55 1D ...Xy.....0...U. | |
| 0F 01 01 FF 04 04 03 02 05 20 30 22 06 03 55 1D ......... 0"..U. | |
| 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 61 ...0...asdfsdffd | |
| 40 61 61 61 61 61 61 61 6F 6E 2E 63 6F 6D 30 0D @company_n.com0. | |
| 06 09 2A 86 48 86 F7 0D 01 01 0D 05 00 61 FD ..*.H........a. | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.753 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 03 82 02 01 00 80 A0 53 CF 43 AE 8C 71 52 CF A6 .......S.C..qR.. | |
| 84 25 91 50 9A 77 52 C8 EC A6 1B 5C D8 6C 27 4E .%.P.wR....\.l'N | |
| 3A 8B D6 CA 05 47 4B D4 D0 36 08 3E FA CA C8 EC :....GK..6.>.... | |
| 58 BC 44 34 9E 30 84 8F C3 7C A9 F3 72 44 15 22 X.D4.0...|..rD." | |
| 5C 6E 6F 9F BC 59 6C 03 6C 4F AD 8E 08 0A 28 45 \no..Yl.lO....(E | |
| 07 1D CB AE BC 0A 81 26 DA A2 42 40 F1 97 7A 84 .......&..B@..z. | |
| CA 5A 01 0A C5 4F 1C 6B 79 26 D8 2A 90 2D 04 E9 .Z...O.ky&.*.-.. | |
| DB A1 A1 12 F6 64 BA F2 8F 57 47 87 13 24 79 3E .....d...WG..$y> | |
| 96 DE A2 EB C7 F8 2A 80 31 C5 B4 CE E7 C6 9F 22 ......*.1......" | |
| 43 D3 69 50 4A 32 10 A5 DB 61 B5 2D 41 16 26 9C C.iPJ2...a.-A.&. | |
| 73 E5 CB B3 7D F1 95 47 D9 CA 37 40 7B E0 5E 85 s...}..G..7@{.^. | |
| C3 19 C3 9E 12 C8 40 33 AF 46 62 01 4B A0 E0 8D ......@3.Fb.K... | |
| EF 95 DD 36 DE 14 A2 81 04 8C A7 FB EB DC B1 EE ...6............ | |
| D7 A3 43 60 CB 6B FF 67 6A F4 0A 08 37 17 E0 46 ..C`.k.gj...7..F | |
| DC B9 CC 1E 51 D8 DD FC 52 B7 4D 0F 8B 01 21 6D ....Q...R.M...!m | |
| 54 4D 51 75 0E 0D FD 12 FB 0F 24 95 D7 61 FD TMQu......$..a. | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 FD ..... | |
| 0x7f07e7ba4e00 18:37:53.782 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (255 bytes): | |
| 1C D9 72 89 D3 9F A4 BC 0F 4A 64 9E 8A 55 55 FA ..r......Jd..UU. | |
| 78 F6 9F 68 61 8E 80 2E 3D B6 64 B2 12 D1 A2 DE x..ha...=.d..... | |
| EA 7B BF 38 F2 2D CC A9 B3 AA 3D 85 45 02 0D FB .{.8.-....=.E... | |
| 4C 9C F2 36 14 46 F9 03 54 F2 36 0D EE F6 53 FD L..6.F..T.6...S. | |
| 58 E3 85 F6 AE A2 96 59 7D 8A 57 BA 61 B1 01 6A X......Y}.W.a..j | |
| 59 BA 5F 68 53 A7 A2 C6 D6 14 E0 36 0B 11 E5 6C Y._hS......6...l | |
| 76 FD 89 60 14 C6 89 7D 63 79 BE 28 88 95 66 F6 v..`...}cy.(..f. | |
| F4 1A E0 C4 A1 6C 66 FB 34 97 EF B7 99 07 C3 02 .....lf.4....... | |
| 0E 27 57 DA AF D4 B6 32 6F AC 04 55 C6 F3 91 12 .'W....2o..U.... | |
| C3 71 DD A3 52 60 41 10 FC DA BB 00 56 E3 67 DB .q..R`A.....V.g. | |
| EF 96 70 18 47 26 62 07 A0 A7 52 FB 13 AB 68 D5 ..p.G&b...R...h. | |
| DB EB DB 2F 93 7B 7F F3 4D A6 00 86 F7 B4 31 8A .../.{..M.....1. | |
| 31 82 4B 10 21 B8 9C 91 BC 39 14 3E A0 BF 3A A8 1.K.!....9.>..:. | |
| AE 53 FB 3F 9B 95 84 B4 78 B7 DA 32 A9 93 01 BA .S.?....x..2.... | |
| 6B 49 FE CF D8 A7 35 A0 51 40 34 77 69 D6 CB F9 kI....5.Q@4wi... | |
| DC 70 6E B3 B8 07 AE BC 8C 27 A1 BD C8 61 10 .pn......'...a. | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:C0, P1:0, P2:0, data(0) (nil) | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (5 bytes): | |
| 00 C0 00 00 10 ..... | |
| 0x7f07e7ba4e00 18:37:53.811 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (18 bytes): | |
| 6B 22 FB 2F 66 50 28 2D 23 45 B9 71 01 00 FE 00 k"./fP(-#E.q.... | |
| 90 00 .. | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] apdu.c:505:sc_get_response: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=1281 sw1=90 sw2=00 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: 1281 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: 1281 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:1036:piv_get_cached_data: added #7 0x5585c148d640:1281 (nil):0 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: 1281 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:1143:piv_cache_internal_data: added #7 internal 0x5585c148eaa0:1268 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:1145:piv_cache_internal_data: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:2576:piv_select_file: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:783:sc_select_file: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:565:sc_read_binary: called; 1268 bytes at index 0 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 0 | |
| 0x7f07e7ba4e00 18:37:53.819 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #7 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:993:piv_get_cached_data: found #7 0x5585c148d640:1281 0x5585c148eaa0:1268 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: 1281 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1182:piv_read_binary: DEE rbuf=0x5585c148d640,rbuflen=1281, | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1068:piv_cache_internal_data: #7 found internal 0x5585c148eaa0:1268 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1069:piv_cache_internal_data: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 512 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:565:sc_read_binary: called; 256 bytes at index 768 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 256 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:565:sc_read_binary: called; 244 bytes at index 1024 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1165:piv_read_binary: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card-piv.c:1229:piv_read_binary: returning with: 244 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:605:sc_read_binary: returning with: 244 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:602:sc_read_binary: returning with: 1268 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15.c:2401:sc_pkcs15_read_file: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-cert.c:368:sc_pkcs15_read_certificate: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-pubkey.c:1327:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5585c148f761:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A0282010100B85F4D 18A70606D7A51F7508F1D91E05727CE2 | |
| ABBCD9D090F8609ACEC60CA24408EA1B 10B850DCDA77E7959084432E612A3C8A DE37ABF84FF9DFA1C3ECA6C9F2851EA0 | |
| EF1645CDD6DD75115622DE76D844D59F A3CF9FD1682D83C2DACB439B584BD32C 2AD82BE48C5CCA33027ACD6972789523 | |
| 50D8713F8FA0AE5CC2390341CD14198E 888EE1AE46344F0718BB92FB3ED8AD83 08DD63BAEA6277CC8AC8190173EC8EA3 | |
| 59EE770DBCC88E597C36EB9D606701F5 A0E7B3296D60270BD5B47D5FF36A7750 61E845A3FDD625E3A4CEED494EB266CE | |
| 061688B9E95220A48F55E6E9D8894617 FEC3AB72E32A824B9A02C746A80092BE 27C5DB6399D84B0F8631533D3D020301 | |
| 0001 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-pubkey.c:1364:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-pubkey.c:1409:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.820 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] pkcs15-cert.c:395:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] pkcs15-cert.c:293:sc_pkcs15_get_extension: returning with: 4 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] pkcs15-cert.c:330:sc_pkcs15_get_bitstring_extension: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0500 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 8 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] pkcs15.c:2306:sc_pkcs15_read_file: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] pkcs15.c:2307:sc_pkcs15_read_file: path=0500cece, index=0, count=-1 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card.c:748:sc_select_file: called; type=2, path=0500cece | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:2504:piv_select_file: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x0500 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 8 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:979:piv_get_cached_data: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:980:piv_get_cached_data: #8 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:1020:piv_get_cached_data: get #8 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:913:piv_get_data: #8 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:932:piv_get_data: get len of #8 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab15050 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab15048 | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 01 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.821 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] iso7816.c:124:iso7816_check_sw: File not found | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:548:piv_general_io: Card returned error | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:1048:piv_get_cached_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2548:piv_select_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card.c:770:sc_select_file: 'SELECT' error: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] pkcs15.c:2407:sc_pkcs15_read_file: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] pkcs15-piv.c:746:sc_pkcs15emu_piv_init: No cert found,i=3 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1001 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 12 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=4 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1002 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 13 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=5 | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.829 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1003 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 14 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=6 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1004 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 15 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=7 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1005 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 16 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=8 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1006 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 17 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=9 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1007 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 18 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=10 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1008 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 19 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=11 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1009 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 20 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=12 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100A | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 21 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=13 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100B | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 22 | |
| 0x7f07e7ba4e00 18:37:53.830 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=14 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100C | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 23 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=15 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100D | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 24 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=16 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100E | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 25 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=17 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x100F | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 26 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=18 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1010 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 27 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=19 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1011 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 28 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=20 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1012 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 29 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=21 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1013 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 30 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=22 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983428 ptr=0x7ffd0ab154d0 | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:403:piv_find_obj_by_containerid: called | |
| 0x7f07e7ba4e00 18:37:53.831 [opensc-pkcs11] card-piv.c:404:piv_find_obj_by_containerid: str=0x1014 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] card-piv.c:408:piv_find_obj_by_containerid: returning with: 31 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] card-piv.c:2157:piv_is_object_present: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:739:sc_pkcs15emu_piv_init: Cert can not be present,i=23 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:905:sc_pkcs15emu_piv_init: PIV-II adding pins... | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] card-piv.c:2178:piv_card_ctl: called | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] card-piv.c:2179:piv_card_ctl: cmd=1346983427 ptr=0x7ffd0ab15330 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] card-piv.c:2170:piv_get_pin_preference: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:936:sc_pkcs15emu_piv_init: DEE Adding pin 0 label=PIV Card Holder pin | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:936:sc_pkcs15emu_piv_init: DEE Adding pin 1 label=PIV PUK | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:960:sc_pkcs15emu_piv_init: PIV-II adding pub keys... | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=0 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env PIV_9A_KEY | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1011:sc_pkcs15emu_piv_init: DEE look for file NULL | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:807:sc_pkcs15_encode_pubkey_as_spki: called | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:811:sc_pkcs15_encode_pubkey_as_spki: Encoding public key with algorithm 0 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:601:sc_pkcs15_encode_pubkey_rsa: called | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:612:sc_pkcs15_encode_pubkey_rsa: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:877:sc_pkcs15_encode_pubkey_as_spki: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1063:sc_pkcs15emu_piv_init: adding pubkey for 1 keyalg=0 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1100:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x000002d1 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:807:sc_pkcs15_encode_pubkey_as_spki: called | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:811:sc_pkcs15_encode_pubkey_as_spki: Encoding public key with algorithm 0 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:601:sc_pkcs15_encode_pubkey_rsa: called | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:612:sc_pkcs15_encode_pubkey_rsa: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-pubkey.c:877:sc_pkcs15_encode_pubkey_as_spki: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1063:sc_pkcs15emu_piv_init: adding pubkey for 2 keyalg=0 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1100:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x00000011 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=3 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env PIV_9E_KEY | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1011:sc_pkcs15emu_piv_init: DEE look for file NULL | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=4 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=5 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=6 | |
| 0x7f07e7ba4e00 18:37:53.832 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=7 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=8 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=9 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=10 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=11 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=12 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=13 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=14 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=15 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=16 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=17 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=18 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=19 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=20 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=21 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=22 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:993:sc_pkcs15emu_piv_init: No cert for this pub key i=23 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1005:sc_pkcs15emu_piv_init: DEE look for env NULL | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1105:sc_pkcs15emu_piv_init: PIV-II adding private keys... | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1167:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x0000022e | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1167:sc_pkcs15emu_piv_init: USAGE: cert_keyUsage_present:1 usage:0x00000022 | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-piv.c:1174:sc_pkcs15emu_piv_init: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] pkcs15-syn.c:183:sc_pkcs15_bind_synthetic: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.833 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] pkcs15.c:1258:sc_pkcs15_bind: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] slot.c:342:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Creating 'generic' token. | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:1364:pkcs15_create_tokens: create PKCS#15 tokens; fws:0x5585c1480310,(nil),(nil) | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:1365:pkcs15_create_tokens: create slots flags 0x8 | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:1374:pkcs15_create_tokens: Use FW data with index 0; fw_data->p15_card 0x5585c1480570 | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] pkcs15.c:1699:sc_pkcs15_find_pin_by_flags: called | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] pkcs15.c:1700:sc_pkcs15_find_pin_by_flags: Find PIN flags:0x10, mask:0xD2, index:-1 | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] pkcs15.c:1726:sc_pkcs15_find_pin_by_flags: returning with: -1407 (Requested object not found) | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] pkcs15.c:1699:sc_pkcs15_find_pin_by_flags: called | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] pkcs15.c:1700:sc_pkcs15_find_pin_by_flags: Find PIN flags:0x12, mask:0xD2, index:-1 | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] pkcs15.c:1723:sc_pkcs15_find_pin_by_flags: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:1380:pkcs15_create_tokens: Flags:0x8; Auth User/Sign PINs 0x5585c1490c40/(nil) | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 2 RSA private keys | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 2 RSA public keys | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:686:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() called, pubkey 0x5585c1492680, data 0x5585c1493160 | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:699:__pkcs15_create_pubkey_object: Use emulated pubkey | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:728:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() returns pubkey object 0x5585c1497330 | |
| 0x7f07e7ba4e00 18:37:53.835 [opensc-pkcs11] framework-pkcs15.c:686:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() called, pubkey 0x5585c1493760, data 0x5585c1494240 | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:699:__pkcs15_create_pubkey_object: Use emulated pubkey | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:728:__pkcs15_create_pubkey_object: __pkcs15_create_pubkey_object() returns pubkey object 0x5585c1497390 | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 0 EC private keys | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 0 EC public keys | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 0 GOSTR3410 private keys | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 0 GOSTR3410 public keys | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 2 certificates | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-cert.c:368:sc_pkcs15_read_certificate: called | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-pubkey.c:1327:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5585c14974e1:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A028201010090B7F4 8361615FCB5E50194FFA1DB0DA65B842 | |
| E3B9820259294D76914565DDFAC24236 81B5A4DEFDEC0558E7E94DBE69F28FE1 1579DC3BE61DB7EDACA9A5AFD0B94DC2 | |
| 4C404070BB75297EC439ABAABCD398D8 606C83CFE7D12BED5A1F33913DDA2647 86B36F222787DCE07CDBEF740AA9BED9 | |
| 14E7CE4FC36BECB86FEEF674C583C761 F364960B10F0FAEF93B187972DB90C17 9FDAEFAD51B06E08006447326676DD5B | |
| 28C1E5510B825740FE78C1AA89A1659B 285CEE51691A84CF0FD80524A59F50D6 B3391FD210CDD29A20A80A9F5A518547 | |
| 9FFF1A0015337F4B6321025A86560950 26507F7177C74F9D08B3310825960F7F 49B8B36F9379E021AC8C017D99020301 | |
| 0001 | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-pubkey.c:1364:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-pubkey.c:1409:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-cert.c:395:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] framework-pkcs15.c:596:pkcs15_cert_extract_label: pkcs15_cert_extract_label() called. Current label: Certificate for Digital Signature | |
| 0x7f07e7ba4e00 18:37:53.836 [opensc-pkcs11] pkcs15-cert.c:368:sc_pkcs15_read_certificate: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-pubkey.c:1327:sc_pkcs15_pubkey_from_spki_fields: sc_pkcs15_pubkey_from_spki_fields() called: 0x5585c1498181:290 | |
| 300D06092A864886F70D010101050003 82010F003082010A0282010100B85F4D 18A70606D7A51F7508F1D91E05727CE2 | |
| ABBCD9D090F8609ACEC60CA24408EA1B 10B850DCDA77E7959084432E612A3C8A DE37ABF84FF9DFA1C3ECA6C9F2851EA0 | |
| EF1645CDD6DD75115622DE76D844D59F A3CF9FD1682D83C2DACB439B584BD32C 2AD82BE48C5CCA33027ACD6972789523 | |
| 50D8713F8FA0AE5CC2390341CD14198E 888EE1AE46344F0718BB92FB3ED8AD83 08DD63BAEA6277CC8AC8190173EC8EA3 | |
| 59EE770DBCC88E597C36EB9D606701F5 A0E7B3296D60270BD5B47D5FF36A7750 61E845A3FDD625E3A4CEED494EB266CE | |
| 061688B9E95220A48F55E6E9D8894617 FEC3AB72E32A824B9A02C746A80092BE 27C5DB6399D84B0F8631533D3D020301 | |
| 0001 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-pubkey.c:1364:sc_pkcs15_pubkey_from_spki_fields: DEE pk_alg.algorithm=0 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-pubkey.c:578:sc_pkcs15_decode_pubkey_rsa: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-pubkey.c:589:sc_pkcs15_decode_pubkey_rsa: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-pubkey.c:1409:sc_pkcs15_pubkey_from_spki_fields: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.13' | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-cert.c:395:sc_pkcs15_read_certificate: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:596:pkcs15_cert_extract_label: pkcs15_cert_extract_label() called. Current label: Certificate for Key Management | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:804:pkcs15_create_pkcs11_objects: Found 13 data objects | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 0 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:819:__pkcs15_prkey_bind_related: Object is a private key and has id 02 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:844:__pkcs15_prkey_bind_related: Associating object 2 as public key | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-pubkey.c:1157:sc_pkcs15_dup_pubkey: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 1 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:819:__pkcs15_prkey_bind_related: Object is a private key and has id 03 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:844:__pkcs15_prkey_bind_related: Associating object 3 as public key | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:532:sc_asn1_encode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:533:sc_asn1_encode_algorithm_id: type of algorithm to encode: 0 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:547:sc_asn1_encode_algorithm_id: encode algo 1.2.840.113549.1.1.1 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:582:sc_asn1_encode_algorithm_id: return encoded algorithm ID: 06092A864886F70D0101010500 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:583:sc_asn1_encode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:491:sc_asn1_decode_algorithm_id: called | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:499:sc_asn1_decode_algorithm_id: decoded OID '1.2.840.113549.1.1.1' | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-algo.c:516:sc_asn1_decode_algorithm_id: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] pkcs15-pubkey.c:1157:sc_pkcs15_dup_pubkey: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 2 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 3 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 4 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:864:__pkcs15_cert_bind_related: Object is a certificate and has id 02 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:893:__pkcs15_cert_bind_related: Associating object 0 as private key | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 5 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:864:__pkcs15_cert_bind_related: Object is a certificate and has id 03 | |
| 0x7f07e7ba4e00 18:37:53.837 [opensc-pkcs11] framework-pkcs15.c:893:__pkcs15_cert_bind_related: Associating object 1 as private key | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 6 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 7 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 8 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 9 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 10 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 11 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 12 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 13 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 14 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 15 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 16 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 17 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:914:pkcs15_bind_related_objects: Looking for objects related to object 18 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1150:_pkcs15_create_typed_objects: found 19 FW objects | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1386:pkcs15_create_tokens: Found 19 FW objects objects | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1402:pkcs15_create_tokens: Found 2 authentication objects | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1411:pkcs15_create_tokens: Found authentication object 'PIV Card Holder pin' | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1086:pkcs15_create_slot: Create slot (p11card 0x5585c147ebf0, fw_data 0x5585c1480310, auth 0x5585c1490c40, app_info (nil)) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] slot.c:426:slot_allocate: Allocated slot 0x0 for card in reader Yubico Yubikey NEO OTP+U2F+CCID 00 00 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1074:pkcs15_init_slot: Initialized token 'PIV Card Holder pin (PIV_II)' in slot 0x0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1272:_add_pin_related_objects: Add objects related to PIN('PIV Card Holder pin',ID:01) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1284:_add_pin_related_objects: ObjID(0x5585c1497270,SIGN key,101):01 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1291:_add_pin_related_objects: Slot:0x5585c147e030, obj:0x5585c1497270 Adding private key 0 to PIN 'PIV Card Holder pin' | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1497270 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1497330 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c14973f0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1284:_add_pin_related_objects: ObjID(0x5585c14972d0,KEY MAN key,101):01 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1291:_add_pin_related_objects: Slot:0x5585c147e030, obj:0x5585c14972d0 Adding private key 1 to PIN 'PIV Card Holder pin' | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c14972d0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1497390 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c14976b0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1284:_add_pin_related_objects: ObjID(0x5585c1497890,Cardholder Fingerprints,500):01 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1295:_add_pin_related_objects: Slot:0x5585c147e030 Adding data object 10 to PIN 'PIV Card Holder pin' | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1497890 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1284:_add_pin_related_objects: ObjID(0x5585c1498090,Printed Information,500):01 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1295:_add_pin_related_objects: Slot:0x5585c147e030 Adding data object 11 to PIN 'PIV Card Holder pin' | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1498090 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1284:_add_pin_related_objects: ObjID(0x5585c14980f0,Cardholder Facial Image,500):01 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1295:_add_pin_related_objects: Slot:0x5585c147e030 Adding data object 12 to PIN 'PIV Card Holder pin' | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c14980f0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1284:_add_pin_related_objects: ObjID(0x5585c1498330,Cardholder Iris Image,500): | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1286:_add_pin_related_objects: Ignoring object 18 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1460:pkcs15_create_tokens: Add public objects to slot 0x5585c147e030 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1328:_add_public_objects: 19 public objects to process | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c1497710,Card Capability Container,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1497710 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c1497770,Card Holder Unique Identifier,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1497770 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c14977d0,Unsigned Card Holder Unique Identifier,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c14977d0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c1497830,X.509 Certificate for PIV Authentication,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1497830 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c1498150,X.509 Certificate for Digital Signature,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1498150 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c14981b0,X.509 Certificate for Key Management,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c14981b0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c1498210,X.509 Certificate for Card Authentication,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1498210 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c1498270,Security Object,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c1498270 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1349:_add_public_objects: Add public object(0x5585c14982d0,Discovery Object,500) | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:977:pkcs15_add_object: Slot:0 Setting object handle of 0x0 to 0x5585c14982d0 | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] framework-pkcs15.c:1464:pkcs15_create_tokens: All tokens created | |
| 0x7f07e7ba4e00 18:37:53.838 [opensc-pkcs11] slot.c:379:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| 0x7f07e7ba4e00 18:37:53.839 [opensc-pkcs11] slot.c:185:initialize_reader: Reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' initialized | |
| 0x7f07e7ba4e00 18:37:53.839 [opensc-pkcs11] pkcs11-global.c:280:C_Initialize: C_Initialize() = CKR_OK | |
| 0x7f07e7ba4e00 18:37:53.839 [opensc-pkcs11] pkcs11-global.c:351:C_GetInfo: C_GetInfo() | |
| 0x7f07e7ba4e00 18:37:53.839 [opensc-pkcs11] pkcs11-global.c:397:C_GetSlotList: C_GetSlotList(token=1, plug-n-play) | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:1283:pcsc_detect_readers: called | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:1302:pcsc_detect_readers: Probing PC/SC readers | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:1423:pcsc_detect_readers: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] slot.c:389:card_detect_all: Detect all cards | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] slot.c:235:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] sc.c:275:sc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:411:pcsc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:339:refresh_attributes: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:416:pcsc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] sc.c:280:sc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] slot.c:379:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] slot.c:408:card_detect_all: All cards detected | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] pkcs11-global.c:433:C_GetSlotList: was only a size inquiry (1) | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] pkcs11-global.c:397:C_GetSlotList: C_GetSlotList(token=1, refresh) | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] slot.c:389:card_detect_all: Detect all cards | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] slot.c:235:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] sc.c:275:sc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:411:pcsc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:53.840 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] reader-pcsc.c:339:refresh_attributes: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] reader-pcsc.c:416:pcsc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] sc.c:280:sc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] slot.c:379:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] slot.c:408:card_detect_all: All cards detected | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] pkcs11-global.c:450:C_GetSlotList: returned 1 slots | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] framework-pkcs15.c:510:C_GetTokenInfo: C_GetTokenInfo(0) | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] slot.c:448:slot_get_token: Slot(id=0x0): get token | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] slot.c:466:slot_get_token: Slot-get-token returns OK | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] framework-pkcs15.c:541:C_GetTokenInfo: C_GetTokenInfo() auth. object 0x5585c1490c40, token-info flags 0x40D | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] pkcs15-pin.c:677:sc_pkcs15_get_pin_info: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] sec.c:169:sc_pin_cmd: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card-piv.c:3256:piv_pin_cmd: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card-piv.c:3257:piv_pin_cmd: piv_pin_cmd tries_left=10, logged_in=-1 | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(0) 0x7ffd0ab11a50 | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (4 bytes): | |
| 00 20 00 80 . .. | |
| 0x7f07e7ba4e00 18:37:53.841 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 63 C3 c. | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] iso7816.c:119:iso7816_check_sw: Verification failed (remaining tries: 3) | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card-piv.c:3181:piv_check_protected_objects: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card-piv.c:913:piv_get_data: #4 | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card-piv.c:954:piv_get_data: buffer for #4 *buf=0x0x7ffd0ab11bd0 len=8 | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab11bd0 | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab11b48 | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 09 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.847 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] iso7816.c:124:iso7816_check_sw: File not found | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:548:piv_general_io: Card returned error | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:913:piv_get_data: #3 | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:954:piv_get_data: buffer for #3 *buf=0x0x7ffd0ab11bd0 len=8 | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab11bd0 | |
| 0x7f07e7ba4e00 18:37:53.854 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab11b48 | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 03 08 ..?..\._... | |
| 0x7f07e7ba4e00 18:37:53.855 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] iso7816.c:124:iso7816_check_sw: File not found | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:548:piv_general_io: Card returned error | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:912:piv_get_data: called | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:913:piv_get_data: #32 | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:954:piv_get_data: buffer for #32 *buf=0x0x7ffd0ab11bd0 len=8 | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:484:piv_general_io: called | |
| 0x7f07e7ba4e00 18:37:53.862 [opensc-pkcs11] card-piv.c:489:piv_general_io: cb 3f ff 5 : 255 256 | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] card-piv.c:530:piv_general_io: calling sc_transmit_apdu flags=3 le=8, resplen=8, resp=0x7ffd0ab11bd0 | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:CB, P1:3F, P2:FF, data(5) 0x7ffd0ab11b48 | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (11 bytes): | |
| 00 CB 3F FF 05 5C 03 5F C1 21 08 ..?..\._.!. | |
| 0x7f07e7ba4e00 18:37:53.863 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 6A 82 j. | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:537:piv_general_io: DEE r=0 apdu.resplen=0 sw1=6a sw2=82 | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] iso7816.c:124:iso7816_check_sw: File not found | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:548:piv_general_io: Card returned error | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:598:piv_general_io: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:966:piv_get_data: returning with: -1201 (File not found) | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:3220:piv_check_protected_objects: No protected objects found, setting CI_CANT_USE_GETDATA_FOR_STATE | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:3239:piv_check_protected_objects: object_test_verify=0, card_issues = 0x0002031b | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:3240:piv_check_protected_objects: returning with: -1214 (PIN code or key incorrect) | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:3340:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card-piv.c:3341:piv_pin_cmd: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] sec.c:216:sc_pin_cmd: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.870 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] pkcs15-pin.c:705:sc_pkcs15_get_pin_info: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] framework-pkcs15.c:559:C_GetTokenInfo: C_GetTokenInfo(0) returns 0x0 | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] pkcs11-session.c:58:C_OpenSession: C_OpenSession(0x0) | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] slot.c:448:slot_get_token: Slot(id=0x0): get token | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] slot.c:466:slot_get_token: Slot-get-token returns OK | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] pkcs11-session.c:94:C_OpenSession: C_OpenSession handle: 0x5585c14a31b0 | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] pkcs11-session.c:97:C_OpenSession: C_OpenSession() = CKR_OK | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] pkcs11-object.c:336:C_FindObjectsInit: C_FindObjectsInit(slot = 0) | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] pkcs11-object.c:337:C_FindObjectsInit: C_FindObjectsInit(): CKA_CLASS = CKO_CERTIFICATE | |
| 0x7f07e7ba4e00 18:37:53.875 [opensc-pkcs11] pkcs11-object.c:337:C_FindObjectsInit: C_FindObjectsInit(): CKA_ID = 02 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x5585c14a31b0, type 0 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497270 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3465:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961827440: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497330 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961827632: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14973f0 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3368:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3368:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:393:C_FindObjectsInit: Object 0/94032961827824 matches | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:397:C_FindObjectsInit: realloc for 32 handles | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14972d0 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3465:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961827536: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497390 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961827728: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14976b0 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3368:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3368:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828528: Attribute 0x102 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497890 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961829008: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498090 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961831056: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14980f0 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961831152: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497710 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828624: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497770 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828720: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14977d0 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828816: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497830 | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828912: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.876 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498150 | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831248: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14981b0 | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831344: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498210 | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831440: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498270 | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831536: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14982d0 | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831632: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:410:C_FindObjectsInit: 1 matching objects | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:59:sc_find_release: freeing 32 handles used 1 at 0x5585c14a2fc0 | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:237:C_GetAttributeValue: Object 94032961827824: CKA_VALUE = <size inquiry> | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:259:C_GetAttributeValue: C_GetAttributeValue(hSession=0x5585c14a31b0, hObject=0x5585c14973f0) = CKR_OK | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:237:C_GetAttributeValue: Object 94032961827824: CKA_VALUE = 3082051B30820303A003020102020151300D06092A864886F70D01010D050030 | |
| 0x7f07e7ba4e00 18:37:53.877 [opensc-pkcs11] pkcs11-object.c:259:C_GetAttributeValue: C_GetAttributeValue(hSession=0x5585c14a31b0, hObject=0x5585c14973f0) = CKR_OK | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:336:C_FindObjectsInit: C_FindObjectsInit(slot = 0) | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:337:C_FindObjectsInit: C_FindObjectsInit(): CKA_CLASS = CKO_PRIVATE_KEY | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:337:C_FindObjectsInit: C_FindObjectsInit(): CKA_ID = 02 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] misc.c:258:session_start_operation: called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] misc.c:259:session_start_operation: Session 0x5585c14a31b0, type 0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497270 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3465:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961827440: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497330 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961827632: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14973f0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3368:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961827824: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14972d0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3465:pkcs15_prkey_get_attribute: pkcs15_prkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961827536: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497390 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3996:pkcs15_pubkey_get_attribute: pkcs15_pubkey_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961827728: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14976b0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3368:pkcs15_cert_cmp_attribute: pkcs15_cert_cmp_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:3266:pkcs15_cert_get_attribute: pkcs15_cert_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828528: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497890 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961829008: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498090 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961831056: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14980f0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:367:C_FindObjectsInit: Object 0/94032961831152: Private object and not logged in. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497710 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828624: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497770 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828720: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14977d0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828816: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1497830 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961828912: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498150 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831248: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14981b0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831344: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498210 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831440: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c1498270 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831536: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:358:C_FindObjectsInit: Object with handle 0x5585c14982d0 | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] framework-pkcs15.c:4275:pkcs15_dobj_get_attribute: pkcs15_dobj_get_attribute() called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:379:C_FindObjectsInit: Object 0/94032961831632: Attribute 0x0 does NOT match. | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:410:C_FindObjectsInit: 0 matching objects | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] misc.c:280:session_get_operation: called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-object.c:59:sc_find_release: freeing 0 handles used 0 at (nil) | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-session.c:342:C_Logout: C_Logout(hSession:0x5585c14a31b0) | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-session.c:158:C_CloseSession: C_CloseSession(0x5585c14a31b0) | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-session.c:109:sc_pkcs11_close_session: real C_CloseSession(0x5585c14a31b0) | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] pkcs11-global.c:397:C_GetSlotList: C_GetSlotList(token=1, plug-n-play) | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] reader-pcsc.c:1283:pcsc_detect_readers: called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] reader-pcsc.c:1302:pcsc_detect_readers: Probing PC/SC readers | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] reader-pcsc.c:1423:pcsc_detect_readers: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] slot.c:389:card_detect_all: Detect all cards | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] slot.c:235:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] sc.c:275:sc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] reader-pcsc.c:411:pcsc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:54.203 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:339:refresh_attributes: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:416:pcsc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] sc.c:280:sc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:379:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:408:card_detect_all: All cards detected | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] pkcs11-global.c:433:C_GetSlotList: was only a size inquiry (1) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] pkcs11-global.c:397:C_GetSlotList: C_GetSlotList(token=1, refresh) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:389:card_detect_all: Detect all cards | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:235:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detecting smart card | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] sc.c:275:sc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:411:pcsc_detect_card_presence: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:319:refresh_attributes: Yubico Yubikey NEO OTP+U2F+CCID 00 00 check | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:339:refresh_attributes: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:416:pcsc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] sc.c:280:sc_detect_card_presence: returning with: 1 | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:379:card_detect: Yubico Yubikey NEO OTP+U2F+CCID 00 00: Detection ended | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:408:card_detect_all: All cards detected | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] pkcs11-global.c:450:C_GetSlotList: returned 1 slots | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] framework-pkcs15.c:510:C_GetTokenInfo: C_GetTokenInfo(0) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:448:slot_get_token: Slot(id=0x0): get token | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] slot.c:466:slot_get_token: Slot-get-token returns OK | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] framework-pkcs15.c:541:C_GetTokenInfo: C_GetTokenInfo() auth. object 0x5585c1490c40, token-info flags 0x40D | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] pkcs15-pin.c:677:sc_pkcs15_get_pin_info: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:612:pcsc_lock: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card-piv.c:3365:piv_card_reader_lock_obtained: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card-piv.c:3373:piv_card_reader_lock_obtained: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] sec.c:169:sc_pin_cmd: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card-piv.c:3256:piv_pin_cmd: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card-piv.c:3257:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] apdu.c:554:sc_transmit_apdu: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card.c:407:sc_lock: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] card.c:449:sc_lock: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] apdu.c:521:sc_transmit: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] apdu.c:371:sc_single_transmit: called | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] apdu.c:378:sc_single_transmit: CLA:0, INS:20, P1:0, P2:80, data(0) 0x7ffd0ab13760 | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:283:pcsc_transmit: reader 'Yubico Yubikey NEO OTP+U2F+CCID 00 00' | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:284:pcsc_transmit: | |
| Outgoing APDU (4 bytes): | |
| 00 20 00 80 . .. | |
| 0x7f07e7ba4e00 18:37:54.204 [opensc-pkcs11] reader-pcsc.c:212:pcsc_internal_transmit: called | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] reader-pcsc.c:293:pcsc_transmit: | |
| Incoming APDU (2 bytes): | |
| 63 C3 c. | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] apdu.c:390:sc_single_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] apdu.c:543:sc_transmit: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] iso7816.c:119:iso7816_check_sw: Verification failed (remaining tries: 3) | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] card-piv.c:3317:piv_pin_cmd: CI_CANT_USE_GETDATA_FOR_STATE set, assume logged_in=-1 | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] card-piv.c:3340:piv_pin_cmd: piv_pin_cmd tries_left=3, logged_in=-1 | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] card-piv.c:3341:piv_pin_cmd: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] sec.c:216:sc_pin_cmd: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] card.c:459:sc_unlock: called | |
| 0x7f07e7ba4e00 18:37:54.210 [opensc-pkcs11] reader-pcsc.c:662:pcsc_unlock: called | |
| 0x7f07e7ba4e00 18:37:54.217 [opensc-pkcs11] pkcs15-pin.c:705:sc_pkcs15_get_pin_info: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:37:54.217 [opensc-pkcs11] framework-pkcs15.c:559:C_GetTokenInfo: C_GetTokenInfo(0) returns 0x0 | |
| 0x7f07e7ba4e00 18:37:54.217 [opensc-pkcs11] pkcs11-session.c:58:C_OpenSession: C_OpenSession(0x0) | |
| 0x7f07e7ba4e00 18:37:54.217 [opensc-pkcs11] slot.c:448:slot_get_token: Slot(id=0x0): get token | |
| 0x7f07e7ba4e00 18:37:54.217 [opensc-pkcs11] slot.c:466:slot_get_token: Slot-get-token returns OK | |
| 0x7f07e7ba4e00 18:37:54.217 [opensc-pkcs11] pkcs11-session.c:94:C_OpenSession: C_OpenSession handle: 0x5585c14d7080 | |
| 0x7f07e7ba4e00 18:37:54.217 [opensc-pkcs11] pkcs11-session.c:97:C_OpenSession: C_OpenSession() = CKR_OK | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs11-global.c:311:C_Finalize: C_Finalize() | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] ctx.c:845:sc_cancel: called | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] reader-pcsc.c:712:pcsc_cancel: called | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] slot.c:195:card_removed: Yubico Yubikey NEO OTP+U2F+CCID 00 00: card removed | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] slot.c:476:slot_token_removed: slot_token_removed(0x0) | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x0) 1 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs11-session.c:109:sc_pkcs11_close_session: real C_CloseSession(0x5585c14d7080) | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] framework-pkcs15.c:1472:pkcs15_release_token: pkcs15_release_token() not implemented | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] slot.c:476:slot_token_removed: slot_token_removed(0x1) | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x1) 0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] slot.c:476:slot_token_removed: slot_token_removed(0x2) | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x2) 0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] slot.c:476:slot_token_removed: slot_token_removed(0x3) | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs11-session.c:140:sc_pkcs11_close_all_sessions: real C_CloseAllSessions(0x3) 0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs15.c:1273:sc_pkcs15_unbind: called | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] pkcs15-pin.c:826:sc_pkcs15_pincache_clear: called | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] misc.c:61:sc_to_cryptoki_error_common: libopensc return value: 0 (Success) | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card.c:346:sc_disconnect_card: called | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2884:piv_finish: called | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #0, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #1, 0x01 0x5585c1480b30:61 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #2, 0x01 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #3, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #4, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #5, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #6, 0x01 0x5585c148bd70:1324 0x5585c148c470:1311 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #7, 0x01 0x5585c148d640:1281 0x5585c148eaa0:1268 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #8, 0x01 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #9, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #10, 0x01 0x5585c146f200:20 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #11, 0x09 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #12, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #13, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #14, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.823 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #15, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #16, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #17, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #18, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #19, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #20, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #21, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #22, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #23, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #24, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #25, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #26, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #27, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #28, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #29, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #30, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #31, 0x08 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #32, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #33, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #34, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #35, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #36, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #37, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #38, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #39, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #40, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #41, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #42, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #43, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #44, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #45, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #46, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #47, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #48, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #49, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #50, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #51, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #52, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #53, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #54, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #55, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.824 [opensc-pkcs11] card-piv.c:2898:piv_finish: DEE freeing #56, 0x00 (nil):0 (nil):0 | |
| 0x7f07e7ba4e00 18:38:01.833 [opensc-pkcs11] reader-pcsc.c:597:pcsc_disconnect: Yubico Yubikey NEO OTP+U2F+CCID 00 00:SCardDisconnect returned: 0x00000000 | |
| 0x7f07e7ba4e00 18:38:01.833 [opensc-pkcs11] card.c:368:sc_disconnect_card: returning with: 0 (Success) | |
| 0x7f07e7ba4e00 18:38:01.833 [opensc-pkcs11] ctx.c:870:sc_release_context: called | |
| 0x7f07e7ba4e00 18:38:01.833 [opensc-pkcs11] reader-pcsc.c:896:pcsc_finish: called |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
This file has been truncated, but you can view the full file.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| 0x7fe968af8e00 18:41:05.881 [opensc-pkcs11] ctx.c:831:sc_context_create: =================================== | |
| 0x7fe968af8e00 18:41:05.881 [opensc-pkcs11] ctx.c:832:sc_context_create: opensc version: 0.19.0 | |
| 0x7fe968af8e00 18:41:05.881 [opensc-pkcs11] reader-pcsc.c:819:pcsc_init: PC/SC options: connect_exclusive=0 disconnect_action=0 transaction_end_action=0 reconnect_action=0 enable_pinpad=0 enable_pace=1 | |
| 0x7fe968af8e00 18:41:05.881 [opensc-pkcs11] reader-pcsc.c:1300:pcsc_detect_readers: called | |
| 0x7fe968af8e00 18:41:05.881 [opensc-pkcs11] reader-pcsc.c:1313:pcs |
View raw
(Sorry about that, but we can’t show files that are this big right now.)
View raw
(Sorry about that, but we can’t show files that are this big right now.)
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment