Created
February 14, 2026 14:32
-
-
Save HugsLibRecordKeeper/323e7d73e9f2eb5c29db8613bf711a86 to your computer and use it in GitHub Desktop.
Rimworld output log published using HugsLib
This file has been truncated, but you can view the full file.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| Log uploaded on Saturday, February 14, 2026, 3:32:26 PM | |
| Loaded mods: | |
| Prepatcher(jikulopo.prepatcher): 0Harmony(2.4.2), 0PrepatcherAPI(1.2.0), 0PrepatcherDataAssembly(1.0.0), PrepatcherImpl(1.3.3), Prestarter(1.0.0) | |
| Harmony(brrainz.harmony)[mv:2.4.2.0]: 0Harmony(av:2.4.2,fv:2.4.1), HarmonyMod(2.4.2) | |
| Core(Ludeon.RimWorld): (no assemblies) | |
| Royalty(Ludeon.RimWorld.Royalty): (no assemblies) | |
| Ideology(Ludeon.RimWorld.Ideology): (no assemblies) | |
| Biotech(Ludeon.RimWorld.Biotech): (no assemblies) | |
| Anomaly(Ludeon.RimWorld.Anomaly): (no assemblies) | |
| Odyssey(Ludeon.RimWorld.Odyssey): (no assemblies) | |
| Adaptive Storage Framework(adaptive.storage.framework): 0MultiplayerAPI(av:0.5.0,fv:0.5.0), 1ITransformable(1.0.0), AdaptiveStorageFramework(1.2.4), CopyOperation(1.0.0), DefNameLink(1.0.0), GeneratorOperation(1.0.0), GeneratorOperationV2(1.0.0), PatchOperationSet(1.0.0), PatchOperationTryAdd(1.0.0), PostInheritanceOperation(1.0.0), SaveGameCompatibility(1.0.0) | |
| Vanilla Backgrounds Expanded(vanillaexpanded.backgrounds): VBE(1.0.0) | |
| XML Extensions(imranfish.xmlextensions): XmlExtensions(av:1.3.0,fv:1.9.2) | |
| Big and Small - Framework(RedMattis.BetterPrerequisites): 0MultiplayerAPI(av:0.5.0,fv:0.5.0), 0PrepatcherAPI(1.2.0), BigAndSmall(1.0.0), BSXeno(1.0.0), RedHealth(1.0.0) | |
| Vehicle Framework(SmashPhil.VehicleFramework): SmashTools(av:1.6.0,fv:1.6.0), UpdateLogTool(av:1.6.0,fv:1.6.0), Vehicles(av:1.6.0,fv:1.6.0) | |
| HugsLib(UnlimitedHugs.HugsLib)[ov:12.0.0]: 0Harmony(av:2.4.2,fv:1.2.0.1), HugsLib(av:1.0.0,fv:12.0.0) | |
| Vanilla Expanded Framework(OskarPotocki.VanillaFactionsExpanded.Core): 0ModSettingsFramework(1.0.0), 0PrepatcherAPI(1.2.0), KCSG(av:1.1.2,fv:25.11.14), MVCF(2.0.0.1), Outposts(av:3.0.0,fv:1.0.0), PipeSystem(av:1.0.1,fv:22.7.29), VEF(av:1.1.7,fv:1.1.9) | |
| EBSG Framework(EBSG.Framework): EBSGFramework(1.0.9528.17658) | |
| +medical supplies(Boeing.medical.supplies): TestMod(1.0.0) | |
| [1.6 Fork] Xenotype And Ideology Buttons TitleScreen(kenx00x.XenotypeAndIdeologyButtonsTitleScreen16update): XenotypeAndIdeologyButtonsTitleScreen(1.0.0) | |
| [CAT] Show Hair With Hats or Hide All Hats(cat2002.showhair): ShowHair(0.0.0) | |
| [FSF] Better Camp Loot(FrozenSnowFox.BetterCampLoot): (no assemblies) | |
| [IMO]IMO Hairstyles(satoimozou.hair): (no assemblies) | |
| [JF] Royal Carpets(JF.RoyalCarpets): (no assemblies) | |
| [Kit] Graze up(kittahkhan.grazeup): 0Harmony(av:2.4.2,fv:2.2.2), GrazeUp(1.0.0) | |
| [KV] Save Storage, Outfit, Crafting, Drug, & Operation Settings [1.5/1.6](savestoragesettings.kv.rw.fishtmp)[ov:1.3.1.1]: SaveStorageSettings(1.0.0) | |
| [LFS] Genes Expanded - Wings(LazyFridayStudio.GenesExpandedWings): (no assemblies) | |
| [LTS]Ammunition - Framework(LimeTreeSnake.Ammunition): Ammunition(1.0.0) | |
| [NL] Facial Animation - WIP(Nals.FacialAnimation): FacialAnimation(1.0.0) | |
| [PL] Trading Spot(tradingpost.programmerlily.com): TradingSpot(0.0.0) | |
| [sbz] Fridge(sbz.NeatStorageFridge): FixesForSBZFridge(1.0.0) | |
| [sbz] Gravship Storage(sbz.GravshipStorage): (no assemblies) | |
| [sbz] Neat Storage(sbz.NeatStorage): (no assemblies) | |
| [sbz] Workbench Shelf(sbz.NeatStorageWorkbenchShelf): NeatStorageFix(1.0.0) | |
| Achtung!(brrainz.achtung)[mv:4.1.8.0]: Achtung(4.1.8), CrossPromotion(1.1.2), ModFeatures(1.2.7) | |
| Addie's Mantles and Cloaks(addie.addiesmantlesandcloaks): (no assemblies) | |
| Advanced Unnatural Darkness(ANNOProfi.AdvancedUnnaturalDarkness): AdvancedUnnaturalDarkness(1.0.0) | |
| AFU女士发型_Women's hairstyles(JintuziLamian.Hairstyle.AFUWomenshairstyles): (no assemblies) | |
| AFU男士发型_Men's hairstyles(JintuziLamian.Hairstyle.AFUMenshairstyles): (no assemblies) | |
| Akeron Extras - Facial Animations(Newton.AKNExtras.FacialAnimations): (no assemblies) | |
| Allow Tool(UnlimitedHugs.AllowTool): AllowTool(av:3.6.0,fv:3.14.0) | |
| Alpha Biomes(sarg.alphabiomes): AlphaBiomes(1.0.0) | |
| Alpha Books(sarg.alphabooks): AlphaBooks(1.0.0) | |
| Alpha Memes(Sarg.AlphaMemes): AlphaMemes(1.0.0) | |
| Alpha Random(sarg.alpharandom): AlphaRandom(1.0.0) | |
| Animals Logic(Oblitus.AnimalsLogic): AnimalsLogic(1.0.9457.23285) | |
| Anomalies Expected(MrHydralisk.AnomaliesExpected)[mv:3.1.0.2]: Anomalies Expected(0.0.0) | |
| Anomaly Research Asteroid(zoarak.anomalyplat): AnomalySpace(1.0.0) | |
| Antimatter Annihilation(co.uk.epicguru.antimatterannihilation): AntimatterAnnihilation(1.0.0), InGameWiki(av:15.0.1,fv:15.0.1) | |
| Architect Icons(com.bymarcin.ArchitectIcons): ArchitectIcons(1.2.0) | |
| Argonic Core(Argon.CoreLib): ArgonicCore(1.0.0), MaterialReplacement(1.0.0) | |
| Beautiful Outdoors(Meltup.BeautifulOutdoors): (no assemblies) | |
| Beliar Xenotype(ElSov.Beliar): (no assemblies) | |
| Better Gene Inheritance(RedMattis.BetterGeneInheritance): BGInheritance(0.0.0) | |
| Better ground-penetrating scanner(kikohi.BetterGroundPenetratingScanner): BGPScanner(1.0.0) | |
| Better Roads(wastelandr.BetterRoads): (no assemblies) | |
| Better Workbench Management(falconne.BWM): ImprovedWorkbenches(1.6.1.3) | |
| Biomes! Fossils(BiomesTeam.BiomesFossils): BMT_Fossils(1.0.0) | |
| Bionic icons(automatic.bionicicons): BionicIcons(1.0.0) | |
| Biosculpter Pod and Neural Supercharger Resize(Syrus.BPaNSResize): 0Harmony(av:2.4.2,fv:2.3.6), BPaNSResize(1.6.0) | |
| Blood Animations(Fuu.BloodAnimations): BloodAnimations(1.0.0) | |
| Bradson's Main Button Icons (Forked + Expanded)(bs.mbifvte): BMBIFVTE(1.0.0) | |
| CCP's Stone Tweaks Vanilla(cucumpear.stonetweaksvanilla): (no assemblies) | |
| Change map edge limit(kapitanoczywisty.changemapedge): ChangeMapEdge(1.0.0) | |
| Childrens Drawings(zylle.ChildrensDrawings): (no assemblies) | |
| Choose Biome Commonality(Mlie.ChooseBiomeCommonality)[mv:1.6.0]: ChooseBiomeCommonality(0.0.0), VersionFromManifest(0.0.0) | |
| Choose Your Medicine(Kopp.ChooseYourMedicine): ChooseYourMedicine(av:1.0.0,fv:1.1.6) | |
| CM Color Coded Mood Bar [1.1+](CrashM.ColorCodedMoodBar.11): 0Harmony(av:2.4.2,fv:2.1.1), 1SettingsHelper(av:1.3.0.18911,fv:1.3.0), CMColoredMoodBar(1.6.4553.2) | |
| Colored deep resources(kikohi.ColoredDeepResources): DeepLumpColor(1.0.0) | |
| Compact Hediffs(PeteTimesSix.CompactHediffs): PeteTimesSix.CompactHediffs(1.0.0) | |
| Compact Work Tab (Continued)(Mlie.CompactWorkTab)[mv:1.6.0]: CompactWorkTab(0.0.0), VersionFromManifest(0.0.0) | |
| Corpse Description Fix(ferny.CorpseDescriptionFix): CorpseDescriptionFix(1.0.0) | |
| Crafting Quality Rebalanced(phomor.CraftingQualityRebalanced): 0Harmony(av:2.4.2,fv:2.3.6), CraftingQualityRebalanced(av:0.18.0,fv:1.0.0) | |
| Custom player icon (Continued)(Mlie.CustomPlayerIcon)[mv:1.6.0]: CustomPlayerIcon(0.0.0) | |
| Cuter Biotech Cat/Dog Ear Replacer(chris.cutercatearreplacer): (no assemblies) | |
| Cybranian - Events(DimonSever000.Events.Specific): EventsCore(1.0.0) | |
| Dark Ages : Crypts and Tombs(Van.DACrypts): WallTombs(0.0.0) | |
| Deep And Deeper(Shashlichnik.DeepAndDeeper): DeepAndDeeper(1.2.1.9) | |
| Defensive Positions(UnlimitedHugs.DefensivePositions): 0MultiplayerAPI(av:0.5.0,fv:0.5.0), DefensivePositions(av:1.7.0,fv:1.14.0) | |
| Disable Automatically Select Travel Supplies(flangopink.disableautoselecttravelsupplies): AutoSelectBegone(1.0.0) | |
| Dismantle Ancient Junk(proxyer.dismantleancientjunk): (no assemblies) | |
| Dormant Auto-mortars(overpl.DormantAm): (no assemblies) | |
| Drop Loot When Destroyed Framework(Romyashi.DLWDFramework): DLWDFramework(1.0.0) | |
| Dubs Bad Hygiene(Dubwise.DubsBadHygiene): 0DubCore(1.0.0), 0Harmony(av:2.4.2,fv:2.3.6), 0MultiplayerAPI(av:0.5.0,fv:0.3.0), BadHygiene(av:1.0.0,fv:1.0.0) | |
| Dubs Break Mod(Dubwise.DubsBreakMod): 0Harmony(av:2.4.2,fv:2.3.6), DubsBreakMod(av:1.0.9315.25534,fv:1.0.0) | |
| Dubs Mint Menus(Dubwise.DubsMintMenus): 0Harmony(av:2.4.2,fv:2.3.6), DubsMintMenus(av:1.2.9326.41237,fv:1.0.0) | |
| Dubs Mint Minimap(dubwise.dubsmintminimap): 0Harmony(av:2.4.2,fv:2.3.6), DubsMintMinimap(av:1.0.0,fv:1.0.0) | |
| Dubs Performance Analyzer(Dubwise.DubsPerformanceAnalyzer.steam): PerformanceAnalyzer(1.0.0) | |
| Dubs Skylights(Dubwise.DubsSkylights): 0Harmony(av:2.4.2,fv:2.3.6), Dubs Skylight(av:1.5.9327.1301,fv:1.0.0) | |
| Dynamic Trade Interface(zeracronius.dynamictradeinterface): DynamicTradeInterface(1.6.0.5) | |
| Enter Here(Mlie.EnterHere)[mv:1.6.3]: EnterHere(0.0.0), VersionFromManifest(0.0.0), EnterHere_VehiclesPatch(0.0.0) | |
| Erin's Auraeyl(Erin.Auraeyl): ErinsAuraeyl(1.0.0), Frystelk(1.0.9519.36557) | |
| Erin's Baldur's Gate 3 Hairs(Erin.BG3.Hair): (no assemblies) | |
| Erin's Cat Overhaul(Erin.Cats): ErinsCatOverhaul(1.0.9320.25163) | |
| Erin's Cosmetic Genes(Erin.CosmeticGenes): (no assemblies) | |
| Erin's Fluffy Fauna(Erin.FluffyFauna): ErinsFluffyFauna(1.0.0) | |
| Erin's Hairstyles 2(Erin.Hair2): (no assemblies) | |
| Erin's Palamutes(Erin.Palamutes): (no assemblies) | |
| ESCP - Skyshards(SirMashedPotato.ESCP.Skyshards): ESCP_Skyshards(1.0.0) | |
| Expanded Floors(Wemd.ExpandedFloors): (no assemblies) | |
| Extra Explosion Effects(Keshash.ExtraExplosionEffects): VanillaExtraExplosionEffects(1.0.0) | |
| Eye Implants Retextured(MasterLorian.EyeImplantsRetextured): (no assemblies) | |
| Faction Customizer(azravos.factioncustomizer): 0ColourPicker1.6(1.0.0), FactionCustomizer(1.0.0) | |
| Faster Biosculpter Pod(Inglix.FasterBiosculptingPod): 1SettingsHelper-Inglix(av:1.3.0.29447,fv:1.3.0), FasterBiosculpterPod(3.1.9319.41027 [no FileVersionInfo]) | |
| Ferny's Easy Caravan Formation(ferny.EasyCaravanFormation): EasyCaravanFormation(1.0.0) | |
| Float Sub-Menus(kathanon.FloatSubMenu): FloatSubMenu(av:1.0.0,fv:1.0.0) | |
| Flooring Floors(ks.flooringfloors): (no assemblies) | |
| Floors Are (Absolutely) Worthless(Hawkwood.FloorsAreAlmostWorthless): (no assemblies) | |
| Food Poisoning Cures(Crocodil.FoodPoisoningCures): FoodPoisoningCures(1.0.0) | |
| Fuck Learning Helper(ferny.FuckLearningHelper): FuckLearningHelper(1.0.0) | |
| Genetic Heads Framework for [NL] Facial Animation(sd.fa.geneticheadsframework): FacialAnimationGeneticHeads(1.0.0) | |
| Geological Landforms(m00nl1ght.GeologicalLandforms): LunarLoader(1.1.16), TerrainGraph(1.2.2), GeologicalLandforms(1.7.11), GeologicalLandformsMod(1.7.11) | |
| Give up your building (Continued)(Mlie.GiveUpYourBuilding)[mv:1.6.0]: GiveUpYourBuilding(0.0.0) | |
| GlitterNet(K.GlitterNet): GlitterNet(1.0.0) | |
| Graphics Settings+(Telefonmast.GraphicsSettings)[mv:1.0.0]: GraphicSetter(1.0.0) | |
| Gunplay(automatic.gunplay): 0Harmony(av:2.4.2,fv:2.0.2), Gunplay(1.0.379.18) | |
| Hex-Retexture(Hex.Retexture): (no assemblies) | |
| History Auto Cleaner(yefreitor.historyautocleaner): HistoryAutoCleaner(0.0.0) | |
| Houseplants Remastered(HouseplantsRemastered.mp3): (no assemblies) | |
| Inject Genes(Zaf.InjectGene): UseGene(1.0.0) | |
| Interaction Bubbles(Jaxe.Bubbles): Bubbles(4.2.0) | |
| Jewelry(kikohi.jewelry): Jewelry(1.4.3) | |
| Just cut it off! (Emergency Surgery)(Dorely.EmergencySurgery): 0Harmony(av:2.4.2,fv:2.3.1.1), EmergencySurgery(1.1.0) | |
| Just Leave Already(Timuttie.JustLeaveAlready.fork.mitasamodel): LeaveTheMap(1.0.0) | |
| Land On Anything(nep.landonanything)[mv:1.0.3]: 0Harmony(av:2.4.2,fv:2.3.6), LandOnAnything(1.0.0) | |
| Large Animal Beds(cucumpear.animalbeds): (no assemblies) | |
| Large Faction Bases (Continued)(Mlie.LargeFactionBases)[mv:1.6.4]: LargeFactionBase(0.0.0) | |
| Level Up!(Krafs.LevelUp): LevelUp(1.0.0) | |
| LWM's Adaptive Deep Storage(ASF.DeepStorage): (no assemblies) | |
| Mad Skills(ratys.madskills)[mv:2.8.0.0]: 0Harmony(av:2.4.2,fv:1.2.0.1), MadSkills(1.0.0) | |
| Map Preview(m00nl1ght.MapPreview): LunarLoader(av:1.1.16,fv:1.1.17), LunarFramework(1.1.17), MapPreview(1.12.24), HugsLogPublisher(2.1.8), MapPreviewMod(1.12.24) | |
| Map Wide Orbital Trade Beacon(Supes.MapWideOrbitalTradeBeacon): MapWideTradeBeacon(1.0.0.4) | |
| Mechanitor Orbital Platform(zoarak.mechplat): MechSpace(1.0.0) | |
| Mechanoid Invaders(EL.InvMech): EL_IM(1.0.0 [no FileVersionInfo]) | |
| Mechanoids Extraordinaire (Continued)(Spino.MechanoidsExtraordinaire): (no assemblies) | |
| Melee Weapons: Speed and Damage(ac.mw.sad): MeleeWeaponSpeedAndDamage(1.0.0) | |
| Metaflora(SA.Metaflora): (no assemblies) | |
| Mod Options Sort(Superniquito.ModOptionsSort): ModOptionsSort(1.0.0) | |
| Moonlight(Owlchemist.Moonlight): 0Harmony(av:2.4.2,fv:2.3.3), Owlchemist.Moonlight(av:1.5.2,fv:1.5.2) | |
| More Crashed Ship Parts(AtamanDolinskaja.MoreCrashedShipParts): MoreCrashedShipParts(1.0.0) | |
| More Vanilla Textures(tidal.morevanilla.textures): MoreVanillaTextures(1.0.0) | |
| Muzzle Flash(IssacZhuang.MuzzleFlash): 0Harmony(av:2.4.2,fv:2.3.3), MuzzleFlash(1.0.0) | |
| Nephilim Xenotype Reborn(Sov.Nephilim): (no assemblies) | |
| No Forced Slowdown(Dingo.NoForcedSlowdown)[mv:1.6.4497.1]: No Forced Slowdown(1.6.4497.1) | |
| No Random Apparel on Ideology Edit(Edern.NoRandomApparelOnIdeoEdit): NoRandomApparelOnIdeoEdit(1.0.0) | |
| OgreStack(Ogre.OgreStack): OgreStack(1.0.0) | |
| Pawn Editor(ISOREX.PawnEditor): PawnEditor(av:1.0.9,fv:1.0.9) | |
| Performance - Slower Pawn Tick Rate(Arkymn.SlowerPawnTickRate): SlowerPawnTickRate(1.0.0) | |
| Performance Optimizer(Taranchuk.PerformanceOptimizer): PerformanceOptimizer(1.0.0) | |
| Persistent Precepts(Alleykat.PersistentPrecepts): Persistent Precepts(1.0.0) | |
| Perspective: Paths (unlisted)(Owlchemist.PerspectivePaths): 0Harmony(av:2.4.2,fv:2.3.3), PerspectivePaths(av:1.0.0,fv:1.0.0) | |
| Pick Up And Haul(Mehni.PickUpAndHaul): IHoldMultipleThings(1.0.0), PickUpAndHaul(1.0.0) | |
| Ponpeco Accessories(ponpeco.PonpecoAccessories): (no assemblies) | |
| Ponpeco Furnitures : Kids' Room(ponpeco.PFKidsRoom): (no assemblies) | |
| Ponpeco Furnitures : Sci-Fi(ponpeco.PFSF): (no assemblies) | |
| Ponpeco Hair(ponpeco.PPHair): (no assemblies) | |
| Ponpeco Kids' Clothes(ponpeco.KidsClothes): (no assemblies) | |
| Prisoners Should Fear Turrets(Mlie.PrisonersShouldFearTurrets)[mv:1.6.0]: PrisonersShouldFearTurrets(0.0.0), VersionFromManifest(0.0.0) | |
| Progress Renderer(neptimus7.progressrenderer)[mv:1.5.2]: Progress-Renderer(1.5.0) | |
| PsiTech(K.PsiTech): PsiTech(1.0.0) | |
| RaiderInfo[1.6] - Forked(pluralled.raiderinfo): RaiderInfo(0.1.0) | |
| Range Finder(brrainz.rangefinder)[mv:2.6.1.0]: 0Harmony(av:2.4.2,fv:1.2.0.1), CrossPromotion(1.1.2), RangeFinder(2.6.1) | |
| RBSE(Rah.RBSE): RahCom(1.0.0 [no FileVersionInfo]), rimworld2020(1)(1.0.0 [no FileVersionInfo]) | |
| Recipe icons (Continued)(Mlie.RecipeIcons)[mv:1.6.1]: RecipeIcons(0.0.0) | |
| Reel's Frieren Hairs(Reel.Hair2): (no assemblies) | |
| Reel's Galactic Hairs(Reel.Hair): (no assemblies) | |
| Relevant Stats In Description(Mlie.RelevantStatsInDescription)[mv:1.6.4]: RelevantStatsInDescription(0.0.0), VersionFromManifest(0.0.0) | |
| Remove Gradual Relations Decay - Patchy(gerads.RemoveGradualRelationsDecayPatchy): RemoveGradualRelationsDecay(1.0.0) | |
| ReplaceLib(ferny.ReplaceLib): ReplaceLib(1.0.0) | |
| ResearchPowl(Owlchemist.ResearchPowl): ResearchPowl(av:1.9.0,fv:1.9.0) | |
| ReSplice: Core(ReSplice.XOTR.Core): LogModVersion(1.0.0), ReSpliceCore(1.0.0) | |
| Restrict Undrawn Apparel(ferny.RestrictUndrawnApparel): RestrictUndrawnApparel(1.0.0) | |
| Rev Additional Xenotype Icons(Rev.IconXenotypes): (no assemblies) | |
| Rim-Effect Renegade: Core(RimEffectRenegade.Core): RimEffect(1.6.9319.33231) | |
| RimHUD(Jaxe.RimHUD): RimHUD(1.17.5) | |
| Rimsenal Xenotype Pack - Askbarn(Rimsenal.Askbarn): (no assemblies) | |
| Rimsenal Xenotype Pack - Harana(Rimsenal.Harana): (no assemblies) | |
| Rimsenal Xenotype Pack - Zohar(Rimsenal.Zohar): (no assemblies) | |
| River's Tribal Shoes(River.Tribal.Shoes): (no assemblies) | |
| Roo's HD Dreadlock Hairstyles(Rooboid.DreadlockHairsHD): (no assemblies) | |
| Roo's HD Hairstyles(Rooboid.Hdhair): (no assemblies) | |
| Roo's HD Royalty Hairstyles(Rooboid.RoyalhairHD)[mv:0.1.0.0]: (no assemblies) | |
| RoofBomb (Continued)(Mlie.RoofBomb)[mv:1.6.0]: RoofBomb(0.0.0) | |
| RunAndGun - Continued(MemeGoddess.RunAndGun)[ov:5.0.0]: RunAndGun(1.0.0) | |
| Safe Drug Policy Generator(seohyeon.bestdrugpolicy): BestDrugPolicyGen(1.0.0) | |
| Search and Destroy (Continued)(MemeGoddess.SearchAndDestroy): SearchAndDestroy(1.0.0) | |
| Show Weapon Tallies(kathanon.ShowWeaponTallies): ShowWeaponTallies(1.0.0) | |
| Simple sidearms(PeteTimesSix.SimpleSidearms): SimpleSidearms(1.4.6) | |
| SimpleCameraSetting(ray1203.SimpleCameraSetting): 0Harmony(av:2.4.2,fv:2.4.1), BetterKeybinding(av:5.0.0,fv:5.5.109), SimpleCameraSetting(1.0.0) | |
| Smart Speed(sarg.smartspeed): 0Harmony(av:2.4.2,fv:2.3.6), SmartSpeed(1.0.0) | |
| Smarter Deconstruction and Mining (Continued)(Mlie.SmarterDeconstructionAndMining)[mv:1.6.0]: SmartDeconstruct(0.0.0), VersionFromManifest(0.0.0) | |
| Snap Out!(weilbyte.snapout): 0MultiplayerAPI(av:0.5.0,fv:0.5.0), SnapOut(av:0.9.1,fv:0.9.1) | |
| Solar Flares Affect Mechanoids(sirrandoo.msf)[mv:1.0.1.0]: 0Harmony(av:2.4.2,fv:1.2.0.1), Mechanoid v Solar Flare(av:1.0.0,fv:1.0.3) | |
| Space Turbulence(HaiLuan.SpaceTurbulence): SpaceTurbulence(1.0.0) | |
| Sparkling Worlds Addon - Blue Moon Corp - Standalone Addon(Albion.SparklingWorlds.Addon.BlueMoon)[mv:2.4.0]: SparklingWorldsBlueMoon(1.0.0) | |
| Stuff List (Continued)(Mlie.StuffList)[mv:1.6.3]: StuffList(0.0.0), VersionFromManifest(0.0.0) | |
| Tab-sorting(Mlie.TabSorting)[mv:1.6.4]: TabSorting(0.0.0), VersionFromManifest(0.0.0) | |
| Tainted Renaming(Divinorium.TaintedRenaming): TaintedRenaming(1.0.0) | |
| The Sims Traits(Goji.TheSimsTraits): SimsTraits(1.0.0) | |
| Toggle Harvest(Jaxe.ToggleHarvest): ToggleHarvest(1.10.0) | |
| Toggleable Overlays(Owlchemist.ToggleableOverlays): 0Harmony(av:2.4.2,fv:2.3.3), ToggleableOverlays(av:2.2.0,fv:2.2.0) | |
| Toggleable Readouts(Owlchemist.ToggleableReadouts): 0Harmony(av:2.4.2,fv:2.3.3), ToggleableReadouts(av:1.2.3,fv:1.2.3) | |
| Trade Ships Drop Spot(smashphil.dropspot)[mv:1.4.0]: 0Harmony(av:2.4.2,fv:1.2.0.1), DropSpot(1.0.0) | |
| Traders Have Money(captaingeorge.TradersHaveMoney): (no assemblies) | |
| Trait and Backstory Icons(Superniquito.TraitIcons): TraitIcons(1.0.0) | |
| True Unnatural Darkness(mb.TrueUnnaturalDarkness): (no assemblies) | |
| UI Not Included: Customizable UI Overhaul(GonDragon.UINotIncluded): UINotIncluded(1.2.9447.18333) | |
| UNAGI Vanilla Hairs うなぎのバニラ髪(UNAGI.Hairs.B.Zibunyou): (no assemblies) | |
| UNAGI_Hair1(UNAGI.Kawaii.hair1): (no assemblies) | |
| UNAGI_Hair2(UNAGI.Short.hair2): (no assemblies) | |
| Undraft After Tucking Forked(AMagicalLime.undraftaftertucking): UndraftAfterTucking_1_6(1.0.0 [no FileVersionInfo]) | |
| Unlimited Threat Scale(unlimitedthreatscale.1trickPwnyta): UnlimitedThreatScale(1.0.0) | |
| Ushankas Glittertech Expansion(Ushanka.GlittertechExpansion): GlittertechExpansion(0.1.0) | |
| Ushankas Hacking Expansion(Ushanka.HackingExpansion): HackingExpansion(0.1.0) | |
| Ushankas Luciferium Expansion(Ushanka.LuciferiumExpansion): LuciferiumExpansion(0.1.0) | |
| Vanilla Animals Expanded(VanillaExpanded.VanillaAnimalsExpanded): (no assemblies) | |
| Vanilla Animals Expanded — Endangered(VanillaExpanded.VAEEndAndExt): VanillaAnimalsExpandedEndangered(1.0.0) | |
| Vanilla Animals Expanded — Royal Animals(VanillaExpanded.VAERoy): VanillaAnimalsExpandedRoyal(1.0.0) | |
| Vanilla Animals Expanded — Waste Animals(VanillaExpanded.VAEWaste): VanillaAnimalsExpandedWaste(1.0.0) | |
| Vanilla Anomaly Expanded - Insanity(VanillaExpanded.VAnomalyEInsanity): VAEInsanity(0.0.0) | |
| Vanilla Apparel Expanded(VanillaExpanded.VAPPE)[mv:1.2.0]: (no assemblies) | |
| Vanilla Apparel Expanded — Accessories(VanillaExpanded.VAEAccessories): VAE Accessories(1.0.0) | |
| Vanilla Armour Expanded(VanillaExpanded.VARME)[mv:1.2.0]: (no assemblies) | |
| Vanilla Aspirations Expanded(VanillaExpanded.VanillaAspirationsExpanded): 0PrepatcherAPI(1.2.0), VAspirE(1.0.0) | |
| Vanilla Backstories Expanded(VanillaExpanded.VanillaBackstoriesExpanded): (no assemblies) | |
| Vanilla Base Generation Expanded(VanillaExpanded.BaseGeneration): (no assemblies) | |
| Vanilla Brewing Expanded(VanillaExpanded.VBrewE): VanillaBrewingExpanded(1.0.0) | |
| Vanilla Combat Reloaded(Donald.VCR): VanillaCombatReloaded(1.0.0) | |
| Vanilla Cooking Expanded(VanillaExpanded.VCookE): VanillaCookingExpanded(1.0.0) | |
| Vanilla Events Expanded(VanillaExpanded.VEE)[mv:1.1.0]: VEE(1.4.2) | |
| Vanilla Factions Expanded - Classical(OskarPotocki.VFE.Classical): VFEC(1.0.0) | |
| Vanilla Factions Expanded - Empire(OskarPotocki.VFE.Empire): VFEEmpire(1.0.0) | |
| Vanilla Factions Expanded - Insectoids 2(OskarPotocki.VFE.Insectoid2): VFEInsectoids(0.0.0) | |
| Vanilla Factions Expanded - Medieval 2(OskarPotocki.VFE.Medieval2): VFEMedieval(1.0.6) | |
| Vanilla Factions Expanded - Settlers(OskarPotocki.VanillaFactionsExpanded.SettlersModule)[mv:1.2.0.0]: VFE_Settlers(1.0.0) | |
| Vanilla Factions Expanded - Tribals(OskarPotocki.VFE.Tribals): VFETribals(1.0.0) | |
| Vanilla Fishing Expanded(VanillaExpanded.VCEF): VCE-Fishing(1.0.0) | |
| Vanilla Food Variety Expanded(VanillaExpanded.VanillaFoodVarietyExpanded): VanillaCookingExpandedVariety(1.0.0) | |
| Vanilla Furniture Expanded(VanillaExpanded.VFECore)[mv:1.1.0]: VanillaFurnitureEC(1.4.0) | |
| Vanilla Furniture Expanded - Architect(VanillaExpanded.VFEArchitect): VFEArchitect(1.0.0) | |
| Vanilla Furniture Expanded - Art(VanillaExpanded.VFEArt)[mv:1.0.3]: (no assemblies) | |
| Vanilla Furniture Expanded - Farming(VanillaExpanded.VFEFarming)[mv:1.0.1.0]: VFEF(1.0.0) | |
| Vanilla Furniture Expanded - Medical Module(VanillaExpanded.VFEMedical)[mv:1.1.0]: VanillaFurnitureEM(1.0.0) | |
| Vanilla Furniture Expanded - Power(VanillaExpanded.VFEPower): VanillaPowerExpanded(1.0.0) | |
| Vanilla Furniture Expanded - Production(VanillaExpanded.VFEProduction)[mv:1.0.3.0]: (no assemblies) | |
| Vanilla Furniture Expanded - Security(VanillaExpanded.VFESecurity)[mv:1.1.1.0]: VFESecurity(0.0.0) | |
| Vanilla Furniture Expanded - Spacer Module(VanillaExpanded.VFESpacer): MFSpacer(av:1.1.3,fv:1.0.0) | |
| Vanilla Genes Rebalanced(RedMattis.VanillaGenesRebalanced): (no assemblies) | |
| Vanilla Gravship Expanded - Chapter 1(vanillaexpanded.gravship): BunkBeds(1.0.0), VanillaGravshipExpanded(1.0.0) | |
| Vanilla Hair Expanded(VanillaExpanded.VHE)[mv:1.0.3]: VanillaHairExpanded(1.2.0) | |
| Vanilla Helixien Gas Expanded(VanillaExpanded.HelixienGas): VHelixienGasE(av:1.0.0,fv:1.0.1) | |
| Vanilla Ideology Expanded - Dryads(VanillaExpanded.Ideo.Dryads): VanillaIdeologyExpandedDryads(1.0.0) | |
| Vanilla Ideology Expanded - Hats and Rags(VanillaExpanded.VIEHAR): (no assemblies) | |
| Vanilla Ideology Expanded - Icons and Symbols(VanillaExpanded.Ideo.IconsandSymbols): (no assemblies) | |
| Vanilla Ideology Expanded - Relics and Artifacts(VanillaExpanded.Ideo.RelicsAndArtifacts): (no assemblies) | |
| Vanilla Ideology Expanded - Sophian Style(VanillaExpanded.Ideo.SophianStyle): (no assemblies) | |
| Vanilla Landmarks Expanded(VanillaExpanded.VExplorationE): VanillaExplorationExpanded(1.0.0) | |
| Vanilla Nutrient Paste Expanded(VanillaExpanded.VNutrientE): VNPE(1.0.0) | |
| Vanilla Outposts Expanded(vanillaexpanded.outposts): VOE(av:3.0.0,fv:1.0.0) | |
| Vanilla Persona Weapons Expanded(VanillaExpanded.VPersonaWeaponsE): VanillaPersonaWeaponsExpanded(1.0.0) | |
| Vanilla Plants Expanded - Succulents(VanillaExpanded.VPlantsESucculents): (no assemblies) | |
| Vanilla Psycasts Expanded(VanillaExpanded.VPsycastsE): VanillaPsycastsExpanded(1.1.0) | |
| Vanilla Quests Expanded - Ancients(vanillaquestsexpanded.ancients): VanillaQuestsExpandedAncients(1.0.0) | |
| Vanilla Quests Expanded - Cryptoforge(vanillaquestsexpanded.cryptoforge): VanillaQuestsExpandedCryptoforge(1.0.0) | |
| Vanilla Quests Expanded - Deadlife(vanillaquestsexpanded.deadlife): VanillaQuestsExpandedDeadlife(1.0.0) | |
| Vanilla Quests Expanded - The Generator(vanillaquestsexpanded.generator): VanillaQuestsExpandedTheGenerator(1.0.0) | |
| Vanilla Races Expanded - Android(vanillaracesexpanded.android): VREAndroids(1.1.0) | |
| Vanilla Races Expanded - Custom Icons(vanillaracesexpanded.customicons): (no assemblies) | |
| Vanilla Races Expanded - Fungoid(vanillaracesexpanded.fungoid): VanillaRacesExpanded-Fungoid(1.0.0) | |
| Vanilla Races Expanded - Genie(vanillaracesexpanded.genie): 0Harmony(av:2.4.2,fv:2.3.6), VanillaRacesExpanded-Genie(1.0.0) | |
| Vanilla Races Expanded - Highmate(vanillaracesexpanded.highmate): VanillaRacesExpandedHighmate(1.0.1) | |
| Vanilla Races Expanded - Hussar(vanillaracesexpanded.hussar): VREHussars(1.0.0) | |
| Vanilla Races Expanded - Lycanthrope(vanillaracesexpanded.lycanthrope): 0Harmony(av:2.4.2,fv:2.3.6), VanillaRacesExpanded-Lycanthrope(1.0.0) | |
| Vanilla Races Expanded - Phytokin(vanillaracesexpanded.phytokin): VanillaRacesExpanded-Phytokin(1.0.0) | |
| Vanilla Races Expanded - Pigskin(vanillaracesexpanded.pigskin): 0Harmony(av:2.4.2,fv:2.3.1.1), VanillaRacesExpanded-Pigskin(1.0.0) | |
| Vanilla Races Expanded - Sanguophage(vanillaracesexpanded.sanguophage): VanillaRacesExpanded-Sanguophage(1.0.0) | |
| Vanilla Races Expanded - Saurid(vanillaracesexpanded.saurid): VRESaurids(1.0.9517.33439) | |
| Vanilla Races Expanded - Starjack(vanillaracesexpanded.starjack): VanillaRacesExpandedStarjack(1.0.0) | |
| Vanilla Races Expanded - Waster(vanillaracesexpanded.waster): 0Harmony(av:2.4.2,fv:2.3.1.1), VanillaRacesExpanded-Waster(1.0.0) | |
| Vanilla Recycling Expanded(VanillaExpanded.Recycling): VanillaRecyclingExpanded(1.0.0) | |
| Vanilla Social Interactions Expanded(VanillaExpanded.VanillaSocialInteractionsExpanded): VanillaSocialInteractionsExpanded(0.0.0) | |
| Vanilla Storytellers Expanded - Perry Persistent(VSE.PerryPersistent): (no assemblies) | |
| Vanilla Storytellers Expanded - Winston Waves(VanillaStorytellersExpanded.WinstonWave): VSEWW(1.0.2.2) | |
| Vanilla Trading Expanded(VanillaExpanded.VanillaTradingExpanded): VanillaTradingExpanded(1.0.0) | |
| Vanilla Traits Expanded(VanillaExpanded.VanillaTraitsExpanded): VanillaTraitsExpanded(1.4.1) | |
| Vanilla Vehicles Expanded(OskarPotocki.VanillaVehiclesExpanded): VanillaVehiclesExpanded(1.0.0) | |
| Vanilla Weapons Expanded(VanillaExpanded.VWE)[mv:1.0.5.0]: (no assemblies) | |
| Vanilla Weapons Expanded - Coilguns(VanillaExpanded.VWEC): (no assemblies) | |
| Vanilla Weapons Expanded - Grenades(VanillaExpanded.VWEG): (no assemblies) | |
| Vanilla Weapons Expanded - Laser(VanillaExpanded.VWEL)[mv:1.1.0]: (no assemblies) | |
| Vanilla Weapons Expanded - Makeshift(VanillaExpanded.VWEMS): (no assemblies) | |
| Vanilla Weapons Expanded - Non-Lethal(VanillaExpanded.VWENL): VanillaWeaponsExpandedNonLethal(1.0.0) | |
| Vanilla Weapons Expanded - Tribal(VanillaExpanded.VWETB): (no assemblies) | |
| Various Space Ship Chunk (Continued)(Mlie.VariousSpaceShipChunk)[mv:1.6.0]: ShipChunkTranspiler(0.0.0), VersionFromManifest(0.0.0) | |
| VGP Garden Fabrics(dismarzero.VGP.VGPGardenFabrics): (no assemblies) | |
| Visible Raid Points(visibleraidpoints.1trickPwnyta): VisibleRaidPoints(1.0.0) | |
| Visual XML Patches(Mlie.VisualXMLPatches)[mv:1.6.0]: VersionFromManifest(0.0.0), VisualXMLPatches(0.0.0) | |
| Way Better Romance(divineDerivative.Romance): 0DivineFramework(0.12.0.1), WayBetterRomance(1.0.0) | |
| Weapon Condition Matters, and so does Quality(Xaviien.WeaponConditionMattersAndSoDoesQuality): (no assemblies) | |
| WeaponStats(bodlosh.WeaponStats): WeaponsTab(1.0.9318.36898) | |
| What's for sale?(kikohi.whatsforsale): WDYS(1.1.0) | |
| What's That Mod(co.uk.epicguru.whatsthatmod): 0ColourPicker(1.0.0 [no FileVersionInfo]), WhatsThatMod(1.0.0) | |
| Won hair_men(won.hair): (no assemblies) | |
| Won hair_women (won2.hair): (no assemblies) | |
| Worldbuilder(ferny.Worldbuilder): Worldbuilder(1.0.0) | |
| Xenotype Spawn Control(bs.xenotypespawncontrol): XenotypeSpawnControl(1.1.2) | |
| [JPT] Soft Warm Beds (Continued)(Mlie.JPTSoftWarmBeds)[mv:1.6.4]: JPTools(0.0.0), SoftWarmBeds(0.0.0), VersionFromManifest(0.0.0) | |
| [LTS]Ammunition - Simple Ammo Pack(LimeTreeSnake.Ammo): (no assemblies) | |
| Alpha Mechs(sarg.alphamechs): AlphaMechs(1.0.0) | |
| Ambiguous Anomaly(ferny.ambiguousanomaly): (no assemblies) | |
| Ancient Junk Loot(Romyashi.AncientJunkLoot): (no assemblies) | |
| Ancient urban ruins(XMB.AncientUrbanrUins.MO): ACM_RandomBuildings(1.0.0 [no FileVersionInfo]), AncientMarket_Libraray(1.0.0), AncientMarketAI_Libraray(1.0.0), BuildingExtraRenderer(1.0.0), DebugLogHarmony(1.0.0 [no FileVersionInfo]), 手电筒(1.0.0) | |
| Antimatter Annihilation Retextured(Halituisamaricanous.antimatterannihilationretextured): (no assemblies) | |
| Cat's Boots and Gloves(CatLover366.BootsAndGloves)[mv:1.0.0]: (no assemblies) | |
| Dark Ages : Beasts and Monsters(Van.Beasts): Bestiary(1.0.0), BestiaryGoldilox(1.0.0), BloodSuckingAnimals(1.0.0), CHAoEOC(1.0.0), DamageAbility(1.0.0), EmergingAnimals(1.0.0), IllogicalPredator(1.0.9312.17556), WanderPreference(1.0.0) | |
| Deep And Deeper - Cavern Texture(Bishaojiu.DeepAndDeeperCavernTexture): (no assemblies) | |
| Deep And Deeper - Ladder retexture(Deon.DeepAndDeeperLadder): (no assemblies) | |
| Drawn Spots(overpl.DrawnSpots): (no assemblies) | |
| Expanded Materials - Masonry(Argon.ExpandedMaterials.Masonry): ExpandedMaterialsMasonry(1.0.0) | |
| Genetic Biotech for Facial Animation(sd.fa.geneticheadsbiotech): (no assemblies) | |
| Genetic Mods for Facial Animation(sd.fa.geneticheadsmods): (no assemblies) | |
| Mashed's Ashlands(SirMashedPotato.Ashlands): Mashed_Ashlands(1.0.0) | |
| More Linkables(4loris4.MoreLinkables): (no assemblies) | |
| More Ritual Rewards(Sinnamon.MoreRitualRewards): ritualRewards(1.0.0) | |
| Nice Inventory Tab(Andromeda.NiceInventoryTab): FloatSubMenu(av:1.0.0,fv:1.0.0), NiceInventoryTab(1.0.0) | |
| Optional Icons for Architect Icons(proxyer.optionalicons4ai): (no assemblies) | |
| Projectile Bullet Retexture(ND.RTPJ): (no assemblies) | |
| Reel's Facial Animation Textures(Reel.FacialAnims): (no assemblies) | |
| ReGrowth 2(ReGrowth.BOTR.Core): 0ModSettingsFramework(1.0.0), LogModVersion(1.0.0), ReGrowthCore(0.0.0) | |
| ReSplice: Charmweavers(ReSplice.XOTR.Charmweavers): LogModVersion(1.0.0), ReSpliceCharmweavers(1.0.0) | |
| Rim-Effect Renegade: Asari and Reapers(RimEffectRenegade.AsariReapers): RimEffectAsariReapers(1.6.9319.33483) | |
| Roo's Faun Xenotype(V.Rooboid.Faun): Roos Faun Xenotype(1.0.0) | |
| Vanilla Brewing Expanded - Coffees and Teas(VanillaExpanded.VBrewECandT): (no assemblies) | |
| Vanilla Chemfuel Expanded(VanillaExpanded.VChemfuelE): VCHE(1.0.5) | |
| Vanilla Cooking Expanded - Bakery(VanillaExpanded.VCookEBakery): VanillaCookingExpandedBakery(1.0.0) | |
| Vanilla Cooking Expanded - Haute(VanillaExpanded.VCookEHaute): VanillaCookingExpandedHaute(1.0.0) | |
| Vanilla Cooking Expanded - Stews(VanillaExpanded.VCookEStews): (no assemblies) | |
| Vanilla Cooking Expanded - Sushi(VanillaExpanded.VCookESushi): VanillaSushiExpanded(1.0.0) | |
| Vanilla Factions Expanded - Deserters(OskarPotocki.VFE.Deserters): VFED(1.0.0) | |
| Vanilla Factions Expanded - Pirates(OskarPotocki.VFE.Pirates): VFEPirates(1.0.0) | |
| Vanilla Fishing Expanded - Fishing Treasures AddOn(VanillaExpanded.VCEFAddon): (no assemblies) | |
| Vanilla Psycasts Expanded - Hemosage(VanillaExpanded.VPE.Hemosage): VPEHemosage(1.0.1) | |
| Vanilla Races Expanded - Archon(vanillaracesexpanded.archon): VREArchon(1.0.0) | |
| Vanilla Textures Expanded - Variations(VanillaExpanded.VTEXVariations): (no assemblies) | |
| Vanilla Vehicles Expanded - Tier 3(OskarPotocki.VanillaVehiclesExpandedTier3): VanillaVehiclesExpanded-Tier3(1.0.0) | |
| Vanilla Vehicles Expanded - Upgrades(OskarPotocki.VanillaVehiclesExpandedUpgrades): (no assemblies) | |
| Vanilla Weapons Expanded - Heavy Weapons(VanillaExpanded.VWEHW): (no assemblies) | |
| Vanilla Weapons Expanded - Quickdraw(VanillaExpanded.VWEQ)[mv:1.1.0]: (no assemblies) | |
| VFE Vitals Control Centre Resize(Spacemoth.VFAVCCRsze)[mv:1.0.1.0]: (no assemblies) | |
| VSIE - Rational Trait Development(Stagz.VSIERationalTraitDevelopment): VSIERationalTraitDevelopment(1.0.0) | |
| Won Hair Men Retextured(Neronix17.Retexture.WonHairMen): (no assemblies) | |
| Won Hair Women Retextured(Neronix17.Retexture.WonHairWomen): (no assemblies) | |
| Yayo's Animation (Continued)(com.yayo.yayoAni.continued): 0PrepatcherAPI(1.2.0), yayoAni(1.0.0) | |
| A Dog Said... Animal Prosthetics 2(SamBucher.ADogSaidAnimalProsthetics2): JPatchOperation(av:1.0.0,fv:1.0.0) | |
| Appliances Expanded(scpchemfuel.appliances): AppliancesExpanded(1.0.0), VChemEAppliances(1.0.0) | |
| Facial Animation Xenotype Eye Color Patches(LekkoBot.eyepatchcollection): (no assemblies) | |
| Progression: Storytellers(ferny.ProgressionStorytellers): ProgressionStorytellers(1.0.0) | |
| ReBuild: Doors and Corners(ReBuild.COTR.DoorsAndCorners): LogModVersion(1.0.0), ReBuildDoorsAndCorners(1.0.0) | |
| Simple FX: Smoke(Owlchemist.SimpleFX.Smoke2): 0Harmony(av:2.4.2,fv:2.3.3), simplefxsmoke(av:2.5.2,fv:2.5.2) | |
| Vanilla Plants Expanded(VanillaExpanded.VPlantsE): VanillaPlantsExpanded(1.0.0) | |
| Vanilla Textures Expanded(VanillaExpanded.VTEXE)[mv:1.0.0]: VanillaTexturesExpanded(1.0.1) | |
| Vanilla Textures Expanded - [NL] Facial Animation(VanillaExpanded.VTEXE.FacialAnims): (no assemblies) | |
| Vanilla Weapons Expanded - Frontier(VanillaExpanded.VWEFT): (no assemblies) | |
| [BT] EyeGenes2 | Base - [NL] Facial Animation |(Oppey.EyeGenes2): (no assemblies) | |
| [HRK] Vanilla Expanded Extra Embrasures(Harkon.VEAddOn.VanillaExpandedExtraEmbrasures): HRKVEEEVFEMedieval(1.0.0) | |
| Big and Small - Genes & More(RedMattis.BigSmall.Core): (no assemblies) | |
| Biotech Mechanoid Retexture(EL.BiotechMechRT): (no assemblies) | |
| Erin's Body Retexture(Erin.Body.Texture): (no assemblies) | |
| Expanded Materials - Metals(Argon.ExpandedMaterials.Metals): (no assemblies) | |
| More and Retextured Head Shapes for VTE for Facial Animation(sd.fa.vte.moreheadshapes): (no assemblies) | |
| Van's Retexture : Hemogen Vials (sirvan.hemogentexture): (no assemblies) | |
| Van's Retexture : Mechanitor(SirVan.MechanitorRetexture): (no assemblies) | |
| Van's Retexture : Melee Weapons(sirvan.MWRetextured): (no assemblies) | |
| Van's Retexture : Organ jars(sirvan.organretexture): (no assemblies) | |
| Vanilla Ideology Expanded - Anima Theme(VanillaExpanded.VIEAT): VIEAT(1.0.0) | |
| Vanilla Plants Expanded - More Plants(VanillaExpanded.VPlantsEMore): VanillaPlantsExpandedMorePlants(1.0.0) | |
| Vanilla Plants Expanded - Mushrooms(VanillaExpanded.VPlantsEMushrooms): VanillaPlantsExpandedMushrooms(1.0.0) | |
| Vanilla Races Expanded - Insector(vanillaracesexpanded.insector): VanillaRacesExpanded-Insector(1.0.0) | |
| Alpha Animals(sarg.alphaanimals): AlphaBehavioursAndEvents(1.0.0) | |
| Rustic Meal Retexture(Jelheb.RusticMealRetexture): (no assemblies) | |
| Alpha Genes(sarg.alphagenes): AlphaGenes(1.0.0) | |
| Clean Textures(IH.Clean.Textures): (no assemblies) | |
| Generally More Research(ferny.generallymoreresearch): (no assemblies) | |
| Vanilla Genetics Expanded(VanillaExpanded.VGeneticsE): GeneticRim(1.0.0) | |
| Vanilla Ideology Expanded - Memes and Structures(VanillaExpanded.VMemesE): VanillaMemesExpanded(1.0.0) | |
| [FSF] Better Ancient Complex Loot(FrozenSnowFox.BetterAncientComplexLoot): (no assemblies) | |
| [FSF] Better Anomaly Loot(FrozenSnowFox.BetterAnomalyLoot): (no assemblies) | |
| [FSF] FrozenSnowFox Tweaks(FrozenSnowFox.FrozenSnowFoxTweaks): (no assemblies) | |
| Alpha Genes Integrated(kupa.AlphaGenesIntegrated): kupa_AlphaGenesIntegrated(1.0.0) | |
| Anomaly Fleshbeasts or Sarg Fleshbeasts?(ferny.fleshbeasts): (no assemblies) | |
| Progression: Agriculture(ferny.progressionagriculture): ProgressionAgriculture(1.0.0), RandomVegetables(1.0.0) | |
| Shavius's Vanilla Expanded Patches(shavius.VEpatches): (no assemblies) | |
| Styles Unleashed(tests.StylesToVTE): (no assemblies) | |
| Vanilla Genetics Expanded - More Lab Stuff(VanillaExpanded.VGeneticsEMoreLabStuff): GeneticRimAddOn(1.0.0) | |
| Vanilla Xenotypes Improved(GrillMaster.vanillaxenotypesimproved): VanillaXenotypesImproved(1.0.0) | |
| [FSF] Complex Jobs(FrozenSnowFox.ComplexJobs): (no assemblies) | |
| Progression: Core(ferny.progressioncore): ProgressionCore(0.0.0) | |
| Wild Crops, a fork of Wild Spawn(SomethingSomething.PlantsAndStuff): (no assemblies) | |
| Progression: Production(ferny.progressionproduction): (no assemblies) | |
| Progression: Scenarios(ferny.ProgressionScenarios): ProgressionScenarios(1.0.0) | |
| Progression: Education(ferny.ProgressionEducation): ProgressionEducation(1.0.0) | |
| Progression: Gravship(ferny.ProgressionGravship): ProgressionGravship(1.0.0) | |
| Too Many Mods - Compats and Rebalances(Wara.toomanymods): AutoCapitalizationFix(1.0.0), InspirationExtension(1.0.0), JoyKindExtension(1.0.0), Misc(1.0.0), PawnKindExtension(1.0.0), TMMSettings(1.0.0), VWENonLethal(1.0.0), TMM_VREStarjack(1.0.0), TMM_VQEA(1.0.0), TooManyMods_VGE(1.0.0 [no FileVersionInfo]), VGE_Disable_Patch_HealthScale(1.0.0), PathUnlockOnFirstPsylink(1.0.0), TMM_VPE(1.0.0), AspirationExtension(1.0.0), TMM_VFEC(1.0.0), RandomItemSpawner(1.0.0), AlphaGenes_BlacklistForGermlineMutator(1.0.0), ReSplice_Disable_Hediff_CurStage_Patch(1.0.0), VTE_Disable_Pawn_CombinedDisabledWorkTags_Patch(1.0.0), VEF_VF(1.0.0 [no FileVersionInfo]) | |
| Rev Misc Patch(rev.miscpatch): (no assemblies) | |
| Rev Xenotypes(rev.xenotypes): (no assemblies) | |
| Active Harmony patches: | |
| ACM_QuestNode_Root_AncientRandomSite.RunInt: (no patches) | |
| AI_AvoidGrid.Ensure: (no patches) | |
| AMUtility.GetSubMaps: (no patches) | |
| AbandonedCamp.<>c__DisplayClass5_0.<Visit>b__0: (no patches) | |
| Ability.GetDescriptionForPawn: (no patches) | |
| Ability.PreActivate: post: EBSGFramework.HarmonyPatches.PreActivatePostfix | |
| AbilityExtension_ExtraHediffs.Cast: (no patches) | |
| AbilityExtension_OnlyNonHemogenicHumanlikes.ValidateTarget: PRE: [2147483647]VREAndroids.VPEHemosage_AbilityExtension_OnlyNonHemogenicHumanlikes_ValidateTarget_Patch.Prefix | |
| AbilityExtension_Psycast.GetEntropyUsedByPawn: post: VPEHemosage.AbilityExtension_Psycast_GetEntropyUsedByPawn_Patch.Postfix | |
| AbilityExtension_PsychicComa.ApplyComa: (no patches) | |
| AbilityExtension_SpawnTemperatureArea.Cast: (no patches) | |
| AbilityExtension_WordOfLove.Cast: (no patches) | |
| AbilityPawnFlyer.RespawnPawn: (no patches) | |
| AbilityUtility.ValidateSickOrInjured: (no patches) | |
| Ability_LuckTransfer.Cast: (no patches) | |
| Ability_Power.Cast: (no patches) | |
| Ability_PsychicComa.Cast: (no patches) | |
| Ability_Recharge.Cast: (no patches) | |
| ActiveDropPawn.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| ActiveTip.DrawInner: PRE: RimHUD.Access.Patch.Verse_ActiveTip_DrawInner.Prefix | |
| ActiveTip.get_TipRect: PRE: RimHUD.Access.Patch.Verse_ActiveTip_TipRect.Prefix | |
| AddDirectRelation_Patch.Prefix: TRANS: BetterRomance.HarmonyPatches.VSIEPatches.AddDirectRelation_PrefixTranspiler | |
| AddictionUtility.HasChemicalDependency: (no patches) | |
| AddictionUtility.ModifyChemicalEffectForToleranceAndBodySize: post: USH_GE.Patch_AddictionUtility_ModifyChemicalEffectForToleranceAndBodySize.Postfix | |
| AerialVehicleCompatibility.CanLandIn: PRE: TooManyMods.Compat_MerchantGuild_TradeArrivalOption+Patch_AerialVehicleCompatibility_CanLandIn_MerchantGuild.Prefix | |
| AerialVehicleLaunchHelper.GetOrMakeAerialVehicle: (no patches) | |
| AgeInjuryUtility.GenerateRandomOldAgeInjuries: PRE: [2147483647]VREAndroids.AgeInjuryUtility_GenerateRandomOldAgeInjuries_Patch.Prefix, SimsTraits.AgeInjuryUtility_GenerateRandomOldAgeInjuries_Patch.Prefix | |
| AgeInjuryUtility.RandomHediffsToGainOnBirthday: post: VREAndroids.AgeInjuryUtility_RandomHediffsToGainOnBirthday_Patch.Postfix, SimsTraits.AgeInjuryUtility_RandomHediffsToGainOnBirthday_Patch.Postfix | |
| Alert.DrawAt: PRE: RaiderInfo.Patch_Alert_DrawAt.Prefix post: RaiderInfo.Patch_Alert_DrawAt.Postfix | |
| Alert_BrawlerHasRangedWeapon.GetReport: PRE: MVCF.PatchSets.PatchSet_Brawlers.GetReport_Prefix | |
| Alert_CannotBeUsedRoofed.get_UnusableBuildings: post: BGPScanner.Alert_CannotBeUsedRoofed_UnusableBuildings.Postfix | |
| Alert_CaravanIdle.get_IdleCaravans: post: Vehicles.Patch_CaravanHandling.IdleVehicleCaravans | |
| Alert_Cave.GetExplanation: (no patches) | |
| Alert_Cave.GetLabel: (no patches) | |
| Alert_Cave.GetReport: (no patches) | |
| Alert_Cave.get_BGColor: (no patches) | |
| Alert_Cave.get_Priority: (no patches) | |
| Alert_ContaminatedTower.GetReport: (no patches) | |
| Alert_CriticalCryptoGenerators.<GetCriticalCryptoGenerators>d__2.MoveNext: (no patches) | |
| Alert_CriticalMaintenance.<GetCriticalMaintenance>d__2.MoveNext: (no patches) | |
| Alert_HunterHasShieldAndRangedWeapon.get_BadHunters: TRANS: AchtungMod.Alert_HunterLacksRangedWeapon_HuntersWithoutRangedWeapon_Patch.Transpiler | |
| Alert_LowComaNeed.get_Cache: (no patches) | |
| Alert_LowGenericNeed.get_Cache: (no patches) | |
| Alert_LowMaintenance.<GetLowMaintenance>d__4.MoveNext: (no patches) | |
| Alert_LowMaintenance.<GetLowMaintenance>d__6.MoveNext: (no patches) | |
| Alert_LowResource.get_Cache: (no patches) | |
| Alert_LowUranium.<GetLowUranium>d__4.MoveNext: (no patches) | |
| Alert_NeedColonistBeds.AvailableColonistBeds: PRE: BunkBeds.Alert_NeedColonistBeds_AvailableColonistBeds_Patch.Prefix | |
| Alert_PasteDispenserNeedsHopper.get_BadDispensers: post: VNPE.Alert_PasteDispenserNeedsHopper_BadDispensers.Postfix | |
| Alert_RoyalNoAcceptableFood.GetExplanation: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| Alert_RoyalNoAcceptableFood.get_Targets: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| Alert_TimedMakeFactionHostile.GetExplanation: (no patches) | |
| Alert_TimedMakeFactionHostile.get_WorldObjects: (no patches) | |
| AllowToolController.WorldLoaded: (no patches) | |
| AmmoLogic.<>c__DisplayClass9_0.<EquipPawn>b__3: (no patches) | |
| AmmoLogic.<>c__DisplayClass9_1.<EquipPawn>b__5: (no patches) | |
| AnimalNameDisplayModeExtension.ShouldDisplayAnimalName: post: VanillaQuestsExpandedAncients.AnimalNameDisplayModeExtension_ShouldDisplayAnimalName_Patch.Postfix | |
| AnimalProductionUtility.<AnimalProductionStats>d__0.MoveNext: (no patches) | |
| AnimalProductionUtility.EggMarketValue: (no patches) | |
| AnimalProductionUtility.EggNutrition: (no patches) | |
| AnimalProductionUtility.EggsPerYear: (no patches) | |
| AnimalProductionUtility.GestationDaysEach: (no patches) | |
| AnimalProductionUtility.GestationDaysLitter: (no patches) | |
| AnimalProductionUtility.MilkMarketValue: (no patches) | |
| AnimalProductionUtility.MilkNutrition: (no patches) | |
| AnimalProductionUtility.MilkPerYear: (no patches) | |
| AnimalProductionUtility.OffspringRange: (no patches) | |
| AnimalProductionUtility.WoolMarketValue: (no patches) | |
| AnimalProductionUtility.WoolPerYear: (no patches) | |
| AnnihilationField.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| AnomalyUtility.TryDuplicatePawn: TRANS: ReSpliceCharmweavers.AnomalyUtility_TryDuplicatePawn.Transpiler | |
| Apparel.PawnCanWear: post: BigAndSmall.CanEquipPatches.PawnCanWear_Postfix, ProgressionEducation.Apparel_PawnCanWear_Patch.Postfix | |
| ApparelGraphicRecordGetter.TryGetGraphicApparel: post: Worldbuilder.ApparelGraphicRecordGetter_TryGetGraphicApparel_Patch.Postfix TRANS: VEF.Apparels.VanillaExpandedFramework_ApparelGraphicRecordGetter_TryGetGraphicApparel_Transpiler.Transpiler, VFEMedieval.ApparelGraphicRecordGetter_TryGetGraphicApparel_Patch.Transpiler | |
| ApparelProperties.PawnCanWear: post: BigAndSmall.CanEquipPatches.PawnCanWear_Postfix | |
| ApparelRequirement.AllowedForPawn: post: BigAndSmall.CanEquipPatches.AllowedForPawn_Postfix | |
| ApparelRequirement.RequiredForPawn: post: BigAndSmall.CanEquipPatches.RequiredForPawn_Postfix | |
| ApparelUtility.CanWearTogether: post: Jewelry.ApparelUtility_CanWearTogether_PostFix.Postfix | |
| ArchitectCategoryTab.CacheSearchState: post: VanillaGravshipExpanded.ArchitectCategoryTab_CacheSearchState_Patch.Postfix | |
| ArchitectCategoryTab.DesignationTabOnGUI: PRE: [2147483647]VanillaGravshipExpanded.ArchitectCategoryTab_DesignationTabOnGUI_Patch.Prefix TRANS: ArchitectIcons.ArchitectIconsMod.OffsetGizmos | |
| ArchitectCategoryTab.DoInfoBox: PRE: RelevantStatsInDescription.ArchitectCategoryTab_DoInfoBox.Prefix, UINotIncluded.ArchitectCategoryTabPatches.Prefix post: RelevantStatsInDescription.ArchitectCategoryTab_DoInfoBox.Postfix | |
| ArchitectCategoryTab.get_InfoRect: post: TabSorting.ArchitectCategoryTab_InfoRect.Postfix TRANS: ArchitectIcons.ArchitectIconsMod.WidenInfoBox | |
| ArchivedDialog.ExposeData: post: VisibleRaidPoints.Patch_ArchivedDialog_ExposeData.Postfix | |
| ArchivedDialog.RimWorld.IArchivable.OpenArchived: TRANS: VisibleRaidPoints.Patch_ArchivedDialog_RimWorld_IArchivable_OpenArchived.Transpiler | |
| ArchivedDialog.RimWorld.IArchivable.get_ArchivedLabel: post: VisibleRaidPoints.Patch_ArchivedDialog_RimWorld_IArchivable_get_ArchivedLabel.Postfix | |
| ArchivedDialog.RimWorld.IArchivable.get_ArchivedTooltip: post: VisibleRaidPoints.Patch_ArchivedDialog_RimWorld_IArchivable_get_ArchivedTooltip.Postfix | |
| AreaManager.AddStartingAreas: post: Vehicles.Patch_Areas.AddVehicleAreas, VFEInsectoids.AreaManager_AddStartingAreas_Patch.Postfix | |
| AreaManager.AreaManagerUpdate: PRE: ProgressRenderer.Harmony_AreaManager_AreaManagerUpdate.Prefix | |
| Area_Home.Set: post: MapWideTradeBeacon.Patcher.AreaTarget | |
| ArenaUtility.BeginArenaFight: (no patches) | |
| ArenaUtility.BeginArenaFightSet: (no patches) | |
| ArenaUtility.PerformBattleRoyale: (no patches) | |
| ArmorUtility.ApplyArmor: PRE: VREArchon.ArmorUtility_ApplyArmor_Patch.Prefix, VCR.ArmorUtility_ApplyArmor_Patch.Prefix, RimEffectAR.Patch_ArmorUtility_ApplyArmor.Prefix TRANS: [800]VEF.Apparels.Patch_ArmorUtility+VanillaExpandedFramework_ArmorUtility_ApplyArmor.Transpiler | |
| ArmorUtility.GetPostArmorDamage: PRE: VEF.Apparels.Patch_ArmorUtility+VanillaExpandedFramework_ArmorUtility_GetPostArmorDamage.Prefix post: VREHussars.ArmorUtility_GetPostArmorDamage_Patch.Postfix | |
| AspirationWorker.<IsCompleted>b__3_1: (no patches) | |
| AspirationWorker.ValidOn: post: TooManyMods.TMM_AspirationValidOn_Postfix.Postfix | |
| AttachableThing.get_DrawPos: post: YayoAnimation.HarmonyPatches.OffsetAttachableThing.Postfix | |
| AttackTargetFinder.<>c__DisplayClass5_0.<BestAttackTarget>b__1: post: VanillaRacesExpandedInsector.AttackTargetFinder_BestAttackTarget_Validator_Patch.Postfix TRANS: VanillaPsycastsExpanded.Technomancer.HaywireManager+OverrideBestAttackTargetValidator.Transpiler | |
| AttackTargetFinder.BestAttackTarget: PRE: VEF.Weapons.VanillaExpandedFramework_AttackTargetFinder_BestAttackTarget_Patch.Prefix, VanillaPsycastsExpanded.Nightstalker.Decoy.BestAttackTarget_Prefix | |
| AttackTargetFinder.FindBestReachableMeleeTarget: PRE: VEF.Weapons.VanillaExpandedFramework_AttackTargetFinder_FindBestReachableMeleeTarget_Patch.Prefix | |
| AttackTargetFinder.NonCombatantScore: post: VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_AttackTargetFinder_NonCombatantScore_Patch.DisableHarmless | |
| AttackTargetsCache.GetPotentialTargetsFor: post: VanillaPsycastsExpanded.Technomancer.HaywireManager.ChangeTargets | |
| AutoHomeAreaMaker.MarkHomeAroundThing: PRE: VanillaGravshipExpanded.AutoHomeAreaMaker_MarkHomeAroundThing_Patch.Prefix | |
| AutoRefuelMannedTurrets.ResolveReferences: (no patches) | |
| AutoUndrafter.AutoUndraftTickInterval: post: PeteTimesSix.SimpleSidearms.Intercepts.AutoUndrafter_AutoUndraftTick_Postfix.AutoUndraftTickInterval | |
| AvoidGrid.PrintAvoidGridAroundTurret: PRE: VanillaGravshipExpanded.AvoidGrid_PrintAvoidGridAroundTurret_Patch.Prefix, VFED.HarmonyPatches.MiscPatches.NoAvoidGridForLargeRange | |
| BPaNSResizeSettings.ChangeBiosculpterPodReadyEffecterAlwaysOff: (no patches) | |
| BPaNSResizeSettings.ChangeBiosculpterPodReadyEffecterColor: (no patches) | |
| BSCache.RegenerateCache: (no patches) | |
| BackCompatibility.BackCompatibleDefName: PRE: DubsBadHygiene.Patches.HarmonyPatches+H_BackCompatibleDefName.Prefix, Jewelry.BackCompatibility_BackCompatibleDefName.Prefix post: ReplaceLib.BackCompatibility_BackCompatibleDefName.Postfix, SimsTraits.BackCompatibility_BackCompatibleDefName_Patch.Postfix | |
| BackCompatibility.BackCompatibleTerrainWithShortHash: post: ReplaceLib.BackCompatibility_BackCompatibleTerrainWithShortHash_Patch.Postfix | |
| BackCompatibility.BackCompatibleThingDefWithShortHash_Force: post: ReplaceLib.BackCompatibility_BackCompatibleThingDefWithShortHash_Force_Patch.Postfix | |
| BackCompatibility.FactionManagerPostLoadInit: post: AnomaliesExpected.HarmonyPatches.BC_FactionManagerPostLoadInit_Postfix | |
| BackCompatibility.GetBackCompatibleType: PRE: SaveGameCompatibility.BackCompatibilityPatch.GetBackCompatibleType, DubsBadHygiene.Patches.HarmonyPatches+H_GetBackCompatibleType.Prefix, AdaptiveStorage.HarmonyPatches.SaveGameCompatibility.GetBackCompatibleType, Jewelry.BackCompatibility_GetBackCompatibleType.Prefix | |
| BackCompatibility.PostExposeData: PRE: Worldbuilder.BackCompatibility_PostExposeData_Patch.Prefix | |
| BackCompatibilityConverter_1_0.PostLoadSavegame: (no patches) | |
| BackCompatibilityConverter_ForceLoadUnderground.PostLoadSavegame: (no patches) | |
| BackstoryDef.BodyTypeFor: post: VEF.Pawns.VanillaExpandedFramework_BackstoryDef_BodyTypeFor_Patch.Postfix | |
| BackstoryDef.FullDescriptionFor: TRANS: VEF.VanillaExpandedFramework_BackstoryDef_FullDescriptionFor_Patch.Transpiler | |
| Base.LoadExtendedDataStorage: (no patches) | |
| BaseGenUtility.RandomCheapWallStuff: post: AlphaBiomes.AlphaBiomes_BaseGenUtility_RandomCheapWallStuff_Patch.RemoveMaterial | |
| BaseGenUtility.TryRandomInexpensiveFloor: post: AlphaBiomes.AlphaBiomes_BaseGenUtility_TryRandomInexpensiveFloor_Patch.RemoveAlphaBiomesFloorsFromRuins, AlphaMemes.AlphaMemes_BaseGenUtility_TryRandomInexpensiveFloor_Patch.RemoveAlphaMemesFloorsFromRuins | |
| Beacon.SpawnSetup: (no patches) | |
| BeautyDrawer.ShouldShow: post: AchtungMod.BeautyDrawer_ShouldShow_Patch.Postfix | |
| BedUtility.GetSleepingSlotsCount: PRE: BunkBeds.BedUtility_GetSleepingSlotsCount_Patch.Prefix | |
| BestCaravanPawnUtility.FindBestNegotiator: PRE: Vehicles.Patch_CaravanHandling.FindBestNegotiatorInVehicle | |
| Bill.DoInterface: PRE: ImprovedWorkbenches.Bill_DoInterface_Detour.Prefix post: ImprovedWorkbenches.Bill_DoInterface_Detour.Postfix | |
| Bill.IsFixedOrAllowedIngredient: PRE: [2147483647]VREAndroids.Bill_IsFixedOrAllowedIngredient_Patch.Prefix | |
| Bill.PawnAllowedToStartAnew: PRE: VanillaTraitsExpanded.PawnAllowedToStartAnew_Patch.Prefix | |
| Bill.get_LabelCap: PRE: ImprovedWorkbenches.Bill_LabelCap_Detour.Prefix | |
| BillConfig_DoWindowContents_Patch.DrawFilters: (no patches) | |
| BillConfig_PreClose_Detour.Postfix: (no patches) | |
| BillRepeatModeUtility.MakeConfigFloatMenu: PRE: ImprovedWorkbenches.BillRepeatModeUtility_MakeConfigFloatMenu_Detour.Prefix | |
| BillStack.AddBill: post: VFEMedieval.RecipePatches+BillStack_AddBill_Patch.Postfix | |
| BillStack.Delete: PRE: ImprovedWorkbenches.BillStack_Delete_Detour.Prefix | |
| BillStack.DoListing: PRE: ImprovedWorkbenches.BillStack_DoListing_Detour.Prefix, DubsMintMenus.Patch_BillStack_DoListing.Prefix post: ImprovedWorkbenches.BillStack_DoListing_Detour.Postfix | |
| BillUtility.IsSurgeryViolationOnExtraFactionMember: post: VEF.Planet.HireableSystemStaticInitialization.IsSurgeryViolation_Postfix | |
| BillUtility.LayoutTooltip: PRE: RecipeIcons.Patch.BillUtility_LayoutTooltip.Prefix TRANS: USH_GE.Patch_BillUtility_LayoutTooltip.Transpiler | |
| BillUtility.MakeNewBill: PRE: USH_GE.Patch_BillUtility_MakeNewBill.Prefix post: ImprovedWorkbenches.Detours.BillUtility_MakeNewBill_Detour.Postfix | |
| BillUtility_MakeNewBill_Detour.Postfix: (no patches) | |
| Bill_Medical.Clone: post: VREAndroids.Bill_Medical_Clone_Patch.Postfix | |
| Bill_Medical.ExposeData: post: VREAndroids.Bill_Medical_ExposeData_Patch.Postfix | |
| Bill_Medical.Notify_BillWorkStarted: PRE: EmergencySurgery.Bill_Medical_Patches.Prefix post: EmergencySurgery.Bill_Medical_Patches.Postfix | |
| Bill_Medical.Notify_IterationCompleted: post: USH_GE.Patch_Bill_Medical_Notify_IterationCompleted.Postfix | |
| Bill_Medical.get_Label: PRE: VREAndroids.Bill_Medical_Label_Patch.Prefix post: VREAndroids.Bill_Medical_Label_Patch.Postfix TRANS: VREAndroids.Bill_Medical_Label_Patch.Transpiler | |
| Bill_Production.Clone: post: ImprovedWorkbenches.ExtendedBillData_Clone.Postfix, VFEMedieval.RecipePatches+Bill_Production_Clone_Patch.Postfix | |
| Bill_Production.DoConfigInterface: PRE: ImprovedWorkbenches.Bill_Production_DoConfigInterface_Detour.Prefix post: ImprovedWorkbenches.Bill_Production_DoConfigInterface_Detour.Postfix | |
| Bill_Production.ExposeData: post: ImprovedWorkbenches.ExtendedBillData_ExposeData.Postfix, VFEMedieval.RecipePatches+Bill_Production_ExposeData_Patch.Postfix | |
| Bill_Production.Notify_IterationCompleted: post: VanillaQuestsExpandedCryptoforge.Bill_Production_Notify_IterationCompleted_Patch.Postfix | |
| Bill_Production.get_RepeatInfoText: PRE: ImprovedWorkbenches.Bill_Production_RepeatInfoText_Detour.Prefix | |
| Bill_ResurrectMech.CreateProducts: post: EBSGFramework.HarmonyPatches.ResurrectMechProductsPostfix | |
| BiomeDef.CommonalityOfAnimal: post: ErinsFluffyFauna.ErinsFluffyFauna_BiomeDef_CommonalityOfAnimal_Patch.MultiplyAlphaAnimalCommonality, AlphaBehavioursAndEvents.AlphaAnimals_BiomeDef_CommonalityOfAnimal_Patch.MultiplyAlphaAnimalCommonality | |
| BiomeWorker_AridShrubland.GetScore: post: AlphaBiomes.BiomeWorker_AridShrubland_GetScore_Patch.RemoveShrub, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_BorealForest.GetScore: post: AlphaBiomes.BiomeWorker_BorealForest_GetScore_Patch.RemoveBoreal, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_ColdBog.GetScore: post: AlphaBiomes.BiomeWorker_ColdBog_GetScore_Patch.RemoveColdBog, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_Desert.GetScore: post: AlphaBiomes.BiomeWorker_Desert_GetScore_Patch.RemoveDesert, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_ExtremeDesert.GetScore: post: AlphaBiomes.BiomeWorker_ExtremeDesert_GetScore_Patch.RemoveExtDesert, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_FeraliskInfestedJungle.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_GallatrossGraveyard.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_GelatinousSuperorganism.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_GlacialPlain.GetScore: post: AlphaBiomes.BiomeWorker_GlacialPlain_GetScore_Patch.RemoveGlacial, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_Glowforest.GetScore: post: AlphaBiomes.BiomeWorker_Glowforest_GetScore_Patch.RemoveGlowforest, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_Grasslands.GetScore: post: AlphaBiomes.BiomeWorker_Grasslands_GetScore_Patch.RemoveGrasslands, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_IceSheet.GetScore: post: AlphaBiomes.BiomeWorker_IceSheet_GetScore_Patch.RemoveIceSh, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_IdyllicMeadows.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_LavaField.GetScore: post: AlphaBiomes.BiomeWorker_LavaField_GetScore_Patch.RemoveLavaField, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_MechanoidIntrusion.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_MiasmicMangrove.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_MycoticJungle.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_Ocean.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_OcularForest.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_PropaneLakes.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_PyroclasticConflagration.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_RockyCrags.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_Scarlands.GetScore: post: AlphaBiomes.BiomeWorker_Scarlands_GetScore_Patch.RemoveScarlands, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_SeaIce.GetScore: post: AlphaBiomes.BiomeWorker_SeaIce_GetScore_Patch.RemoveSeaIce, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_Space.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_TarPits.GetScore: post: ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_TemperateForest.GetScore: post: AlphaBiomes.BiomeWorker_TemperateForest_GetScore_Patch.RemoveForest, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_TemperateSwamp.GetScore: post: AlphaBiomes.BiomeWorker_TemperateSwamp_GetScore_Patch.RemoveTempSw, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_TropicalRainforest.GetScore: post: AlphaBiomes.BiomeWorker_TropicalRainforest_GetScore_Patch.RemoveTropRain, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_TropicalSwamp.GetScore: post: AlphaBiomes.BiomeWorker_TropicalSwamp_GetScore_Patch.RemoveTropSw, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BiomeWorker_Tundra.GetScore: post: AlphaBiomes.BiomeWorker_Tundra_GetScore_Patch.RemoveTundra, ChooseBiomeCommonality.BiomeWorker_GetScore.Postfix | |
| BioticSphere.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Blueprint.TryReplaceWithSolidThing: post: VanillaRacesExpandedInsector.VanillaRacesExpandedInsector_Blueprint_TryReplaceWithSolidThing_Patch.CreateFilth | |
| Blueprint.get_Graphic: post: Worldbuilder.Blueprint_Graphic_Patch.Postfix, Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Blueprint_Build.GetGizmos: post: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.AddMaterialSelectors | |
| Blueprint_Build.MakeSolidThing: post: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.MakeFrame, VEF.Buildings.CustomizableGraphicsPatches+PreserveBlueprintOverride.Postfix | |
| Blueprint_Build.TotalMaterialCost: post: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.BlueprintCostList | |
| Blueprint_Door.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Blueprint_GarageDoor.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| BodyDef.GetPartsWithDef: post: [200]BigAndSmall.MechanicalColonistPatches.GetPartsWithDef_Postfix | |
| BodyPartDef.GetMaxHealth: post: AlphaGenes.AlphaGenes_BodyPartDef_GetMaxHealth.PostFix, SimsTraits.BodyPartDef_GetMaxHealth_Patch.Postfix | |
| BodyPartDef.IsSkinCovered: PRE: [2147483647]VREAndroids.BodyPartDef_IsSkinCovered_Patch.Prefix | |
| BookReadResult_Biome.Notify_BookRead: (no patches) | |
| BookReadResult_Condiment.Notify_BookRead: (no patches) | |
| BookUtility.<>c.<MakeBook>b__4_0: (no patches) | |
| BookUtility.GetReadingBonus: post: SimsTraits.BookUtility_GetReadingBonus_Patch.Postfix | |
| BookUtility.IsValidBook: post: AlphaBooks.AlphaBooks_BookUtility_IsValidBook_Patch.RemoveBooks | |
| BrambleSpawner.SetupPlant: (no patches) | |
| BreachingUtility.FindVerbToUseForBreaching: post: MVCF.PatchSets.PatchSet_MultiVerb.FindVerbToUseForBreaching | |
| BroadshieldPack.BroadshieldProjectileInterceptorProperties: (no patches) | |
| BuildCopyCommandUtility.BuildCopyCommand: PRE: Vehicles.Patch_Gizmos.VehicleMaterialOnCopyBuildGizmo post: VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_BuildCopyCommandUtility_BuildCopyCommand_Patch.RemoveCopyButton | |
| BuildCopyCommandUtility.FindAllowedDesignator: PRE: [2147483647]PerformanceOptimizer.Optimization_BuildCopyCommandUtility_FindAllowedDesignator.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_BuildCopyCommandUtility_FindAllowedDesignator.Postfix | |
| BuildDesignatorUtility.TryDrawPowerGridAndAnticipatedConnection: PRE: ReBuildDoorsAndCorners.BuildDesignatorUtility_TryDrawPowerGridAndAnticipatedConnection_Patch.Prefix | |
| BuildFacilityCommandUtility.<BuildFacilityCommands>d__0.MoveNext: (no patches) | |
| BuildFacilityCommandUtility.BuildFacilityCommands: post: ProgressionEducation.BuildFacilityCommandUtility_BuildFacilityCommands_Patch.Postfix | |
| BuildableDef.ForceAllowPlaceOver: post: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.ForceAllowPlaceOver_Postfix | |
| Building.DeSpawn: PRE: FixesForSBZFridge.OtherPatches+Building_DeSpawn_Patch.Prefix, ReGrowthCore.Building_DeSpawn_Patch.Prefix post: RimEffect.DeSpawn_Patch.Postfix | |
| Building.Destroy: PRE: VEF.Buildings.VanillaExpandedFramework_Building_Destroy_Patch.Prefix, ImprovedWorkbenches.Building_Destroy_Detour.Prefix | |
| Building.GetGizmos: post: SaveStorageSettings.Patch_Building_GetGizmos.Postfix | |
| Building.SpawnSetup: post: RimEffect.SpawnSetup_Patch.Postfix, ReBuildDoorsAndCorners.Building_SpawnSetup_Patch.Postfix, ReGrowthCore.Building_SpawnSetup_Patch.Postfix | |
| BuildingGlitterNetCable.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| BuildingGlitterNetCableHidden.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| BuildingGlitterNetHub.<>c.<GetGizmos>b__27_0: (no patches) | |
| BuildingGlitterNetHub.<>c.<GetGizmos>b__27_1: (no patches) | |
| BuildingGlitterNetHub.<>c.<GetGizmos>b__27_4: (no patches) | |
| BuildingPsiTechTrainer.DeSpawn: (no patches) | |
| BuildingPsiTechTrainer.SpawnSetup: (no patches) | |
| BuildingTrader.GiveSoldThingToPlayer: PRE: VanillaTradingExpanded.GiveSoldThingToPlayer_Patch.Prefix | |
| BuildingTrader.GiveSoldThingToTrader: PRE: VanillaTradingExpanded.GiveSoldThingToTrader_Patch.Prefix | |
| BuildingWithRandomGraphic.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_AEBloodLakeExit.get_mapComponent: (no patches) | |
| Building_AEChristmasTreeExit.get_mapComponent: (no patches) | |
| Building_AlloyFusionMachine.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_AntimatterReactor.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_ArchogenInjector.ApplyInjectionComa: (no patches) | |
| Building_Bed.DeSpawn: PRE: SoftWarmBeds.Building_Bed_DeSpawn.Prefix | |
| Building_Bed.DrawGUIOverlay: PRE: BunkBeds.Building_Bed_DrawGUIOverlay_Patch.Prefix | |
| Building_Bed.GetCurOccupant: PRE: BunkBeds.Building_Bed_GetCurOccupant_Patch.Prefix | |
| Building_Bed.GetFloatMenuOptions: post: VREAndroids.Building_Bed_GetFloatMenuOptions_Patch.Postfix | |
| Building_Bed.GetInspectString: post: SoftWarmBeds.Building_Bed_GetInspectString.Postfix | |
| Building_Bed.GetSleepingSlotPos: PRE: BunkBeds.Building_Bed_GetSleepingSlotPos_Patch.Prefix post: BunkBeds.Building_Bed_GetSleepingSlotPos_Patch.Postfix | |
| Building_Bed.get_DrawColorTwo: post: SoftWarmBeds.Building_Bed_DrawColorTwo.Postfix | |
| Building_Bed.get_SleepingSlotsCount: PRE: BunkBeds.Building_Bed_SleepingSlotsCount_Patch.Prefix | |
| Building_CannonControl.get_Manager: (no patches) | |
| Building_CeilingFan.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_CellWall.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_Chemlamp.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_CommsConsole.GetCommTargets: post: VEF.Factions.VanillaExpandedFramework_Building_CommsConsole_GetCommTargets_Patch.Postfix, VFED.WorldComponent_Deserters.GetCommTargets_Postfix, VEF.Planet.HireableSystemStaticInitialization.GetCommTargets_Postfix | |
| Building_Composter.get_CurrentTempProgressSpeedFactor: (no patches) | |
| Building_ConcealedBarrier.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_ConcealedTurret.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_CryptosleepCasket.FindCryptosleepCasketFor: TRANS: PsiTech.Utility.FindCryptosleepCasketTranspiler.Transpiler | |
| Building_Cyberpod.get_Manager: (no patches) | |
| Building_DeSpawn_Patch.Prefix: (no patches) | |
| Building_Destroy_Detour.Prefix: (no patches) | |
| Building_Door.CanPhysicallyPass: post: VanillaGravshipExpanded.Building_Door_CanPhysicallyPass_Patch.Postfix, ReBuildDoorsAndCorners.Building_Door_CanPhysicallyPass_Patch.Postfix | |
| Building_Door.DrawAt: post: ReBuildDoorsAndCorners.Building_Door_DrawAt_Patch.Postfix | |
| Building_Door.PawnCanOpen: post: ReBuildDoorsAndCorners.Building_Door_PawnCanOpen_Patch.Postfix | |
| Building_Door.get_TicksToOpenNow: post: VFEArchitect.VFEArchitect_Building_Door_TicksToOpenNow_Patch.NoDoorSpeed | |
| Building_FermentingBarrel.get_CurrentTempProgressSpeedFactor: (no patches) | |
| Building_FleshmassHeart.Destroy: (no patches) | |
| Building_GeneExtractor.<>c__DisplayClass34_0.<Finish>g__SelectionWeight|0: post: ReSpliceCore.Building_GeneExtractor_SelectionWeight_Patch.Postfix, VEF.Genes.VanillaExpandedFramework_Building_GeneExtractor_Patch.Postfix | |
| Building_GeneExtractor.<GetGizmos>b__38_3: (no patches) | |
| Building_GeneExtractor.CanAcceptPawn: post: [-2147483648]VREAndroids.Building_GeneExtractor_CanAcceptPawn_Patch.Postfix | |
| Building_GenetronNuclear.Destroy: (no patches) | |
| Building_GenetronNuclear.Kill: (no patches) | |
| Building_GenetronNuclear.SpawnSetup: (no patches) | |
| Building_GenetronOverdrive.Signal_CriticalBreakdown: (no patches) | |
| Building_GenetronOverdrive.Signal_CriticalBreakdownRepaired: (no patches) | |
| Building_GenetronWithMaintenance.Destroy: (no patches) | |
| Building_GenetronWithMaintenance.Kill: (no patches) | |
| Building_GenetronWithMaintenance.SpawnSetup: (no patches) | |
| Building_Genetron_Studiable.<GetGizmos>b__7_0: (no patches) | |
| Building_Genetron_Studiable.SpawnSetup: (no patches) | |
| Building_GravEngine.<GetOrbitalWarnings>d__83.MoveNext: TRANS: VEF.Buildings.GravshipUtility_PreLaunchConfirmation_Patch.Transpiler | |
| Building_GravEngine.CanLaunch: post: VanillaGravshipExpanded.VanillaGravshipExpanded_Building_GravEngine_CanLaunch_Patch.Postfix, [-2147483648]VanillaQuestsExpandedDeadlife.Building_GravEngine_CanLaunch_Patch.Postfix | |
| Building_GravEngine.ConsumeFuel: PRE: VanillaGravshipExpanded.Building_GravEngine_ConsumeFuel_Patch.Prefix post: VanillaGravshipExpanded.Building_GravEngine_ConsumeFuel_Patch.Postfix | |
| Building_GravEngine.DeSpawn: post: VanillaGravshipExpanded.Building_GravEngine_DeSpawn_Patch.Postfix | |
| Building_GravEngine.DrawAt: TRANS: VanillaGravshipExpanded.Building_GravEngine_DrawAt_Patch.Transpiler | |
| Building_GravEngine.Inspect: PRE: VanillaGravshipExpanded.Building_GravEngine_Inspect_Patch.Prefix post: VanillaGravshipExpanded.Building_GravEngine_Inspect_Patch.Postfix | |
| Building_GravEngine.SpawnSetup: post: VanillaGravshipExpanded.Building_GravEngine_SpawnSetup_Patch.Postfix | |
| Building_GravEngine.get_FuelPerTile: post: VanillaGravshipExpanded.Building_GravEngine_FuelPerTile_Patch.Postfix | |
| Building_GravEngine.get_Graphic: PRE: VanillaGravshipExpanded.Building_GravEngine_Graphic_Patch.Prefix post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_GravEngine.get_MaxFuel: post: VanillaGravshipExpanded.Building_GravEngine_MaxFuel_Patch.Postfix | |
| Building_GravEngine.get_TotalFuel: post: VanillaGravshipExpanded.Building_GravEngine_TotalFuel_Patch.Postfix | |
| Building_Grave.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_GravshipTurret.SpawnSetup: (no patches) | |
| Building_GrowthVat.CanAcceptPawn: post: [-2147483648]VREAndroids.Building_GrowthVat_CanAcceptPawn_Patch.Postfix | |
| Building_GrowthVat.Tick: post: VNPE.Building_GrowthVat_Tick.Postfix | |
| Building_MechCharger.IsCompatibleWithCharger: post: AlphaMechs.AlphaMechs_Building_MechCharger_IsCompatibleWithCharger_Patch.AddBossMechsToCharger | |
| Building_Mechafuse.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_Mechahybridizer.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_MultiTileDoor.DrawAt: TRANS: ReBuildDoorsAndCorners.Building_MultiTileDoor_DrawAt_Patch.Transpiler | |
| Building_NutrientPasteDispenser.GetGizmos: post: VNPE.Building_NutrientPasteDispenser_GetGizmos.Postfix | |
| Building_NutrientPasteDispenser.HasEnoughFeedstockInHoppers: post: VNPE.Building_NutrientPasteDispenser_HasEnoughFeedstockInHoppers.Postfix | |
| Building_NutrientPasteDispenser.TryDispenseFood: PRE: VNPE.Building_NutrientPasteDispenser_TryDispenseFood.Prefix post: AlphaMemes.AlphaMemes_Building_NutrientPasteDispenser_TryDispenseFood_Patch.ApplyNutrientPasteStyle | |
| Building_NutrientPasteDispenser.get_CanDispenseNow: PRE: VNPE.Building_NutrientPasteDispenser_CanDispenseNow.Prefix | |
| Building_OutfitStand.DrawAt: post: VEF.Apparels.VanillaExpandedFramework_Building_OutfitStand_DrawAt_Patch.Postfix | |
| Building_OutfitStand.GetFloatMenuOptionToEquipWeapon: post: VEF.AnimalBehaviours.VanillaExpandedFramework_Building_OutfitStand_GetFloatMenuOptionToEquipWeapon_Patch.NoWeaponEquipping | |
| Building_OutfitStand.GetFloatMenuOptionToWear: post: MVCF.PatchSets.PatchSet_Brawlers.GetFloatMenuOptionToWear_Postfix | |
| Building_OutfitStand.GetFloatMenuOptions: post: VEF.Apparels.VanillaExpandedFramework_Building_OutfitStand_GetFloatMenuOptionToWear_Patch.Postfix | |
| Building_Pipe.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_PipeValve.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_PlantGrower.CanAcceptSowNow: post: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.PlantGrowerCanAcceptSowNow_Postfix | |
| Building_PlantGrower.ExposeData: post: ToggleHarvest.Patch.RimWorld_Building_PlantGrower_ExposeData.Postfix | |
| Building_PlantGrower.GetGizmos: post: ToggleHarvest.Patch.RimWorld_Building_PlantGrower_GetGizmos.Postfix | |
| Building_PlantGrower.GetPlantDefToGrow: post: ProgressionAgriculture.IPlantToGrowSettable_GetPlantDefToGrow_Patch.Postfix | |
| Building_PlantGrower.TickRare: PRE: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.PlantGrowerTickRare_Prefix | |
| Building_PowerConverter.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_PowerNetConsole.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_PowerSwitch.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_ReactorInjector.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_SaplingChild.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_SleepCasket.get_NutritionConsumedPerTick: (no patches) | |
| Building_SpawnSetup_Patch.Postfix: (no patches) | |
| Building_SteamGeyser.Tick: PRE: VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_Building_SteamGeyser_Tick_Patch.DisableSteam | |
| Building_Storage.GetGizmos: post: AdaptiveStorage.HarmonyPatches.HideStorageGizmos.Postfix | |
| Building_Storage.GetInspectString: PRE: [600]AdaptiveStorage.HarmonyPatches.ReplaceLegacyStorageInspectString.Prefix | |
| Building_SubcoreScanner.CanAcceptPawn: post: [-2147483648]VREAndroids.Building_SubcoreScanner_CanAcceptPawn_Patch.Postfix | |
| Building_TargetingTerminal.SpawnSetup: (no patches) | |
| Building_Trap.CheckSpring: PRE: GeneticRim.GeneticRim_Building_Trap_CheckSpring_Patch.ManalopesDontTriggerTraps | |
| Building_Trap.KnowsOfTrap: PRE: VFESecurity.Building_Trap_KnowsOfTrap_Patch.Prefix post: VFETribals.Building_AnimalTrap+Building_Trap_KnowsOfTrap_Patch.Postfix | |
| Building_TrapBear.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_TrapDamager.SpringSub: TRANS: VFESecurity.Building_TrapDamager_SpringSub_Patch.Transpiler | |
| Building_TrapExplosive_SelfStun.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_TurretGun.BurstComplete: post: VFED.Building_TurretGunBarrels.BurstComplete_Postfix | |
| Building_TurretGun.DrawExtraSelectionOverlays: post: VEF.Weapons.VanillaExpandedFramework_Building_TurretGun_DrawExtraSelectionOverlays_Patch.Postfix TRANS: VEF.Weapons.VanillaExpandedFramework_Building_TurretGun_DrawExtraSelectionOverlays_Transpiler.Transpiler | |
| Building_TurretGun.IsValidTarget: post: VEF.Weapons.VanillaExpandedFramework_Building_TurretGun_IsValidTarget_Patch.Postfix, VFESecurity.Building_TurretGun_IsValidTarget_Patch.Postfix, PrisonersShouldFearTurrets.Building_TurretGun_IsValidTarget.Postfix TRANS: VanillaPsycastsExpanded.Technomancer.HaywireManager.Transpiler | |
| Building_TurretGun.OrderAttack: PRE: VFESecurity.Building_TurretGun_OrderAttack_Patch.Prefix, VanillaGravshipExpanded.Building_TurretGun_OrderAttack_Patch.Prefix | |
| Building_TurretGun.ResetForcedTarget: PRE: VFESecurity.Building_TurretGun_ResetForcedTarget_Patch.Prefix, VanillaGravshipExpanded.Building_TurretGun_ResetForcedTarget_Patch.Prefix | |
| Building_TurretGun.TryFindNewTarget: PRE: VanillaGravshipExpanded.Building_TurretGun_TryFindNewTarget_Patch.Prefix post: VanillaGravshipExpanded.Building_TurretGun_TryFindNewTarget_Patch.Postfix | |
| Building_TurretGun.TryStartShootSomething: PRE: VFESecurity.Building_TurretGun_TryStartShootSomething_Patch.Prefix, VanillaGravshipExpanded.Building_TurretGun_TryStartShootSomething_Patch.Prefix post: VanillaGravshipExpanded.Building_TurretGun_TryStartShootSomething_Patch.Postfix, VFEInsectoids.VFEInsectoids_Building_TurretGun_TryStartShootSomething_Patch.Postfix | |
| Building_TurretGun.get_Active: PRE: VanillaGravshipExpanded.Building_TurretGun_Active_Patch.Prefix post: VFESecurity.Building_TurretGun_Active_Patch.Postfix | |
| Building_TurretGun.get_IsMortarOrProjectileFliesOverhead: PRE: VanillaGravshipExpanded.Building_TurretGun_IsMortarOrProjectileFliesOverhead_Patch.Prefix | |
| Building_VacBarrier.get_BarrierOn: post: VanillaGravshipExpanded.Building_VacBarrier_BarrierOn_Patch.Postfix | |
| Building_VacBarrier.get_Vacuum: (no patches) | |
| Building_VacBarrier_Recolorable.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_Valve.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_Vent.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Building_Vent.get_Vacuum: (no patches) | |
| Building_WarcasketFoundry.DrawAt: post: AlphaMemes.Building_WarcasketFoundry_Draw_Patch.Postfix | |
| Building_WarcasketFoundry.get_OccupantAliveAndPresent: post: AlphaMemes.Building_WarcasketFoundry_OccupantAliveAndPresent_Patch.Postfix | |
| Building_ZeusCannon.get_Manager: (no patches) | |
| Building_skyLight.DeSpawn: (no patches) | |
| Building_skyLight.SpawnSetup: (no patches) | |
| Building_toilet.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Bullet.Impact: post: BloodAnimations.Bullet_Impact.Impact | |
| CallBossgroupUtility.<>c.<GetBossgroupCaller>b__3_0: (no patches) | |
| CallBossgroupUtility.BossgroupEverCallable: post: VanillaGravshipExpanded.CallBossgroupUtility_BossgroupEverCallable_Patch.Postfix | |
| CallBossgroupUtility.GetBossgroupCaller: PRE: VanillaGravshipExpanded.CallBossgroupUtility_GetBossgroupCaller_Patch.Prefix | |
| CallBossgroupUtility.TryStartSummonBossgroupJob: PRE: VanillaGravshipExpanded.CallBossgroupUtility_TryStartSummonBossgroupJob_Patch.Prefix post: VanillaGravshipExpanded.CallBossgroupUtility_TryStartSummonBossgroupJob_Patch.Postfix | |
| CallBossgroupUtility_BossgroupEverCallable_Patch.Postfix: (no patches) | |
| CallBossgroupUtility_TryStartSummonBossgroupJob_Patch.Postfix: (no patches) | |
| CameraDriver.CalculateCurInputDollyVect: TRANS: UINotIncluded.Patches.CameraDriverPatch.Transpiler | |
| CameraDriver.CameraDriverOnGUI: PRE: SimpleCameraSetting.CameraDriverOnGUIPatch.Prefix | |
| CameraDriver.Update: PRE: AchtungMod.Root_Play_Update_Patch.Prefix post: AchtungMod.Root_Play_Update_Patch.Postfix | |
| CameraDriver.get_CurrentZoom: PRE: SimpleCameraSetting.CameraConfigPatch.CurrentZoomPreFix | |
| CameraJumper.GetAdjustedTarget: post: Vehicles.Patch_WorldObjects.GetAdjustedTargetForAerialVehicle | |
| CameraJumper.TryJumpAndSelect: PRE: RaiderInfo.Patch_CameraJumper_TryJumpAndSelect.Prefix | |
| CameraJumper.TryShowWorld: PRE: Vehicles.Patch_WorldHandling.ForcedTargetingDontShowWorld | |
| CameraMapConfig.ConfigFixedUpdate_60: PRE: SimpleCameraSetting.CameraMapConfigUpdatePatch.Prefix | |
| Camp.Notify_MyMapRemoved: (no patches) | |
| Caravan.AddPawn: post: Vehicles.Patch_CaravanHandling.AddPawnInVehicleCaravan | |
| Caravan.ContainsPawn: post: Vehicles.Patch_CaravanHandling.ContainsPawnInVehicle | |
| Caravan.GetGizmos: post: VEF.Abilities.VanillaExpandedFramework_Caravan_GetGizmos_Patch.Postfix, Outposts.HarmonyPatches.AddCaravanGizmos, VFEC.WorldComponent_RoadBuilding.AddRoadGizmos | |
| Caravan.GetInspectString: post: Outposts.HarmonyPatches.AddRestingAtOutpost, VFEC.WorldComponent_RoadBuilding.AddToString | |
| Caravan.GiveSoldThingToPlayer: PRE: VanillaTradingExpanded.GiveSoldThingToPlayer_Patch.Prefix | |
| Caravan.GiveSoldThingToTrader: PRE: VanillaTradingExpanded.GiveSoldThingToTrader_Patch.Prefix | |
| Caravan.IsOwner: post: Vehicles.Patch_CaravanHandling.IsOwnerOfVehicle | |
| Caravan.Notify_PawnAdded: post: Vehicles.Patch_CaravanHandling.NotifyVehicleCaravanPawnAdded | |
| Caravan.Notify_PawnRemoved: post: Vehicles.Patch_CaravanHandling.NotifyVehicleCaravanPawnRemoved | |
| Caravan.TickInterval: post: VFEC.WorldComponent_RoadBuilding.PostTick | |
| Caravan.get_AllOwnersDowned: PRE: Vehicles.Patch_CaravanHandling.AllOwnersDownedVehicle | |
| Caravan.get_AllOwnersHaveMentalBreak: PRE: Vehicles.Patch_CaravanHandling.AllOwnersMentalBreakVehicle | |
| Caravan.get_NightResting: PRE: Vehicles.Patch_CaravanHandling.NoRestForVehicles post: GeneticRim.GeneticRim_Caravan_NightResting_Patch.DecreaseNighttime | |
| Caravan.get_PawnsListForReading: PRE: Vehicles.Patch_CaravanHandling.AllPawnsAndVehiclePassengers | |
| Caravan.get_TicksPerMove: PRE: Vehicles.Patch_CaravanHandling.VehicleCaravanTicksPerMove | |
| Caravan.get_TicksPerMoveExplanation: PRE: Vehicles.Patch_CaravanHandling.VehicleCaravanTicksPerMoveExplanation | |
| CaravanArrivalAction_Trade.CanTradeWith: post: Vehicles.Patch_CaravanHandling.NoTradingUndocked | |
| CaravanArrivalAction_VisitEscapeShip.<>c__DisplayClass12_0.<GetFloatMenuOptions>b__1: (no patches) | |
| CaravanArrivalAction_VisitEscapeShip.CanVisit: (no patches) | |
| CaravanEnterMapUtility.Enter: PRE: Vehicles.Patch_CaravanHandling.EnterMapVehiclesCatchAll2, PeteTimesSix.SimpleSidearms.Intercepts.CaravanEnterMapUtility_Enter.Prefix post: PeteTimesSix.SimpleSidearms.Intercepts.CaravanEnterMapUtility_Enter.Postfix | |
| CaravanEnterMapUtility.Enter: PRE: Vehicles.Patch_CaravanHandling.EnterMapVehiclesCatchAll1 | |
| CaravanEnterMapUtility.GetEnterCell: PRE: EnterHere.CaravanEnterMapUtility_GetEnterCell.Prefix | |
| CaravanExitMapUtility.AddCaravanExitTaleIfShould: post: VanillaMemesExpanded.VanillaMemesExpanded_CaravanExitMapUtility_AddCaravanExitTaleIfShould_Patch.SetPawnCaravanTimerToZero | |
| CaravanExitMapUtility.CanExitMapAndJoinOrCreateCaravanNow: post: Vehicles.Patch_CaravanFormation.CanVehicleExitMapAndJoinOrCreateCaravanNow | |
| CaravanExitMapUtility.ExitMapAndCreateCaravan: post: VanillaSocialInteractionsExpanded.ExitMapAndCreateCaravan_Patch.Postfix | |
| CaravanExitMapUtility.ExitMapAndJoinOrCreateCaravan: PRE: Vehicles.Patch_CaravanFormation.ExitMapAndJoinOrCreateVehicleCaravan | |
| CaravanFormation.TryFindExitSpot: post: EnterHere_VehiclesPatch.CaravanFormation_TryFindExitSpot.Postfix | |
| CaravanFormingUtility.AllSendablePawns: post: Vehicles.Patch_FormCaravanDialog.AllSendablePawnsInVehicles TRANS: VEF.Planet.HireableSystemStaticInitialization.CaravanAllSendablePawns_Transpiler | |
| CaravanFormingUtility.GetGizmos: post: Vehicles.Patch_Gizmos.GizmosForVehicleCaravans | |
| CaravanFormingUtility.IsFormingCaravan: PRE: Vehicles.Patch_CaravanFormation.IsFormingCaravanVehicle | |
| CaravanFormingUtility.IsFormingCaravanOrDownedPawnToBeTakenByCaravan: PRE: VanillaTradingExpanded.IsFormingCaravanOrDownedPawnToBeTakenByCaravanPatch.Prefix | |
| CaravanHelper.<>c__DisplayClass8_2.<AvailableExitTilesAt>b__2: (no patches) | |
| CaravanHelper.BestExitTileToGoTo: (no patches) | |
| CaravanHelper.FindAerialVehicleToJoinForAllowingVehicles: (no patches) | |
| CaravanHelper.OpportunistcallyCreatedAerialVehicle: (no patches) | |
| CaravanInventoryUtility.FindPawnToMoveInventoryTo: PRE: Vehicles.Patch_CaravanHandling.FindVehicleToMoveInventoryTo | |
| CaravanInventoryUtility.TryGetBestMedicine: PRE: ChooseYourMedicine.TryGetBestMedicine_Prefix.Prefix | |
| CaravanMaker.MakeCaravan: PRE: Vehicles.Patch_CaravanHandling.MakeVehicleCaravan | |
| CaravanMergeUtility.MergeCaravans: post: Vehicles.Patch_CaravanHandling.MergeCaravansWithVehicle | |
| CaravanMergeUtility.MergeCommand: post: Vehicles.Patch_CaravanHandling.DisableMergeForAerialVehicles | |
| CaravanNeedsTabUtility.DoRows: PRE: Vehicles.Patch_CaravanHandling.NoVehiclesNeedNeeds | |
| CaravanNeedsTabUtility.GetSize: PRE: Vehicles.Patch_CaravanHandling.NoVehiclesNeedNeeds | |
| CaravanTendUtility.CheckTend: PRE: Vehicles.Patch_CaravanHandling.CheckTendInVehicleCaravan | |
| CaravanTicksPerMoveUtility.GetTicksPerMove: post: VanillaTraitsExpanded.GetTicksPerMove_Patch.Postfix | |
| CaravanTweenerUtility.PatherTweenedPosRoot: PRE: Vehicles.Patch_CaravanHandling.VehicleCaravanTweenedPosRoot | |
| CaravanUIUtility.AddPawnsSections: TRANS: ReSpliceCharmweavers.CaravanUIUtility_AddPawnsSections_Patch.Transpiler | |
| CaravanUIUtility.CreateCaravanTransferableWidgets: post: Vehicles.Patch_FormCaravanDialog.CreateTransferableVehicleWidget | |
| CaravanUtility.GetCaravan: post: Vehicles.Patch_CaravanHandling.GetParentCaravan | |
| CaravanUtility.RandomOwner: PRE: Vehicles.Patch_CaravanHandling.RandomVehicleOwner | |
| CaravanVisibilityCalculator.Visibility: TRANS: Vehicles.Patch_CaravanHandling.VehicleVisibilityInCaravanTranspiler | |
| Caravan_BedsTracker.RecalculateUsedBeds: PRE: Vehicles.Patch_CaravanHandling.RecalculateUsedBedsInVehicleCaravan | |
| Caravan_NeedsTracker.AnyPawnOutOfFood: TRANS: VREAndroids.Caravan_NeedsTracker_AnyPawnOutOfFood_Patch.Transpiler | |
| Caravan_NeedsTracker.TrySatisfyChemicalDependencies: post: EBSGFramework.HarmonyPatches.TrySatisfyChemicalDependenciesPostfix | |
| Caravan_NeedsTracker.TrySatisfyPawnNeeds: PRE: DubsBadHygiene.Patches.HarmonyPatches+Harmony_TrySatisfyPawnNeeds.Prefix | |
| Caravan_PathFollower.ExposeData: post: VEF.Planet.VanillaExpandedFramework_Caravan_PathFollower_ExposeData_Patch.Postfix | |
| Caravan_PathFollower.PatherTickInterval: PRE: VEF.Planet.VanillaExpandedFramework_Caravan_PathFollower_PatherTickInterval_Patch.Prefix | |
| Caravan_PathFollower.StartPath: PRE: Vehicles.Patch_WorldPathing.StartVehicleCaravanPath post: VEF.Planet.Caravan_PathFollower_StartPath_Patch.Postfix | |
| Caravan_PathFollower.get_Moving: post: Vehicles.Patch_CaravanHandling.VehicleCaravanMoving | |
| Caravan_PathFollower.get_MovingNow: post: Vehicles.Patch_CaravanHandling.VehicleCaravanMovingNow | |
| Caravan_TraderTracker.ColonyThingsWillingToBuy: post: PeteTimesSix.SimpleSidearms.Intercepts.Caravan_TraderTracker_ColonyThingsWillingToBuy.Postfix | |
| Caravan_Tweener.TweenerTickInterval: PRE: Vehicles.Patch_CaravanHandling.VehicleCaravanTweenerTick | |
| CaravansBattlefield.CheckWonBattle: (no patches) | |
| CaravansBattlefield.PostMapGenerate: (no patches) | |
| CastPositionFinder.TryFindCastPosition: PRE: VEF.Weapons.VanillaExpandedFramework_CastPositionFinder_TryFindCastPosition_Patch.Prefix | |
| CaveEntrance.get_CaveMapComponent: (no patches) | |
| CaveEntrance.get_IsCollapsing: (no patches) | |
| CaveEntrance.get_Level: (no patches) | |
| CaveEntrance.set_TicksToOpen: (no patches) | |
| CaveExit.Destroy: (no patches) | |
| CaveExitSurfaceInterest.get_OriginalMap: (no patches) | |
| CellFinder.TryFindRandomPawnExitCell: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.TryFindRandomPawnExitCell | |
| CellFinderLoose.TryFindRandomNotEdgeCellWith: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.TryFindRandomNotEdgeCellWith | |
| CellFinderLoose.TryGetRandomCellWith: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.TryGetRandomCellWith | |
| CellInspectorDrawer.DrawMapInspector: post: ReGrowthCore.CellInspectorDrawer_DrawMapInspector_Patch.Postfix, GeologicalLandforms.Patches.Patch_Verse_CellInspectorDrawer.DrawMapInspector TRANS: ReGrowthCore.CellInspectorDrawer_DrawMapInspector_Patch.Transpiler | |
| CellInspectorDrawer.DrawThingRow: PRE: Vehicles.Patch_Rendering.CellInspectorDrawVehicle | |
| CellInspectorDrawer.DrawWorldInspector: post: GeologicalLandforms.Patches.Patch_Verse_CellInspectorDrawer.DrawWorldInspector | |
| CellInspectorDrawer.ShouldShow: post: AchtungMod.CellInspectorDrawer_ShouldShow_Patch.Postfix | |
| CellRect.InNoBuildEdgeArea: PRE: ChangeMapEdge.ChangeMapEdgeHarmony.IgnoreFunction post: ChangeMapEdge.ChangeMapEdgeHarmony.CellRectInNoBuildEdgeArea_Postfix | |
| CharacterCardUtility.<>c.<DoLeftSection>b__43_6: post: TraitIcons.Size_Patch.Postfix | |
| CharacterCardUtility.<>c.<DoLeftSection>b__43_9: post: TraitIcons.Size_Patch.Postfix | |
| CharacterCardUtility.<>c__DisplayClass36_4.<LifestageAndXenotypeOptions>b__22: PRE: [2147483647]VREAndroids.CharacterCardUtility_LifestageAndXenotypeOptions_Subclass_Patch.Prefix | |
| CharacterCardUtility.<>c__DisplayClass42_0.<DoTopStack>b__8: PRE: [2147483647]VREAndroids.CharacterCardUtility_DoTopStack_Patch.Prefix | |
| CharacterCardUtility.<>c__DisplayClass43_0.<DoLeftSection>b__4: PRE: [2147483647]VREAndroids.CharacterCardUtility_DoLeftSection_Patch.Prefix post: TraitIcons.Backstories_Patch.Posfix | |
| CharacterCardUtility.<>c__DisplayClass43_2.<DoLeftSection>b__8: PRE: TraitIcons.Main_Patch.Prefix post: BetterRomance.HarmonyPatches.CharacterCardUtility_DoLeftSection.Postfix | |
| CharacterCardUtility.DoLeftSection: TRANS: VFEEmpire.HarmonyPatches.Patch_DoLeftSection.Transpiler | |
| CharacterCardUtility.DoTopStack: TRANS: BigAndSmall.CharacterCardUtilityUIPatch.DoTopStack_Transpiler | |
| CharacterCardUtility.DrawCharacterCard: TRANS: VFEEmpire.HarmonyPatches.Patch_StripTitles.Transpiler | |
| CharacterCardUtility.GetWorkTypeDisableCauses: TRANS: VFEEmpire.HarmonyPatches.Patch_Conceit+Work.Transpiler | |
| CharacterCardUtility.GetWorkTypeDisabledCausedBy: post: VFETribals.CharacterCardUtility_GetWorkTypeDisabledCausedBy_Patch.Postfix | |
| CharacterCardUtility.LifestageAndXenotypeOptions: TRANS: VREAndroids.CharacterCardUtility_LifestageAndXenotypeOptions_Patch.Transpiler | |
| CharacterCardUtility.get_CustomXenotypes: TRANS: VREAndroids.CharacterCardUtility_CustomXenotypes_Patch.Transpiler | |
| ChildRelationUtility.ChanceOfBecomingChildOf: PRE: BetterRomance.HarmonyPatches.ChildRelationUtility_ChanceOfBecomingChildOf.Prefix TRANS: BetterRomance.HarmonyPatches.ChildRelationUtility_ChanceOfBecomingChildOf.Transpiler | |
| ChildRelationUtility.NumberOfChildrenFemaleWantsEver: TRANS: BetterRomance.HarmonyPatches.ChildRelationUtility_NumberOfChildrenFemaleWantsEver.Transpiler | |
| ChildcareUtility.CanBreastfeedNow: (no patches) | |
| ChildcareUtility.SuckleFromLactatingPawn: (no patches) | |
| ChoiceLetter.ExposeData: post: VisibleRaidPoints.Patch_ChoiceLetter_ExposeData.Postfix | |
| ChoiceLetter.GetMouseoverText: post: VisibleRaidPoints.Patch_ChoiceLetter_GetMouseoverText.Postfix | |
| ChoiceLetter.OpenLetter: TRANS: VisibleRaidPoints.Patch_ChoiceLetter_OpenLetter.Transpiler | |
| ChoiceLetter.get_Text: post: VisibleRaidPoints.Patch_ChoiceLetter_get_Text.Postfix | |
| ChoiceLetter_ChoosePersonaWeapon.<get_AllPersonaWeapons>d__5.MoveNext: (no patches) | |
| ChoiceLetter_ChoosePersonaWeapon.RemoveAndResolveLetter: (no patches) | |
| ChoiceLetter_EntityDiscovered.get_Choices: PRE: AnomaliesExpected.HarmonyPatches.CLED_Choices_Prefix | |
| ChoiceLetter_GrowthMoment.CacheLetterText: TRANS: BetterRomance.HarmonyPatches.ChoiceLetter_GrowthMoment_CacheLetterText.Transpiler | |
| ChoiceLetter_GrowthMoment.ConfigureGrowthLetter: post: VAspirE.GrowthMomentPatches.AlsoConfigureAspirations | |
| ChoiceLetter_GrowthMoment.MakeChoices: TRANS: BetterRomance.HarmonyPatches.ChoiceLetter_GrowthMoment_MakeChoices.Transpiler | |
| Chunk.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| CliffRacerTrackerUtility.ExtinctionReached: (no patches) | |
| CliffRacerTrackerUtility.ModifyProgress: (no patches) | |
| CliffRacerTrackerUtility.SetProgress: (no patches) | |
| CliffRacerTrackerUtility.WildPopulation: (no patches) | |
| CollectionsMassCalculator.Capacity: TRANS: Vehicles.Patch_CaravanHandling.PawnCapacityInVehicleTranspiler | |
| CollectionsMassCalculator.MassUsage: TRANS: Vehicles.Patch_CaravanHandling.IgnorePawnGearAndInventoryMassTranspiler | |
| ColonistBar.CheckRecacheEntries: PRE: UINotIncluded.CheckRecacheEntriesPatch.Prefix post: UINotIncluded.CheckRecacheEntriesPatch.Postfix TRANS: Vehicles.Patch_Rendering.CheckRecacheVehicleEntriesTranspiler | |
| ColonistBarColonistDrawer.DrawColonist: PRE: ColoredMoodBar13.VanillaDrawColonist.Prefix | |
| ColonistBarColonistDrawer.DrawIcons: PRE: [2147483647]PerformanceOptimizer.Optimization_ColonistBarColonistDrawer_DrawIcons.Prefix post: Vehicles.Patch_Rendering.DrawIconsVehicles, [-2147483648]PerformanceOptimizer.Optimization_ColonistBarColonistDrawer_DrawIcons.Postfix TRANS: ReSpliceCharmweavers.ColonistBarColonistDrawer_DrawIcons_Patch.Transpiler | |
| ColonistBarColonistDrawer.GroupFrameRect: post: UINotIncluded.GroupFrameRectPatch.Postfix | |
| ColonistBarColonistDrawer.Notify_RecachedEntries: PRE: ColoredMoodBar13.VanillaNotifyRecachedEntries.Prefix | |
| Command.GizmoOnGUIInt: post: AllowTool.Patches.Command_GizmoOnGUI_Patch.InterceptInteraction, VEF.AI.DraftGizmos.GizmoOnGUIPostfix, ShowWeaponTallies.Patches.OnGui, BigAndSmall.DraftGizmos.GizmoOnGUIPostfix TRANS: AllowTool.Patches.Command_GizmoOnGUI_Patch.DrawRightClickIcon, MVCF.PatchSets.PatchSet_IntegratedToggle.GizmoOnGUI_Transpile | |
| Command_Ability.get_BGTexture: post: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_Command_Ability_BGTexture_Patch.ChangeBG, AlphaBooks.AlphaBooks_Command_Ability_BGTexture_Patch.ChangeBG | |
| Command_Ability.get_BGTextureShrunk: post: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_Command_Ability_BGTextureShrunk_Patch.ChangeBGShrunk, AlphaBooks.AlphaBooks_Command_Ability_BGTextureShrunk_Patch.ChangeBGShrunk | |
| Command_Ability_Psycast.get_TopRightLabel: post: VPEHemosage.Command_Ability_Psycast_TopRightLabel_Patch.Postfix | |
| Command_Ritual..ctor: post: VIEAT.Command_Ritual_Patch.Postfix | |
| Command_SetAnimalList.<>c__DisplayClass5_0.<ProcessInput>b__3: (no patches) | |
| Command_SetParagonList.<>c__DisplayClass4_0.<ProcessInput>b__4: (no patches) | |
| Command_SetPlantToGrow.IsPlantAvailable: post: ProgressionAgriculture.Command_SetPlantToGrow_IsPlantAvailable_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_Command_SetPlantToGrow_IsPlantAvailable_Patch.MakeCocoaBushNotSowable | |
| Command_SetPlantToGrow.ProcessInput: PRE: DubsMintMenus.Patch_Command_SetPlantToGrow.Prefix | |
| CompAbilities.GetGizmos: post: VanillaPsycastsExpanded.CompAbilities_GetGizmos_Patch.Postfix | |
| CompAbilityCallTradeCaravan.Apply: (no patches) | |
| CompAbilityEffect_BloodfeederBite.Apply: post: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_CompAbilityEffect_BloodfeederBite_Apply_Patch.DeleteAllHediffs | |
| CompAbilityEffect_BloodfeederBite.Valid: post: BigAndSmall.BloodPatches.CompAbilityEffect_BloodfeederBite_Postfix, [-2147483648]VREAndroids.CompAbilityEffect_BloodfeederBite_Valid_Patch.Postfix | |
| CompAbilityEffect_Coagulate.Valid: post: [-2147483648]VREAndroids.CompAbilityEffect_Coagulate_Valid_Patch.Postfix | |
| CompAbilityEffect_CorpsefeederBite.Valid: post: [-2147483648]VREAndroids.CompAbilityEffect_BloodfeederBite_Valid_Patch.Postfix | |
| CompAbilityEffect_CreateLinkedHediff.Apply: (no patches) | |
| CompAbilityEffect_FleshbeastFromCorpse.Apply: PRE: VAspirE.VAspirE_CompAbilityEffect_FleshbeastFromCorpse_Apply_Patch.GiveThought | |
| CompAbilityEffect_GiveHediff.ApplyInner: post: SimsTraits.CompAbilityEffect_GiveHediff_ApplyInner_Patch.Postfix | |
| CompAbilityEffect_GiveHediffComplex.ApplyInner: (no patches) | |
| CompAbilityEffect_GiveHediff_ApplyInner_Patch.Postfix: (no patches) | |
| CompAbilityEffect_HeartCrush.Valid: post: [-2147483648]VREAndroids.VanillaRacesExpandedSanguophage_CompAbilityEffect_HeartCrush_Valid_Patch.Postfix | |
| CompAbilityEffect_InitiateLovin.GetLovers: PRE: BetterRomance.HarmonyPatches.VREPatches.VREGetLoversPrefix | |
| CompAbilityEffect_InitiateLovin.Valid: TRANS: BetterRomance.HarmonyPatches.VREPatches.InitiateLovinMinAgeTranspiler, BetterRomance.HarmonyPatches.VREPatches.VREAsexualTranspiler | |
| CompAbilityEffect_LoveTheCaster.Apply: (no patches) | |
| CompAbilityEffect_ParasiticStinger.Apply: (no patches) | |
| CompAbilityEffect_ReimplantGermline.Apply: (no patches) | |
| CompAbilityEffect_ReimplantGermline.ExtractGermline: (no patches) | |
| CompAbilityEffect_ReimplantXenogerm.Apply: (no patches) | |
| CompAbilityEffect_ReimplantXenogerm.PawnIdeoCanAcceptReimplant: post: EBSGFramework.HarmonyPatches.PawnIdeoCanAcceptReimplantPostfix, ReSpliceCharmweavers.CompAbilityEffect_ReimplantXenogerm_PawnIdeoCanAcceptReimplant_Patch.Postfix | |
| CompAbilityEffect_ReimplantXenogerm.Valid: post: [-2147483648]VREAndroids.CompAbilityEffect_ReimplantXenogerm_Valid_Patch.Postfix | |
| CompAbilityEffect_RequiresTrainable.get_HasLearnedTrainable: PRE: BigAndSmall.SimpleCustomRaces.SapientAnimals.TrainableAbilitiesPatch.HasLearnedTrainable_Prefix | |
| CompAbilityEffect_Resurrect.Valid: post: [-2147483648]VREAndroids.CompAbilityEffect_Resurrect_Valid_Patch.Postfix | |
| CompAbilityEffect_SanguofeederBite.Valid: post: [-2147483648]VREAndroids.CompAbilityEffect_BloodfeederBite_Valid_Patch.Postfix | |
| CompAbilityEffect_WarHowl.Apply: (no patches) | |
| CompAbilityEffect_WordOfLove.Apply: (no patches) | |
| CompAbilityEffect_WordOfLove.ValidateTarget: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix TRANS: BetterRomance.HarmonyPatches.CompAbilityEffect_WordOfLove_ValidateTarget.Transpiler | |
| CompAffectedByFacilities.<PotentialThingsToLinkTo>d__24.MoveNext: (no patches) | |
| CompAffectedByFacilities.CanPotentiallyLinkTo: (no patches) | |
| CompAffectedByFacilities.CanPotentiallyLinkTo_Static: PRE: VEF.Buildings.VanillaExpandedFramework_CompAffectedByFacilities_CanPotentiallyLinkTo_Static_Patch.Prefix | |
| CompAffectedByFacilities.GetPotentiallySupplantedFacility: (no patches) | |
| CompAffectedByFacilities.IsPotentiallyValidFacilityForMe: (no patches) | |
| CompAffectedByFacilities.IsPotentiallyValidFacilityForMe_Static: (no patches) | |
| CompAffectedByFacilities.LinkToNearbyFacilities: post: VFEMedieval.RecipePatches+CompAffectedByFacilities_LinkToNearbyFacilities_Patch.Postfix | |
| CompAffectedByFacilities.Notify_NewLink: post: VFEMedieval.RecipePatches+CompAffectedByFacilities_Notify_NewLink_Patch.Postfix | |
| CompApparelVerbOwner.CreateVerbTargetCommand: post: VFEPirates.HarmonyPatches.CompReloadable_CreateVerbTargetCommand_Patch.Postfix | |
| CompArt.JustCreatedBy: post: VFEEmpire.HarmonyPatches.CompArt_JustCreatedBy_Patch.Postfix | |
| CompAssignableToPawn.<CompGetGizmosExtra>b__31_0: PRE: DubsMintMenus.Patch_CompAssignableToPawn.Prefix | |
| CompAssignableToPawn.get_PlayerCanSeeAssignments: PRE: VanillaFurnitureEC.NoLoungerOwnershipOverlays.Prefix post: [-2147483648]VREAndroids.CompAssignableToPawn_PlayerCanSeeAssignments_Patch.Postfix | |
| CompAssignableToPawn_Bed.IdeoligionForbids: PRE: [2147483647]BunkBeds.CompAssignableToPawn_Bed_IdeoligionForbids_Patch.Prefix | |
| CompBiocodable.IsBiocodedFor: post: SimsTraits.CompBiocodable_IsBiocodedFor_Patch.Postfix | |
| CompBiosculpterPod.<>c.<FindPodFor>b__143_0: (no patches) | |
| CompBiosculpterPod.<CompGetGizmosExtra>b__91_9: TRANS: FasterBiosculpterPod.HarmonyPatches+NutritionRequiredTranspiler.Transpiler | |
| CompBiosculpterPod.<CompGetGizmosExtra>d__91.MoveNext: TRANS: FasterBiosculpterPod.HarmonyPatches+NutritionRequiredTranspiler.Transpiler | |
| CompBiosculpterPod.CanAgeReverse: PRE: [2147483647]VREAndroids.CompBiosculpterPod_CanAgeReverse_Patch.Prefix | |
| CompBiosculpterPod.CannotUseNowPawnReason: post: [-2147483648]VREAndroids.CompBiosculpterPod_CannotUseNowPawnReason_Patch.Postfix | |
| CompBiosculpterPod.CompGetGizmosExtra: post: SaveStorageSettings.Patch_CompBiosculpterPod_CompGetGizmosExtra.Postfix | |
| CompBiosculpterPod.CompInspectStringExtra: TRANS: FasterBiosculpterPod.HarmonyPatches+NutritionRequiredTranspiler.Transpiler | |
| CompBiosculpterPod.CompTick: post: VNPE.CompBiosculpterPod_CompTick.Postfix TRANS: BPaNSResize.HarmonyPatches.CompBiosculpterPod_CompTick_Transpiler, FasterBiosculpterPod.HarmonyPatches+CompTickTranspiler.Transpiler | |
| CompBiosculpterPod.CycleCompleted: PRE: DubsBadHygiene.Patches.HarmonyPatches+H_CycleCompleted.Prefix | |
| CompBiosculpterPod.FindPodFor: PRE: VREAndroids.CompBiosculpterPod_FindPodFor_Patch.Prefix | |
| CompBiosculpterPod.LiquifyNutrition: TRANS: FasterBiosculpterPod.HarmonyPatches+NutritionRequiredTranspiler.Transpiler | |
| CompBiosculpterPod.PostDraw: TRANS: BPaNSResize.HarmonyPatches.CompBiosculpterPod_PostDraw_Transpiler | |
| CompBiosculpterPod.SetBiotuned: TRANS: FasterBiosculpterPod.HarmonyPatches+SetBiotunedTranspiler.Transpiler | |
| CompBiosculpterPod.get_RequiredNutritionRemaining: TRANS: FasterBiosculpterPod.HarmonyPatches+NutritionRequiredTranspiler.Transpiler | |
| CompBiosculpterPod_AgeReversalCycle.CycleCompleted: TRANS: FasterBiosculpterPod.HarmonyPatches+CycleCompletedTranspiler.Transpiler | |
| CompBiosculpterPod_AgeReversalCycle.Description: TRANS: FasterBiosculpterPod.HarmonyPatches+DescriptionTranspiler.Transpiler | |
| CompBladelinkWeapon.Notify_KilledPawn: post: VFEEmpire.HarmonyPatches.Patch_HonorsMisc.Postfix_KilledPawn | |
| CompBlockage.DoBreakdown: (no patches) | |
| CompBlockage.Notify_Repaired: (no patches) | |
| CompBouncingArrow.PostSpawnSetup: (no patches) | |
| CompBreakdownable.CheckForBreakdown: PRE: VanillaGravshipExpanded.VanillaGravshipExpanded_CompBreakdownable_ChekForBreakdown_Patch.Prefix TRANS: VEF.Buildings.VanillaExpandedFramework_CompBreakdownable_CheckForBreakdown_Patch.Transpiler | |
| CompBreakdownable.DoBreakdown: (no patches) | |
| CompBreakdownable.Notify_Repaired: post: VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_CompBreakdownable_Notify_Repaired_Patch.NotifyComponentCalibration | |
| CompBreakdownable.PostDeSpawn: (no patches) | |
| CompBreakdownable.PostSpawnSetup: (no patches) | |
| CompCanBeDormant.ToSleep: PRE: VFEInsectoids.CompCanBeDormant_ToSleep_Patch.Prefix | |
| CompCauseGameCondition_ForceWeather.<>c.<RandomizeSettings>b__6_0: post: VEF.Weathers.VanillaExpandedFramework_GameCondition_ForceWeather_RandomizeSettings_Patch.Postfix | |
| CompCauseHediff_AoE.GiveOrUpdateHediff: (no patches) | |
| CompCauseHediff_AoEOnColonist.GiveOrUpdateHediff: (no patches) | |
| CompCauseHediff_AoE_WithFaction.CompTick: (no patches) | |
| CompCauseHediff_AoE_WithRestrictions.CompTick: (no patches) | |
| CompCauseHediff_Apparel.Notify_Equipped: (no patches) | |
| CompConvertToThing.OutputResource: PRE: VNPE.CompConvertToThing_OutputResource.Prefix | |
| CompDataSource.UpdateDesignation: (no patches) | |
| CompDataSourceProtected.get_WorldComp: (no patches) | |
| CompDeathrestBindable.Apply: post: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_CompDeathrestBindable_Apply_Patch.DeathRestExtensions | |
| CompDeathrestBindable.CompTickRare: post: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_CompDeathrestBindable_CompTickRare_Patch.DeathRestExtensions | |
| CompDeepDrill.CanDrillNow: post: AppliancesExpanded.CompChemfuelDeepDrill+CompDeepDrill_CanDrillNow_Patch.Postfix | |
| CompDeepDrill.DrillWorkDone: post: AppliancesExpanded.CompChemfuelDeepDrill+CompDeepDrill_DrillWorkDone_Patch.Postfix | |
| CompDeepExtractor.PostSpawnSetup: post: VHelixienGasE.CompDeepExtractor_PostSpawnSetup.Postfix | |
| CompDeepExtractor.TryProducePortion: PRE: VHelixienGasE.CompDeepExtractor_TryProducePortion.Prefix | |
| CompDeepScanner.DoFind: TRANS: VEF.Maps.VanillaExpandedFramework_CompDeepScanner_DoFind_Patch.ModifyDeepResourceNumbers | |
| CompDestroyThisItem.PostDeSpawn: (no patches) | |
| CompDestroyThisItem.PostDestroy: (no patches) | |
| CompDestroyThisItem.PostSpawnSetup: (no patches) | |
| CompDisconnectedFacilityOverlay.PostSpawnSetup: (no patches) | |
| CompDissolution.CompInspectStringExtra: post: VanillaRecyclingExpanded.VanillaRecyclingExpanded_CompDissolution_CompInspectStringExtra_Patch.InspectStringInformOfProtection | |
| CompDissolution.get_CanDissolveNow: post: VanillaRecyclingExpanded.VanillaRecyclingExpanded_CompDissolution_CanDissolveNow_Patch.AvoidDissolutionInCrate | |
| CompDraincasket.PostDeSpawn: (no patches) | |
| CompDraincasket.PostDestroy: (no patches) | |
| CompDraincasket.PostSpawnSetup: (no patches) | |
| CompDreadmeld.Notify_Killed: (no patches) | |
| CompDrug.PostIngested: post: VanillaMemesExpanded.VanillaMemesExpanded_CompDrug_PostIngested_Patch.DetectDrinkConsumed TRANS: BigAndSmall.DietPatch.PostIngested_Transpiler, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_CompDrug_PostIngested_Patch.Transpiler | |
| CompEffecter_NonFogged.CompTick: (no patches) | |
| CompEggLayer.ProduceEgg: TRANS: VEF.AnimalBehaviours.VanillaExpandedFramework_CompEggLayer_ProduceEgg.ModifyCrossbreedEggThingDef | |
| CompEggLayer.get_Active: post: Mashed_Ashlands.CompEggLayer_Active_Patch.Mashed_Ashlands_CliffRacerCanLayEggs_Patch | |
| CompEquippable.CompGetEquippedGizmosExtra: post: VFEMedieval.CompEquippable_CompGetEquippedGizmosExtra_Patch.Postfix | |
| CompEquippable.GetVerbsCommands: PRE: MVCF.PatchSets.PatchSet_ExtraEquipment.GetVerbsCommands_Prefix | |
| CompExplosive.Detonate: PRE: VEF.Weapons.CompExplosive_Shells.Detonate_Prefix, VFESecurity.CompExplosive_Detonate_Patch.Prefix, VanillaQuestsExpandedDeadlife.CompExplosive_Detonate_Patch.Prefix post: AntimatterAnnihilation.Patches.Patch_CompExplosive.Postfix | |
| CompFacility.DrawLinesToPotentialThingsToLinkTo: (no patches) | |
| CompFacility.DrawPlaceMouseAttachmentsToPotentialThingsToLinkTo: (no patches) | |
| CompFlecker.PostDeSpawn: (no patches) | |
| CompFlecker.PostSpawnSetup: (no patches) | |
| CompFloorEtching.PostSpawnSetup: (no patches) | |
| CompForbiddable.CompGetGizmosExtra: post: AllowTool.Patches.CompForbiddable_Gizmos_Patch.InjectDesignatorFunctionality | |
| CompFueledTravel.get_FuelEfficiency: post: VanillaVehiclesExpanded.VanillaVehiclesExpanded_CompFueledTravel_FuelEfficiency_Patch.Postfix | |
| CompGiveThoughtToAllMapPawnsOnDestroy.PostDestroy: post: AlphaMemes.AlphaMemes_CompGiveThoughtToAllMapPawnsOnDestroy_PostDestroy_Patch.DetectAnimaScream | |
| CompGlassWall.PostDeSpawn: (no patches) | |
| CompGlassWall.PostSpawnSetup: (no patches) | |
| CompGlittertechRepairer.PostDestroy: (no patches) | |
| CompGlittertechRepairer.get_Manager: (no patches) | |
| CompGlower.ReceiveCompSignal: post: PipeSystem.ReceiveCompSignal_Postfix.Postfix | |
| CompGlower.SetGlowColorInternal: post: VEF.Buildings.CompGlowerExtended+CompGlower_SetGlowColorInternal_Patch.Postfix | |
| CompGlower.get_ShouldBeLitNow: PRE: AntimatterAnnihilation.Patches.Patch_CompGlower.Prefix post: PipeSystem.ShouldBeLitNow_Postfix.Postfix | |
| CompGravMaintainable.PostDestroy: (no patches) | |
| CompGravMaintainable.PostSpawnSetup: (no patches) | |
| CompGravshipThruster.IsBlocked: PRE: NepLandOnAnything.LandOnAnythingPatches.CompGravshipThruster_IsBlocked_Patch | |
| CompGravshipThruster.IsOutdoors: PRE: NepLandOnAnything.LandOnAnythingPatches.CompGravshipThruster_IsOutdoors_Patch | |
| CompGravshipThruster.get_CanBeActive: post: VanillaGravshipExpanded.CompGravshipThruster_CanBeActive_Patch.Postfix | |
| CompGrayStatueTeleporter.Trigger: (no patches) | |
| CompGuidedProjectile.PostSpawnSetup: (no patches) | |
| CompHackable.CanHackNow: post: USH_HE.Patch_CompHackable_CanHackNow.Postfix | |
| CompHackable.Hack: post: USH_HE.Patch_CompHackable_Hack.Postfix | |
| CompHackable.ProcessHacked: post: USH_HE.Patch_CompHackable_ProcessHack.Postfix | |
| CompHasGatherableBodyResource.Gathered: TRANS: BigAndSmall.CompHasGatherableBodyResourcePatches.Gathered_Transpiler | |
| CompHatcher.CompTick: (no patches) | |
| CompHatcher.Hatch: PRE: Mashed_Ashlands.CompHatcher_Hatch_Patch.Mashed_Ashlands_Hatch_Patch, GeneticRim.GeneticRim_CompHatcher_Hatch_Patch.AddQuality | |
| CompHibernatable.CompTick: (no patches) | |
| CompHybrid.GetToolPowerFactor: PRE: TooManyMods.Patch_CompHybrid_GetToolPowerFactor.Prefix | |
| CompIngredients.MergeIngredients: TRANS: VanillaCookingExpandedVariety.VanillaCookingExpandedVariety_CompIngredients_MergeIngredients_Patch.Transpiler | |
| CompInvisibilityEngulfer.Activate: (no patches) | |
| CompMaintainable.CheckTakeDamage: post: VFEInsectoids.CompMaintenableHive+CompMaintainable_CheckTakeDamage_Patch.Postfix | |
| CompMaintainable.get_CurStage: PRE: VFEInsectoids.CompMaintenableHive+CompMaintainable_CurStage_Patch.Prefix | |
| CompMultipleGravEnginesHandler.PostSpawnSetup: (no patches) | |
| CompNeuralSupercharger.CanAutoUse: post: [-2147483648]VREAndroids.CompNeuralSupercharger_CanAutoUse_Patch.Postfix | |
| CompNeuralSupercharger.CompFloatMenuOptions: post: [-2147483648]VREAndroids.CompNeuralSupercharger_CompFloatMenuOptions_Patch.Postfix | |
| CompNonRefuelable.CompTick: (no patches) | |
| CompObelisk.CompTick: (no patches) | |
| CompObelisk.Initialize: (no patches) | |
| CompObelisk.PostDeSpawn: (no patches) | |
| CompObelisk.PostDestroy: (no patches) | |
| CompObelisk.PostSpawnSetup: (no patches) | |
| CompObelisk_Abductor.<>c__DisplayClass30_0.<GenerateLabyrinth>b__0: (no patches) | |
| CompObelisk_Abductor.get_Labyrinth: (no patches) | |
| CompObelisk_Labyrinth.OnInteracted: (no patches) | |
| CompOrbitalScanner.get_OrbitalScannerWorldComponent: (no patches) | |
| CompOverseerSubject.CanGoFeral: PRE: [2147483647]PerformanceOptimizer.Optimization_CompOverseerSubject_CanGoFeral.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_CompOverseerSubject_CanGoFeral.Postfix | |
| CompPilotConsole.<>c__DisplayClass14_0.<StartChoosingDestination_NewTemp>b__2: TRANS: VanillaGravshipExpanded.CompPilotConsole_StartChoosingDestination_Lambda_Patch.Transpiler | |
| CompPilotConsole.CompFloatMenuOptions: post: VanillaGravshipExpanded.CompPilotConsole_CompFloatMenuOptions_Patch.Postfix | |
| CompPilotConsole.CompInspectStringExtra: TRANS: VanillaGravshipExpanded.CompPilotConsole_CompInspectStringExtra_Patch.Transpiler | |
| CompPipe.PostSpawnSetup: (no patches) | |
| CompPlantable.ConnectionStrengthReducedByNearbyBuilding: (no patches) | |
| CompPlantable.DrawSurroundingsInfo: (no patches) | |
| CompPower.ConnectToTransmitter: post: MapWideTradeBeacon.Patcher.Connect | |
| CompPowerBattery.get_AmountCanAccept: PRE: VFEPirates.CompPowerBattery_AmountCanAccept_Patch.Prefix | |
| CompPowerPlantSolar.PostDraw: TRANS: VanillaExplorationExpanded.VanillaExplorationExpanded_CompPowerPlantSolar_PostDraw_Patch.ModifySunOutput | |
| CompPowerPlantSolar.get_DesiredPowerOutput: TRANS: VanillaExplorationExpanded.VanillaExplorationExpanded_CompPowerPlantSolar_DesiredPowerOutput_Patch.ModifySunOutput | |
| CompPowerPlantWind.CompTick: TRANS: VanillaExplorationExpanded.VanillaExplorationExpanded_CompPowerPlantWind_CompTick_Patch.ModifyWindOutput, ReGrowthCore.CompPowerPlantWind_CompTick_Patch.Transpiler | |
| CompProjectileInterceptor.PostDraw: PRE: AlphaMechs.AlphaMechs_CompProjectileInterceptor_PostDraw_Patch.ChangeShieldColour | |
| CompProjectileInterceptor.get_Active: post: VFED.CompProperties_ProjectileInterceptor_Powered.Active_Postfix | |
| CompProperties_AssignableToPawn.PostLoadSpecial: post: BunkBeds.CompProperties_AssignableToPawn_PostLoadSpecial_Patch.Postfix | |
| CompProperties_AssignableToPawn_PostLoadSpecial_Patch.Postfix: (no patches) | |
| CompProperties_Facility.ResolveReferences: (no patches) | |
| CompProperties_Serum.<SpecialDisplayStats>d__1.MoveNext: (no patches) | |
| CompPsychicSuppressionField.get_Manager: (no patches) | |
| CompQuestGiver.PostSpawnSetup: (no patches) | |
| CompRallyAbility.ApplyRallyHediffToWearer: (no patches) | |
| CompRandomBuildingGraphic.ChangeGraphic: PRE: Worldbuilder.CompRandomBuildingGraphic_ChangeGraphic_Patch.Prefix | |
| CompRandomBuildingGraphic.CompGetGizmosExtra: post: Worldbuilder.CompRandomBuildingGraphic_CompGetGizmosExtra_Patch.Postfix | |
| CompRefuelable.CompInspectStringExtra: TRANS: VFEMedieval.CompRefuelablePatches.Transpiler | |
| CompRefuelable.ConsumeFuel: TRANS: VFEEmpire.HarmonyPatches.Patch_CompRefuelable_ConsumeFuel.Transpiler | |
| CompRefuelable.Refuel: TRANS: ArgonicCore.HarmonyPatch_FuelPower.RefuelTranspiler | |
| CompRefuelable.get_ConsumptionRatePerTick: TRANS: VFEMedieval.CompRefuelablePatches.Transpiler | |
| CompRefuelableWithOverdrive.PostDeSpawn: (no patches) | |
| CompRefuelableWithOverdrive.PostDestroy: (no patches) | |
| CompRefuelableWithOverdrive.PostSpawnSetup: (no patches) | |
| CompRegisterAsRewardDrop.PostSpawnSetup: (no patches) | |
| CompReportWorkSpeed.CompInspectStringExtra: (no patches) | |
| CompResourceThruster.PostSpawnSetup: (no patches) | |
| CompResourceTrader_NotInVacuumBiome.PostSpawnSetup: (no patches) | |
| CompRevenant.Hypnotize: PRE: [2147483647]VREAndroids.CompRevenant_Hypnotize_Patch.Prefix | |
| CompRevenant.get_Invisibility: (no patches) | |
| CompRottable.CompInspectStringExtra: PRE: [2147483647]VREAndroids.CompRottable_CompInspectStringExtra_Patch.Prefix | |
| CompRottable.get_Active: PRE: [2147483647]VREAndroids.CompRottable_Active_Patch.Prefix, VanillaVehiclesExpanded.CompRottable_Active_Patch.Prefix | |
| CompRottable.set_RotProgress: PRE: [2147483647]VREAndroids.CompRottable_RotProgress_Patch.Prefix | |
| CompRoyalImplant.CheckForViolations: (no patches) | |
| CompScanner.get_CanUseNow: PRE: BGPScanner.CompScanner_CanUseNow.Prefix | |
| CompScorpionCounter.<>c.<CompGetGizmosExtra>b__4_0: (no patches) | |
| CompScorpionCounter.PostDestroy: (no patches) | |
| CompScorpionCounter.PostSpawnSetup: (no patches) | |
| CompShield.Draw: PRE: AlphaMechs.AlphaMechs_CompShield_Draw_Patch.ChangeShieldColour | |
| CompSightstealer.get_Invisibility: (no patches) | |
| CompSolarFlareBank.PostDeSpawn: (no patches) | |
| CompSolarFlareBank.PostSpawnSetup: (no patches) | |
| CompSpawnerPawn.RandomPawnKindDef: PRE: VFEInsectoids.CompInsectSpawner+CompSpawnerPawn_RandomPawnKindDef_Patch.Prefix | |
| CompSprinkler.PostDeSpawn: (no patches) | |
| CompSprinkler.PostSpawnSetup: (no patches) | |
| CompStatue.CreateSnapshotOfPawn_HookForMods: PRE: FacialAnimation.HarmonyPatches.PrefixCreateSnapshotOfPawn_HookForMods | |
| CompStatue.InitFakePawn_HookForMods: PRE: FacialAnimation.HarmonyPatches.PrefixInitFakePawn_HookForMods | |
| CompStudiable.Study: post: VAEInsanity.CompStudiable_Study_Patch.Postfix | |
| CompStudyUnlocks.Notify_StudyLevelChanged: post: AnomaliesExpected.HarmonyPatches.CSU_Notify_StudyLevelChanged_Postfix | |
| CompStudyUnlocks.OnStudied: post: AnomaliesExpected.HarmonyPatches.CSU_OnStudied_Postfix | |
| CompStudyUnlocks.PostPostMake: post: AnomaliesExpected.HarmonyPatches.CSU_Notify_StudyLevelChanged_Postfix | |
| CompStudyUnlocksMonolith.Notify_StudyLevelChanged: post: AnomaliesExpected.HarmonyPatches.CSU_Notify_StudyLevelChanged_Postfix | |
| CompSummonScorpion.Valid: (no patches) | |
| CompTargetEffect_GermlineMutator.DoEffectOn: PRE: TooManyMods.Patch_GermlineMutator_DoEffectOn.Prefix | |
| CompTargetable.ValidateTarget: post: [-2147483648]VREAndroids.CompTargetable_ValidateTarget_Patch.Postfix | |
| CompTeratogenicHediff.Apply: (no patches) | |
| CompTerrainPumpDry.GetTerrainToDryTo: post: Mashed_Ashlands.GetTerrainToDryTo_Patch.Postfix | |
| CompTransporter.SubtractFromToLoadList: PRE: VanillaQuestsExpandedAncients.CompTransporter_SubtractFromToLoadList_Patch.Prefix post: VanillaQuestsExpandedAncients.CompTransporter_SubtractFromToLoadList_Patch.Postfix | |
| CompTurretGun.get_CanShoot: post: EBSGFramework.HarmonyPatches.TurretCanShootPostfix | |
| CompUndergroundPassage.PostDeSpawn: (no patches) | |
| CompUpdateRoomStats.PostDeSpawn: (no patches) | |
| CompUpdateRoomStats.PostDestroy: (no patches) | |
| CompUpdateRoomStats.PostSpawnSetup: (no patches) | |
| CompUsable.UsedBy: post: VAEInsanity.CompUsable_UsedBy_Patch.Postfix | |
| CompUseEffect_AddHediffAndEnableDisappearsComp.DoEffect: (no patches) | |
| CompUseEffect_CallBossgroup.CallBossgroup: (no patches) | |
| CompUseEffect_CallBossgroup.ConfirmMessage: (no patches) | |
| CompUseEffect_HediffModule.get_OwnerComp: (no patches) | |
| CompUseEffect_InstallImplant.CanBeUsedBy: PRE: VREAndroids.CompUseEffect_InstallImplant_CanBeUsedBy_Patch.Prefix post: VREAndroids.CompUseEffect_InstallImplant_CanBeUsedBy_Patch.Postfix | |
| CompUseEffect_LearnSkill.CanBeUsedBy: post: [-2147483648]VREAndroids.CompUseEffect_LearnSkill_CanBeUsedBy_Patch.Postfix | |
| CompUseEffect_LearnSkill.DoEffect: TRANS: LevelUp.Patcher.RemoveMessageCall | |
| Comp_BloodLakeTerminal.get_mapComponent: (no patches) | |
| CompressibilityDeciderUtility.IsSaveCompressible: post: Worldbuilder.CompressibilityDeciderUtility_IsSaveCompressible_Patch.Postfix, ReGrowthCore.CompressibilityDeciderUtility_IsSaveCompressible_Patch.Postfix | |
| ConditionalStatAffecter_InSunlight.Applies: post: AlphaBiomes.AlphaBiomes_ConditionalStatAffecter_InSunlight_Applies_Patch.VampiresAreFine | |
| ContainmentUtility.<GetInhibitorAffectedCells>d__8.MoveNext: (no patches) | |
| ContainmentUtility.GetLinearBuildingFrontCell: (no patches) | |
| ContainmentUtility.IsLinearBuildingBlocked: (no patches) | |
| ContrabandManager.TryGiveExtension: (no patches) | |
| ControllerBaseComp`2.InitializeIfNeed: PRE: FacialAnimationGeneticHeads.CompPatches.Patch_LidControllerComp.Prefix | |
| ControllerBaseComp`2.InitializeIfNeed: PRE: FacialAnimationGeneticHeads.CompPatches.Patch_BrowControllerComp.Prefix | |
| ControllerBaseComp`2.InitializeIfNeed: PRE: FacialAnimationGeneticHeads.CompPatches.Patch_SkinControllerComp.Prefix | |
| ControllerBaseComp`2.InitializeIfNeed: PRE: FacialAnimationGeneticHeads.CompPatches.Patch_MouthControllerComp.Prefix | |
| Corpse.ButcherProducts: PRE: BigAndSmall.MechanicalColonistPatches.ButcherProducts_Prefix, VanillaSocialInteractionsExpanded.Patch_ButcherProducts.Prefix | |
| Corpse.DeSpawn: post: ShowHair.HarmonyPatches.Corpse_DeSpawn_Patch.Postfix | |
| Corpse.GetInspectString: post: [-2147483648]VREAndroids.Corpse_GetInspectString_Patch.Postfix | |
| Corpse.GiveObservedHistoryEvent: post: AlphaMemes.Corpse_GiveObservedHistoryEvent.Postfix | |
| Corpse.RotStageChanged: PRE: AlphaGenes.AlphaGenes_Corpse_RotStageChanged_Patch.DisableStupidFuckingError | |
| Corpse.TickRare: post: BigAndSmall.Pawn_TickRare_Patch.Postfix | |
| CostListCalculator.CostListAdjusted: PRE: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.PrefixToRegisterThing post: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.PostfixToRegisterThing | |
| CostListCalculator.CostListAdjusted: post: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.ModifiedCostList | |
| CoverUtility.BaseBlockChance: post: VFESecurity.CoverUtility_BaseBlockChance_Patch.Postfix | |
| CreepJoinerUtility.GenerateAndSpawn: TRANS: AnomaliesExpected.HarmonyPatches.CJU_GenerateAndSpawn_Transpiler | |
| CreepJoinerUtility.GetCreepjoinerSpecifics: TRANS: AnomaliesExpected.HarmonyPatches.CJU_GenerateAndSpawn_Transpiler | |
| Current.Notify_LoadedSceneChanged: post: VBE.BackgroundController.Notify_SceneChanged | |
| CustomHealthCardUtility.<>c.<DrawHediffRow>b__24_19: (no patches) | |
| CustomHealthCardUtility.DrawCumulativeThreatmentBar: (no patches) | |
| CustomHealthCardUtility.DrawCustomTendingIcon: (no patches) | |
| CustomHealthCardUtility.DrawHediffRow: TRANS: ChooseYourMedicine.CompactHediffs_CustomHealthCardUtility_Transpiler.TranspilerSendToLog, ChooseYourMedicine.CompactHediffs_CustomHealthCardUtility_Transpiler.TranspilerTooltip, ChooseYourMedicine.CompactHediffs_CustomHealthCardUtility_Transpiler.TranspilerTooltip2 | |
| CustomHealthCardUtility.DrawSeverityBar: (no patches) | |
| CustomOverlayDrawer.PostDisposeHandle: (no patches) | |
| CustomOverlayDrawer.RenderCustomOverlays: (no patches) | |
| CustomSite.<GetGizmos>b__0_1: (no patches) | |
| CustomizableGraphicsPatches.InjectImpliedDefComps.Postfix: (no patches) | |
| CustomizableGraphicsPatches.UseUiIconForCustomizableGraphicGhosts.IsCustomizableGraphic: (no patches) | |
| CustomizableGraphicsPatches.get_AllowedToMakePatches: (no patches) | |
| CustomizationGraphicUtility.GetGraphic: (no patches) | |
| DamageFlasher.GetDamagedMat: PRE: VanillaPsycastsExpanded.Nightstalker.Decoy.GetDuplicateMat | |
| DamageUtility.GetVerbsAndTools: (no patches) | |
| DamageWorker.ExplosionDamageTerrain: post: VanillaGravshipExpanded.DamageWorker_ExplosionDamageTerrain_Patch.Postfix | |
| DamageWorker.ExplosionDamageThing: post: Vehicles.Patch_Combat.VehicleMultipleExplosionInstances TRANS: Vehicles.Patch_Combat.VehicleExplosionDamageTranspiler | |
| DamageWorker_AcidBite.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_AddInjury.Apply: PRE: VanillaMemesExpanded.VanillaMemesExpanded_DamageWorker_AddInjury_Apply_Patch.DetectIfDamagedInnocent post: AlphaMemes.AlphaMemes_DamageWorker_AddInjury_Apply_Patch.SendHistoryIfMelee | |
| DamageWorker_AddInjury.ApplyDamageToPart: PRE: VEF.Storyteller.VanillaExpandedFramework_DamageWorker_AddInjury_ApplyDamageToPart_Patch.Prefix, VanillaTraitsExpanded.Patch_ApplyDamageToPart.Prefix | |
| DamageWorker_AddInjury.ApplyToPawn: post: BloodAnimations.DamageWorker_AddInjury_ApplyToPawn.ApplyToPawn TRANS: VEF.Genes.VanillaExpandedFramework__DamageWorker_AddInjury_ApplyToPawn_Patch.Transpiler | |
| DamageWorker_AddInjury.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_AddInjury.FinalizeAndAddInjury: post: BigAndSmall.DamageWorker_BiteDevourDmg.FinalizeAndAddInjury_Postfix | |
| DamageWorker_AddInjury.FinalizeAndAddInjury: (no patches) | |
| DamageWorker_Annihilate.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_Arrow.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_Bite.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix TRANS: VCR.MeleeFlankingTranspiler.Transpiler | |
| DamageWorker_Blunt.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix TRANS: VCR.MeleeFlankingTranspiler.Transpiler | |
| DamageWorker_Bullet.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_Cut.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix TRANS: VCR.MeleeFlankingTranspiler.Transpiler | |
| DamageWorker_Extinguish.Apply: post: VanillaGravshipExpanded.VanillaGravshipExpanded_DamageWorker_Extinguish_Apply_Patch.Postfix | |
| DamageWorker_ExtraFungoidInfection.ApplySpecialEffectsToPart: (no patches) | |
| DamageWorker_ExtraFungoidInfection_Bite.ApplySpecialEffectsToPart: (no patches) | |
| DamageWorker_GalvaPain.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_NoDirectDamage.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_OuterAndFullDamage.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_OuterAndHalfDamage.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_OuterAndQuarterDamage.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix | |
| DamageWorker_Scratch.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix TRANS: VCR.MeleeFlankingTranspiler.Transpiler | |
| DamageWorker_Stab.ChooseHitPart: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_DamageWorker_AddInjury_ChooseHitPart_Patches.Prefix TRANS: VCR.MeleeFlankingTranspiler.Transpiler | |
| DarkArchiteSpike.SetTargetPawn: (no patches) | |
| DaysWorthOfFoodCalculator.AnyFoodEatingPawn: TRANS: VREAndroids.DaysWorthOfFoodCalculator_AnyFoodEatingPawn_Patch.Transpiler | |
| DaysWorthOfFoodCalculator.ApproxDaysWorthOfFood: TRANS: VREAndroids.DaysWorthOfFoodCalculator_ApproxDaysWorthOfFood_Patch.Transpiler | |
| DeathActionWorker_AcidExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_AcidExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_AcidExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_BeeExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_BigExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_BiggerExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_ConfigurableExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_EMPExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_Eggxplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_ExplodeAndSpawnEggs.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_Explosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_FrostExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_FrostbiteExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_GargantuanExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_GargantuanExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_HairballExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_LuciferiumExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_MouseFission.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_PsionicExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_RedAcidExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_RedAcidExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SmallAcidExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SmallBomb.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SmallExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SmallHairballExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SmallRedAcidExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SpidermineExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_StunningExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SummonEclipse.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_SummonFlashstorm.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_ToxCloud.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DeathActionWorker_ToxicExplosion.PawnDied: PRE: AnimalsLogic.NoBoomSlaughter.Explosion_Prefix | |
| DebugActions.MoveAllPawns: (no patches) | |
| DebugActionsMisc.SetFactionRelations: PRE: VFEMedieval.DebugActionsMisc_SetFactionRelations_Patch.Prefix post: VFEMedieval.DebugActionsMisc_SetFactionRelations_Patch.Postfix | |
| DebugOptions.<>c__DisplayClass2_0.<SkipToWave>b__0: (no patches) | |
| DebugOptions.AddModifier: (no patches) | |
| DebugOptions.ResetToWaveOne: (no patches) | |
| DebugOptions.ResetWave: (no patches) | |
| DebugOptions.RewardTest: (no patches) | |
| DebugOptions.SendAllReward: (no patches) | |
| DebugOptions.SendWaveNow: (no patches) | |
| DebugOutputsEconomy.<>c.<AnimalBreeding>b__13_6: (no patches) | |
| DebugOutputsEconomy.<>c.<AnimalBreeding>b__13_7: (no patches) | |
| DebugOutputsEconomy.<>c.<Drugs>b__6_41: (no patches) | |
| DebugOutputsEconomy.<>c.<Wool>b__7_0: (no patches) | |
| DebugOutputsEconomy.<>c.<Wool>b__7_2: (no patches) | |
| DebugOutputsEconomy.<>c.<Wool>b__7_3: (no patches) | |
| DebugOutputsEconomy.<>c.<Wool>b__7_4: (no patches) | |
| DebugOutputsEconomy.<>c.<Wool>b__7_5: (no patches) | |
| DebugOutputsEconomy.<>c.<Wool>b__7_6: (no patches) | |
| DebugOutputsEconomy.LitterSizeAverage: (no patches) | |
| DebugOutputsGeneral.<>c.<DoTablesInternalMelee>b__18_9: (no patches) | |
| DebugOutputsGeneral.<>c.<Tools>b__19_4: (no patches) | |
| DebugOutputsGeneral.<>c.<Tools>b__19_5: (no patches) | |
| DebugOutputsGeneral.<Turrets>g__fuelCapacity|16_0: (no patches) | |
| DebugOutputsGeneral.<Turrets>g__fuelToReload|16_2: (no patches) | |
| DebugOutputsGeneral.<Turrets>g__fuelType|16_1: (no patches) | |
| DebugOutputsInfection.<>c.<Infections>b__3_5: (no patches) | |
| DebugOutputsInfection.<>c__DisplayClass3_0.<Infections>b__4: (no patches) | |
| DebugOutputsInfection.<Infections>g__baseSeverityIncrease|3_3: (no patches) | |
| DebugOutputsMisc.<>c.<FoodPoisonChances>b__11_3: (no patches) | |
| DebugOutputsMisc.<>c.<ThingsPowerAndHeat>b__10_3: (no patches) | |
| DebugOutputsMisc.<>c.<ThingsPowerAndHeat>b__10_4: (no patches) | |
| DebugOutputsMisc.<>c.<ThingsPowerAndHeat>b__10_5: (no patches) | |
| DebugOutputsMisc.<>c__DisplayClass10_0.<ThingsPowerAndHeat>b__1: (no patches) | |
| DebugOutputsMisc.<MeditationFoci>g__TryGetOffset|6_0: (no patches) | |
| DebugOutputsPawns.<>c.<Entities>b__28_2: (no patches) | |
| DebugOutputsPawns.<>c.<Entities>b__28_3: (no patches) | |
| DebugOutputsPawns.BioferriteGeneration: (no patches) | |
| DebugTabMenu_Settings.InitActions: post: MoreWidgets.Patch_ShowCoords.InitActions_Post | |
| DebugToolsPawns.GivePsylink: TRANS: VanillaPsycastsExpanded.DebugToolsPawns_GivePsylink.Transpiler | |
| DebugToolsPawns.MakeInjuryPermanent: (no patches) | |
| DebugToolsSpawning.<>c__DisplayClass45_0.<SpawnBossgroup>b__0: (no patches) | |
| DebugToolsSpawning.SpawnPawn: post: Vehicles.Patch_Debug.DebugHideVehiclesFromPawnSpawner | |
| DebugWindowsOpener.DevToolStarterOnGUI: PRE: VEF.Sounds.VanillaExpandedFramework_DebugWindowsOpener_DevToolStarterOnGUI_Patch.Prefix, Analyzer.DebugLogenabler.DebugKeysPatch, PawnEditor.PawnEditorMod.Keybind | |
| DebugWindowsOpener.DrawButtons: PRE: UINotIncluded.Patches.DebugWindowsOpener_Patch.Prefix post: UINotIncluded.Patches.DebugWindowsOpener_Patch.Postfix TRANS: HugsLib.Patches.DebugWindowsOpener_Patch.DrawAdditionalButtons, VEF.Sounds.VanillaExpandedFramework_DebugWindowsOpener_DrawButtons_Patch.Transpiler, PawnEditor.PawnEditorMod.AddDevButton | |
| DeepProfiler.Start: PRE: Prepatcher.HarmonyPatches.InitAllMetadataPrefix | |
| DeepResourceGrid.DeepResourceGridUpdate: PRE: ProgressRenderer.Harmony_DeepResourceGrid_DeepResourceGridUpdate.Prefix | |
| DeepResourceGrid.DeepResourcesOnGUI: post: VEF.Maps.VanillaExpandedFramework_DeepResourceGrid_DeepResourcesOnGUI.Postfix | |
| DeepResourceGrid.GetCellExtraColor: post: VEF.Maps.VanillaExpandedFramework_DeepResourceGrid_GetCellExtraColor.PostFix | |
| DeepResourceGrid.RenderMouseAttachments: PRE: VHelixienGasE.DeepResourceGrid_RenderMouseAttachments.Prefix | |
| DeepResourceGrid.SetAt: PRE: VHelixienGasE.DeepResourceGrid_SetAt.Prefix | |
| DeepResourceGrid_SetAt.Prefix: (no patches) | |
| Def.ResolveReferences: PRE: VEF.MergeablePatches+VanillaExpandedFramework_Def_ResolveReferences_Patch.Prefix | |
| Def.SpecialDisplayStats: post: VEF.VanillaExpandedFramework_Def_SpecialDisplayStats_Patch.Postfix | |
| DefExtensions.ResolveReferences: (no patches) | |
| DefExtensions.get_SaunaDefs: (no patches) | |
| DefGenerator.GenerateImpliedDefs_PostResolve: post: RTMadSkills.ModSettingsDefJockey.Postfix, ReplaceLib.DefGenerator_GenerateImpliedDefs_PostResolve_Patch.Postfix, [0]DefNameLink.DefDatabaseInsertion.DefGeneratorPostfix | |
| DefGenerator.GenerateImpliedDefs_PreResolve: PRE: BigAndSmall.ReloadPatches.GenerateImpliedDefs_Prefix, SmashTools.GameEvent.RaiseOnGenerateImpliedDefs, VFEMedieval.VFEMedieval_DefGenerator_GenerateImpliedDefs_PreResolve_Patch.GenerateTerrainDefs, VFESecurity.DefGenerator_GenerateImpliedDefs_PreResolve_Patch.Prefix, VREAndroids.DefGenerator_GenerateImpliedDefs_PreResolve_Patch.Prefix post: BigAndSmall.ReloadPatches.GenerateImpliedDefs_Postfix, ShowHair.HarmonyPatches.DefGenerator_GenerateImpliedDefs_PreResolve_Patch.Postfix, USH_GE.Patch_DefGenerator_GenerateImpliedDefs_PreResolve.Postfix, ProgressionAgriculture.DefGenerator_GenerateImpliedDefs_PreResolve_Patch.Postfix TRANS: BigAndSmall.ReloadPatches.InsertBeforeResolveAllWantedCrossReferences | |
| DefOfHelper.RebindAllDefOfs: post: AllowTool.Patches.DefOfHelper_RebindAll_Patch.HookBeforeImpliedDefsGeneration, USH_GE.Patch_DefOfHelper_RebindAllDefOfs.Postfix, USH_HE.Patch_DefOfHelper_RebindAllDefOfs.Postfix | |
| DefensivePositionsManager.WorldLoaded: (no patches) | |
| DelayedRaidUtility.TriggerDelayedRaid: (no patches) | |
| Designation.DesignationDraw: PRE: ProgressRenderer.Harmony_Designation_DesignationDraw.Prefix | |
| Designation.Notify_Added: post: VFED.HarmonyPatches.MiscPatches.BiosecurityWarning | |
| DesignationCategoryDef.ResolveDesignators: post: [300]AllowTool.Patches.DesignationCategoryDef_ResolveDesignators_Patch.InjectAllowToolDesignators | |
| DesignationCategoryDef.get_AllIdeoDesignators: post: AlphaMemes.FuneralFramework_DesignationCategoryDef_AllIdeoDesignators_Postfix.Postfix | |
| DesignationCategoryDef.get_ResolvedAllowedDesignators: post: VEF.Buildings.VanillaExpandedFramework_DesignationCategoryDef_ResolvedAllowedDesignators_Patch.AllowBuild, PipeSystem.ResolvedAllowedDesignators_Patch.Postfix, VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_DesignationCategoryDef_ResolvedAllowedDesignators_Patch.AllowBuild | |
| DesignationManager.AddDesignation: PRE: VFETribals.DesignationManager_AddDesignation_Patch.Prefix | |
| Designator.CreateReverseDesignationGizmo: PRE: [2147483647]PerformanceOptimizer.Optimization_Designator_CreateReverseDesignationGizmo.Prefix post: AllowTool.Patches.Designator_CreateReverseDesignationGizmo_Patch.CreateReverseDesignationGizmo_Postfix, VFETribals.Designator_CreateReverseDesignationGizmo_Patch.Postfix, [-2147483648]PerformanceOptimizer.Optimization_Designator_CreateReverseDesignationGizmo.Postfix | |
| Designator.GizmoOnGUI: post: VFETribals.Designator_GizmoOnGUI_Patch.Postfix | |
| DesignatorContextMenuController.RegisterReverseDesignatorPair: (no patches) | |
| DesignatorManager.DesignatorManagerUpdate: PRE: ProgressRenderer.Harmony_DesignatorManager_DesignatorManagerUpdate.Prefix post: AchtungMod.DesignatorManager_DesignatorManagerUpdate_Patch.Postfix | |
| Designator_Adopt.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Allow.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Build.DrawIcon: PRE: Worldbuilder.Designator_Build_DrawIcon_Patch.Prefix | |
| Designator_Build.DrawPanelReadout: TRANS: VEF.Pawns.VanillaExpandedFramework_Designator_Build_DrawPanelReadout_Patch.Transpiler | |
| Designator_Build.GizmoOnGUI: PRE: Vehicles.Patch_Gizmos.VehicleMaterialOnBuildGizmo | |
| Designator_Build.ResolvedIcon: post: Worldbuilder.Designator_Build_ResolvedIcon_Patch.Postfix | |
| Designator_Build.SelectedUpdate: post: PipeSystem.Designator_Build_Patch.Postfix | |
| Designator_Build.get_Desc: post: Worldbuilder.Designator_Build_Desc_Getter_Patch.Postfix, RelevantStatsInDescription.Designator_Build_Desc.Postfix | |
| Designator_Build.get_IconDrawColor: post: Worldbuilder.Designator_Build_IconDrawColor_Getter_Patch.Postfix | |
| Designator_Build.get_Label: post: Worldbuilder.Designator_Build_Label_Getter_Patch.Postfix | |
| Designator_Build.get_ThingStyleDefForPreview: post: Worldbuilder.Designator_Build_ThingStyleDefForPreview_Getter_Patch.Postfix | |
| Designator_Build.get_Visible: post: VFEArchitect.ArchitectMod.RequireGodMode | |
| Designator_Cancel.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_CaptureEntity.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Claim.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_CoatWalls.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Deconstruct.CanDesignateThing: PRE: ExpandedMaterialsMasonry.HarmonyPatch_Deconstruct.CanDesignateThing_DiggingSpot post: Vehicles.Patch_Construction.AllowDeconstructVehicle | |
| Designator_Deconstruct.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_EjectFuel.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_ExtractSkull.CanDesignateThing: post: [-2147483648]VREAndroids.Designator_ExtractSkull_CanDesignateThing_Patch.Postfix | |
| Designator_ExtractSkull.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_ExtractTree.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_FillIn.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_FinishOff.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Forbid.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Forbid.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_GiveUpBuilding.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_HarvestFullyGrown.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Haul.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_HaulUrgently.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Hunt.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Install.SelectedUpdate: post: PipeSystem.Designator_Install_Patch.Postfix | |
| Designator_LootAmmo.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_MechControlGroup.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Mine.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_MoveGravship.DesignateSingleCell: PRE: VanillaGravshipExpanded.Designator_MoveGravship_DesignateSingleCell_Patch.Prefix | |
| Designator_MoveGravship.DrawMouseAttachments: PRE: VanillaGravshipExpanded.Designator_MoveGravship_DrawMouseAttachments_Patch.Prefix | |
| Designator_MoveGravship.IsValidCell: PRE: VanillaGravshipExpanded.Designator_MoveGravship_IsValidCell_Patch.Prefix, NepLandOnAnything.ShuttlePrivatePatch+GravshipPrivatePatch.Prefix | |
| Designator_MoveGravship.SelectedUpdate: PRE: VanillaGravshipExpanded.Designator_MoveGravship_SelectedUpdate_Patch.Prefix post: VanillaGravshipExpanded.Designator_MoveGravship_SelectedUpdate_Patch.Postfix | |
| Designator_MoveGravship.ValidGravshipLocation: post: VanillaGravshipExpanded.Designator_MoveGravship_ValidGravshipLocation_Patch.Postfix | |
| Designator_Open.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Open.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_PaintBuilding.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Place.DoExtraGuiControls: PRE: RelevantStatsInDescription.Designator_Place_DoExtraGuiControls.Prefix | |
| Designator_Plants.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_PlantsCut.AffectsThing: post: AlphaBiomes.AlphaBiomes_Designator_PlantsCut_AffectsThing_Patch.RemovePlantCutGizmo | |
| Designator_PlantsCut.CanDesignateThing: post: AllowTool.Patches.Designator_PlantsCut_Patch.PreventSpecialTreeMassDesignation | |
| Designator_PlantsCut.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_PlantsHarvestWood.CanDesignateThing: post: AllowTool.Patches.Designator_PlantsHarvestWood_Patch.PreventSpecialTreeMassDesignation | |
| Designator_PlantsHarvestWood.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_RearmTrap.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_ReleaseAnimalToWild.CanDesignateThing: PRE: VFEInsectoids.Designator_ReleaseAnimalToWild_CanDesignateThing_Patch.Prefix | |
| Designator_ReleaseAnimalToWild.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_RemovePaint.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_RemovePlumbing.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_RemoveSkylights.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_SelectSimilar.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Slaughter.CanDesignateThing: PRE: VFEInsectoids.Designator_Slaughter_CanDesignateThing_Patch.Prefix | |
| Designator_Slaughter.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_SmoothSurface.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_SmoothWalls.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Strip.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Tame.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Unforbid.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Designator_Uninstall.DesignateThing: PRE: VFETribals.Designator_DesignateThing_Patch.Prefix | |
| Dialog_AEEntityDB.EntityRecord: (no patches) | |
| Dialog_AppearanceEditor.DoWindowContents: post: ErinsAuraeyl.PawnEditor_CompatPatch.Postfix | |
| Dialog_BeginLordJob.get_InitialSize: post: VanillaGravshipExpanded.Dialog_BeginLordJob_InitialSize_Patch.Postfix | |
| Dialog_BeginRitual.BlockingIssues: post: AlphaMemes.AlphaMemes_Dialog_BeginRitual_BlockingIssues_Patch.Postfix, VFETribals.VFETribals_Dialog_BeginRitual_BlockingIssues_Patch.Postfix | |
| Dialog_BeginRitual.DrawExtraRitualOutcomeDescriptions: post: VanillaGravshipExpanded.Dialog_BeginRitual_DrawExtraRitualOutcomeDescriptions_Patch.Postfix | |
| Dialog_BeginRitual.DrawQualityFactors: post: AlphaMemes.Dialog_BeginRitual_DoWindowContents_Patch.Postfix | |
| Dialog_BillConfig.DoWindowContents: post: ImprovedWorkbenches.BillConfig_DoWindowContents_Patch.DrawFilters | |
| Dialog_ChangeDryadCaste.DrawLeftRect: (no patches) | |
| Dialog_ChooseMemes.DoAcceptChanges: PRE: PersistentPrecepts.Patch_IgnoreRandomize.Prefix post: VEF.Memes.VanillaExpandedFramework_Dialog_ChooseMemes_DoAcceptChanges_Patch.ForceTraitAndAbilitiesOnChooseMemeDialog, PersistentPrecepts.Patch_IgnoreRandomize.Postfix | |
| Dialog_ChooseMemes.GetFirstIncompatibleMemePair: post: VEF.Memes.VanillaExpandedFramework_Dialog_ChooseMemes_GetFirstIncompatibleMemePair_Patch.DetectIfRequiredMeme | |
| Dialog_ChooseMemes.TryAccept: PRE: VEF.Memes.VanillaExpandedFramework_Dialog_ChooseMemes_TryAccept_Patch.DetectIfPairedMeme | |
| Dialog_ChooseMemes.get_MemeCountRangeAbsolute: post: VanillaMemesExpanded.VanillaMemesExpanded_Dialog_ChooseMemes_MemeCountRangeAbsolute_Patch.SetMaxToOptions | |
| Dialog_CreateXenotype.DrawGene: PRE: VEF.Genes.VanillaExpandedFramework__Dialog_CreateXenotype_DrawGene_Patch.Prefix, EBSGFramework.HarmonyPatches.DrawGenePrefix, [0]BigAndSmall.Dialog_CreateXenotypePatches.DrawGenePrefix | |
| Dialog_CreateXenotype.DrawSearchRect: TRANS: VREAndroids.Dialog_CreateXenotype_DrawSearchRect_Patch.Transpiler | |
| Dialog_DebugHygiene.<>c.<DoWindowContents>b__19_3: (no patches) | |
| Dialog_DebugHygiene.<>c.<DoWindowContents>b__19_4: (no patches) | |
| Dialog_DebugSetHediffRemaining.get_Comp: (no patches) | |
| Dialog_EntityCodex.DoWindowContents: post: AnomaliesExpected.HarmonyPatches.DEC_DoWindowContents_Postfix | |
| Dialog_FormCaravan..ctor: post: AutoSelectBegone.Dialog_FormCaravan_Patch.Postfix | |
| Dialog_FormCaravan.DebugTryFormCaravanInstantly: PRE: Vehicles.Patch_FormCaravanDialog.TryFormCaravanInstantly | |
| Dialog_FormCaravan.DoBottomButtons: TRANS: Vehicles.Patch_FormCaravanDialog.StartRoutePlanningForVehiclesTranspiler | |
| Dialog_FormCaravan.DoWindowContents: TRANS: Vehicles.Patch_FormCaravanDialog.FormCaravanTabsTranspiler | |
| Dialog_FormCaravan.Notify_TransferablesChanged: PRE: ReSpliceCharmweavers.Dialog_FormCaravan_Notify_TransferablesChanged_Patch.Prefix | |
| Dialog_FormCaravan.PostClose: post: Vehicles.Patch_FormCaravanDialog.FormCaravanPostClose | |
| Dialog_FormCaravan.PostOpen: TRANS: Vehicles.Patch_FormCaravanDialog.FormCaravanPostOpenTranspiler | |
| Dialog_FormCaravan.TrySend: PRE: Vehicles.Patch_FormCaravanDialog.TryAndSendWithVehicles, EasyCaravanFormation.Dialog_FormCaravan_TrySend_Patch.Prefix | |
| Dialog_FormCaravan.get_DaysWorthOfFood: PRE: Vehicles.Patch_FormCaravanDialog.DaysOfWorthOfFoodWithVehicles | |
| Dialog_FormCaravan.get_TicksToArrive: PRE: Vehicles.Patch_FormCaravanDialog.TicksToArriveWithVehicles | |
| Dialog_GrowthMomentChoices.DrawTraitChoices: PRE: TraitIcons.Dialog_GrowthMomentChoices_DrawTraitChoices_Patch.Prefix | |
| Dialog_Hire.OnAcceptKeyPressed: (no patches) | |
| Dialog_InfoCard..ctor: post: VFEEmpire.HarmonyPatches.Patch_RoyalTitleIcons.Dialog_InfoCard_Postfix | |
| Dialog_InfoCard.DoWindowContents: PRE: Vehicles.Patch_Gizmos.VehicleInfoCardOverride, VREAndroids.Dialog_InfoCard_DoWindowContents_Patch.Prefix | |
| Dialog_InfoCard.FillCard: PRE: VEF.AnimalBehaviours.VanillaExpandedFramework_Dialog_InfoCard_FillCard_Patch.Prefix | |
| Dialog_ManageApparelPolicies.DoContentsRect: post: SaveStorageSettings.Patch_Dialog_ManageApparelPolicies_DoContentsRect.Postfix | |
| Dialog_ManageDrugPolicies.DoContentsRect: post: SaveStorageSettings.Patch_Dialog_ManageDrugPolicies_DoContentsRect.Postfix | |
| Dialog_ManageFoodPolicies.DoContentsRect: post: SaveStorageSettings.Patch_Dialog_ManageFoodRestrictions_DoContentsRect.Postfix | |
| Dialog_ManageReadingPolicies.DoContentsRect: post: SaveStorageSettings.Patch_Dialog_ManageReadingPolicies_DoContentsRect.Postfix | |
| Dialog_ManageReadingPolicies.get_PolicyGlobalFilter: post: AlphaBooks.AlphaBooks_Dialog_ManageReadingPolicies_PolicyGlobalFilter_Patch.ModifyPolicyFilter | |
| Dialog_ModSettings.DoWindowContents: post: ModSettingsFramework.Dialog_ModSettings_Patch.Postfix | |
| Dialog_NewFactionSpawning.Ignore: (no patches) | |
| Dialog_Options.DoCategoryRow: PRE: XmlExtensions.Dialog_Options_Patch.Prefix | |
| Dialog_Options.DoModOptions: PRE: [800]ModOptionsSort.Dialog_Options_DoModOptions_Patch.Prefix TRANS: HugsLib.Patches.DialogOptions_DoModOptions_Patch.InterceptWindowOpening | |
| Dialog_Options.PostOpen: post: HugsLib.Patches.DialogOptions_PostOpen_Patch.InjectHugsLibEntries, ModOptionsSort.Dialog_Options_PostOpen_Patch.Postfix | |
| Dialog_ReformIdeo.RandomizeNewIdeo: PRE: PersistentPrecepts.Patch_IgnoreRandomize.Prefix post: PersistentPrecepts.Patch_IgnoreRandomize.Postfix | |
| Dialog_SplitCaravan.AddItemsToTransferables: post: PeteTimesSix.SimpleSidearms.Intercepts.Dialog_SplitCaravan_AddItemsToTransferables.Postfix | |
| Dialog_SplitCaravan.DoWindowContents: TRANS: Vehicles.Patch_FormCaravanDialog.SplitCaravanTabsTranspiler | |
| Dialog_SplitCaravan.PostOpen: PRE: Vehicles.Patch_FormCaravanDialog.SplitCaravanPostOpen | |
| Dialog_SplitCaravan.TrySplitCaravan: PRE: PeteTimesSix.SimpleSidearms.Intercepts.Dialog_SplitCaravan_TrySplitCaravan.Prefix post: PeteTimesSix.SimpleSidearms.Intercepts.Dialog_SplitCaravan_TrySplitCaravan.Postfix | |
| Dialog_SplitCaravan.get_DestDaysWorthOfFood: PRE: Vehicles.Patch_FormCaravanDialog.SplitDaysOfWorthOfFoodWithVehicles | |
| Dialog_SplitCaravan.get_TicksToArrive: PRE: Vehicles.Patch_FormCaravanDialog.SplitTicksToArriveWithVehicles | |
| Dialog_Trade.CountToTransferChanged: post: Vehicles.Patch_CaravanHandling.AerialVehicleCountPawnsToTransfer | |
| Dialog_Trade.PostOpen: PRE: DynamicTradeInterface.Patches.Dialog_TradePatches.Prefix | |
| Dialog_TraitChoices.GainTrait: (no patches) | |
| Dialog_VehicleSelector.DoBottomButtons: (no patches) | |
| Dialog_ViewGenes.DoWindowContents: PRE: [2147483647]VREAndroids.Dialog_ViewGenes_DoWindowContents_Patch.Prefix | |
| Dialog_WorldSearch.InitializeSearchSet: post: GeologicalLandforms.Patches.Patch_RimWorld_Dialog_WorldSearch.InitializeSearchSet_Postfix | |
| DirectXmlCrossRefLoader.RegisterObjectWantsCrossRef: TRANS: ReplaceLib.DirectXmlCrossRefLoader_RegisterObjectWantsCrossRef_PatchThree.Transpiler | |
| DirectXmlCrossRefLoader.RegisterObjectWantsCrossRef: PRE: ReplaceLib.DirectXmlCrossRefLoader_RegisterObjectWantsCrossRef_PatchTwo.Prefix | |
| DirectXmlCrossRefLoader.RegisterObjectWantsCrossRef: PRE: ReplaceLib.DirectXmlCrossRefLoader_RegisterObjectWantsCrossRef_PatchOne.Prefix | |
| DirectXmlCrossRefLoader.ResolveAllWantedCrossReferences: PRE: [800]DefNameLink.DefDatabaseInsertion.CrossRefLoaderPrefix, ReplaceLib.DirectXmlCrossRefLoader_ResolveAllWantedCrossReferences.Prefix | |
| DirectXmlLoader.DefFromNode: PRE: Prepatcher.HarmonyPatches.PrefixDefFromNode, SmashTools.Patching.Patch_XmlParsing.PreProcessAttributesOnDef post: SmashTools.Patching.Patch_XmlParsing.ReadCustomAttributesOnDef | |
| DirectXmlToObjectNew.DefFromNodeNew: PRE: SmashTools.Patching.Patch_XmlParsing.PreProcessAttributesOnDef, DubsBadHygiene.DubsBadHygieneMod.Prefix post: SmashTools.Patching.Patch_XmlParsing.ReadCustomAttributesOnDef | |
| DropCellFinder.<>c__DisplayClass0_0.<RandomDropSpot>b__0: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass0_0.<RandomDropSpot>b__1: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass10_0.<TryFindDropSpotNear>g__AnyRoomValidator|3: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass10_0.<TryFindDropSpotNear>g__SameRoomValidator|2: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass10_0.<TryFindDropSpotNear>g__Validator|0: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass13_0.<FindRaidDropCenterDistant>b__1: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass14_0.<TryFindRaidDropCenterClose>b__0: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass14_0.<TryFindRaidDropCenterClose>b__1: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass14_0.<TryFindRaidDropCenterClose>b__2: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass16_0.<FindSafeLandingSpotNearAvoidingHostiles>b__0: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass18_0.<IsSafeDropSpot>g__CellHasCrops|0: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass1_0.<TradeDropSpot>b__3: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass1_0.<TradeDropSpot>b__5: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.<>c__DisplayClass3_0.<TryFindSafeLandingSpotCloseToColony>g__SpotValidator|0: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_LambdaPatches.Prefix | |
| DropCellFinder.AnyAdjacentGoodDropSpot: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_AnyAdjacentGoodDropSpot_Patch.Prefix | |
| DropCellFinder.CanPhysicallyDropInto: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_CanPhysicallyDropInto_Patch.Prefix | |
| DropCellFinder.FindSafeLandingSpot: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.FindSafeLandingSpot | |
| DropCellFinder.IsGoodDropSpot: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_IsGoodDropSpot_Patch.Prefix | |
| DropCellFinder.IsSafeDropSpot: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_IsSafeDropSpot_Patch.Prefix | |
| DropCellFinder.SkyfallerCanLandAt: PRE: [-2147483648]VanillaGravshipExpanded.DropCellFinder_SkyfallerCanLandAt_Patch.Prefix | |
| DropCellFinder.TradeDropSpot: PRE: DropSpot.DropSpotHarmony.CustomDropSpotTradeShips | |
| Drought.Init: (no patches) | |
| DrugPolicy.<>c.<InitializeIfNeeded>b__13_0: (no patches) | |
| DrugPolicy.ExposeData: PRE: VEF.Pawns.Patch_DrugPolicy+VanillaExpandedFramework_DrugPolicy_ExposeData_Patch.Prefix | |
| DrugPolicyDatabase.GenerateStartingDrugPolicies: post: VFEMedieval.VFEMedieval_DrugPolicyDatabase_GenerateStartingDrugPolicies_Patch.Postfix | |
| DrugPolicyUIUtility.DoAssignDrugPolicyButtons: PRE: [2147483647]VREAndroids.DrugPolicyUIUtility_DoAssignDrugPolicyButtons_Patch.Prefix | |
| DrugStatsUtility.GetAddictionOffsetPerDay: (no patches) | |
| DrugStatsUtility.GetDrugComp: (no patches) | |
| DrugStatsUtility.GetHighOffsetPerDay: (no patches) | |
| DrugStatsUtility.GetToleranceOffsetPerDay: (no patches) | |
| DubUtils.Hygiene: (no patches) | |
| DubUtils.PipeNet: (no patches) | |
| DynamicPawnRenderNodeSetup_Apparel.ProcessApparel: post: VEF.Apparels.VanillaExpandedFramework_DynamicPawnRenderNodeSetup_Apparel_ProcessApparel_Patch.Postfix, ShowHair.HarmonyPatches.DynamicPawnRenderNodeSetup_Apparel_ProcessApparel_Patch.Postfix | |
| EBSGCache_Component.GetPawnNameColor: (no patches) | |
| EBSGCache_Component.GetPawnTerrainComp: (no patches) | |
| EBSGUtilities.CreateComplexHediff: (no patches) | |
| EBSGUtilities.HandleHediffToGive: (no patches) | |
| EditWindow_Log.DoMessagesListing: PRE: HugsLib.Patches.EditWindow_Log_Patch.ExtraLogWindowButtons | |
| EducationManager.get_Instance: (no patches) | |
| EmpireUtility.RoyaltyTracker: (no patches) | |
| EmpireUtility.Terrorism: (no patches) | |
| EnterCooldownCompUtility.EnterCooldownBlocksEntering: (no patches) | |
| EnterCooldownCompUtility.EnterCooldownDaysLeft: (no patches) | |
| EnterCooldownCompUtility.EnterCooldownHoursLeft: (no patches) | |
| EnterCooldownCompUtility.EnterCooldownTicksLeft: (no patches) | |
| EnterMapUtilityVehicles.FindNearEdgeCell: post: EnterHere_VehiclesPatch.EnterMapUtilityVehicles_FindNearEdgeCell.Postfix | |
| EntityCodex.SetDiscovered: TRANS: AnomaliesExpected.HarmonyPatches.EC_SetDiscovered_Transpiler | |
| Environment.GetStackTrace: PRE: HarmonyMod.Environment_GetStackTrace_Patch.Prefix | |
| EnvironmentStatsDrawer.DrawRoomOverlays: PRE: ProgressRenderer.Harmony_EnvironmentStatsDrawer_DrawRoomOverlays.Prefix | |
| EquipmentUtility.CanEquip: post: VEF.Weapons.VanillaExpandedFramework_EquipmentUtility_CanEquip_Patch.Postfix, RestrictUndrawnApparel.EquipmentUtility_CanEquip_Patch.Postfix, RimEffect.Patch_EquipmentUtility_CanEquip.Postfix, VREArchon.VREArchon_EquipmentUtility_CanEquip_Postfix.PostFix, AlphaGenes.AlphaGenes_EquipmentUtility_CanEquip_Postfix.PostFix, BigAndSmall.CanEquipPatches.CanEquip_Postfix, ProgressionEducation.EquipmentUtility_CanEquip_Patch.Postfix, EBSGFramework.HarmonyPatches.CanEquipPostfix, VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_EquipmentUtility_CanEquip_Postfix.PostFix | |
| EquipmentUtility.QuestLodgerCanUnequip: post: VEF.Planet.HireableSystemStaticInitialization.QuestLodgerCanUnequip_Postfix | |
| EssenceConfigurationWindow.PreClose: (no patches) | |
| ExecutionUtility.ExecutionInt: post: GeneticRim.GeneticRim_ExecutionUtility_ExecutionInt_Patch.GiveHediffIfLizardman | |
| ExitMapGrid.IsGoodExitCell: TRANS: LeaveTheMap.Harmony_ExitMapGrid+ExitMapGrid_IsGoodExitCell_Patch.Transpiler | |
| ExitMapGrid.Rebuild: TRANS: LeaveTheMap.Harmony_ExitMapGrid+ExitMapGrid_Rebuild_Patch.Transpiler | |
| ExitMapGrid.get_MapUsesExitGrid: post: LeaveTheMap.Harmony_ExitMapGrid+ExitMapGrid_MapUsesExitGrid_Patch.Postfix | |
| ExitMapGrid.get_MapUsesExitGridNow: (no patches) | |
| ExpandableLandmarksUtility.get_LandmarksToShow: TRANS: GeologicalLandforms.Patches.Patch_RimWorld_ExpandableLandmarksUtility.GetLandmarksToShow_Transpiler | |
| ExpandableProjectile.Impact: PRE: RimEffect.ExpandableProjectile_Impact_Patch.Prefix post: RimEffect.ExpandableProjectile_Impact_Patch.Postfix | |
| ExpectationsUtility.CurrentExpectationFor: post: SimsTraits.ExpectationsUtility_CurrentExpectationFor_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_ExpectationsUtility_CurrentExpectationFor_Patch.LowerOrDecreaseExpectation TRANS: VFEEmpire.HarmonyPatches.Patch_Conceit.Expectations | |
| Explosion.AffectCell: PRE: Vehicles.Patch_Combat.AffectVehicleInCell | |
| Ext_Caravan.EnsureWorldGridInitialized: (no patches) | |
| Ext_Vehicles.GetAerialVehicle: (no patches) | |
| ExtendedBillDataStorage.MirrorBills: (no patches) | |
| ExtendedBillData_ExposeData.Postfix: (no patches) | |
| ExtensionUtils.BiomeGrid: (no patches) | |
| ExtensionUtils.LandformData: (no patches) | |
| ExtraDamage.AdjustedArmorPenetration: post: VCR.AdvanceArmor_postfix.Postfix | |
| ExtraDamage.AdjustedArmorPenetration: post: VCR.AdvanceArmor_postfix.Postfix | |
| EyeballControllerComp.InitializeIfNeed: PRE: FacialAnimationGeneticHeads.CompPatches.Patch_EyeballControllerComp.Prefix | |
| FacialAnimationModSettings.ShouldDrawRaceXenoType: PRE: BigAndSmall.FactialAnimHarmonyPatches+FA_DisableFeatures.Prefix | |
| Faction.CanChangeGoodwillFor: post: VFED.HarmonyPatches.GoodwillPatches.CanChangeGoodwillFor_Postfix, VFEC.Senators.WorldComponent_Senators.LockGoodwill2 | |
| Faction.CheckReachNaturalGoodwill: PRE: RemoveGradualRelationsDecay.HarmonyPatches.CheckReachNaturalGoodwillPrefix | |
| Faction.ExposeData: post: Worldbuilder.Faction_ExposeData_Patch.Postfix | |
| Faction.GoodwillWith: post: VFEC.Senators.WorldComponent_Senators.LockGoodwill1 | |
| Faction.Notify_MemberDied: PRE: VEE.Faction_Notify_MemberDied.Prefix | |
| Faction.Notify_MemberTookDamage: post: BloodSuckingAnimals.HarmonyPatches.MemberTookDamagePostfix | |
| Faction.Notify_RelationKindChanged: (no patches) | |
| Faction.RelationKindWith: post: VFEC.Senators.WorldComponent_Senators.ForceAlly | |
| Faction.TryAffectGoodwillWith: PRE: VanillaTraitsExpanded.TryAffectGoodwillWith_Patch.Prefix | |
| Faction.TryMakeInitialRelationsWith: post: VEF.Factions.VanillaExpandedFramework_Faction_TryMakeInitialRelationsWith_Patch.Postfix, VFED.HarmonyPatches.GoodwillPatches.TryMakeInitialRelationsWith_Postfix | |
| Faction.get_Color: PRE: CustomPlayerIcon.Faction_Color.Prefix post: VFEC.Senators.WorldComponent_Senators.OverrideColor | |
| Faction.get_GetReportText: post: Worldbuilder.Faction_GetReportText_Patch.Postfix | |
| Faction.get_HasGoodwill: post: VFEMedieval.Faction_HasGoodwill_Patch.Postfix, VFEInsectoids.Faction_HasGoodwill_Patch.Postfix | |
| Faction.get_LeaderTitle: PRE: VFEC.Senators.SenatorQuests.ForceTitle | |
| Faction.get_Name: post: Worldbuilder.Faction_Name_Patch.Postfix | |
| Faction.get_NaturalGoodwill: post: VEF.Storyteller.VanillaExpandedFramework_Faction_NaturalGoodwill_Patch.Postfix | |
| FactionDef.RaidCommonalityFromPoints: post: VFED.HarmonyPatches.MiscPatches.EmpireRaidChance, PsiTech.Utility.RaidFactionWeightPatch.Postfix | |
| FactionDef.get_Description: PRE: VEF.Factions.FactionDef_Description_Patch.Prefix, Worldbuilder.FactionDef_Description_Patch.Prefix post: VEF.Factions.FactionDef_Description_Patch.Postfix | |
| FactionDef.get_FactionIcon: post: Worldbuilder.FactionDef_FactionIcon_Patch.Postfix | |
| FactionDialogMaker.<>c__DisplayClass3_0.<RequestAICoreQuest>b__0: (no patches) | |
| FactionGenerator.GenerateFactionsIntoWorldLayer: post: Worldbuilder.FactionGenerator_GenerateFactionsIntoWorld_Patch.Postfix | |
| FactionGenerator.NewGeneratedFaction: post: VEF.Planet.VanillaExpandedFramework_FactionGenerator_NewGeneratedFaction_Patch.Postfix | |
| FactionIdeosTracker.RecalculateIdeosBasedOnPlayerPawns: PRE: VFETribals.FactionIdeosTracker_RecalculateIdeosBasedOnPlayerPawns_Patch.Prefix | |
| FactionUIUtility.DoWindowContents: PRE: VFEMedieval.FactionUIUtility_DoWindowContents_Patch.Prefix post: VFEMedieval.FactionUIUtility_DoWindowContents_Patch.Postfix, VFEC.Senators.SenatorUIUtility.DoPerkButton, VFETribals.FactionUIUtility_DoWindowContents_Patch.Postfix | |
| FactionUIUtility.DrawFactionRow: PRE: VFEC.Senators.SenatorUIUtility.DoSenatorInfoButton | |
| FactionUtility.GetSlavesInFactionCount: post: [-2147483648]VREAndroids.FactionUtility_GetSlavesInFactionCount_Patch.Postfix | |
| FallingStructureArrival.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| FallingStructureStrategy.SpawnThreats: PRE: [200]EnterHere.RaidStrategyWorker_SpawnThreats.Prefix | |
| FeedPatientUtility.ShouldBeFed: post: [-2147483648]VREAndroids.FeedPatientUtility_ShouldBeFed_Patch.Postfix | |
| FertilityGrid.CalculateFertilityAt: post: DubsBadHygiene.Patches.HarmonyPatches_Fertilizer+H_CalculateFertilityAt.PostFix, VEE.FertilityGrid_Patch.Postfix, Mashed_Ashlands.BiotechHarmonyPatches.FertilityGrid_CalculateFertilityAt_Patch TRANS: ReGrowthCore.FertilityGrid_CalculateFertilityAt_Patch.Transpiler | |
| FertilityGrid_Patch.Postfix: PRE: MapPreview.Compatibility.ModCompat_VE_VEE.FertilityGrid_Patch | |
| FilthMonitor.FilthMonitorTick: post: AdaptiveStorage.HarmonyPatches.UpdateInvalidHaulablesAndMergeables.Postfix | |
| Find.get_Anomaly: (no patches) | |
| Find.get_BossgroupManager: (no patches) | |
| Find.get_GravshipController: (no patches) | |
| Find.get_PawnDuplicator: (no patches) | |
| Find.get_PsychicRitualManager: (no patches) | |
| Fire.DeSpawn: PRE: ReGrowthCore.Patch_DeSpawn.Prefix | |
| Fire.SpawnSetup: post: ReGrowthCore.Patch_SpawnSetup.Postfix | |
| FireUtility.CanEverAttachFire: post: AlphaGenes.AlphaGenes_FireUtility_CanEverAttachFire_Patch.CantAttachFire | |
| FireWatcher.UpdateObservations: PRE: ReGrowthCore.Patch_FireWatcher_UpdateObservations.Prefix | |
| FiringIncident..ctor: post: BigAndSmall.FiringIncident_Patch.Postfix | |
| FishingUtility.GetCatchesFor: TRANS: VCE_Fishing.VCE_Fishing_FishingUtility_GetCatchesFor_Patch.Transpiler | |
| FishingUtility.GetNegativeFishingOutcomes: post: Bestiary.FishingUtility_GetNegativeFishingOutcomes.Postfix TRANS: VCE_Fishing.VCE_Fishing_FishingUtility_GetNegativeFishingOutcomes_Patch.Transpiler | |
| FleshTypeDef.ChooseWoundOverlay: PRE: [200]BigAndSmall.MechanicalColonistPatches.ChooseWoundOverlayPatch post: VEF.Genes.VanillaExpandedFramework__FleshTypeDef_ChooseWoundOverlay_Patch.Postfix | |
| FleshTypeDef.Wound.Resolve: TRANS: VanillaPsycastsExpanded.WoundWithShader.Resolve_Transpiler | |
| FloatMenu.UpdateBaseColor: PRE: FloatSubMenus.Patches.UpdateBaseColor_Pre post: FloatSubMenus.Patches.UpdateBaseColor_Post | |
| FloatMenu.get_SizeMode: post: RecipeIcons.Patch.FloatMenu_SizeMode.Postfix | |
| FloatMenuMakerMap.GetOptions: post: BigAndSmall.FloatMenuMakerMap_AddHumanlikeOrders_Patch.Postfix, Ammunition.Harmony.AmmoHarmonyPatches.GetOptions_PostFix | |
| FloatMenuMakerMap.ShouldGenerateFloatMenuForPawn: post: [-2147483648]VREAndroids.FloatMenuMakerMap_ShouldGenerateFloatMenuForPawn_Patch.Postfix | |
| FloatMenuOption.DoGUI: post: RecipeIcons.Patch.FloatMenuOption_DoGUI.Postfix | |
| FloatMenuOptionProvider.Applies: PRE: Vehicles.Patch_VehiclePathing.DontVanillaDraftMoveVehicles | |
| FloatMenuOptionProvider_Arrest.GetSingleOptionFor: PRE: ReSpliceCharmweavers.FloatMenuOptionProvider_Arrest_GetSingleOptionFor_Patch.Prefix | |
| FloatMenuOptionProvider_CapturePawn.GetSingleOptionFor: PRE: ReSpliceCharmweavers.FloatMenuOptionProvider_CapturePawn_GetSingleOptionFor_Patch.Prefix | |
| FloatMenuOptionProvider_CleanRoom.get_Undrafted: PRE: AchtungMod.FloatMenuOptionProviders_Patch.Prefix | |
| FloatMenuOptionProvider_ComaGene.get_Cache: (no patches) | |
| FloatMenuOptionProvider_DraftedMove.PawnCanGoto: PRE: Vehicles.Patch_VehiclePathing.MultiselectVehicleGotoBlocked | |
| FloatMenuOptionProvider_DraftedMove.PawnGotoAction: (no patches) | |
| FloatMenuOptionProvider_DressOtherPawn.GetSingleOptionFor: post: VEF.Apparels.VanillaExpandedFramework_FloatMenuOptionProvider_DressOtherPawn_GetSingleOptionFor_Patch.Postfix | |
| FloatMenuOptionProvider_EnterMapPortal.GetSingleOptionFor: PRE: AchtungMod.FloatMenuOptionProvider_EnterMapPortal_GetSingleOptionFor_Patch.Prefix | |
| FloatMenuOptionProvider_Equip.AppliesInt: post: VEF.AnimalBehaviours.VanillaExpandedFramework_FloatMenuOptionProvider_Equip_AppliesInt_Patch.NoWeaponEquipping | |
| FloatMenuOptionProvider_Equip.GetSingleOptionFor: PRE: VEF.Weapons.VanillaExpandedFramework_FloatMenuOptionProvider_Equip_GetSingleOptionFor_Patch.Prefix post: VEF.Weapons.VanillaExpandedFramework_FloatMenuOptionProvider_Equip_GetSingleOptionFor_Patch.Postfix, VEF.Apparels.VanillaExpandedFramework_FloatMenuOptionProvider_Equip_GetSingleOptionFor_Patch.Postfix | |
| FloatMenuOptionProvider_ExtinguishFires.get_Drafted: PRE: AchtungMod.FloatMenuOptionProviders_Patch.Prefix | |
| FloatMenuOptionProvider_ExtinguishFires.get_Undrafted: PRE: AchtungMod.FloatMenuOptionProviders_Patch.Prefix | |
| FloatMenuOptionProvider_Ingest.GetSingleOptionFor: post: VEF.AnimalBehaviours.VanillaExpandedFramework_FloatMenuOptionProvider_Ingest_GetSingleOptionFor_Patch.RemoveErrorForNonForbiddables | |
| FloatMenuOptionProvider_OpenThing.GetSingleOptionFor: post: VFED.HarmonyPatches.MiscPatches.Postfix | |
| FloatMenuOptionProvider_OrderVehicle.PawnGotoAction: (no patches) | |
| FloatMenuOptionProvider_ReloadableAbilities.get_Cache: (no patches) | |
| FloatMenuOptionProvider_Wear.GetSingleOptionFor: post: VEF.Apparels.VanillaExpandedFramework_FloatMenuOptionProvider_Wear_GetSingleOptionFor_Patch.Postfix, VanillaPsycastsExpanded.Technomancer.Psyring.EquipConditions, MVCF.PatchSets.PatchSet_Brawlers.GetSingleOptionFor_Postfix | |
| FloatMenuOptionProvider_WorkGivers.GetWorkGiverOption: PRE: [1000000]AchtungMod.FloatMenuOptionProvider_WorkGivers_GetWorkGiverOption_Patch.Prefix post: VEF.AnimalBehaviours.VanillaExpandedFramework_FloatMenuOptionProvider_WorkGivers_GetWorkGiverOption_Patch.NoWorkBesidesAttacks, AchtungMod.FloatMenuOptionProvider_WorkGivers_GetWorkGiverOption_Patch.Postfix TRANS: AchtungMod.FloatMenuOptionProvider_WorkGivers_GetWorkGiverOption_Patch.Transpiler | |
| FloatMenuOptionProvider_WorkGivers.ScannerShouldSkip: PRE: AchtungMod.FloatMenuOptionProvider_WorkGivers_ScannerShouldSkip_Patch.Prefix | |
| FloatMenuUtility.GetMeleeAttackAction: PRE: Vehicles.Patch_Components.NoMeleeForVehicles, ReSpliceCharmweavers.FloatMenuUtility_DisableAttack_Patch.Prefix | |
| FloatMenuUtility.GetRangedAttackAction: PRE: ReSpliceCharmweavers.FloatMenuUtility_DisableAttack_Patch.Prefix | |
| FlyPawnArriving.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| FlyPawnLeaving.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| FoodUtility.<>c__DisplayClass16_0.<BestFoodSourceOnMap>b__0: TRANS: VanillaCookingExpanded.HarmonyPatches.H_FoodUtility_TryFindBestFoodSourceFor.Transpiler | |
| FoodUtility.<>c__DisplayClass16_0.<BestFoodSourceOnMap>b__1: TRANS: VanillaCookingExpanded.HarmonyPatches.H_FoodUtility_TryFindBestFoodSourceFor.Transpiler | |
| FoodUtility.<>c__DisplayClass16_0.<BestFoodSourceOnMap>b__2: TRANS: VanillaCookingExpanded.HarmonyPatches.H_FoodUtility_TryFindBestFoodSourceFor.Transpiler | |
| FoodUtility.AddFoodPoisoningHediff: PRE: VanillaTraitsExpanded.AddFoodPoisoningHediff_Patch.Prefix | |
| FoodUtility.AddThoughtsFromIdeo: PRE: VanillaRacesExpandedFungoid.VanillaRacesExpandedFungoid_FoodUtility_AddThoughtsFromIdeo_Patch.DisableNonCannibalFoodThought | |
| FoodUtility.BestFoodInInventory: TRANS: VanillaCookingExpanded.HarmonyPatches.H_FoodUtility_BestFoodInInventory.Transpiler | |
| FoodUtility.BestFoodSourceOnMap: TRANS: AnimalsLogic.AnimalsUseDispenser.BestFoodSourcePatch | |
| FoodUtility.GetFoodKind: (no patches) | |
| FoodUtility.GetMeatSourceCategory: PRE: VEF.Genes.VanillaExpandedFramework_FoodUtility_GetMeatSourceCategory.Prefix, VEF.Cooking.VanillaExpandedFramework_FoodUtility_GetMeatSourceCategory_Patch.DontCrapTheBedWithIngredientsWithoutNutrition | |
| FoodUtility.GetMeatSourceCategoryFromCorpse: PRE: VEF.Genes.VanillaExpandedFramework_FoodUtility_GetMeatSourceCategoryFromCorpse.Prefix | |
| FoodUtility.InappropriateForTitle: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| FoodUtility.IsAcceptablePreyFor: post: BigAndSmall.IsAcceptablePreyFor_Patch.Postfix, IllogicalPredator.HarmonyPatches.IsAcceptablePreyForPostfix, [-2147483648]VREAndroids.FoodUtility_IsAcceptablePreyFor_Patch.Postfix | |
| FoodUtility.NutritionForEater: post: AlphaGenes.AlphaGenes_FoodUtility_NutritionForEater_Postfix.PostFix | |
| FoodUtility.ThoughtsFromIngesting: PRE: VEF.Genes.ThingIngestingPatches.Prefix post: AlphaGenes.AlphaGenes_FoodUtility_ThoughtsFromIngesting_Patch.DisableThoughtsFromVenomGland, VanillaRacesExpandedFungoid.VanillaRacesExpandedFungoid_FoodUtility_ThoughtsFromIngesting_Patch.AddPorkThought, VanillaMemesExpanded.VanillaMemesExpanded_FoodUtility_ThoughtsFromIngesting_Patch.NotifyAnimalProducstIngested | |
| FoodUtility.WillEat: PRE: [10000]BigAndSmall.DietPatch.WillDietPermitEatingThing post: [-2147483648]VREAndroids.FoodUtility_WillEat_Thing_Patch.Postfix | |
| FoodUtility.WillEat: PRE: [700]BigAndSmall.DietPatch.WillEatDef_Prefix post: [-2147483648]VREAndroids.FoodUtility_WillEat_ThingDef_Patch.Postfix | |
| ForagedFoodPerDayCalculator.GetBaseForagedNutritionPerDay: PRE: Vehicles.Patch_CaravanHandling.GetBaseForagedNutritionPerDayInVehicle | |
| ForagedFoodPerDayCalculator.GetForagedFoodCountPerInterval: post: GeneticRim.GeneticRim_ForagedFoodPerDayCalculator_GetForagedFoodCountPerInterval_Patch.MultiplyForaging | |
| ForbidUtility.CaresAboutForbidden: post: VEF.Planet.HireableSystemStaticInitialization.CaresAboutForbidden_Postfix | |
| ForbidUtility.IsForbidden: PRE: [2147483647]PerformanceOptimizer.Optimization_ForbidUtility_IsForbidden.Prefix, AchtungMod.ForbidUtility_IsForbidden_Patch.Prefix post: EBSGFramework.HarmonyPatches.IsForbiddenPostfix, [-2147483648]PerformanceOptimizer.Optimization_ForbidUtility_IsForbidden.Postfix | |
| ForcedWork.get_Instance: (no patches) | |
| FormCaravanComp.<>c__DisplayClass18_0.<GetGizmos>b__0: TRANS: VanillaGravshipExpanded.ListAllGravEngines_Patch.Transpiler | |
| FormCaravanComp.<GetGizmos>d__18.MoveNext: TRANS: Vehicles.Patch_FormCaravanDialog.ReformCaravanWithVehiclesGizmoTranspiler | |
| FormCaravanComp.CanReformNow: PRE: Vehicles.Patch_FormCaravanDialog.ReformWithVehicles | |
| Frame.CompleteConstruction: PRE: Vehicles.Patch_Construction.CompleteConstructionVehicle, AlphaBooks.AlphaBooks_Frame_CompleteConstruction_Patch.StoreCrafter, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_Frame_CompleteConstruction_Patch.StoreCrafter post: AlphaBooks.AlphaBooks_Frame_CompleteConstruction_Patch.RemoveCrafter, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_Frame_CompleteConstruction_Patch.RemoveCrafter TRANS: VEF.Pawns.VanillaExpandedFramework_Frame_CompleteConstruction_Patch.Transpiler, MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.AddMaterialsForThing, Worldbuilder.Frame_CompleteConstruction_Patch.Transpiler | |
| Frame.Destroy: PRE: VanillaVehiclesExpanded.Frame_Destroy_Patch.Prefix post: VanillaVehiclesExpanded.Frame_Destroy_Patch.Postfix | |
| Frame.FailConstruction: TRANS: AchtungMod.Frame_FailConstruction_Patch.Transpiler | |
| Frame.GetInspectString: TRANS: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.InspectStringWrongCall | |
| Frame.TotalMaterialCost: post: MaterialReplacement.Patch_Interchangability+HarmonyPatches_ResourceInterchangeability.FrameCostList | |
| Frame.get_WorkToBuild: PRE: [2147483647]PerformanceOptimizer.Optimization_Frame_WorkToBuild.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_Frame_WorkToBuild.Postfix | |
| Frame_Destroy_Patch.Postfix: (no patches) | |
| GUIUtility.GetControlID: (no patches) | |
| Game.AddMap: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData post: SmashTools.ComponentCache.PreCache | |
| Game.ClearCaches: post: PipeSystem.Game_ClearCaches.Postfix | |
| Game.DeinitAndRemoveMap: PRE: AchtungMod.Game_DeinitAndRemoveMap_Patch.Prefix post: HugsLib.Patches.Game_DeinitAndRemoveMap_Patch.MapRemovalHook, ReGrowthCore.Patch_Game_DeinitAndRemoveMap.Postfix | |
| Game.Dispose: PRE: SmashTools.GameEvent.RaiseOnGameDisposing post: SmashTools.GameEvent.RaiseOnGameDisposed | |
| Game.ExposeSmallComponents: post: DynamicTradeInterface.Patches.GameSettings.ExposeComponents | |
| Game.FillComponents: PRE: HugsLib.Patches.Game_FillComponents_Patch.GameInitializationHook, PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData | |
| Game.FinalizeInit: post: HugsLib.Patches.Game_FinalizeInit_Patch.WorldLoadedHook, ReplaceLib.Game_FinalizeInit_Patch.Postfix, RimHUD.Access.Patch.Verse_Game_FinalizeInit.Postfix, SearchAndDestroy.ExtendedDataStorageLoader.Load, Brrainz.ModFeatures.Game_FinalizeInit_Postfix | |
| Game.InitNewGame: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData, SimpleCameraSetting.CameraConfigPatch.PreFix, VFETribals.Game_InitNewGame_Patch.Prefix post: PawnEditor.StartingThingsManager.RestoreScenario, ProgressionCore.Game_InitNewGame_Patch.Postfix, MapPreview.Patches.Patch_Verse_Game.InitNewGame_Postfix TRANS: VEF.Maps.VanillaExpandedFramework_Game_InitNewGame_Patch.TweakMapSizes | |
| Game.LoadGame: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData, SimpleCameraSetting.CameraConfigPatch.LoadGamePreFix post: MapPreview.Patches.Patch_Verse_Game.LoadGame_Postfix | |
| Game.UpdatePlay: post: AchtungMod.Game_UpdatePlay_Patch.Postfix, ToggleableOverlays.Patch_Game_UpdatePlay.Postfix | |
| GameComponentUtility.FinalizeInit: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData post: UpdateLogTool.Patches.UpdateOnGameInit | |
| GameComponentUtility.GameComponentOnGUI: post: MoreWidgets.Patch_ShowCoords.DrawUI_Post | |
| GameComponentUtility.LoadedGame: post: SmashTools.GameEvent.RaiseOnLoadGame, UpdateLogTool.Patches.UpdateOnLoadedGame, VEF.Factions.VanillaExpandedFramework_GameComponentUtility_LoadedGame_Patch+LoadedGame.Postfix | |
| GameComponentUtility.StartedNewGame: post: SmashTools.GameEvent.RaiseOnNewGame, UpdateLogTool.Patches.UpdateOnNewGame, VEF.Factions.VanillaExpandedFramework_GameComponentUtility_LoadedGame_Patch+StartedNewGame.Postfix | |
| GameComponent_AncientMarket.get_GetComp: (no patches) | |
| GameComponent_Anomaly.Hypnotize: PRE: [2147483647]VREAndroids.GameComponent_Anomaly_Hypnotize_Patch.Prefix | |
| GameComponent_EventsCore.get_CurrentGame: (no patches) | |
| GameComponent_EventsCore.get_PlanetWeatherController: (no patches) | |
| GameComponent_HyperlinkInitializer.AddExcavatorHyperlinks: (no patches) | |
| GameComponent_PawnDuplicator.Duplicate: post: VanillaCookingExpandedVariety.GameComponent_PawnDuplicator_Duplicate_Patch.Postfix | |
| GameConditionManager.DoConditionsUI: PRE: MoreWidgets.Patch_ShowCoords.DoConditionsUI_Pre | |
| GameConditionManager.GameConditionManagerDraw: PRE: ProgressRenderer.Harmony_GameConditionManager_GameConditionManagerDraw.Prefix | |
| GameConditionManager.RegisterCondition: post: VanillaMemesExpanded.VanillaMemesExpanded_GameConditionManager_RegisterCondition_Patch.SendRandomMood | |
| GameConditionManager.TotalHeightAt: post: MoreWidgets.Patch_ShowCoords.TotalHeightAt_Post | |
| GameCondition_AETemperatureDrop.get_snowArmyMapComponent: (no patches) | |
| GameCondition_Aurora.Init: post: VanillaMemesExpanded.VanillaMemesExpanded_GameCondition_Aurora_Init_Patch.SendRandomMood | |
| GameCondition_ColossalFauna.GameConditionTick: (no patches) | |
| GameCondition_ForceWeather.<>c.<RandomizeSettings>b__4_0: post: VEF.Weathers.VanillaExpandedFramework_GameCondition_ForceWeather_RandomizeSettings_Patch.Postfix | |
| GameCondition_Microfauna.GameConditionTick: (no patches) | |
| GameCondition_NoSunlight.SkyTarget: post: Moonlight.Patch_NoSunlight.Postfix | |
| GameCondition_RottenStench.GameConditionTick: (no patches) | |
| GameCondition_VolcanicAsh.GiveOrUpdateHediff: (no patches) | |
| GameDataSaveLoader.SaveGame: PRE: ChooseYourMedicine.SaveGame_Prefix.Prefix | |
| GameDataSaveLoader.SaveXenotype: PRE: XenotypeSpawnControl.HarmonyPatches.GameDataSaveLoader_SaveXenotype.Prefix | |
| GameEnder.CheckOrUpdateGameOver: post: Vehicles.Patch_WorldHandling.GameEnderWithVehicles | |
| GameInitData.ResetWorldRelatedMapInitData: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData | |
| GasGrid.GasCanMoveTo: post: Vehicles.Patch_MapHandling.GasCanMoveThroughVehicle | |
| GasUtility.PawnGasEffectsTickInterval: (no patches) | |
| GatheringsUtility.<>c__DisplayClass12_0.<FindRandomGatheringOrganizer>g__CanOrganize|0: PRE: SimsTraits.GatheringsUtility_FindRandomGatheringOrganizer_CanOrganize_Patch.Prefix post: SimsTraits.GatheringsUtility_FindRandomGatheringOrganizer_CanOrganize_Patch.Postfix | |
| GatheringsUtility.InGatheringArea: post: AlphaMemes.GatheringsUtility_InGatheringArea_Patch.Postfix | |
| GatheringsUtility.ShouldGuestKeepAttendingGathering: PRE: [800]Vehicles.Patch_LordAi.VehiclesDontParty post: [-2147483648]VREAndroids.GatheringsUtility_ShouldGuestKeepAttendingGathering_Patch.Postfix | |
| GatheringsUtility.ShouldPawnKeepGathering: PRE: VanillaTraitsExpanded.ShouldPawnKeepGathering_Patch.Prefix | |
| GauranlenTreeModeDef.get_Description: (no patches) | |
| GenAdj.AdjacentTo8WayOrInside: PRE: Vehicles.Patch_VehiclePathing.AdjacentTo8WayOrInsideVehicle | |
| GenAdj.OccupiedRect: PRE: Vehicles.Patch_VehiclePathing.OccupiedRectVehicles | |
| GenCelestial.CelestialSunGlowPercent: post: EventsCore.Patches.GenCelestial_CelestialSunGlowPercent_EventsCorePatch.Postfix | |
| GenCelestial.CurCelestialSunGlow: PRE: [2147483647]PerformanceOptimizer.Optimization_GenCelestial_CurCelestialSunGlow.Prefix post: AlphaBiomes.AlphaBiomes_GenCelestial_CurCelestialSunGlow_Patch.AvoidTheLight, [-2147483648]PerformanceOptimizer.Optimization_GenCelestial_CurCelestialSunGlow.Postfix | |
| GenCelestial.CurShadowStrength: post: VanillaPsycastsExpanded.Nightstalker.GameCondition_IntenseShadows.CurShadowStrength_Postfix | |
| GenClosest.ClosestThingReachable: PRE: FixesForSBZFridge.GenClosest_ClosestThingReachable.Prefix | |
| GenConstruct.BlocksConstruction: PRE: AchtungMod.GenConstruct_BlocksConstruction_Patch.Prefix post: VEF.Buildings.VanillaExpandedFramework_GenConstruct_BlocksConstruction_Patch.Postfix | |
| GenConstruct.CanBuildOnTerrain: PRE: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.CanBuildOnTerrain_Prefix | |
| GenConstruct.CanConstruct: PRE: VEF.Pawns.VanillaExpandedFramework_GenConstruct_CanConstruct_Patch.Prefix | |
| GenConstruct.CanConstruct: PRE: VEF.Pawns.VanillaExpandedFramework_GenConstruct_CanConstruct_Patch2.Prefix post: VEF.Buildings.VanillaExpandedFramework_GenConstruct_CanConstruct_Patch.Postfix, AlphaGenes.AlphaGenes_GenConstruct_CanConstruct_Postfix.PostFix, AlphaMemes.AlphaMemes_GenConstruct_CanConstruct_Patch.CantBuildReliquary, VFEInsectoids.GenConstruct_CanConstruct_Patch.Postfix, VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_GenConstruct_CanConstruct_Postfix.PostFix | |
| GenConstruct.CanPlaceBlueprintAt: TRANS: VanillaGravshipExpanded.GenConstruct_CanPlaceBlueprintAt_Patch.Transpiler, VFEInsectoids.GenConstruct_CanPlaceBlueprintAt_NewTemp_Patch.Transpiler | |
| GenDefDatabase.GetDef: PRE: VanillaPsycastsExpanded.PsycastsMod.PreGetDef post: ReplaceLib.GenDefDatabase_GetDef.Postfix | |
| GenDefDatabase.GetDefSilentFail: PRE: VanillaPsycastsExpanded.PsycastsMod.PreGetDef post: ReplaceLib.GenDefDatabase_GetDefSilentFail.Postfix | |
| GenDraw.DrawAimPie: PRE: VanillaGravshipExpanded.GenDraw_DrawAimPie_Patch.Prefix TRANS: VanillaGravshipExpanded.CastSourceReplacer.Transpiler, VFED.Building_TurretGunBarrels+CastSourceReplacer.ReplaceCall | |
| GenDraw.DrawNoBuildEdgeLines: PRE: ChangeMapEdge.ChangeMapEdgeHarmony.DrawNoBuildEdgeLines_Prefix | |
| GenDraw.DrawNoZoneEdgeLines: PRE: ChangeMapEdge.ChangeMapEdgeHarmony.DrawNoZoneEdgeLines_Prefix | |
| GenExplosion.DoExplosion: post: ExplosionEffects.Patch.Postfix | |
| GenGameEnd.EndGameDialogMessage: PRE: VSEWW.GenGameEnd_EndGameDialogMessage.Prefix | |
| GenGameEnd_EndGameDialogMessage.Prefix: (no patches) | |
| GenGrid.InNoBuildEdgeArea: PRE: ChangeMapEdge.ChangeMapEdgeHarmony.IgnoreFunction post: ChangeMapEdge.ChangeMapEdgeHarmony.InNoBuildEdgeArea_Postfix | |
| GenGrid.InNoZoneEdgeArea: PRE: ChangeMapEdge.ChangeMapEdgeHarmony.IgnoreFunction post: ChangeMapEdge.ChangeMapEdgeHarmony.InNoZoneEdgeArea_Postfix | |
| GenGrid.WalkableBy: PRE: VEF.Hediffs.PhasingPatches.WalkableBy_Prefix | |
| GenGridVehicles.ImpassableForVehicles: post: VanillaGravshipExpanded.VehicleFramework_GenGridVehicles_ImpassableForVehicles_Patch.Postfix | |
| GenGuest.EnslavePrisoner: PRE: [2147483647]VREAndroids.GenGuest_EnslavePrisoner_Patch.Prefix | |
| GenHostility.AnyHostileActiveThreatToPlayer: post: VFED.HarmonyPatches.MiscPatches.ComplexHostileWithQuest | |
| GenHostility.HostileTo: post: AnimalsLogic.Patches.HostilePredators.HostileToThing_Postfix | |
| GenLabel.BestKindLabel: PRE: VREAndroids.GenLabel_BestKindLabel_Patch.Prefix | |
| GenLabel.NewThingLabel: post: TaintedRenaming.NewThingLabelClass.NewThingLabel | |
| GenLabel.ThingLabel: PRE: Worldbuilder.GenLabel_ThingLabel_Patch.Prefix post: PsiTech.Utility.GenLabelPatch.Postfix | |
| GenLeaving.DoLeavingsFor: PRE: Vehicles.Patch_Construction.DoUnsupportedVehicleRefunds | |
| GenLeaving.DropFilthDueToDamage: post: BloodAnimations.GenLeaving_DropFilthDueToDamage.DropFilthDueToDamage | |
| GenLeaving.GetBuildingResourcesLeaveCalculator: post: VanillaMemesExpanded.VanillaMemesExpanded_GenLeaving_GetBuildingResourcesLeaveCalculator_Patch.SetYieldTo100 | |
| GenPlace.PlaceSpotQualityAt: PRE: ReBuildDoorsAndCorners.GenPlace_PlaceSpotQualityAt_Patch.Prefix | |
| GenRadial.NumCellsInRadius: TRANS: VEF.GenRadialPatches.IncreaseNumCellsInRadiusCount | |
| GenRecipe.MakeRecipeProducts: PRE: [800]BigAndSmall.MechanicalColonistPatches.MakeRecipeProducts, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_GenRecipe_MakeRecipeProducts_Patch.StoreIngredients post: ArgonicCore.HarmonyPatches_Generic.ContaminateProduct, ArgonicCore.HarmonyPatches_Generic.AddHediffPostRecipeCompletion, ArgonicCore.HarmonyPatches_Generic.MakeSpecialProducts, ArgonicCore.HarmonyPatches_Generic.RegisterIngredients, VFEMedieval.VFEMedieval_GenRecipe_MakeRecipeProducts_Patch.Postfix, Worldbuilder.GenRecipe_MakeRecipeProducts_Patch.Postfix, EBSGFramework.HarmonyPatches.MakeRecipeProductsPostfix, AlphaBooks.AlphaBooks_GenRecipe_MakeRecipeProducts_Patch.Postfix, Jewelry.GenRecipe_MakeRecipeProducts.Postfix, SimsTraits.GenRecipe_MakeRecipeProducts_Patch.Postfix, VanillaAnimalsExpandedRoyal.VanillaAnimalsExpandedRoyal_GenRecipe_MakeRecipeProducts_Patch.Postfix, VanillaCookingExpanded.VanillaCookingExpanded_GenRecipe_MakeRecipeProducts_Patch.Postfix, VanillaSocialInteractionsExpanded.MakeRecipeProducts_Patch.Postfix, VanillaTraitsExpanded.MakeRecipeProducts_Patch.Postfix, Bestiary.HarmonyPatches.MakeRecipeProductsPostfix, VanillaCookingExpandedHaute.VanillaCookingExpandedHaute_GenRecipe_MakeRecipeProducts_Patch.Postfix, GeneticRim.GeneticRim_GenRecipe_MakeRecipeProducts.AddQualityToImplants | |
| GenRecipe.PostProcessProduct: PRE: ArgonicCore.HarmonyPatches_Generic.ReturnBotchedThing post: ArgonicCore.HarmonyPatches_Generic.InheritQuality, AlphaGenes.AlphaGenes_GenRecipe_PostProcessProduct_Patch.IncreaseQualityByOne, AlphaBooks.AlphaBooks_GenRecipe_PostProcessProduct_Patch.HandleCraftModifications, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_GenRecipe_PostProcessProduct_Patch.HandleCraftModifications, VanillaCookingExpandedHaute.VanillaCookingExpandedHaute_GenRecipe_PostProcessProduct_Patch.Postfix, GeneticRim.GeneticRim_GenRecipe_PostProcessProduct.AddQualityToImplants, VanillaMemesExpanded.VanillaMemesExpanded_GenRecipe_PostProcessProduct_Patch.IncreaseQualityByOne | |
| GenSpawn.Spawn: PRE: Vehicles.Patch_Construction.RegisterThingSpawned, VFEPirates.GenSpawn_Spawn_Patch.Prefix, ReGrowthCore.GenSpawn_Spawn_Patch.Prefix | |
| GenSpawn.SpawningWipes: PRE: Dubs_Skylight.Patch_SpawningWipes.Prefix post: VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_GenSpawn_SpawningWipes_Patch.DisableDeconstruct | |
| GenStep_AncientComplex.GenerateAndSpawn: (no patches) | |
| GenStep_Animals.Generate: PRE: [600]GeologicalLandforms.Patches.Patch_RimWorld_GenStep_Animals.Generate_Prefix | |
| GenStep_Asteroid.GenerateArcheanTree: PRE: MapPreview.Patches.Patch_RimWorld_GenStep_Asteroid.GenerateArcheanTree | |
| GenStep_Asteroid.GenerateRuins: PRE: MapPreview.Patches.Patch_RimWorld_GenStep_Asteroid.GenerateRuins | |
| GenStep_Asteroid.SpawnOres: PRE: ReGrowthCore.GenStep_Asteroid_SpawnOres_Patch.Prefix, MapPreview.Patches.Patch_RimWorld_GenStep_Asteroid.SpawnOres | |
| GenStep_CaveHives.Generate: TRANS: [100]GeologicalLandforms.Patches.Patch_RimWorld_GenStep_CaveHives.Generate_Transpiler | |
| GenStep_DownedRefugee.ScatterAt: (no patches) | |
| GenStep_Fog.Generate: PRE: VanillaQuestsExpandedAncients.GenStep_Fog_Generate_Patch.Prefix | |
| GenStep_GravshipMarker.Generate: PRE: VanillaGravshipExpanded.GenStep_GravshipMarker_Generate_Patch.Prefix | |
| GenStep_GravshipWreckage.Generate: TRANS: VanillaGravshipExpanded.GenStep_GravshipWreckage_Generate_Patch.Transpiler | |
| GenStep_InventorShelter.PostGenerate: (no patches) | |
| GenStep_ItemStash.ScatterAt: (no patches) | |
| GenStep_Labyrinth.Generate: (no patches) | |
| GenStep_Power.Generate: PRE: KCSG.Prefix_GenStep_Power.Prefix | |
| GenStep_PreciousLump.Generate: PRE: VanillaTradingExpanded.ResetMarketValue_Patch.Prefix post: VanillaTradingExpanded.ResetMarketValue_Patch.Postfix | |
| GenStep_PrisonerWillingToJoin.ScatterAt: (no patches) | |
| GenStep_RandomAncientComplex.ScatterAt: (no patches) | |
| GenStep_ReserveGravshipArea.Generate: PRE: VanillaGravshipExpanded.GenStep_ReserveGravshipArea_Generate_Patch.Prefix | |
| GenStep_RockChunks.GrowLowRockFormationFrom: PRE: AlphaBiomes.AlphaBiomes_GenStep_RockChunks_GrowLowRockFormationFrom_Patch.RemoveRockFilth post: ReGrowthCore.GenStep_RockChunks_GrowLowRockFormationFrom_Patch.Postfix TRANS: ReGrowthCore.GenStep_RockChunks_GrowLowRockFormationFrom_Patch.Transpiler | |
| GenStep_RocksFromGrid.Generate: PRE: Vehicles.Patch_VehiclePathing.DisableRegionUpdatingRockGen TRANS: [100]GeologicalLandforms.Patches.Patch_RimWorld_GenStep_RocksFromGrid.Generate_Transpiler | |
| GenStep_ScatterLumpsMineable.ChooseThingDef: PRE: VanillaTradingExpanded.ResetMarketValue_Patch.Prefix post: VanillaTradingExpanded.ResetMarketValue_Patch.Postfix | |
| GenStep_ScatterLumpsMineable.ScatterAt: post: ReGrowthCore.GenStep_ScatterLumpsMineable_ScatterAt_Patch.Postfix | |
| GenStep_Scatterer.Generate: PRE: [600]GeologicalLandforms.Patches.Patch_RimWorld_GenStep_Scatterer.Generate_Prefix post: [200]GeologicalLandforms.Patches.Patch_RimWorld_GenStep_Scatterer.Generate_Postfix | |
| GenStep_Settlement.ScatterAt: PRE: [0]VFE_Settlers.Utilities.Harmony+GenStep_SettlementScatterAt_Patch.PreFix TRANS: VEF.Factions.VanillaExpandedFramework_GenStep_Settlement_ScatterAt_Patch.Transpiler | |
| GenStuff.RandomStuffInexpensiveFor: post: AlphaBiomes.AlphaBiomes_GenStuff_RandomStuffInexpensiveFor_Patch.RemoveMaterial TRANS: [0]VEF.Things.VanillaExpandedFramework_GenStuff_RandomStuffInexpensiveFor_Patch.Transpiler | |
| GenStuff.TryRandomStuffByCommonalityFor: PRE: [800]VEF.Things.VanillaExpandedFramework_GenStuff_TryRandomStuffByCommonalityFor_Patch.Prefix | |
| GenTemperature.ComfortableTemperatureRange: post: SoftWarmBeds.GenTemperature_ComfortableTemperatureRange.Postfix | |
| GenTemperature.GetTemperatureForCell: PRE: VanillaPsycastsExpanded.GenTemperature_GetTemperatureForCell_Patch.Prefix | |
| GenTemperature_GetTemperatureForCell_Patch.Prefix: (no patches) | |
| GenThing.ItemCenterAt: PRE: VanillaGravshipExpanded.GenThing_ItemCenterAt_Patch.Prefix | |
| GenThing.TrueCenter: PRE: Vehicles.Patch_Rendering.TrueCenterVehicle | |
| GenUI.DistFromRect: PRE: FloatSubMenus.Patches.DistFromRect_Pre | |
| Gene.ExposeData: post: VEF.Genes.VanillaExpandedFramework_Gene_ExposeData_Patch.Postfix, BigAndSmall.NotifyGenesChanges.Gene_ExposeDataPatch | |
| Gene.Notify_PawnDied: post: VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_Gene_Notify_PawnDied_Patch.RemoveFromStaticList | |
| Gene.OverrideBy: post: VEF.Genes.VanillaExpandedFramework_Gene_OverrideBy_Patch.Postfix, VREHussars.VREHussars_Gene_OverrideBy_Patch.Postfix, BigAndSmall.NotifyGenesChanges.Gene_OverrideBy_Patch TRANS: BigAndSmall.OverrideAllConflictingTranspiler.Transpile | |
| Gene.PostAdd: post: VEF.Genes.VanillaExpandedFramework_Gene_PostAdd_Patch.Postfix, BigAndSmall.NotifyGenesChanges.Gene_PostAddPatch | |
| Gene.PostRemove: post: VEF.Genes.VanillaExpandedFramework_Gene_PostRemove_Patch.Postfix, BigAndSmall.NotifyGenesChanges.Gene_PostRemovePatch | |
| GeneDef.ConflictsWith: post: EBSGFramework.HarmonyPatches.GeneConflictsWithPostfix | |
| GeneDef.GetDescriptionFull: post: BigAndSmall.GeneDef_GetDescriptionFull.Postfix, VanillaQuestsExpandedAncients.GeneDef_GetDescriptionFull_Patch.Postfix, [-2147483648]VREAndroids.GeneDef_GetDescriptionFull_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.GeneDef_GetDescriptionFull.AgeCurveTranspiler | |
| GeneDef.SpecialDisplayStats: post: [-2147483648]VREAndroids.GeneDef_SpecialDisplayStats_Patch.Postfix | |
| GeneDefGenerator.ImpliedGeneDefs: post: VREAndroids.GeneDefGenerator_ImpliedGeneDefs_Patch.Postfix, VREHussars.VREHussars_GeneDefGenerator_ImpliedGeneDefs_Patch.Postfix, VanillaRacesExpandedLycanthrope.VanillaRacesExpandedLycanthrope_GeneDefGenerator_ImpliedGeneDefs_Patch.Postfix, VanillaRacesExpandedStarjack.VanillaRacesExpandedStarjack_GeneDefGenerator_ImpliedGeneDefs_Patch.Postfix, AlphaGenes.AlphaGenes_GeneDefGenerator_ImpliedGeneDefs_Patch.Postfix, [100]BigAndSmall.DefGeneratorPatches.ImpliedGeneDefs_Postfix | |
| GeneGizmo_Resource.get_Title: PRE: VanillaRacesExpandedPhytokin.VanillaRacesExpandedPhytokin_GeneGizmo_Resource_Title_Patch.ChangeBarColour, VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_GeneGizmo_Resource_Title_Patch.ChangeLabel | |
| GeneGizmo_ResourceHemogen.GizmoOnGUI: post: VPEHemosage.GeneGizmo_ResourceHemogen_GizmoOnGUI_Patch.Postfix | |
| GeneResourceDrainUtility.OffsetResource: PRE: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_GeneResourceDrainUtility_OffsetResource_Apply_Patch.DoubleHemogenLoss | |
| GeneUIUtility.DoDebugButton: post: BigAndSmall.Debugging.DebugUIPatches.DoDebugButton_Postfix | |
| GeneUIUtility.DrawGene: TRANS: VEF.Genes.VanillaExpandedFramework_GeneUIUtility_DrawGene_Patch.Transpiler | |
| GeneUIUtility.DrawGeneBasics: TRANS: VEF.Genes.VanillaExpandedFramework_GeneUIUtility_DrawGeneBasics_Patch.Transpiler, BigAndSmall.DrawGene.Transpiler | |
| GeneUIUtility.DrawGenesInfo: PRE: [2147483647]VREAndroids.GeneUIUtility_DrawGenesInfo_Patch.Prefix, BigAndSmall.DrawGeneSection.DrawGenesInfoPrefix TRANS: RimHUD.Access.Patch.RimWorld_GeneUIUtility_DrawGenesInfo.Transpiler | |
| GeneUIUtility.DrawSection: PRE: VanillaRacesExpandedStarjack.VanillaRacesExpandedStarjack_GeneUIUtility_DrawSection_Patch.Prefix, VanillaRacesExpandedInsector.GeneUIUtility_DrawSection_Patch.Prefix post: VanillaRacesExpandedStarjack.VanillaRacesExpandedStarjack_GeneUIUtility_DrawSection_Patch.Postfix, VanillaRacesExpandedInsector.GeneUIUtility_DrawSection_Patch.Postfix TRANS: [200]BigAndSmall.DrawGeneSection.Transpiler | |
| GeneUIUtility.RecacheGenes: post: EBSGFramework.HarmonyPatches.RecacheGenesPostfix | |
| GeneUtility.AddedAndImplantedPartsWithXenogenesCount: post: [200]BigAndSmall.MechanicalColonistPatches+AddedAndImplantedPartsWithXenogenesCount_Patch.Postfix | |
| GeneUtility.ExtractXenogerm: (no patches) | |
| GeneUtility.IsBloodfeeder: post: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_GeneUtility_IsBloodfeeder_Patch.CountEkkimianAsBloodfeeder, BigAndSmall.IsBloodfeederPatch.Postfix, EBSGFramework.HarmonyPatches.IsBloodfeederPostfix | |
| GeneUtility.SatisfyChemicalGenes: post: EBSGFramework.HarmonyPatches.SatisfyChemicalGenesPostfix | |
| GeneUtility.ToBodyType: PRE: [100]BigAndSmall.HarmonyPatches.ToBodyTypePatch | |
| GeneUtility.get_GenesInOrder: post: [-2147483648]VREAndroids.GeneUtility_GenesInOrder_Patch.Postfix, [-2147483648]VanillaRacesExpandedStarjack.VanillaRacesExpandedStarjack_GeneUtility_GenesInOrder_Patch.Postfix, [-2147483648]VanillaRacesExpandedInsector.GeneUtility_GenesInOrder_Patch.Postfix | |
| Gene_Deathrest.get_DeathrestEfficiency: post: EBSGFramework.HarmonyPatches.DeathrestEfficiencyPostfix | |
| Gene_Hemogen.get_InitialResourceMax: post: EBSGFramework.HarmonyPatches.HemogenMaxPostFix | |
| Gene_PsychicBonding.BondTo: post: BigAndSmall.Gene_PsychicBonding_BondTo.Postfix | |
| Gene_PsychicBonding.RemoveBond: PRE: BigAndSmall.Gene_PsychicBonding_RemoveBond.Prefix | |
| Genepack.ExposeData: post: ReSpliceCore.Genepack_ExposeData_Patch.Postfix | |
| Genepack.Initialize: PRE: BigAndSmall.Genepack_Initialize_Patch.Prefix post: ReSpliceCore.Genepack_Initialize_Patch.Postfix | |
| Genepack.PostMake: post: ReSpliceCore.Genepack_PostMake_Patch.Postfix, AlphaGenes.AlphaGenes_Genepack_PostMake_Patch.ChangeForAlphaGenes | |
| Genepack.TickRare: post: ReSpliceCore.Genepack_TickRare_Patch.Postfix | |
| GeneratorVehicleSkyfallerCrashing.Vehicles.IVehicleDefGenerator<Verse.ThingDef>.TryGenerateImpliedDef: (no patches) | |
| GeneratorVehicleSkyfallerIncoming.Vehicles.IVehicleDefGenerator<Verse.ThingDef>.TryGenerateImpliedDef: (no patches) | |
| GeneratorVehicleSkyfallerLeaving.Vehicles.IVehicleDefGenerator<Verse.ThingDef>.TryGenerateImpliedDef: (no patches) | |
| GetOrGenerateMapUtility.GetOrGenerateMap: PRE: VEF.Maps.VanillaExpandedFramework_GetOrGenerateMapUtility_GetOrGenerateMap_Patch.TweakMapSizes | |
| GhostDrawer.DrawGhostThing: PRE: Worldbuilder.GhostDrawer_DrawGhostThing_Patch.Prefix, VanillaVehiclesExpanded.GhostDrawer_DrawGhostThing_Patch.Prefix post: Vehicles.Patch_Rendering.DrawGhostVehicle, VanillaVehiclesExpanded.GhostDrawer_DrawGhostThing_Patch.Postfix | |
| GhostUtility.GhostGraphicFor: PRE: VEF.Buildings.VanillaExpandedFramework_GhostUtility_GhostGraphicFor_Patch.DisplayBlueprintGraphic TRANS: VEF.Buildings.CustomizableGraphicsPatches+UseUiIconForCustomizableGraphicGhosts.Transpiler | |
| GiveToPackAnimalUtility.UsablePackAnimalWithTheMostFreeSpace: PRE: Vehicles.Patch_CaravanFormation.UsableVehicleWithMostFreeSpace | |
| GizmoGridDrawer.<DrawGizmoGrid>g__ProcessGizmoState|18_0: PRE: DubsMintMenus.HarmonyPatches+H_GizmoGridDrawer.Prefix TRANS: PerformanceOptimizer.Optimization_InspectGizmoGrid_DrawInspectGizmoGridFor.GizmoGridDrawer_ProcessGizmoStateTranspiler | |
| GizmoGridDrawer.DrawGizmoGrid: TRANS: UINotIncluded.Patches.GizmoGridDrawerPatch.Transpiler | |
| GizmoGridDrawer.DrawGizmoGridFor: TRANS: AllowTool.Patches.GizmoGridDrawer_DrawGizmoGridFor_Patch.ClearReverseDesignators, PerformanceOptimizer.Optimization_InspectGizmoGrid_DrawInspectGizmoGridFor.InspectGizmoGrid_DrawInspectGizmoGridForTranspiler | |
| Gizmo_GrowthTier.GrowthTierTooltip: TRANS: BetterRomance.HarmonyPatches.Gizmo_GrowthTier_GrowthTierTooltip.Transpiler | |
| GlitterNetPane_AwokenHubSummary.get_Manager: (no patches) | |
| GlitterNetSignalListener.get_Manager: (no patches) | |
| GlitterNetSystemWakeEnforcer.FinalizeInit: (no patches) | |
| GlitterNetSystemWakeManager.get_Enforcer: (no patches) | |
| GlobalControls.GlobalControlsOnGUI: PRE: FactionCustomizer.PlanetGUIPatch.GlobalControlsOnGUIPrefix TRANS: UINotIncluded.GlobalControl_TranspilerPatch.Transpiler | |
| GlobalControls.TemperatureString: TRANS: [-2147483648]VanillaPsycastsExpanded.GlobalControls_TemperatureString_Patch.Transpiler | |
| GlobalControlsUtility.DoDate: PRE: [200]UINotIncluded.GlobalControlsUtilityPatches.DoDate_Patch | |
| GlobalControlsUtility.DoPlaySettings: PRE: [200]UINotIncluded.GlobalControlsUtilityPatches.DoPlaySettingsPatch | |
| GlobalControlsUtility.DoRealtimeClock: PRE: [200]UINotIncluded.GlobalControlsUtilityPatches.DoRealtimeClock_Patch | |
| GlobalControlsUtility.DoTimespeedControls: PRE: Analyzer.GUIElement_TPS.Prefix, [200]UINotIncluded.GlobalControlsUtilityPatches.DoTimespeedControls_Patch | |
| GlobalControls_TemperatureString_Patch.ModifyTemperatureIfNeeded: (no patches) | |
| GlobalDrawLayer_Sun.Regenerate: PRE: EventsCore.Patches.GlobalDrawLayer_Sun_Regenerate_EventsCorePatch.Prefix | |
| GlowGrid.GroundGlowAt: PRE: VanillaPsycastsExpanded.Nightstalker.CompDarkener.IgnoreSkyDark post: Dubs_Skylight.Patch_GameGlowAt.Postfix, VanillaPsycastsExpanded.Nightstalker.GameCondition_IntenseShadows.GameGlowAt_Postfix TRANS: ReBuildDoorsAndCorners.GlowGrid_GroundGlowAt_Patch.Transpiler | |
| GlowGrid_GroundGlowAt_Patch.HasNoNaturalLight: (no patches) | |
| GoodwillSituationManager.GetNaturalGoodwill: post: VFEMedieval.GoodwillSituationManager_GetNaturalGoodwill_Patch.Postfix | |
| GoodwillSituationManager.RecalculateAll: post: Moonlight.Patch_GoodwillSituationManager_RecalculateAll.Postfix | |
| GoodwillSituationWorker_PermanentEnemy.ArePermanentEnemies: post: VFED.HarmonyPatches.GoodwillPatches.ArePermanentEnemies_Postfix | |
| GraphicData.GraphicColoredFor: PRE: EmergingAnimals.HarmonyPatches.GraphicColoredForPrefix | |
| GraphicData.Init: post: Vehicles.Patch_Graphics.GraphicInit | |
| GraphicUtility.ExtractInnerGraphicFor: PRE: VEF.Buildings.CustomizableGraphicsPatches+UseCorrectGraphicForMinifiedThing.Prefix | |
| Graphic_Flicker.DrawWorker: (no patches) | |
| Graphic_Linked.ShouldLinkWith: post: ReGrowthCore.Graphic_Linked_ShouldLinkWith_Patch.Postfix | |
| Graphic_Random.GetColoredVersion: PRE: VanillaAnimalsExpandedRoyal.VanillaAnimalsExpandedRoyal_Graphic_Random_GetColoredVersion_Patch.AvoidStupidErrorMessages | |
| Graphic_Random.SubGraphicFor: post: Worldbuilder.Graphic_Random_SubGraphicFor_Patch.Postfix | |
| Gravship.AddThing: post: VanillaGravshipExpanded.Gravship_AddThing_Patch.Postfix | |
| Gravship.CopyCellContents: TRANS: VEF.Buildings.VanillaExpandedFramework_Gravship_CopyCellContents_Patch.Transpiler | |
| Gravship.get_Label: post: VanillaGravshipExpanded.Gravship_Label_Patch.Postfix | |
| GravshipCapturer.BeginGravshipRender: PRE: VanillaGravshipExpanded.GravshipCapturer_BeginGravshipRender_Patch.Prefix post: VanillaGravshipExpanded.GravshipCapturer_BeginGravshipRender_Patch.Postfix | |
| GravshipLandingMarker.CacheCells: (no patches) | |
| GravshipLandingMarker.DrawAt: TRANS: VanillaGravshipExpanded.GravshipLandingMarker_DrawAt_Patch.Transpiler | |
| GravshipPlacementUtility.PlaceGravshipInMap: PRE: NepLandOnAnything.LandOnAnythingPatches.GravshipPlacementUtility_PlaceGravshipInMap_Prefix | |
| GravshipUtility.GetConnectedSubstructure: PRE: VanillaGravshipExpanded.GravshipUtility_GetConnectedSubstructure_Patch.Prefix post: VanillaGravshipExpanded.GravshipUtility_GetConnectedSubstructure_Patch.Postfix | |
| GravshipUtility.GetPlayerGravEngine_NewTemp: TRANS: VanillaGravshipExpanded.GravshipUtility_GetPlayerGravEngine_Patch.Transpiler | |
| GravshipUtility.MaxDistForFuel: PRE: VanillaGravshipExpanded.GravshipUtility_MaxDistForFuel_Patch.Prefix | |
| GravshipUtility.PreLaunchConfirmation: PRE: VanillaGravshipExpanded.GravshipUtility_PreLaunchConfirmation_Patch.Prefix | |
| GravshipUtility.TryGetPathFuelCost: PRE: VanillaGravshipExpanded.GravshipUtility_TryGetPathFuelCost_Patch.Prefix TRANS: VanillaGravshipExpanded.GravshipUtility_TryGetPathFuelCost_Patch.Transpiler | |
| GravshipUtility.get_ShowConnectedSubstructure: (no patches) | |
| GridsUtility.GetMaxItemsAllowedInCell: TRANS: AdaptiveStorage.HarmonyPatches.StorageLimit.Transpiler | |
| HairDef.GraphicFor: post: ShowHair.HarmonyPatches.HairDef_GraphicFor_Patch.Postfix | |
| Harmony..ctor: PRE: Analyzer.Profiling.RememberHarmonyIDs.Prefix | |
| HarmonyInit.AddDroughtLine: (no patches) | |
| HarmonyPatches.<>c.<AllowedThingDefsPostfix>b__16_0: (no patches) | |
| HarmonyPatches.<>c.<InitiateSlaveRebellionPostfix>b__70_0: (no patches) | |
| HarmonyPatches.<>c.<ParticipateInSlaveRebellionPostfix>b__71_0: (no patches) | |
| HarmonyPatches.<>c.<PreApplyDamagePostfix>b__26_0: (no patches) | |
| HarmonyPatches.CanHitTargetFromPostfix: (no patches) | |
| HarmonyPatches.DoingSpecialExplosion: (no patches) | |
| HarmonyPatches.HasSpecialExplosion: (no patches) | |
| HarmonyPatches.IsForbiddenPostfix: (no patches) | |
| HarmonyPatches.RenderPawnAtPostfix: (no patches) | |
| HarmonyPatches.SkillAptitudePostfix: (no patches) | |
| HarmonyPatches.StanceWarmupPostfix: (no patches) | |
| HarmonyPatches.TakeDamagePostfix: (no patches) | |
| HarmonyPatches.TakeDamagePrefix: (no patches) | |
| HarmonyPatches.get_Cache: (no patches) | |
| HarmonyUtility.HasActivePatches: PRE: PerformanceOptimizer.Optimization_FasterGetCompReplacement.StripPOPatchesInfo | |
| Harmony_AreaManager_AreaManagerUpdate.Prefix: (no patches) | |
| Harmony_DeepResourceGrid_DeepResourceGridUpdate.Prefix: (no patches) | |
| Harmony_Designation_DesignationDraw.Prefix: (no patches) | |
| Harmony_DesignatorManager_DesignatorManagerUpdate.Prefix: (no patches) | |
| Harmony_EnvironmentStatsDrawer_DrawRoomOverlays.Prefix: (no patches) | |
| Harmony_GameConditionManager_GameConditionManagerDraw.Prefix: (no patches) | |
| Harmony_MapEdgeClipDrawer_DrawClippers.Prefix: (no patches) | |
| Harmony_OverlayDrawHandler_ShouldDrawPowerGrid.Prefix: (no patches) | |
| Harmony_OverlayDrawer_DrawAllOverlays.Prefix: (no patches) | |
| Harmony_PlanDesignation_DesignationDraw.Prefix: (no patches) | |
| Harmony_RoofGrid_RoofGridUpdate.Prefix: (no patches) | |
| Harmony_Targeter_TargeterUpdate.Prefix: (no patches) | |
| HaulAIUtility.HaulablePlaceValidator: PRE: ReBuildDoorsAndCorners.HaulAIUtility_HaulablePlaceValidator_Patch.Prefix post: VanillaPlantsExpandedMorePlants.VanillaPlantsExpandedMorePlants_HaulAIUtility_HaulablePlaceValidator_Patch.MakeZonesNotHaulable, VanillaPlantsExpandedMushrooms.VanillaPlantsExpandedMushrooms_HaulAIUtility_HaulablePlaceValidator_Patch.MakeZonesNotHaulable | |
| HaulAIUtility.PawnCanAutomaticallyHaulFast: PRE: AchtungMod.HaulAIUtility_PawnCanAutomaticallyHaulFast_Patch.Prefix TRANS: AlphaGenes.AlphaGenes_HaulAIUtility_PawnCanAutomaticallyHaulFast.Transpiler | |
| HeadControllerComp.InitializeIfNeed: PRE: FacialAnimationGeneticHeads.CompPatches.Patch_HeadControllerComp.Prefix | |
| HeadTypeDef.GetGraphic: TRANS: VEF.Pawns.VanillaExpandedFramework_HeadTypeDef_GetGraphic_Patch.Transpiler | |
| HealthAIUtility.FindBestMedicine: PRE: ChooseYourMedicine.FindBestMedicine_Prefix.Prefix post: RimEffect.HealthAIUtility_FindBestMedicine.Postfix | |
| HealthAIUtility.ShouldBeTendedNowByPlayer: post: [-2147483648]VREAndroids.HealthAIUtility_ShouldBeTendedNowByPlayer_Patch.Postfix | |
| HealthAIUtility.ShouldSeekMedicalRestUrgent: post: [-2147483648]VREAndroids.HealthAIUtility_ShouldSeekMedicalRestUrgent_Patch.Postfix | |
| HealthAspectTracker.HealthEvent: (no patches) | |
| HealthCardUtility.<>c__DisplayClass27_0.<DrawMedOperationsTab>b__0: TRANS: VREAndroids.HealthCardUtility_DrawMedOperationsTab_Patch.Transpiler | |
| HealthCardUtility.CanDoRecipeWithMedicineRestriction: post: [-2147483648]VREAndroids.HealthCardUtility_CanDoRecipeWithMedicineRestriction_Patch.Postfix | |
| HealthCardUtility.CreateSurgeryBill: post: VREAndroids.HealthCardUtility_CreateSurgeryBill_Patch.Postfix | |
| HealthCardUtility.DrawHediffListing: TRANS: VREAndroids.HealthCardUtility_DrawHediffListing_Patch.Transpiler, ChooseYourMedicine.DrawHediffListing_Transpiler.DrawHediffListingTranspiler | |
| HealthCardUtility.DrawHediffRow: PRE: VEF.Genes.VanillaExpandedFramework_HealthCardUtility_DrawHediffRow_Patch.Prefix, PeteTimesSix.CompactHediffs.HarmonyPatches.HealthCardUtility_DrawHediffRow.HealthCardUtility_DrawHediffRow_DestructivePrefix, VREAndroids.HealthCardUtility_DrawHediffRow_Patch.Prefix post: VEF.Genes.VanillaExpandedFramework_HealthCardUtility_DrawHediffRow_Patch.Postfix, VREAndroids.HealthCardUtility_DrawHediffRow_Patch.Postfix TRANS: VEF.Genes.VanillaExpandedFramework_HealthCardUtility_DrawHediffRow_Patch.Transpiler, VREAndroids.HealthCardUtility_DrawHediffRow_Patch.Transpiler, ChooseYourMedicine.DrawHediffRow_Transpiler.DrawHediffRowTranspiler | |
| HealthCardUtility.DrawOverviewTab: PRE: [2147483647]VREAndroids.HealthCardUtility_DrawOverviewTab_Patch.Prefix | |
| HealthCardUtility.DrawPawnHealthCard: PRE: VREAndroids.HealthCardUtility_DrawPawnHealthCard_Patch.Prefix post: DubsMintMenus.Patch_HealthCardUtility.Postfix, [-2147483648]VREAndroids.HealthCardUtility_DrawPawnHealthCard_Patch.Postfix TRANS: PeteTimesSix.CompactHediffs.HarmonyPatches.HealthCardUtility_DrawPawnHealthCard.HealthCardUtility_DrawPawnHealthCard_Transpiler | |
| HealthCardUtility.GenerateSurgeryOption: PRE: VREAndroids.HealthCardUtility_GenerateSurgeryOption_Patch.Prefix post: RecipeIcons.Patch.HealthCardUtility_GenerateSurgeryOption.Postfix, VREAndroids.HealthCardUtility_GenerateSurgeryOption_Patch.Postfix, MVCF.PatchSets.PatchSet_Brawlers.GenerateSurgeryOption_Postfix TRANS: VREAndroids.HealthCardUtility_GenerateSurgeryOption_Patch.Transpiler | |
| HealthCardUtility.GetPawnCapacityTip: post: PsiTech.Utility.HealthTooltipPatch.Postfix TRANS: VEF.Apparels.VanillaExpandedFramework_HealthCardUtility_GetPawnCapacityTip_Patch.Transpiler | |
| HealthCardUtility.VisibleHediffGroupsInOrder: post: PeteTimesSix.CompactHediffs.HarmonyPatches.HealthCardUtility_VisibleHediffGroupsInOrder.HealthCardUtility_VisibleHediffGroupsInOrder_Postfix | |
| HealthCardUtility.VisibleHediffs: post: VREAndroids.HealthCardUtility_VisibleHediffs_Patch.Postfix | |
| HealthUtility.AddStartingHediffs: (no patches) | |
| HealthUtility.AdjustSeverity: PRE: ReGrowthCore.HealthUtility_AdjustSeverity_Patch.Prefix | |
| HealthUtility.DamageUntilDead: PRE: Vehicles.Patch_Debug.DebugDamagePawnsInVehicleUntilDead | |
| HealthUtility.DamageUntilDowned: PRE: Vehicles.Patch_Debug.DebugDamagePawnsInVehicleUntilDowned | |
| HealthUtility.FindImmunizableHediffWhichCanKill: (no patches) | |
| HealthUtility.GetGeneralConditionLabel: PRE: Vehicles.Patch_HealthAndStats.ReplaceConditionLabel | |
| HealthUtility.GetPartConditionLabel: post: VanillaPsycastsExpanded.HealthUtility_GetPartConditionLabel_Patch.Postfix | |
| HealthUtility.TryAnesthetize: PRE: [2147483647]VREAndroids.HealthUtility_TryAnesthetize_Patch.Prefix, EmergencySurgery.HealthUtility_Patches.Prefix, [200]BigAndSmall.MechanicalColonistPatches.TryAnesthetizePatch | |
| Hediff.GetTooltip: post: BigAndSmall.Hediff_Patches.Hediff_GetTooltip | |
| Hediff.OnStageIndexChanged: post: BigAndSmall.Hediff_Patches.OnStageIndexChanged | |
| Hediff.PostAdd: post: BigAndSmall.Hediff_PostAdd.Postfix, BigAndSmall.Hediff_Patches.Hediff_PostAdd, VAEInsanity.Hediff_PostAdd_Patch.Postfix | |
| Hediff.PostRemoved: PRE: MVCF.PatchSets.Trackers.PatchSet_Hediffs.PostRemoved_Prefix post: [600]BigAndSmall.Hediff_Patches.Hediff_PostRemove, ReSpliceCore.Hediff_PostRemoved_Patch.Postfix, VAEInsanity.Hediff_PostRemoved_Patch.Postfix | |
| Hediff.TendableNow: post: ChooseYourMedicine.TendableNow_Postfix.Postfix | |
| Hediff.TryMergeWith: PRE: ReSpliceCharmweavers.Hediff_TryMergeWith_Patch.Prefix | |
| Hediff.get_CapMods: post: BigAndSmall.Piloted.CapMods_Postfix | |
| Hediff.get_CurStage: post: ReSpliceCharmweavers.Hediff_CurStage_Patch.Postfix | |
| Hediff.get_ShouldRemove: post: VanillaTraitsExpanded.ShouldRemove_Patch.Postfix | |
| Hediff.get_TendPriority: (no patches) | |
| Hediff.get_TipStringExtra: (no patches) | |
| HediffCompProperties_Reloadable.TargetVerb: (no patches) | |
| HediffCompToxAbsorption.CompPostTickInterval: (no patches) | |
| HediffComp_AutoPermanentInjury.CompPostMake: (no patches) | |
| HediffComp_AutoPermanentInjury.CompPostMake: (no patches) | |
| HediffComp_Disappears.CompPostMerged: (no patches) | |
| HediffComp_DisappearsConfigurable.CompPostMerged: (no patches) | |
| HediffComp_DisappearsPausable.CompPostTick: post: AlphaGenes.AlphaGenes_HediffComp_DisappearsPausable_CompPostTick_Patch.DetectGene | |
| HediffComp_EntropyLink.Notify_EntropyGained: (no patches) | |
| HediffComp_Exploder.CompPostMake: (no patches) | |
| HediffComp_GiveHediffsInRange.CompPostTick: (no patches) | |
| HediffComp_GiveHediffsInRangeExpanded.CompPostTick: (no patches) | |
| HediffComp_GiveHediffsInRangeExpanded.CompPostTick: (no patches) | |
| HediffComp_GiveHediffsInRangeGeneRestricting.CompPostTickInterval: (no patches) | |
| HediffComp_GiveHediffsToNonAlliesInRange.CompPostTickInterval: (no patches) | |
| HediffComp_Hatcher.CompPostMake: (no patches) | |
| HediffComp_Immunizable.get_SeverityFactorFromHediffs: post: VEF.Genes.VanillaExpandedFramework_HediffComp_Immunizable_SeverityFactorFromHediffs_Patch.AddDiseaseFactor | |
| HediffComp_Infecter.CheckMakeInfection: (no patches) | |
| HediffComp_Invisibility.UpdateTarget: PRE: PerformanceOptimizer.Optimization_PawnUtility_IsInvisible.ClearCache | |
| HediffComp_MultipleLives.Notify_PawnDied: (no patches) | |
| HediffComp_NameColor.get_Cache: (no patches) | |
| HediffComp_PregnantHuman.get_CompTipStringExtra: post: VEF.Genes.VanillaExpandedFramework_HediffComp_PregnantHuman_CompTipStringExtra_Patch.AddGeneMultiplierExplanation, AlphaGenes.AlphaGenes_HediffComp_PregnantHuman_CompTipStringExtra_Patch.AddGeneMultiplierExplanation | |
| HediffComp_ReactOnDamage.Notify_PawnPostApplyDamage: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_HediffComp_ReactOnDamage_Notify_PawnPostApplyDamage_Patch.Prefix | |
| HediffComp_SeverityFromGas.CompPostTick: TRANS: VanillaRacesExpandedFungoid.VanillaRacesExpandedFungoid_HediffComp_SeverityFromGas_CompPostTick_Patch.Transpiler | |
| HediffComp_SnowBlockCompressor.get_snowArmyMapComponent: (no patches) | |
| HediffComp_TemporaryFaction.CompPostPostRemoved: (no patches) | |
| HediffComp_TemporaryFaction.CompPostTickInterval: (no patches) | |
| HediffComp_TemporaryIdeology.CompPostPostRemoved: (no patches) | |
| HediffComp_TemporaryIdeology.CompPostTick: (no patches) | |
| HediffComp_TerrainCostOverride.get_Cache: (no patches) | |
| HediffComp_Traitor.CompPostMerged: (no patches) | |
| HediffComp_Traitor.CompPostMerged: (no patches) | |
| HediffDef.PossibleToDevelopImmunityNaturally: PRE: [2147483647]PerformanceOptimizer.Optimization_HediffDef_PossibleToDevelopImmunityNaturally.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_HediffDef_PossibleToDevelopImmunityNaturally.Postfix | |
| HediffDef.ResolveReferences: PRE: VEF.MergeablePatches+VanillaExpandedFramework_HediffDef_ResolveReferences_Patch.Prefix | |
| HediffGiver_Birthday.TryApplyAndSimulateSeverityChange: PRE: GeneticRim.GeneticRim_HediffGiver_Birthday_TryApplyAndSimulateSeverityChange_Patch.NoBasegameAgeDiseasesForHybrids | |
| HediffGiver_Bleeding.OnIntervalPassed: PRE: [2147483647]VREAndroids.HediffGiver_Bleeding_OnIntervalPassed_Patch.Prefix post: EBSGFramework.HarmonyPatches.BloodRecoveryPostfix | |
| HediffGiver_Heat.OnIntervalPassed: PRE: [2147483647]VREAndroids.HediffGiver_Heat_OnIntervalPassed_Patch.Prefix, VRESaurids.Patch_HediffGiver_Heat_OnIntervalPassed.Prefix | |
| HediffGiver_Hypothermia.OnIntervalPassed: PRE: [2147483647]VREAndroids.HediffGiver_Hypothermia_OnIntervalPassed_Patch.Prefix, VRESaurids.Patch_HediffGiver_Hypothermia_OnIntervalPassed.Prefix | |
| HediffGiver_Terrain.OnIntervalPassed: post: VanillaExplorationExpanded.VanillaExplorationExpanded_HediffGiver_Terrain_OnIntervalPassed_Patch.DoTerrainEffects | |
| HediffSet.AddDirect: PRE: [2147483647]VREAndroids.HediffSet_AddDirect_Patch.Prefix, [2147483647]SimsTraits.HediffSet_AddDirect_Patch.Prefix, [2147483647]VAEInsanity.HediffSet_AddDirect_Patch.Prefix, [2147483647]ReSpliceCharmweavers.HediffSet_AddDirect_Patch.Prefix post: ReSpliceCore.HediffSet_AddDirect_Patch.Postfix, VAspirE.SatisfactionPatches.CheckGeneral, VanillaRacesExpandedHighmate.HediffSet_AddDirect_Patch.Postfix, ReSpliceCharmweavers.HediffSet_AddDirect_Patch.Postfix TRANS: RimEffect.Patch_HediffSet_AddDirect.Transpiler | |
| HediffSet.CacheMissingPartsCommonAncestors: PRE: [2147483647]VREAndroids.HediffSet_CacheMissingPartsCommonAncestors_Patch.Prefix | |
| HediffSet.CalculateBleedRate: post: BigAndSmall.CalculateBleedRatePatch.Postfix, RimEffectAR.Patch_HediffSet_CalculateBleedRate.Postfix | |
| HediffSet.CalculatePain: post: VEF.Pawns.VanillaExpandedFramework_HediffSet_CalculatePain_Patch.Postfix | |
| HediffSet.DirtyCache: post: VEF.Weapons.VanillaExpandedFramework_HediffSet_DirtyCache_Patch.Postfix, PsiTech.Utility.HediffDirtyPatch.Postfix, VanillaPsycastsExpanded.HediffSet_DirtyCache_Patch.Postfix | |
| HediffSet.GetHediffsVerbs: (no patches) | |
| HediffSet.GetHungerRateFactor: post: VFEPirates.HediffSet_GetHungerRateFactor_Patch.Postfix | |
| HediffSet.GetPartHealth: TRANS: VREAndroids.HediffSet_GetPartHealth_Patch.Transpiler | |
| HediffSet.HasDirectlyAddedPartFor: PRE: VREAndroids.HediffSet_HasDirectlyAddedPartFor_Patch.Prefix | |
| HediffSet.HasHediffPreventsPregnancy: PRE: ReSpliceCharmweavers.HediffSet_HasHediffPreventsPregnancy_Patch.Prefix | |
| HediffSet.get_BleedRateTotal: post: VEF.Apparels.VanillaExpandedFramework_HediffSet_BleedRateTotal_Patch.Postfix, VanillaPsycastsExpanded.HediffSet_BleedRateTotal_Patch.Postfix | |
| HediffStatsUtility.SpecialDisplayStats: post: AncientMarket_Libraray.Patch_Stat.postfix | |
| HediffUtility.<>c.<.cctor>b__6_0: (no patches) | |
| HediffUtility.CanHealFromTending: PRE: Vehicles.Patch_HealthAndStats.VehiclesDontHealTended post: [-2147483648]VREAndroids.HediffUtility_CanHealFromTending_Patch.Postfix | |
| HediffUtility.CanHealNaturally: PRE: Vehicles.Patch_HealthAndStats.VehiclesDontHeal post: VanillaPsycastsExpanded.HediffUtility_CanHealNaturally_Patch.Postfix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_HediffUtility_CanHealNaturally_Patch.Postfix, [-2147483648]VREAndroids.HediffUtility_CanHealNaturally_Patch.Postfix | |
| HediffUtility.FullyImmune: (no patches) | |
| HediffUtility.IsPermanent: (no patches) | |
| HediffUtility.IsTended: (no patches) | |
| HediffWithComps.Tended: post: ChooseYourMedicine.Tended_Postfix.Postfix | |
| Hediff_AddedPart.PostAdd: TRANS: VREAndroids.Hediff_AddedPart_PostAdd_Patch.Transpiler | |
| Hediff_Addiction.get_LabelInBrackets: (no patches) | |
| Hediff_Alcohol.HangoverSusceptible: post: SimsTraits.Hediff_Alcohol_HangoverSusceptible_Patch.Postfix | |
| Hediff_BlizzardSource.PostAdd: (no patches) | |
| Hediff_BlizzardSource.PostRemoved: (no patches) | |
| Hediff_BlizzardSource.Tick: (no patches) | |
| Hediff_IceBlock.PostAdd: (no patches) | |
| Hediff_Injury.get_BleedRate: PRE: [2147483647]VREAndroids.Hediff_Injury_BleedRate_Patch.Prefix post: BigAndSmall.BleedRatePatch.Postfix | |
| Hediff_Injury.get_LabelBase: (no patches) | |
| Hediff_Injury.get_LabelInBrackets: (no patches) | |
| Hediff_Injury.get_PainOffset: PRE: [2147483647]VREAndroids.Hediff_Injury_PainOffset_Patch.Prefix | |
| Hediff_Injury_PainOffset_Patch.Prefix: (no patches) | |
| Hediff_Labor.GetRandomLaborPushingDuration: (no patches) | |
| Hediff_Labor.PreRemoved: (no patches) | |
| Hediff_Labor.get_Progress: (no patches) | |
| Hediff_LaborPushing.get_Progress: (no patches) | |
| Hediff_MissingPart.get_BleedRate: post: BigAndSmall.BleedRate_Missing_Patch.Postfix | |
| Hediff_Overlay.PostAdd: (no patches) | |
| Hediff_Pregnant.DoBirthSpawn: PRE: ErinsFluffyFauna.BirthEventPatch.BirthEventPrefix, GeneticRim.GeneticRim_Hediff_Pregnant_DoBirthSpawn_Patch.AddQuality TRANS: VEF.AnimalBehaviours.VanillaExpandedFramework_Hediff_Pregnant_DoBirthSpawn_Patch.ModifyCrossbreedKindDef | |
| Hediff_Pregnant.PostAdd: post: VEF.Genes.VanillaExpandedFramework_Hediff_Pregnant_PostAdd_Patch.CauseEggFertilization, EBSGFramework.HarmonyPatches.PregnantAddPostfix | |
| Hediff_Pregnant.TickInterval: PRE: VanillaRacesExpandedPhytokin.VanillaRacesExpandedPhytokin_Hediff_Pregnant_TickInterval.Prefix, VRESaurids.Patch_Hediff_Pregnant_TickInterval.Prefix, VanillaRacesExpandedInsector.VanillaRacesExpandedInsector_Hediff_Pregnant_Tick.Prefix | |
| Hediff_Pregnant.get_GestationProgress: post: ReSpliceCharmweavers.Hediff_Pregnant_GestationProgress_Patch.Postfix | |
| Hediff_Pregnant.set_GestationProgress: PRE: EBSGFramework.HarmonyPatches.PregnancySpeedPrefix | |
| Hediff_PsycastAbilities.InitializeFromPsylink: post: VanillaPersonaWeaponsExpanded.Hediff_Psylink_InitializeFromPsylink_Patch.Postfix, TooManyMods.TMM_VPE_FirstPsylink_InitPatch.Postfix | |
| Hediff_Psylink.ChangeLevel: PRE: [2147483647]VREAndroids.Hediff_Psylink_ChangeLevel_Patch.Prefix | |
| Hediff_Psylink.ChangeLevel: PRE: VanillaPsycastsExpanded.Hediff_Psylink_ChangeLevel.Prefix | |
| Hediff_Psylink.PostAdd: post: VanillaPsycastsExpanded.Hediff_Psylink_PostAdd.Postfix | |
| Hediff_Psylink.TryGiveAbilityOfLevel: PRE: VanillaPsycastsExpanded.Hediff_Psylink_TryGiveAbilityOfLevel.Prefix | |
| Hediff_Scaria.Notify_PawnDamagedThing: (no patches) | |
| Hediff_Sear.Tended: (no patches) | |
| Hediff_Shambler.PostMake: post: VEF.Genes.VanillaExpandedFramework_Hediff_Shambler_PostMake_Patch.ActivateShamblerGenes, AlphaGenes.AlphaGenes_Hediff_Shambler_PostMake_Patch.AddRandomGenes | |
| Helper.GetHandlerFor: (no patches) | |
| Helper.ReRollDeposit: (no patches) | |
| HireableSystemStaticInitialization.GetCommTargets_Postfix: (no patches) | |
| HireableSystemStaticInitialization.GetContractTracker: (no patches) | |
| HistoryEventUtility.IsKillingInnocentAnimal: post: BloodSuckingAnimals.HarmonyPatches.IsKillingInnocentAnimalPostfix | |
| HonorWorker_Gallery.<>c.<Available>b__0_1: (no patches) | |
| HookupUtility.CanDrawTryHookup: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix | |
| HookupUtility.HookupEligible: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix | |
| HookupUtility.HookupEligiblePair: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix | |
| HostilityResponseModeUtility.DrawResponseButton_GenerateMenu: PRE: SimsTraits.HostilityResponseModeUtility_DrawResponseButton_GenerateMenu_Patch.Prefix | |
| HugsLibUtility.GetModAssemblyFileInfo: post: LunarFramework.Internal.Compatibility.ModCompat_HugsLib.HugsLibUtility_GetModAssemblyFileInfo | |
| HumanEmbryo.CanImplantReport: post: VRESaurids.Patch_HumanEmbryo_CanImplantReport.Postfix, ReSpliceCharmweavers.HumanEmbryo_CanImplantReport_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.HumanEmbryo_CanImplantReport.Transpiler, ReSpliceCharmweavers.HumanEmbryo_CanImplantReport_Patch.Transpiler | |
| HumanOvum.CanFertilizeReport: TRANS: BetterRomance.HarmonyPatches.HumanOvum_CanFertilizeReport.Transpiler | |
| HumanlikeMeshPoolUtility.GetHumanlikeBeardSetForPawn: post: FacialAnimation.HarmonyPatches.PostfixGetHumanlikeBeardSetForPawn | |
| HumanlikeMeshPoolUtility.GetHumanlikeHairSetForPawn: post: FacialAnimation.HarmonyPatches.PostfixGetHumanlikeHairSetForPawn | |
| ITab_Bills.FillTab: PRE: [2147483647]VFEMedieval.RecipePatches+ITab_Bills_FillTab_Patch.Prefix post: [-2147483648]VFEMedieval.RecipePatches+ITab_Bills_FillTab_Patch.Postfix | |
| ITab_Bills.TabUpdate: PRE: ImprovedWorkbenches.ITab_Bills_TabUpdate_Detour.Prefix | |
| ITab_Pawn_Character.get_PawnToShowInfoAbout: PRE: [2147483647]VREAndroids.ITab_Pawn_Character_PawnToShowInfoAbout_Patch.Prefix | |
| ITab_Pawn_FormingCaravan.DoPeopleAndAnimals: PRE: Vehicles.Patch_CaravanHandling.DoPeopleAnimalsAndVehicle | |
| ITab_Pawn_FormingCaravan.FillTab: PRE: Vehicles.Patch_CaravanHandling.FillTabVehicleCaravan | |
| ITab_Pawn_Gear..ctor: post: NiceInventoryTab.ITab_Pawn_Gear_Constructor_Patch.Postfix | |
| ITab_Pawn_Gear.DrawThingRow: TRANS: VFEPirates.ITab_Pawn_Gear_DrawThingRow_Transpiler.Transpiler, PickUpAndHaul.HarmonyPatches.GearTabHighlightTranspiler | |
| ITab_Pawn_Gear.FillTab: PRE: NiceInventoryTab.ITab_Pawn_Gear_Patch.Prefix | |
| ITab_Pawn_Gear.InterfaceDrop: PRE: PeteTimesSix.SimpleSidearms.Intercepts.ITab_Pawn_Gear_InterfaceDrop_Prefix.InterfaceDrop | |
| ITab_Pawn_Gear.ShouldShowEquipment: post: VEF.AnimalBehaviours.VanillaExpandedFramework_ITab_Pawn_Gear_IsVisible_Patch.RemoveTab | |
| ITab_Pawn_Gear.TryDrawOverallArmor: TRANS: VEF.Apparels.Patch_ITab_Pawn_Gear+VanillaExpandedFramework_ITab_Pawn_Gear_TryDrawOverallArmor.Transpiler | |
| ITab_Pawn_Health..ctor: post: PeteTimesSix.CompactHediffs.HarmonyPatches.ITab_Pawn_Health_Patches.ITab_Pawn_Health_Patches_ctor_Postifx | |
| ITab_Pawn_Training.get_IsVisible: post: VFEInsectoids.ITab_Pawn_Training_IsVisible_Patch.Postfix | |
| ITab_Pawn_Visitor.<>c__DisplayClass8_0.<DoPrisonerTab>g__CanUsePrisonerInteractionMode|0: post: VREAndroids.ITab_Pawn_Visitor_CanUsePrisonerInteractionMode_Patch.Postfix, VanillaMemesExpanded.PreceptPatches.CanUseInteractionMode_Postfix | |
| ITab_Pawn_Visitor.FillTab: PRE: VREAndroids.ITab_Pawn_Visitor_FillTab_Patch.Prefix post: VREAndroids.ITab_Pawn_Visitor_FillTab_Patch.Postfix | |
| ITab_Pawn_Visitor.InteractionModeChanged: post: VanillaMemesExpanded.PreceptPatches.InteractionModeChanged_Postfix | |
| ITab_StudyNotes.DrawTitle: post: AnomaliesExpected.HarmonyPatches.ITSN_DrawTitle_Postfix | |
| Ideo.AddPrecept: PRE: AlphaMemes.FuneralFramework_Ideo_AddPrecept.Prefix | |
| Ideo.ExposeData: TRANS: VEF.Memes.VanillaExpandedFramework_Ideo_ExposeData_Patch.Transpiler | |
| Ideo.MemberWillingToDo: PRE: VanillaMemesExpanded.PreceptPatches.MemberWillingToDo_Prefix | |
| Ideo.MembersCanBuild: post: AlphaMemes.AlphaMemes_Ideo_MembersCanBuild.Postfix | |
| Ideo.Notify_MemberCorpseDestroyed: PRE: AlphaMemes.AlphaMemesIdeo_Notify_Patches+FuneralFramework_Ideo_MemberCorpseDestroyed.Prefix post: AlphaMemes.AlphaMemesIdeo_Notify_Patches+FuneralFramework_Ideo_MemberCorpseDestroyed.Postfix | |
| Ideo.Notify_MemberDied: post: AlphaMemes.AlphaMemesIdeo_Notify_Patches+FuneralFramework_Ideo_Notify_MemberDied.Postfix | |
| Ideo.RecacheColonistBelieverCount: PRE: PerformanceOptimizer.Optimization_Precept_RoleSingle_RecacheActivity.RecacheColonistBelieverCountPrefix, PerformanceOptimizer.Optimization_Precept_RoleMulti_RecacheActivity.RecacheColonistBelieverCountPrefix post: PerformanceOptimizer.Optimization_Precept_RoleSingle_RecacheActivity.RecacheColonistBelieverCountPostfix, PerformanceOptimizer.Optimization_Precept_RoleMulti_RecacheActivity.RecacheColonistBelieverCountPostfix | |
| Ideo.RecachePrecepts: post: BetterRomance.HarmonyPatches.Ideo_RecachePrecepts.Postfix | |
| IdeoFoundation.RandomizePrecepts: PRE: PersistentPrecepts.Patch_RandomizePrecepts.Prefix post: AlphaMemes.FuneralFramework_IdeoFoundation_RandomizePrecepts.Postfix | |
| IdeoManager.SortIdeos: post: Worldbuilder.IdeoManager_SortIdeos_Patch.Postfix | |
| IdeoUIUtility.AddPrecept: TRANS: VEF.Memes.VanillaExpandedFramework_IdeoUIUtility_AddPrecept_Patch.Transpiler, VanillaMemesExpanded.VanillaMemesExpanded_IdeoUIUtility_AddPrecept_Patch.Transpiler | |
| IdeoUIUtility.AddPreceptOption: post: AlphaMemes.FuneralFramework_IdeoUIUtility_AddPreceptOption_Patch.Postfix | |
| IdeoUIUtility.CanAddPrecept: post: AlphaMemes.FuneralFramework_IdeoUIUtility_CanAddPrecept_Patch.Postfix | |
| IdeoUIUtility.DoFactionIcons: PRE: VFETribals.IdeoUIUtility_DoFactionIcons_Patch.Prefix | |
| IdeoUIUtility.DoIdeoList: TRANS: VFETribals.IdeoUIUtilityDoIdeoList_Patch.Transpiler | |
| IdeoUIUtility.DoIdeoListAndDetails: PRE: VFETribals.IdeoUIUtility_DoIdeoListAndDetails_Patch.Prefix post: PersistentPrecepts.Patch_DoIdeoListAndDetails.Postfix | |
| IdeoUIUtility.DoMemes: PRE: VanillaMemesExpanded.VanillaMemesExpanded_IdeoUIUtility_DoMemes_Patch.MakeBoxSmaller post: VanillaMemesExpanded.VanillaMemesExpanded_IdeoUIUtility_DoMemes_Patch.MakeBoxBigger | |
| IdeoUIUtility.DoPrecepts: post: AlphaMemes.AlphaMemes_IdeoUIUtility_DoPrecepts_Patch.AddDespisedAnimalPrecepts, VanillaMemesExpanded.VanillaMemesExpanded_IdeoUIUtility_DoPrecepts_Patch.EnableMorePrecepts | |
| IdeoUIUtility.DoPreceptsInt: PRE: PersistentPrecepts.Patch_IgnoreRandomize.Prefix post: PersistentPrecepts.Patch_IgnoreRandomize.Postfix | |
| IdeoUIUtility.DoStyles: TRANS: VanillaMemesExpanded.VanillaMemesExpanded_IdeoUIUtility_DoStyles_Patch.Transpiler | |
| IdeoUIUtility.DrawIdeoRow: PRE: VFETribals.IdeoUIUtility_DrawIdeoRow_Patch.Prefix | |
| IdeoUtility.GetStyleDominance: PRE: [2147483647]PerformanceOptimizer.Optimization_IdeoUtility_GetStyleDominance.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_IdeoUtility_GetStyleDominance.Postfix | |
| IdeoUtility.IsMemeAllowedForInitialFluidIdeo: post: VanillaMemesExpanded.VanillaMemesExpanded_IdeoUtility_IsMemeAllowedForInitialFluidIdeo_Patch.AllowAllMemes | |
| ImmunityHandler.DiseaseContractChanceFactor: post: [-2147483648]VREAndroids.ImmunityHandler_DiseaseContractChanceFactor_Patch.Postfix, [-2147483648]VAEInsanity.ImmunityHandler_DiseaseContractChanceFactor_Patch.Postfix | |
| ImmunityHandler.TryAddImmunityRecord: (no patches) | |
| ImmunityRecord.ImmunityChangePerTick: (no patches) | |
| ImmunityRecord.ImmunityTickInterval: PRE: VanillaSocialInteractionsExpanded.ImmunityRecord_ImmunityTickInterval_Patch.Prefix post: VanillaSocialInteractionsExpanded.ImmunityRecord_ImmunityTickInterval_Patch.Postfix | |
| ImpactSoundUtility.PlayImpactSound: post: VanillaRecyclingExpanded.VanillaRecyclingExpanded_ImpactSoundUtility_PlayImpactSound_Patch.MakeWallsFartInAVeryVeryConvolutedWay TRANS: ReBuildDoorsAndCorners.ImpactSoundUtility_PlayImpactSound_Patch.Transpiler | |
| IncidentParms.ExposeData: post: VisibleRaidPoints.Patch_IncidentParms_ExposeData.Postfix | |
| IncidentParmsUtility.GetDefaultPawnGroupMakerParms: post: PsiTech.Utility.RaidGroupParmsPatch.Postfix | |
| IncidentWorker.CanFireNow: PRE: VFED.HarmonyPatches.MiscPatches.CheckForVisibility, VanillaMemesExpanded.VanillaMemesExpanded_IncidentWorker_CanFireNow_Patch.DisableIncident post: EventsCore.Patches.IncidentWorker_CanFireNow_EventsCorePatch.Postfix, [200]GeologicalLandforms.Patches.Patch_RimWorld_IncidentWorker.CanFireNow | |
| IncidentWorker.SendIncidentLetter: TRANS: VisibleRaidPoints.Patch_IncidentWorker_SendIncidentLetter.Transpiler | |
| IncidentWorker.TryExecute: PRE: VEF.Storyteller.VanillaExpandedFramework_IncidentWorker_TryExecute_Patch.Prefix | |
| IncidentWorker_Ambush_ManhunterPack.AdjustedPoints: TRANS: VisibleRaidPoints.Patch_IncidentWorker_Ambush_ManhunterPack_AdjustedPoints.Transpiler | |
| IncidentWorker_AnimalInsanityMass.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_AnimalInsanityMass_TryExecuteWorker.Transpiler | |
| IncidentWorker_BurrowSiege.FindNearbyLocation: (no patches) | |
| IncidentWorker_CaravanDemand.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_CaravanDemand_TryExecuteWorker.Transpiler | |
| IncidentWorker_CaravanRaid.TryExecuteWorker: (no patches) | |
| IncidentWorker_ChimeraAssault.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_ChimeraAssault_TryExecuteWorker.Transpiler | |
| IncidentWorker_CrashedShipPart.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_CrashedShipPart_TryExecuteWorker.Transpiler | |
| IncidentWorker_DeepDrillInfestation.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_DeepDrillInfestation_TryExecuteWorker.Transpiler | |
| IncidentWorker_DevourerAssault.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_DevourerAssault_TryExecuteWorker.Transpiler | |
| IncidentWorker_DevourerWaterAssault.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_DevourerWaterAssault_TryExecuteWorker.Transpiler | |
| IncidentWorker_Disease.PotentialVictims: post: VEF.AnimalBehaviours.VanillaExpandedFramework_IncidentWorker_Disease_PotentialVictims_Patch.Postfix | |
| IncidentWorker_Disease.TryExecuteWorker: (no patches) | |
| IncidentWorker_DiseaseHuman.PotentialVictimCandidates: post: VREAndroids.IncidentWorker_DiseaseHuman_PotentialVictimCandidates.Postfix, VAEInsanity.IncidentWorker_DiseaseHuman_PotentialVictimCandidates.Postfix | |
| IncidentWorker_EntitySwarm.GenerateEntities: post: [200]EnterHere.IncidentWorker_EntitySwarm_GenerateEntities.Postfix TRANS: VisibleRaidPoints.Patch_IncidentWorker_EntitySwarm_GenerateEntities.Transpiler | |
| IncidentWorker_FleshbeastAttack.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_FleshbeastAttack_TryExecuteWorker.Transpiler | |
| IncidentWorker_GorehulkAssault.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_GorehulkAssault_TryExecuteWorker.Transpiler | |
| IncidentWorker_HateChanters.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_HateChanters_TryExecuteWorker.Transpiler | |
| IncidentWorker_Infestation.CanFireNowSub: TRANS: VFEInsectoids.IncidentWorker_Infestation_CanFireNowSub_Patch.Transpiler | |
| IncidentWorker_Infestation.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_Infestation_TryExecuteWorker.Transpiler | |
| IncidentWorker_LargeInfestation.SpawnTunnels: (no patches) | |
| IncidentWorker_MakeGameCondition.CanFireNowSub: post: AlphaBiomes.AlphaBiomes_IncidentWorker_MakeGameCondition_CanFireNowSub_Patch.DisableEclipseAndAcidRain, VCE_Fishing.VCE_Fishing_IncidentWorker_MakeGameCondition_CanFireNowSub_Patch.RemoveGillRot | |
| IncidentWorker_MakeGameConditionPurple.CanFireNowSub: (no patches) | |
| IncidentWorker_MakeGameConditionPurple.TryExecuteWorker: (no patches) | |
| IncidentWorker_NeutralGroup.SpawnPawns: post: VFEEmpire.HarmonyPatches.Patch_SpawnPawns.Postfix | |
| IncidentWorker_Obelisk.<>c.<ChanceFactorNow>b__2_0: (no patches) | |
| IncidentWorker_Raid.AdjustedRaidPoints: TRANS: VisibleRaidPoints.Patch_IncidentWorker_Raid_AdjustedRaidPoints.Transpiler | |
| IncidentWorker_Raid.TryExecuteWorker: PRE: VEF.Storyteller.VanillaExpandedFramework_IncidentWorker_Raid_TryExecuteWorker_Patch.Prefix, VSEWW.IncidentWorker_Raid_TryExecuteWorker.Prefix | |
| IncidentWorker_RaidEnemy.FactionCanBeGroupSource: post: VREArchon.IncidentWorker_RaidEnemy_FactionCanBeGroupSource_Patch.Postfix | |
| IncidentWorker_RaidEnemy.GenerateRaidLoot: post: AlphaRandom.AlphaRandom_IncidentWorker_RaidEnemy_GenerateRaidLoot_Patch.Postfix, VanillaRacesExpandedFungoid.VanillaRacesExpandedFungoid_IncidentWorker_RaidEnemy_GenerateRaidLoot_Patch.Postfix | |
| IncidentWorker_RaidEnemy.GetLetterText: PRE: VFEEmpire.HarmonyPatches.Patch_GetLetterText.Prefix, VanillaPsycastsExpanded.IncidentWorker_RaidEnemy_GetLetterText_Patch.Prefix post: RaiderInfo.Patch_IncidentWorker_RaidEnemy_GetLetterText.AppendCountOfRaiders | |
| IncidentWorker_RaidEnemy.ResolveRaidStrategy: post: VEF.Factions.VanillaExpandedFramework_IncidentWorker_RaidEnemy_ResolveRaidStrategy_Patch.Postfix | |
| IncidentWorker_RaidEnemy.TryExecuteWorker: PRE: VOE.Outpost_Defensive.InterceptRaid | |
| IncidentWorker_RaidEnemy.TryResolveRaidFaction: PRE: RimEffectAR.Harmony.Raid_Patches+RaidEnemyResolveFaction_Patch.Prefix post: RimEffectAR.Harmony.Raid_Patches+RaidEnemyResolveFaction_Patch.Postfix | |
| IncidentWorker_SelfTame.Candidates: post: VEF.AnimalBehaviours.VanillaExpandedFramework_IncidentWorker_SelfTame_Candidates_Patch.Postfix | |
| IncidentWorker_ShamblerAssault.PostProcessSpawnedPawns: (no patches) | |
| IncidentWorker_ShamblerSwarm.GenerateEntities: post: [200]EnterHere.IncidentWorker_EntitySwarm_GenerateEntities.Postfix | |
| IncidentWorker_ShamblerSwarm.SetupShamblerHediffs: (no patches) | |
| IncidentWorker_ShamblerSwarmAnimals.GenerateEntities: post: [200]EnterHere.IncidentWorker_EntitySwarm_GenerateEntities.Postfix | |
| IncidentWorker_ShamblerSwarmSmall.GenerateEntities: post: [200]EnterHere.IncidentWorker_EntitySwarm_GenerateEntities.Postfix | |
| IncidentWorker_ShipChunkDrop.SpawnChunk: TRANS: ShipChunkDrop_Transpiler.HarmonyPatches.IncidentWorker_ShipChunkDrop_SpawnChunk_Transpiler | |
| IncidentWorker_SightstealerSwarm.TryExecuteWorker: TRANS: VisibleRaidPoints.Patch_IncidentWorker_SightstealerSwarm_TryExecuteWorker.Transpiler | |
| IncidentWorker_TowerContamination.TryExecuteWorker: (no patches) | |
| IncidentWorker_TraderCaravanArrival.TryExecuteWorker: PRE: [200]EnterHere.IncidentWorker_TraderCaravanArrival_TryExecuteWorker.Prefix TRANS: RimEffectAR.TraderCaravanArrival_Patch.Transpiler | |
| IncidentWorker_TravelerGroup.TryExecuteWorker: PRE: [200]EnterHere.IncidentWorker_TravelerGroup_TryExecuteWorker.Prefix | |
| IncidentWorker_UnnaturalCorpseArrival.ValidatePawn: PRE: [2147483647]VREAndroids.IncidentWorker_UnnaturalCorpseArrival_ValidatePawn_Patch.Prefix post: ReSpliceCharmweavers.NoUnnaturalCorpseForPawns_Patch.Postfix | |
| IncidentWorker_VisitorGroup.TryExecuteWorker: PRE: [200]EnterHere.IncidentWorker_VisitorGroup_TryExecuteWorker.Prefix | |
| IncidentWorker_WandererJoin.GeneratePawn: post: BigAndSmall.TryExecuteWorker.Postfix, VFETribals.IncidentWorker_WandererJoin_GeneratePawn_Patch.Postfix TRANS: VEF.Storyteller.VanillaExpandedFramework_IncidentWorker_WandererJoin_GeneratePawn+TryExecuteWorker.Transpiler | |
| IncidentWorker_WandererJoin.TryExecuteWorker: PRE: VFETribals.IncidentWorker_WandererJoin_TryExecuteWorker_Patch.Prefix post: VFETribals.IncidentWorker_WandererJoin_TryExecuteWorker_Patch.Postfix | |
| IndividualThoughtToAdd.Add: post: VanillaSocialInteractionsExpanded.IndividualThoughtToAdd_Patch.Postfix, VanillaTraitsExpanded.Add_Patch.Postfix | |
| InfestationCellFinder.GetScoreAt: PRE: VFEInsectoids.InfestationCellFinder_GetScoreAt_Patch.Prefix | |
| InfestationUtility.FindRootTunnelLoc: PRE: VFEInsectoids.InfestationUtility_FindRootTunnelLoc_Patch.Prefix | |
| InfestationUtility.SpawnJellyTunnels: (no patches) | |
| InfestationUtility.SpawnTunnels: (no patches) | |
| IngestionOutcomeDoer_GiveHediffMemoryCell.DoIngestionOutcomeSpecial: (no patches) | |
| InspectPaneButtons.Draw: post: SmashTools.Patching.Compatibility_RimHUD.DrawButtonsOnRimHUD | |
| InspectPaneFiller.DrawAreaAllowed: PRE: VFEInsectoids.InspectPaneFiller_DrawAreaAllowed_Patch.Prefix | |
| InspectPaneFiller.DrawHealth: post: VanillaQuestsExpandedTheGenerator.InspectPaneFiller_DrawHealth_Patch.Postfix | |
| InspectPaneFiller.DrawMood: PRE: [2147483647]VREAndroids.InspectPaneFiller_DrawMood_Patch.Prefix | |
| InspectPaneUtility.DoTabs: PRE: [2147483647]Worldbuilder.InspectPaneUtility_DoTabs_Patch.Prefix, RimHUD.Access.Patch.RimWorld_InspectPaneUtility_DoTabs.Prefix TRANS: UINotIncluded.Patches.InspectPaneUtility_Patch.Transpiler | |
| InspectPaneUtility.InspectPaneOnGUI: PRE: RimHUD.Access.Patch.RimWorld_InspectPaneUtility_InspectPaneOnGUI.Prefix post: FactionCustomizer.InspectPaneUtilityPatch.InspectPaneOnGUIPostfix | |
| InspectPaneUtility.PaneSizeFor: PRE: RimHUD.Access.Patch.RimWorld_InspectPaneUtility_PaneSizeFor.Prefix | |
| InspectPaneUtility.PaneWidthFor: PRE: RimHUD.Access.Patch.RimWorld_InspectPaneUtility_PaneWidthFor.Prefix | |
| InspectPaneUtility.PluralLabelFor: post: Worldbuilder.InspectPaneUtility_PluralLabelFor_Patch.Postfix | |
| InspectTabBase.get_TabRect: post: DubsMintMenus.HarmonyPatches.TabSizeAdjuster | |
| InspirationHandler.EndInspiration: post: VanillaSocialInteractionsExpanded.EndInspiration_Patch.Postfix | |
| InspirationHandler.TryStartInspiration: PRE: [2147483647]VREAndroids.InspirationHandler_TryStartInspiration_Patch.Prefix post: VAspirE.SatisfactionPatches.OnInspiration, VanillaSocialInteractionsExpanded.TryStartInspiration_Patch.Postfix | |
| InspirationWorker.InspirationCanOccur: post: TooManyMods.TMM_InspirationCanOccur_Postfix.Postfix | |
| InteractionWorker.Interacted: post: VanillaRacesExpandedLycanthrope.VanillaRacesExpandedLycanthrope_InteractionWorker_Interacted_Patch.CreateRelationOnDeepTalk, VREArchon.VREArchon_InteractionWorker_Interacted_Patch.GoNuts, VanillaAnimalsExpandedWaste.VanillaAnimalsExpandedWaste_InteractionWorker_Interacted_Patch.Toxflu, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_InteractionWorker_Interacted_Patch.VomitIfFungoid, VanillaRacesExpandedFungoid.VanillaRacesExpandedFungoid_InteractionWorker_Interacted_Patch.VomitIfFungoid | |
| InteractionWorker_Breakup.Interacted: PRE: BetterRomance.HarmonyPatches.InteractionWorker_Breakup_Interacted.Prefix post: VanillaSocialInteractionsExpanded.Interacted_Patch.Postfix | |
| InteractionWorker_Breakup.RandomSelectionWeight: post: SimsTraits.InteractionWorker_Breakup_RandomSelectionWeight_Patch.Postfix, VanillaTraitsExpanded.RandomSelectionWeight_Patch.Postfix, BetterRomance.HarmonyPatches.InteractionWorker_Breakup_RandomSelectionWeight.Postfix, ReSpliceCharmweavers.InteractionWorker_Breakup_RandomSelectionWeight_Patch.Postfix | |
| InteractionWorker_DeepTalk.RandomSelectionWeight: post: VanillaSocialInteractionsExpanded.InteractionWorker_DeepTalk_RandomSelectionWeight_Patch.Postfix | |
| InteractionWorker_Insult.RandomSelectionWeight: post: VAEInsanity.InteractionWorker_Insult_RandomSelectionWeight_Patch.Postfix | |
| InteractionWorker_KindWords.RandomSelectionWeight: post: BigAndSmall.InteractionWorker_KindWords_Patch.Postfix, SimsTraits.InteractionWorker_KindWords_RandomSelectionWeight_Patch.Postfix, VanillaSocialInteractionsExpanded.InteractionWorker_KindWords_RandomSelectionWeight_Patch.Postfix | |
| InteractionWorker_MarriageProposal.AcceptanceChance: post: BetterRomance.HarmonyPatches.InteractionWorker_MarriageProposal_AcceptanceChance.Postfix, ReSpliceCharmweavers.InteractionWorker_MarriageProposal_AcceptanceChance_Patch.Postfix | |
| InteractionWorker_MarriageProposal.Interacted: PRE: BetterRomance.HarmonyPatches.InteractionWorker_MarriageProposal_Interacted.Prefix | |
| InteractionWorker_MarriageProposal.RandomSelectionWeight: PRE: BigAndSmall.RomancePatches.MarriageProposalPrefix, BetterRomance.HarmonyPatches.InteractionWorker_MarriageProposal_RandomSelectionWeight.Prefix post: ReSpliceCharmweavers.InteractionWorker_MarriageProposal_RandomSelectionWeight_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.InteractionWorker_MarriageProposal_RandomSelectionWeight.Transpiler | |
| InteractionWorker_RecruitAttempt.DoRecruit: PRE: VanillaSocialInteractionsExpanded.DoRecruit_Patch.Prefix post: VanillaSocialInteractionsExpanded.DoRecruit_Patch.Postfix | |
| InteractionWorker_RecruitAttempt.Interacted: PRE: RimEffectAR.RecruitInteractionWorker_Patch.Prefix post: RimEffectAR.RecruitInteractionWorker_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_InteractionWorker_RecruitAttempt_Interacted_Patch.DecreaseAnonymity TRANS: AnimalsLogic.Patches.GetThemYoung.Interacted_Transpiler, VanillaSocialInteractionsExpanded.InteractionWorker_RecruitAttempt_Interacted_Patch.Transpiler | |
| InteractionWorker_RomanceAttempt.BreakLoverAndFianceRelations: PRE: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_BreakLoverAndFianceRelations.Prefix | |
| InteractionWorker_RomanceAttempt.CanCreatePsychicBondBetween: post: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_CanCreatePsychicBondBetween.Postfix | |
| InteractionWorker_RomanceAttempt.OpinionFactor: PRE: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_OpinionFactor.Prefix TRANS: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_OpinionFactor.Transpiler | |
| InteractionWorker_RomanceAttempt.PartnerFactor: PRE: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_PartnerFactor.Prefix | |
| InteractionWorker_RomanceAttempt.RandomSelectionWeight: PRE: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_RandomSelectionWeight.Prefix post: SimsTraits.InteractionWorker_RomanceAttempt_RandomSelectionWeight_Patch.Postfix, VAEInsanity.InteractionWorker_RomanceAttempt_RandomSelectionWeight_Patch.Postfix, VanillaSocialInteractionsExpanded.InteractionWorker_RomanceAttempt_RandomSelectionWeight_Patch.Postfix, VanillaTraitsExpanded.InteractionWorker_RomanceAttempt_RandomSelectionWeight_Patch.Postfix, ReSpliceCharmweavers.InteractionWorker_RomanceAttempt_RandomSelectionWeight_Patch.Postfix, GM_RomanceAttemptGenePatch.IncreaseRomanceChanceIfHasGene, [-2147483648]VREAndroids.InteractionWorker_RomanceAttempt_RandomSelectionWeight_Patch.Postfix | |
| InteractionWorker_RomanceAttempt.RomanceFactors: PRE: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_RomanceFactors.Prefix post: EBSGFramework.HarmonyPatches.RomanceFactorsPostFix, SimsTraits.InteractionWorker_RomanceAttempt_RomanceFactors_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_RomanceFactors.Transpiler | |
| InteractionWorker_RomanceAttempt.SuccessChance: post: SimsTraits.InteractionWorker_RomanceAttempt_SuccessChance_Patch.Postfix, VAEInsanity.InteractionWorker_RomanceAttempt_SuccessChance_Patch.Postfix, VanillaSocialInteractionsExpanded.SuccessChance_Patch.Postfix | |
| InteractionWorker_RomanceAttempt.TryAddCheaterThought: PRE: BetterRomance.HarmonyPatches.InteractionWorker_RomanceAttempt_TryAddCheaterThought.Prefix | |
| InteractionWorker_Slight.RandomSelectionWeight: post: VAEInsanity.InteractionWorker_Slight_RandomSelectionWeight_Patch.Postfix | |
| InventoryCalculatorsUtility.ShouldIgnoreInventoryOf: post: Vehicles.Patch_CaravanHandling.ShouldIgnoreInventoryPawnInVehicle | |
| InvisibilityUtility.GetAlpha: (no patches) | |
| InvisibilityUtility.GetInvisibilityComp: (no patches) | |
| InvisibilityUtility.IsHiddenFromPlayer: (no patches) | |
| InvisibilityUtility.IsPsychologicallyInvisible: PRE: [2147483647]PerformanceOptimizer.Optimization_PawnUtility_IsInvisible.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_PawnUtility_IsInvisible.Postfix | |
| JobDriver.CheckCurrentToilEndOrFail: PRE: PerformanceOptimizer.Optimization_ForbidUtility_IsForbidden.CheckCurrentToilEndOrFailPrefix post: PerformanceOptimizer.Optimization_ForbidUtility_IsForbidden.CheckCurrentToilEndOrFailPostfix | |
| JobDriver.Notify_Starting: post: VanillaMemesExpanded.VanillaMemesExpanded_JobDriver_Notify_Starting_Patch.ModifyOnWork | |
| JobDriver.ReportStringProcessed: PRE: RimEffectAR.JobDriverReportString_Patch.Prefix | |
| JobDriver.SetupToils: post: RunAndGun.Harmony.JobDriver_SetupToils.Postfix | |
| JobDriver_ActivitySuppression.TrySuppress: post: VAEInsanity.JobDriver_ActivitySuppression_TrySuppress_Patch.Postfix | |
| JobDriver_ArchotechDNAExtraction.<MakeNewToils>b__1_0: (no patches) | |
| JobDriver_AttackMelee.TryMakePreToilReservations: post: PeteTimesSix.SimpleSidearms.Intercepts.JobDriver_AttackMelee_TryMakePreToilReservations.Postfix | |
| JobDriver_BestowingCeremony.MakeNewToils: post: VanillaSocialInteractionsExpanded.JobDriver_BestowingCeremony_MakeNewToils.Postfix | |
| JobDriver_ChestburstImplantation.<MakeNewToils>b__3_0: (no patches) | |
| JobDriver_CleanFilth.<>c__DisplayClass7_0.<MakeNewToils>b__1: TRANS: VFED.HarmonyPatches.FilthCleaningPatch.Transpiler | |
| JobDriver_ConstructFinishFrame.<>c__DisplayClass8_0.<MakeNewToils>b__1: post: VFETribals.JobDriver_ConstructFinishFrame_MakeNewToils_TickAction_Patch.Postfix TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_ConstructFinishFrame_MakeNewToils_TickAction_Patch.Transpiler | |
| JobDriver_ConstructFinishFrame.MakeNewToils: post: VEF.Pawns.VanillaExpandedFramework_JobDriver_ConstructFinishFrame_MakeNewToils_Patch.Postfix | |
| JobDriver_ConvertPrisoner.MakeNewToils: post: VanillaMemesExpanded.VanillaMemesExpanded_JobDriver_ConvertPrisoner_MakeNewToils_Patch.ReduceAnonymity | |
| JobDriver_Deconstruct.get_WorkEffecter: post: ReGrowthCore.JobDriver_Deconstruct_WorkEffecter_Patch.Postfix | |
| JobDriver_DoLovinCasual.GenerateRandomMinTicksToNextLovin: post: VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_JobDriver_Lovin_GenerateRandomMinTicksToNextLovin_Patch.PawnFucks, VanillaXenotypesImproved_JobDriver_DoLovinCasual_GenerateRandomMinTicksToNextLovin_Patch.PawnDidLovinNeedCasual | |
| JobDriver_DropEquipment.<MakeNewToils>b__4_1: TRANS: PeteTimesSix.SimpleSidearms.Intercepts.JobDriver_DropEquipment_MakeNewToils_Patches.JobDriver_DropEquipment_MakeNewToils_Patches_initAction_Transpiler | |
| JobDriver_Equip.<MakeNewToils>b__10_1: TRANS: PeteTimesSix.SimpleSidearms.Intercepts.JobDriver_Equip_MakeNewToils_Patches.JobDriver_Equip_MakeNewToils_Patches_initAction_Transpiler | |
| JobDriver_Equip.<MakeNewToils>b__10_2: TRANS: PeteTimesSix.SimpleSidearms.Intercepts.JobDriver_Equip_MakeNewToils_Patches.JobDriver_Equip_MakeNewToils_Patches_initAction_Transpiler | |
| JobDriver_Equip.MakeNewToils: post: SimsTraits.JobDriver_Equip_MakeNewToils_Patch.Postfix | |
| JobDriver_Fish.<CompleteFishingToil>b__4_0: TRANS: VCE_Fishing.VCE_Fishing_JobDriver_Fish_CompleteFishingToil_Patch.Transpiler, Bestiary.JobDriver_Fish_CompleteFishingToil_Transpile.Transpiler | |
| JobDriver_Fish.<MakeNewToils>d__3.MoveNext: TRANS: VCE_Fishing.VCE_Fishing_JobDriver_Fish_MakeNewToils_Patch.Transpiler | |
| JobDriver_Fish.CompleteFishingToil: post: VCE_Fishing.VCE_Fishing_JobDriver_Fish_CompleteFishingToil_PostFix_Patch.CompleteFishingToilPostActions TRANS: Bestiary.JobDriver_Fish_CompleteFishingToil_Helper.Transpiler | |
| JobDriver_FixBrokenDownBuilding.<MakeNewToils>b__8_1: PRE: SimsTraits.JobDriver_FixBrokenDownBuilding_Patch.Prefix | |
| JobDriver_ForceTargetWear.TryMakePreToilReservations: post: VanillaGravshipExpanded.JobDriver_ForceTargetWear_TryMakePreToilReservations_Patch.Postfix | |
| JobDriver_GiveToPawn.MakeNewToils: post: SimsTraits.JobDriver_GiveToPawn_MakeNewToils_Patch.Postfix | |
| JobDriver_HaulCorpseToPublicPlace.MakeNewToils: post: VanillaSocialInteractionsExpanded.JobDriver_HaulCorpseToPublicPlace_MakeNewToils.Postfix | |
| JobDriver_HaulToCell.MakeNewToils: post: PickUpAndHaul.HarmonyPatches.JobDriver_HaulToCell_PostFix | |
| JobDriver_Hunt.MakeNewToils: post: MVCF.PatchSets.PatchSet_Hunting.MakeNewToils | |
| JobDriver_Ingest.MakeNewToils: post: VanillaSocialInteractionsExpanded.JobDriver_Ingest_MakeNewToils.Postfix, AlphaBehavioursAndEvents.AlphaAnimals_JobDriver_Ingest_MakeNewToils_Patch.ApplyHediffIfCorpseEaten | |
| JobDriver_Ingest.PrepareToIngestToils_Dispenser: PRE: AnimalsLogic.AnimalsUseDispenser.PrepareToIngestToils_DispenserPrefix | |
| JobDriver_Ingest.PrepareToIngestToils_ToolUser: PRE: GrazeUp.Patch.PatchJobDriver_Ingest_PrepareToIngestToils_ToolUser.Prefix | |
| JobDriver_InitiateLovin.<MakeNewToils>b__10_6: TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_FinishAction_Highmates.Transpiler | |
| JobDriver_InitiateLovin.<MakeNewToils>d__10.MoveNext: TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_MoveNext_Patch.Transpiler | |
| JobDriver_InitiateLovin.GetLovers: PRE: BetterRomance.HarmonyPatches.VREPatches.VREGetLoversPrefix | |
| JobDriver_InitiateLovin.ProcessBreakups: PRE: BetterRomance.HarmonyPatches.VREPatches.VREProcessBreakupsPrefix, ReSpliceCharmweavers.VRE_Highmate_Breakup_Patch.Prefix post: BetterRomance.HarmonyPatches.VREPatches.VREProcessBreakupsPostfix | |
| JobDriver_InteractWithPassage.<MakeNewToils>b__1_0: (no patches) | |
| JobDriver_LayDown.<MakeNewToils>b__16_0: PRE: BunkBeds.JobDriver_LayDown_FailOn_Patch.Prefix post: BunkBeds.JobDriver_LayDown_FailOn_Patch.Postfix | |
| JobDriver_LayDown.GetReport: PRE: [2147483647]VREAndroids.JobDriver_LayDown_GetReport_Patch.Prefix | |
| JobDriver_LeaveMap.<MakeNewToils>b__1_0: (no patches) | |
| JobDriver_Lovin.<MakeNewToils>b__12_1: post: RimEffectAR.LovinJobDriverInit_Patch.Postfix TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_Patch.Transpiler | |
| JobDriver_Lovin.<MakeNewToils>b__12_3: TRANS: RimEffectAR.LovinJobDriverFleck_Patch.Transpiler | |
| JobDriver_Lovin.<MakeNewToils>b__12_4: post: RimEffectAR.LovinJobDriver_Patch.Postfix TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_FinishAction_Vanilla.Transpiler, ReSpliceCharmweavers.JobDriver_Lovin_FinishAction_Vanilla.Transpiler, RimEffectAR.LovinJobDriver_Patch.Transpiler | |
| JobDriver_Lovin.<MakeNewToils>d__12.MoveNext: TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_MoveNext_Patch.Transpiler | |
| JobDriver_Lovin.GenerateRandomMinTicksToNextLovin: post: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_GenerateRandomMinTicksToNextLovin_Patch.ModifyMTB, EBSGFramework.HarmonyPatches.PostLovinPostfix, VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_JobDriver_Lovin_GenerateRandomMinTicksToNextLovin_Patch.PawnFucks, VanillaTraitsExpanded.GenerateRandomMinTicksToNextLovin_Patch.Postfix, RimEffectAR.TicksToNextLovin_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.JobDriver_Lovin_GenerateRandomMinTicksToNextLovin.Transpiler | |
| JobDriver_Lovin.MakeNewToils: post: BigAndSmall.RoosCrushedPelvis_Patch.MakeNewToils_Postfix, BigAndSmall.JobDriver_Lovin_MakeNewToils.Postfix, VanillaSocialInteractionsExpanded.JobDriver_Lovin_MakeNewToils.Postfix | |
| JobDriver_LovinOneNightStand.<MakeNewToils>b__12_4: TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_FinishAction_VSIE.Transpiler, ReSpliceCharmweavers.JobDriver_Lovin_FinishAction_VSIE.Transpiler | |
| JobDriver_LovinOneNightStand.<MakeNewToils>d__12.MoveNext: TRANS: VEF.Pawns.VanillaExpandedFramework_JobDriver_Lovin_MoveNext_Patch.Transpiler | |
| JobDriver_ManTurret.<>c__DisplayClass11_0.<FindFuelForTurret>g__FuelValidator|0: PRE: VEF.Weapons.JobDriver_ManTurret_FindFuelForTurretLambda_Patch.Prefix post: VEF.Weapons.JobDriver_ManTurret_FindFuelForTurretLambda_Patch.Postfix | |
| JobDriver_ManTurret.<>c__DisplayClass13_0.<MakeNewToils>b__0: post: VEF.Weapons.JobDriver_ManTurret_RefuelIfNeededLambda_Patch.Postfix | |
| JobDriver_ManTurret.FindAmmoForTurret: post: VFESecurity.JobDriver_ManTurret_FindAmmoForTurret_Patch.Postfix | |
| JobDriver_ManTurret.GunNeedsRefueling: post: VEF.Weapons.JobDriver_ManTurret_GunNeedsRefueling_Patch.Postfix | |
| JobDriver_Meditate.MakeNewToils: post: SimsTraits.JobDriver_Meditate_MakeNewToils_Patch.Postfix | |
| JobDriver_Meditate.MeditationTick: post: VanillaExplorationExpanded.VanillaExplorationExpanded_JobDriver_Meditate_MeditationTick_Patch.AddGrass | |
| JobDriver_Mine.DoDamage: PRE: SlowerPawnTickRate.JobDriver_Mine_DoDamage_Patch.Prefix | |
| JobDriver_Mine.MakeNewToils: post: SmartDeconstruct.SmartDeconstructMod.CheckForRoofsBeforeJob | |
| JobDriver_Mine.ResetTicksToPickHit: PRE: SlowerPawnTickRate.JobDriver_Mine_ResetTicksToPickHit_Patch.Prefix post: SlowerPawnTickRate.JobDriver_Mine_ResetTicksToPickHit_Patch.Postfix, VFEInsectoids.VFEInsectoids_JobDriver_Mine_ResetTicksToPickHit_Patch.Postfix | |
| JobDriver_Nuzzle.MakeNewToils: post: VAspirE.SatisfactionPatches.CheckNuzzlers, GeneticRim.GeneticRim_JobDriver_Nuzzle_MakeNewToils_Patch.NotifyNuzzled | |
| JobDriver_ParagonConversion.<MakeNewToils>b__1_0: (no patches) | |
| JobDriver_PilotConsole.MakeNewToils: post: VanillaGravshipExpanded.JobDriver_PilotConsole_MakeNewToils_Patch.Postfix | |
| JobDriver_PlantSaplingchild.<MakeNewToils>b__3_0: (no patches) | |
| JobDriver_PlantSow.MakeNewToils: post: VanillaRacesExpandedPhytokin.VanillaRacesExpandedPhytokin_JobDriver_PlantSow_MakeNewToils_Patch.Postfix, VanillaSocialInteractionsExpanded.JobDriver_PlantSow_MakeNewToils.Postfix | |
| JobDriver_PlayPoker.ModifyPlayToil: post: SimsTraits.JobDriver_PlayPoker_ModifyPlayToil_Patch.Postfix | |
| JobDriver_PrepareCaravan_GatherItems.get_Transferables: PRE: Vehicles.Patch_JobSystem.TransferablesVehicle | |
| JobDriver_Reading.ReadBook: post: AlphaBooks.AlphaBooks_JobDriver_Reading_ReadBook_Patch.CommunicateFinishedReading | |
| JobDriver_Reign.<MakeNewToils>b__7_3: PRE: VanillaPsycastsExpanded.JobDriver_Reign_Patch.Prefix post: VanillaPsycastsExpanded.JobDriver_Reign_Patch.Postfix | |
| JobDriver_RemoveBuilding.MakeNewToils: post: SmartDeconstruct.SmartDeconstructMod.CheckForRoofsBeforeJob | |
| JobDriver_RemoveFloor.DoEffect: post: VanillaGravshipExpanded.JobDriver_RemoveFloor_DoEffect_Patch.Postfix | |
| JobDriver_RemoveSewage.DoEffect: (no patches) | |
| JobDriver_Repair.MakeNewToils: post: SimsTraits.JobDriver_Repair_MakeNewToils_Patch.Postfix | |
| JobDriver_RepairMech.MakeNewToils: PRE: AlphaGenes_JobDriver_RepairMech_MakeNewToils_Patch.StorePawn | |
| JobDriver_Resurrect.MakeNewToils: post: VanillaSocialInteractionsExpanded.JobDriver_Resurrect_MakeNewToils.Postfix | |
| JobDriver_Resurrect.Resurrect: PRE: [2147483647]VREAndroids.JobDriver_Resurrect_Resurrect_Patch.Prefix | |
| JobDriver_Scarify.Scarify: (no patches) | |
| JobDriver_SocialRelax.<MakeNewToils>d__12.MoveNext: TRANS: FixesForSBZFridge.JobDriver_SocialRelax_MakeNewToils.Transpiler | |
| JobDriver_TakeToBed.MakeNewToils: post: UndraftAfterTucking.Harmony.Postfix, VanillaSocialInteractionsExpanded.JobDriver_TakeToBed_MakeNewToils.Postfix | |
| JobDriver_TendEntity.<MakeNewToils>b__15_0: TRANS: ChooseYourMedicine.TendEntity_MakeNewToil_Transpiler.Transpiler | |
| JobDriver_TendPatient.<MakeNewToils>b__19_0: TRANS: ChooseYourMedicine.MakeNewToil_Transpiler.Transpiler | |
| JobDriver_TendPatient.FindMoreMedicineToil: PRE: ChooseYourMedicine.FindMoreMedicineToil_Prefix.Prefix | |
| JobDriver_TendPatient.MakeNewToils: post: [800]ChooseYourMedicine.JobDriver_TendPatient_Postfix.Postfix | |
| JobDriver_UnnaturalCorpseAttack.<>c__DisplayClass4_0.<MakeNewToils>b__4: (no patches) | |
| JobDriver_ViewArt.WaitTickAction: post: VanillaTraitsExpanded.WaitTickAction_Patch.Postfix | |
| JobDriver_Vomit.<MakeNewToils>b__4_1: TRANS: VEF.Genes.VanillaExpandedFramework_JobDriver_Vomit_MakeNewToils_Transpiler_Patch.Transpiler | |
| JobDriver_Vomit.<MakeNewToils>d__4.MoveNext: TRANS: VEF.Genes.VanillaExpandedFramework_JobDriver_Vomit_MoveNext_Patch.Transpiler | |
| JobDriver_Vomit.MakeNewToils: PRE: VEF.Genes.VanillaExpandedFramework_JobDriver_Vomit_MakeNewToils_Patch.StorePawn post: AlphaGenes.AlphaGenes_JobDriver_Vomit_MakeNewToils_Patch.DamageAfterPuking | |
| JobDriver_Wait.CheckForAutoAttack: PRE: PsiTech.Utility.AutoAttackPatch.Prefix post: AllowTool.Patches.JobDriverWait_CheckForAutoAttack_Patch.DoPartyHunting TRANS: VEF.Weapons.VanillaExpandedFramework_JobDriver_Wait_CheckForAutoAttack_Patch.Transpiler, MVCF.PatchSets.PatchSet_TargetFinder.BestTargetTranspiler | |
| JobDriver_WatchBuilding.MakeNewToils: post: SimsTraits.JobDriver_WatchBuilding_MakeNewToils_Patch.Postfix, VanillaTraitsExpanded.MakeNewToils_Patch.Postfix | |
| JobDriver_WatchTelevision.WatchTickAction: PRE: VanillaQuestsExpandedDeadlife.JobDriver_WatchTelevision_WatchTickAction_Patch.Prefix post: VanillaQuestsExpandedDeadlife.JobDriver_WatchTelevision_WatchTickAction_Patch.Postfix | |
| JobDriver_Wear.Notify_Starting: post: SimsTraits.JobDriver_Wear_Notify_Starting_Patch.Postfix | |
| JobDriver_Wear.TryMakePreToilReservations: post: VanillaGravshipExpanded.JobDriver_Wear_TryMakePreToilReservations_Patch.Postfix | |
| JobDriver_poopOutside.<MakeNewToils>b__1_3: (no patches) | |
| JobGiver_AIFightEnemy.FindAttackTarget: TRANS: MVCF.PatchSets.PatchSet_TargetFinder.AttackTargetTranspiler | |
| JobGiver_AIFightEnemy.UpdateEnemyTarget: PRE: VanillaPsycastsExpanded.Nightstalker.Decoy.UpdateEnemyTarget_Prefix | |
| JobGiver_AIFollowPawn.TryGiveJob: post: VEF.Buildings.DoorTeleporter+JobGiver_AIFollowPawn_TryGiveJob_Patch.Postfix | |
| JobGiver_AIGotoNearestHostile.TryGiveJob: post: VFEInsectoids.JobGiver_AIGotoNearestHostile_TryGiveJob_Patch.Postfix | |
| JobGiver_Berserk.FindAttackTarget: post: SimsTraits.JobGiver_Berserk_FindAttackTarget_Patch.Postfix | |
| JobGiver_BoardOrLeaveGravship.TryGiveJob: TRANS: VanillaGravshipExpanded.ListAllGravEngines_Patch.Transpiler | |
| JobGiver_ConfigurableHostilityResponse.TryGetAttackNearbyEnemyJob: PRE: VEF.Weapons.VanillaExpandedFramework_JobGiver_ConfigurableHostilityResponse_TryGetAttackNearbyEnemyJob_Patch.Prefix TRANS: MVCF.PatchSets.PatchSet_TargetFinder.AttackTargetTranspiler | |
| JobGiver_ConfigurableHostilityResponse.TryGiveJob: PRE: [2147483647]PerformanceOptimizer.Optimization_JobGiver_ConfigurableHostilityResponse.Prefix | |
| JobGiver_DoLovin.TryGiveJob: PRE: VanillaTraitsExpanded.JobGiver_DoLovin_TryGiveJob_Patch.Prefix, BetterRomance.HarmonyPatches.JobGiver_DoLovin_TryGiveJob.Prefix post: BunkBeds.JobGiver_DoLovin_TryGiveJob_Patch.Postfix, ReSpliceCharmweavers.JobGiver_DoLovin_TryGiveJob_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.JobGiver_DoLovin_TryGiveJob.Transpiler | |
| JobGiver_DropUnusedInventory.Drop: PRE: PeteTimesSix.SimpleSidearms.Intercepts.JobGiver_DropUnusedInventory_Drop.Prefix, PickUpAndHaul.HarmonyPatches.Drop_Prefix | |
| JobGiver_DropUnusedInventory.TryGiveJob: post: PickUpAndHaul.HarmonyPatches.DropUnusedInventory_PostFix | |
| JobGiver_EatInGatheringArea.TryGiveJob: post: VanillaSocialInteractionsExpanded.TryGiveJob_Patch.Postfix | |
| JobGiver_EatRandom.TryGiveJob: PRE: AnimalsLogic.DoNotEatRandomly+JobGiver_EatRandom_TryGiveJob_Patch.Prefix | |
| JobGiver_ExitMap.TryGiveJob: PRE: Shashlichnik.JobGiver_ExitMap_Patch.Prefix post: AncientMarketAI_Libraray.Patch_Exit.postfix | |
| JobGiver_ExitMap_Patch.Prefix: (no patches) | |
| JobGiver_GetComaRest.get_Cache: (no patches) | |
| JobGiver_GetFood.TryGiveJob: PRE: VEF.AnimalBehaviours.VanillaExpandedFramework_JobGiver_GetFood_GetPriority_Patch.StopEatingThings post: BloodSuckingAnimals.HarmonyPatches.TryGiveFoodJobPostfix | |
| JobGiver_GetHemogen.CanFeedOnPrisoner: post: BigAndSmall.BloodPatches.CanFeedOnPrisoner_Postfix, [-2147483648]VREAndroids.JobGiver_GetHemogen_CanFeedOnPrisoner_Patch.Postfix | |
| JobGiver_GetJoy.TryGiveJob: PRE: SimsTraits.JobGiver_GetJoy_TryGiveJob_Patch.Prefix post: SimsTraits.JobGiver_GetJoy_TryGiveJob_Patch.Postfix | |
| JobGiver_GetJoyInGatheringArea.TryGiveJobFromJoyGiverDefDirect: post: VanillaSocialInteractionsExpanded.TryGiveJobFromJoyGiverDefDirect_Patch.Postfix | |
| JobGiver_GetResourcePack.get_Cache: (no patches) | |
| JobGiver_GetRest.GetPriority: PRE: ProgressionEducation.JobGiver_GetRest_GetPriority_Patch.Prefix TRANS: VEF.AnimalBehaviours.JobGiver_GetRest_Patch+VanillaExpandedFramework_JobGiver_GetRest_GetPriority_Patch.Transpiler | |
| JobGiver_GetRest.TryGiveJob: PRE: VanillaTraitsExpanded.TryGiveJob_Patch.Prefix post: AncientMarketAI_Libraray.Patch_Rest.postfix | |
| JobGiver_Haul.TryGiveJob: TRANS: PickUpAndHaul.HarmonyPatches.JobGiver_Haul_TryGiveJob_Transpiler | |
| JobGiver_Hemohunter.FindPawnToSuck: TRANS: VREAndroids.VanillaRacesExpandedSanguophage_JobGiver_Hemohunter_FindPawnToSuck_Patch.Transpiler | |
| JobGiver_Idle.TryGiveJob: post: PickUpAndHaul.HarmonyPatches.IdleJoy_Postfix | |
| JobGiver_LeaveCave.TryIssueJobPackage: (no patches) | |
| JobGiver_OptimizeApparel.ApparelScoreGain: post: VREArchon.VREArchon_JobGiver_OptimizeApparel_ApparelScoreGain_Postfix.PostFix, AlphaGenes.AlphaGenes_JobGiver_OptimizeApparel_ApparelScoreGain_Postfix.PostFix, EBSGFramework.HarmonyPatches.ApparelScoreGainPostFix, VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_JobGiver_OptimizeApparel_ApparelScoreGain_Postfix.PostFix, VanillaMemesExpanded.VanillaMemesExpanded_JobGiver_OptimizeApparel_ApparelScoreGain_Postfix.PostFix | |
| JobGiver_OptimizeApparel.ApparelScoreRaw: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| JobGiver_OptimizeApparel.TryGiveJob: PRE: VFEPirates.JobGiver_OptimizeApparel_TryGiveJob_Patch.Prefix | |
| JobGiver_Orders.TryGiveJob: post: SearchAndDestroy.Harmony.JobGiver_Orders_TryGiveJob.Postfix | |
| JobGiver_PatientGoToBed.TryGiveJob: post: VREAndroids.JobGiver_PatientGoToBed_TryGiveJob_Patch.Postfix | |
| JobGiver_PawnNeedCharger.get_Cache: (no patches) | |
| JobGiver_ReactToCloseMeleeThreat.TryGiveJob: post: VanillaMemesExpanded.PreceptPatches.NoFightingInterrogator | |
| JobGiver_ReloadAbility.get_Cache: (no patches) | |
| JobGiver_SatisfyDependency.get_Cache: (no patches) | |
| JobGiver_SocialFighting.TryGiveJob: PRE: VREArchon.VREArchon_JobGiver_SocialFighting_TryGiveJob_Patch.GoNuts, VanillaRacesExpandedInsector.VanillaRacesExpandedInsector_JobGiver_SocialFighting_TryGiveJob_Patch.GoNuts | |
| JobGiver_StandAndBeSociallyActive.TryGiveJob: post: VanillaSocialInteractionsExpanded.JobGiver_StandAndBeSociallyActive_TryGiveJob_Patch.Postfix | |
| JobGiver_TakeForInventoryStock.TryGiveJob: TRANS: ChooseYourMedicine.TakeForInventoryStock_TryGiveJob_Transpiler.Transpiler | |
| JobGiver_TrainInTube.TryIssueJobPackage: (no patches) | |
| JobGiver_Wander.TryGiveJob: PRE: Vehicles.Patch_JobSystem.VehiclesDontWander, RimEffect.GenSteps.Patch_JobGiver_Wander_TryGiveJob.Prefix, VanillaRacesExpandedInsector.VanillaRacesExpandedInsector_JobGiver_Wander_TryGiveJob.Prefix post: VanillaRacesExpandedInsector.VanillaRacesExpandedInsector_JobGiver_Wander_TryGiveJob.Postfix | |
| JobGiver_WanderInRoofedCellsInPen.ShouldSeekRoofedCells: post: VEE.JobGiver_WanderInRoofedCellsInPen_Patch.Postfix | |
| JobGiver_Work.GetPriority: PRE: ProgressionEducation.JobGiver_Work_GetPriority_Patch.Prefix post: SimsTraits.JobGiver_Work_GetPriority_Patch.Postfix | |
| JobUtility.TryStartErrorRecoverJob: PRE: Vehicles.Patch_JobSystem.VehicleErrorRecoverJob | |
| JoyGiver.GetChance: post: SimsTraits.JoyGiver_GetChance_Patch.Postfix, VanillaTraitsExpanded.GetChance_Patch.Postfix | |
| JoyGiver.GetSearchSet: post: ProgressionEducation.JoyGiver_GetSearchSet_Patch.Postfix | |
| JoyGiver_InteractBuilding.CanInteractWith: TRANS: Dubs_Skylight.GardenPatches+Patch_CanInteractWith.Transpiler | |
| JoyGiver_Meditate.TryGiveJob: post: [-2147483648]VREAndroids.JoyGiver_Meditate_Patch.Postfix | |
| JoyGiver_VisitGrave.TryGiveJob: PRE: VanillaTraitsExpanded.JoyGiver_VisitGrave_TryGiveJob_Patch.Prefix | |
| JoyGiver_WatchBuilding.CanInteractWith: post: VanillaQuestsExpandedDeadlife.JoyGiver_WatchBuilding_CanInteractWith_Patch.Postfix | |
| JoyKindDef.PawnCanDo: post: TooManyMods.TMM_InspirationCanOccur_Postfix.Postfix | |
| JoyUtility.JoyTickCheckEnd: PRE: VanillaSocialInteractionsExpanded.JoyUtility_JoyTickCheckEnd.Prefix post: VanillaMemesExpanded.VanillaMemesExpanded_JoyUtility_JoyTickCheckEnd_Patch.InformJoyTakingPlace | |
| JoyUtility.TryGainRecRoomThought: PRE: VanillaPsycastsExpanded.JoyUtility_TryGainRecRoomThought_Patch.Prefix post: VanillaPsycastsExpanded.JoyUtility_TryGainRecRoomThought_Patch.Postfix | |
| KidnappedPawnsTracker.Kidnap: post: VREArchon.VREArchon_KidnappedPawnsTracker_Kidnap_Patch.TurnIntoArchon | |
| LandformGraphEditor.Init: PRE: MapPreview.Compatibility.ModCompat_GeologicalLandforms+LandformGraphEditor_Init.Prefix | |
| LanguageDatabase.SelectLanguage: PRE: HugsLib.Patches.LanguageDatabase_Patch.ForceRestartAfterLangChange | |
| LaunchInfo.ExposeData: post: VanillaGravshipExpanded.LaunchInfo_ExposeData_Patch.Postfix | |
| LaunchProtocol.GetArrivalOptions: post: TooManyMods.Compat_MerchantGuild_TradeArrivalOption+Patch_LaunchProtocol_GetArrivalOptions_MerchantGuild_AsEmptyTile.Postfix | |
| LearningGiver.CanDo: TRANS: SimsTraits.LearningGiver_CanDo_Patch.Transpiler | |
| LearningGiver_Radiotalking.TryFindCommsConsole: post: VanillaGravshipExpanded.LearningGiver_Radiotalking_TryFindCommsConsole_Patch.Postfix | |
| LearningReadout.LearningReadoutOnGUI: PRE: [600]GeologicalLandforms.Patches.Patch_RimWorld_LearningReadout.LearningReadoutOnGUI, FuckLearningHelper.LearningReadout_LearningReadoutOnGUI_Patch.Prefix | |
| LearningUtility.SchoolDeskLearningRate: PRE: VEF.Buildings.VanillaExpandedFramework_LearningUtility_SchoolDeskLearningRate.Prefix | |
| LeaveQuestPartUtility.MakePawnsLeave: PRE: ReSpliceCharmweavers.LeaveQuestPartUtility_MakePawnsLeave_Patch.Prefix | |
| Letter.PostProcessedLabel: post: VisibleRaidPoints.Patch_Letter_PostProcessedLabel.Postfix | |
| Letter.RimWorld.IArchivable.get_ArchivedLabel: post: VisibleRaidPoints.Patch_Letter_RimWorld_IArchivable_get_ArchivedLabel.Postfix | |
| Letter.get_Label: post: VisibleRaidPoints.Patch_Letter_get_Label.Postfix | |
| LetterStack.LettersOnGUI: PRE: RimHUD.Access.Patch.Verse_LetterStack_LettersOnGUI.Prefix, AchtungMod.LetterStack_LettersOnGUI_Patch.Prefix | |
| LetterStack.ReceiveLetter: post: SimsTraits.LetterStack_ReceiveLetter_Patch.Postfix | |
| LifeStageWorkSettings.IsDisabled: PRE: [2147483647]VREAndroids.LifeStageWorkSettings_IsDisabled_Patch.Prefix TRANS: VREArchon.LifeStageWorkSettings_IsDisabled_Patch.Transpiler | |
| LifeStageWorker.Notify_LifeStageStarted: post: VEF.Genes.VanillaExpandedFramework_LifeStageWorker_Notify_LifeStageStarted_Patch.Postfix, BigAndSmall.BSVanillaPatches.Post_Notify_LifeStageStarted, ProgressionEducation.LifeStageWorker_Notify_LifeStageStarted_Patch.Postfix | |
| LifeStageWorker_HumanlikeChild.Notify_LifeStageStarted: TRANS: VREArchon.LifeStageWorker_HumanlikeChild_Notify_LifeStageStarted_Patch.Transpiler | |
| ListerBuildings.Add: (no patches) | |
| ListerBuildings.Remove: (no patches) | |
| ListerBuildingsRepairable.Notify_BuildingRepaired: PRE: Vehicles.Patch_Construction.Notify_RepairedVehicle | |
| ListerMergeables.Notify_ThingStackChanged: post: AdaptiveStorage.HarmonyPatches.NotifyItemStackChanged.Postfix | |
| ListerThings.EverListable: post: VanillaPsycastsExpanded.HarmonyPatches.ListerThings_EverListable_Patch.Postfix | |
| ListingMenu_Thoughts.<>c.<Add>b__12_0: (no patches) | |
| ListingMenu_Thoughts.Add: (no patches) | |
| Listing_ResourceReadout.DoCategory: TRANS: DubsMintMenus.PinningSys+Patch_DoCategory.Transpiler | |
| Listing_ResourceReadout.DoThingDef: TRANS: DubsMintMenus.PinningSys+Patch_DoThingDef.Transpiler | |
| Listing_Standard.ButtonTextLabeledPct: PRE: FuckLearningHelper.ListingStandard_ButtonTextLabeledPct_Patch.Prefix | |
| Listing_Standard.CheckboxLabeled: PRE: FuckLearningHelper.ListingStandard_CheckboxLabeled_Patch.Prefix | |
| Listing_TreeThingFilter.DoThingDef: PRE: DubsMintMenus.HarmonyPatches+Harmony_DoThingDef.Prefix | |
| LoadedModManager.ApplyPatches: PRE: XmlExtensions.ApplyPatches_Patch.Prefix, ModSettingsFramework.LoadedModManager_ApplyPatches_Patch.Prefix post: XmlExtensions.ApplyPatches_Patch.Postfix, ReGrowthCore.LoadedModManager_ApplyPatches_Patch.Postfix, ReGrowthCore.LoadedModManager_ApplyPatches_Patch.Postfix | |
| LoadedModManager.LoadModXML: PRE: LogModVersion.LoadedModManager_LoadModXML_Patch.Prefix | |
| LoadedModManager.ParseAndProcessXML: PRE: Prepatcher.HarmonyPatches.PrefixParseXML TRANS: PostInheritanceOperation.XmlInheritanceResolvePostfix.Transpiler | |
| LoadedModManager.get_ModHandles: post: ModSettingsFramework.LoadedModManager_ModHandles_Patch.Postfix | |
| LoadedObjectDirectory.Clear: post: VEF.Planet.HireableSystemStaticInitialization.AddHireablesToLoadedObjectDirectory | |
| Log.Error: PRE: ModSettingsFramework.Log_Error_Patch.Prefix, Analyzer.DebugLogenabler.ErrorPrefix, PerformanceOptimizer.Log_Error_Patch.Prefix post: Analyzer.DebugLogenabler.ErrorPostfix | |
| Log.ResetMessageCount: PRE: EventsCore.Patches.Log_ResetMessageCount_EventsCorePatch.Prefix post: HarmonyMod.Log_ResetMessageCount_Patch.Postfix | |
| LongEventHandler.DrawLongEventWindowContents: (no patches) | |
| LongEventHandler.LongEventsOnGUI: TRANS: MoreWidgets.Patch_DoTooltipGUI.Transpiler | |
| LootableBuilding_Custom.get_InteractablesMapComp: (no patches) | |
| Lootbox.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Lord.AddPawn: PRE: VanillaTraitsExpanded.AddPawn_Patch.Prefix post: VEF.Storyteller.VanillaExpandedFramework_Lord_AddPawn_Patch.Postfix, VanillaSocialInteractionsExpanded.Patch_AddPawn.Postfix | |
| Lord.CheckTransitionOnSignal: post: VFEEmpire.HarmonyPatches.Patch_Lords.CheckTransitionOnSignal_Postfix | |
| Lord.Cleanup: PRE: VEF.Storyteller.VanillaExpandedFramework_Lord_Cleanup_Patch.Prefix, VanillaSocialInteractionsExpanded.Patch_Cleanup.Prefix | |
| Lord.GotoToil: post: VFEEmpire.HarmonyPatches.Patch_Lords.GotoToil_Postfix | |
| LordJob_FormAndSendCaravan.CreateGraph: PRE: EnterHere.LordJob_FormAndSendCaravan_CreateGraph.Prefix | |
| LordJob_FormAndSendCaravan.get_GatheringItemsNow: PRE: VanillaTradingExpanded.GatheringItemsNowPatch.Prefix | |
| LordJob_Joinable_MarriageCeremony.WeddingSucceeded: PRE: VAEInsanity.LordJob_Joinable_MarriageCeremony_WeddingSucceeded_Patch.Prefix post: VanillaSocialInteractionsExpanded.LordJob_Joinable_MarriageCeremony_WeddingSucceeded_Patch.Postfix | |
| LordJob_Joinable_Party.ApplyOutcome: PRE: VAEInsanity.LordJob_Joinable_Party_ApplyOutcome_Patch.Prefix | |
| LordJob_Joinable_Party.get_AttendeeThought: post: VanillaMemesExpanded.VanillaMemesExpanded_LordJob_Joinable_Party_AttendeeThought_Patch.ChangeThoughtForParty | |
| LordJob_Joinable_Party.get_OrganizerThought: post: VanillaMemesExpanded.VanillaMemesExpanded_LordJob_Joinable_Party_OrganizerThought_Patch.ChangeThoughtForPartyOrganizer | |
| LordJob_Ritual..ctor: post: ReBuildDoorsAndCorners.LordJob_Ritual_Constructor_Patch.Postfix | |
| LordJob_Ritual.ApplyOutcome: post: VanillaGravshipExpanded.LordJob_Ritual_ApplyOutcome_Patch.Postfix, AlphaMemes.FuneralFramework_LordJobRitual_ApplyOutcome_Patch.Postfix | |
| LordJob_Ritual.ExposeData: post: VanillaGravshipExpanded.LordJob_Ritual_ExposeData_Patch.Postfix | |
| LordJob_Ritual.Notify_AddedToLord: post: AlphaMemes.FuneralFramework_LordJobRitual_NotifyAddedToLord_Patch.Postfix | |
| LordMaker.MakeNewLord: post: VFEEmpire.HarmonyPatches.Patch_Lords.MakeNewLord_Postfix | |
| LordManager.RemoveLord: post: VFEEmpire.HarmonyPatches.Patch_Lords.RemoveLord_Prefix | |
| LordToil_DefendAndExpandHive.UpdateAllDuties: PRE: VFEInsectoids.LordToil_DefendAndExpandHive_UpdateAllDuties_Patch.Prefix | |
| LordToil_HiveRelated.FindClosestHive: PRE: VFEInsectoids.LordToil_HiveRelated_FindClosestHive_Patch.Prefix | |
| LordToil_PanicFlee.Init: post: VanillaMemesExpanded.VanillaMemesExpanded_LordToil_PanicFlee_Init_Patch.UndraftWhenEnemyFlees | |
| LordToil_PsychicRitual.RitualCompleted: PRE: VAEInsanity.LordToil_PsychicRitual_RitualCompleted_Patch.Prefix | |
| LovePartnerRelationUtility.ExLovePartnerRelationExists: post: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_ExLovePartnerRelationExists.Postfix | |
| LovePartnerRelationUtility.GetGenerationChanceAgeFactor: PRE: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_GetGenerationChanceAgeFactor.Prefix | |
| LovePartnerRelationUtility.GetGenerationChanceAgeGapFactor: TRANS: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_GetGenerationChanceAgeGapFactor.Transpiler | |
| LovePartnerRelationUtility.GetHistoryEventForLoveRelationCountPlusOne: PRE: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_GetHistoryEventForLoveRelationCountPlusOne.Prefix | |
| LovePartnerRelationUtility.GetHistoryEventLoveRelationCount: PRE: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_GetHistoryEventLoveRelationCount.Prefix | |
| LovePartnerRelationUtility.GetLovinMtbHours: post: ReSpliceCharmweavers.LovePartnerRelationUtility_GetLovinMtbHours_Patch.Postfix | |
| LovePartnerRelationUtility.GetMostDislikedNonPartnerBedOwner: PRE: BunkBeds.LovePartnerRelationUtility_GetMostDislikedNonPartnerBedOwner_Patch.Prefix | |
| LovePartnerRelationUtility.GiveRandomExLoverOrExSpouseRelation: PRE: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_GiveRandomExLoverOrExSpouseRelation.Prefix | |
| LovePartnerRelationUtility.IsExLovePartnerRelation: post: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_IsExLovePartnerRelation.Postfix | |
| LovePartnerRelationUtility.IsLovePartnerRelation: post: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_IsLovePartnerRelation.Postfix | |
| LovePartnerRelationUtility.LovePartnerRelationExists: post: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_LovePartnerRelationExists.Postfix | |
| LovePartnerRelationUtility.LovePartnerRelationGenerationChance: post: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_LovePartnerRelationGenerationChance.Postfix TRANS: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_LovePartnerRelationGenerationChance.Transpiler | |
| LovePartnerRelationUtility.LovinMtbSinglePawnFactor: PRE: VREAndroids.LovePartnerRelationUtility_LovinMtbSinglePawnFactor_Patch.Prefix post: ReSpliceCharmweavers.LovePartnerRelationUtility_LovinMtbSinglePawnFactor_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_LovinMtbSinglePawnFactor.Transpiler | |
| LovePartnerRelationUtility.MinPossibleAgeGapAtMinAgeToGenerateAsLovers: TRANS: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_MinPossibleAgeGapAtMinAgeToGenerateAsLovers.Transpiler | |
| LovePartnerRelationUtility.TryToShareChildrenForGeneratedLovePartner: PRE: BetterRomance.HarmonyPatches.LovePartnerRelationUtility_TryToShareChildrenForGeneratedLovePartner.Prefix | |
| MWTBMod.WriteSettings: (no patches) | |
| Main.Patch_FinalizeInit.Postfix: (no patches) | |
| MainButtonDef.get_Icon: post: VanillaTexturesExpanded.Patch_MainButtonDef+get_Icon.Postfix | |
| MainButtonWorker.DoButton: TRANS: VanillaTexturesExpanded.Patch_MainButtonWorker+DoButton.Transpiler | |
| MainButtonWorker_ToggleWorld.Activate: PRE: Vehicles.Patch_WorldHandling.ForcedTargetingDontToggleWorld | |
| MainButton_Toggle.<>c.<Activate>b__2_0: (no patches) | |
| MainButtonsRoot.MainButtonsOnGUI: PRE: DubsMintMenus.HarmonyPatches+Patch_MainButtonsOnGUI.Prefix post: UINotIncluded.MainButtonRootPatch.Postfix TRANS: UINotIncluded.MainButtonsRoot_TranspilerPatch.Transpiler | |
| MainMenuDrawer.DoMainMenuControls: PRE: GraphicSetter.Patches.UIPatches+DoMainMenuControlsPatch.Prefix TRANS: HugsLib.Patches.MainMenuDrawer_Quickstart_Patch.QuicktestButtonUsesQuickstarter, GraphicSetter.Patches.UIPatches+DoMainMenuControlsPatch.Transpiler, ProgressionScenarios.MainMenuDrawer_DoMainMenuControls_Patch.Transpiler | |
| MainMenuDrawer.Init: post: VBE.BackgroundController.Initialize, LunarFramework.Internal.Patches.Patch_RimWorld_MainMenuDrawer.Init_Postfix | |
| MainMenuDrawer.MainMenuOnGUI: PRE: XenotypeAndIdeologyButtonsTitleScreen.MainPatches+MainMenuDrawer_Patch.Prefix post: XenotypeAndIdeologyButtonsTitleScreen.MainPatches+MainMenuDrawer_Patch.Postfix | |
| MainTabWindow.SetInitialSizeAndPosition: post: UINotIncluded.MainTabWindowPatch.Postfix | |
| MainTabWindow_Animals.get_Pawns: post: VFEInsectoids.MainTabWindow_Animals_Pawns_Patch.Postfix | |
| MainTabWindow_Architect.CacheDesPanels: post: VanillaGravshipExpanded.MainTabWindow_Architect_CacheDesPanels_Patch.Postfix | |
| MainTabWindow_Architect.DoCategoryButton: TRANS: ArchitectIcons.ArchitectIconsMod.ReplaceArchitectButton | |
| MainTabWindow_Architect.DoWindowContents: PRE: TabSorting.MainTabWindow_Architect_TabRectHeight.Prefix post: TabSorting.MainTabWindow_Architect_TabRectHeight.Postfix | |
| MainTabWindow_Architect.get_RequestedTabSize: post: ArchitectIcons.ArchitectIconsMod.AddWidth | |
| MainTabWindow_Architect.get_WinHeight: PRE: TabSorting.MainTabWindow_Architect_TabRectHeight.Prefix post: TabSorting.MainTabWindow_Architect_TabRectHeight.Postfix | |
| MainTabWindow_Inspect.DoInspectPaneButtons: PRE: [800]SmashTools.Patching.Patch_Rendering.InspectablePaneButtons | |
| MainTabWindow_Inspect.get_PaneTopY: PRE: RimHUD.Access.Patch.RimWorld_MainTabWindow_Inspect_PaneTopY.Prefix post: UINotIncluded.MainTabWindow_InspectPatches.Postfix | |
| MainTabWindow_MayaMenu.RefreshDesignatorCaches: PRE: VanillaGravshipExpanded.DubsMintMenus_RefreshDesignatorCaches_Patch.Prefix post: VanillaGravshipExpanded.DubsMintMenus_RefreshDesignatorCaches_Patch.Postfix | |
| MainTabWindow_MiniMap.DrawAllPawns: PRE: PerformanceOptimizer.Optimization_Pawn_DrawPos.EnableCache post: PerformanceOptimizer.Optimization_Pawn_DrawPos.DisableCache | |
| MainTabWindow_MintResearch.DrawPanel: PRE: VanillaGravshipExpanded.DubsMintMenus_Compat_Patches.DrawPanel_Prefix post: VanillaGravshipExpanded.DubsMintMenus_Compat_Patches.DrawPanel_Postfix | |
| MainTabWindow_MintResearch.LockedBox: post: VanillaGravshipExpanded.DubsMintMenus_Compat_Patches.LockedBox_Postfix | |
| MainTabWindow_MintResearch.MysterBox.InsertQueue: PRE: VanillaGravshipExpanded.DubsMintMenus_Compat_Patches.Queue_Prefix | |
| MainTabWindow_MintResearch.MysterBox.PushToQueue: PRE: VanillaGravshipExpanded.DubsMintMenus_Compat_Patches.Queue_Prefix | |
| MainTabWindow_MintResearch.MysterBox.SetTargetProject: PRE: VanillaVehiclesExpanded.MainTabWindow_MintResearch_SetTargetProject_Patch.Prefix | |
| MainTabWindow_MintResearch.NextResearchProject: PRE: VanillaGravshipExpanded.DubsMintMenus_Compat_Patches.NextResearchProject_Prefix | |
| MainTabWindow_Quests.DoCharityIcon: post: VEF.Storyteller.VanillaExpandedFramework_MainTabWindow_Quests_DoCharityIcon_Patch.Postfix, VFED.HarmonyPatches.MiscPatches.AddDeserterIcon | |
| MainTabWindow_Quests.DoRow: post: VEF.Storyteller.VanillaExpandedFramework_MainTabWindow_Quests_DoRow_Patch.Postfix | |
| MainTabWindow_Research.DoBeginResearch: PRE: VanillaGravshipExpanded.MainTabWindow_Research_DoBeginResearch_Patch.Prefix, VanillaVehiclesExpanded.MainTabWindow_Research_DoBeginResearch_Patch.Prefix | |
| MainTabWindow_Research.DrawContentSource: PRE: VEF.VanillaExpandedFramework_MainTabWindow_Research_DrawContentSource_Patch.Prefix | |
| MainTabWindow_Research.DrawProjectInfo: TRANS: VanillaGravshipExpanded.MainTabWindow_Research_DrawProjectInfo_Patch.Transpiler, AnomaliesExpected.HarmonyPatches.MTWR_ViewSize_Transpiler | |
| MainTabWindow_Research.DrawProjectScrollView: PRE: VanillaGravshipExpanded.MainTabWindow_Research_DrawProjectScrollView_Patch.Prefix | |
| MainTabWindow_Research.DrawResearchPrerequisites: PRE: VFEMedieval.MainTabWindow_Research_DrawResearchPrerequisites_Patch.Prefix | |
| MainTabWindow_Research.DrawRightRect: TRANS: AnomaliesExpected.HarmonyPatches.MTWR_ViewSize_Transpiler | |
| MainTabWindow_Research.DrawStartButton: TRANS: AnomaliesExpected.HarmonyPatches.MTWR_ViewSize_Transpiler, VanillaVehiclesExpanded.MainTabWindow_Research_DrawStartButton_Patch.Transpiler | |
| MainTabWindow_Research.ListProjects: TRANS: AnomaliesExpected.HarmonyPatches.MTWR_ListProjects_Transpiler | |
| MainTabWindow_Research.Select: PRE: AnomaliesExpected.HarmonyPatches.MTWR_Select_Prefix | |
| MainTabWindow_Research.UpdateSelectedProject: TRANS: AnomaliesExpected.HarmonyPatches.MTWR_ViewSize_Transpiler | |
| MainTabWindow_Research.ViewSize: TRANS: AnomaliesExpected.HarmonyPatches.MTWR_ViewSize_Transpiler | |
| MainTabWindow_ResearchTree.MenuOfPacks: post: VanillaGravshipExpanded.ResearchTree_Compat_Patches.MenuOfPacks_Postfix | |
| MainTabsRoot.HandleLowPriorityShortcuts: PRE: DubsMintMenus.HarmonyPatches+Patch_InterfaceTryActivate.Prefix post: RangeFinder.MainTabsRoot_HandleLowPriorityShortcuts_Patch.Postfix | |
| MainTabsRoot.ToggleTab: PRE: DubsMintMenus.HarmonyPatches+Patch_MainTabsRoot.Prefix | |
| Map.ConstructComponents: post: HugsLib.Patches.Map_ConstructComponents_Patch.MapComponentsInitHook | |
| Map.ExposeData: PRE: KCSG.Prefix_Map_ExposeData.Prefix | |
| Map.FillComponents: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData, [200]MapPreview.Patches.Patch_Verse_Map.FillComponents_Prefix TRANS: [200]MapPreview.Patches.Patch_Verse_Map.FillComponents_Filter_Transpiler, [200]MapPreview.Patches.Patch_Verse_Map.FillComponents_CheckRand_Transpiler | |
| Map.FinalizeInit: post: Vehicles.Patch_Areas.BackfillVehicleAreas, HugsLib.Patches.Map_FinalizeInit_Patch.MapLoadedHook, Moonlight.Patch_Map_FinalizeInit.Postfix, PerformanceOptimizer.Map_FinalizeInit.Postfix, PerspectivePaths.Patch_FinalizeInit.Postfix, ReGrowthCore.Map_FinalizeInit_Patch.Postfix, ReGrowthCore.Patch_Map_FinalizeInit.Postfix | |
| Map.FinalizeLoading: PRE: SmashTools.ComponentCache.PreCacheInst post: RangeFinder.Map_FinalizeLoading_Patch.Postfix | |
| Map.MapPostTick: post: SimsTraits.Map_MapPostTick_Patch.Postfix, VFEInsectoids.Map_MapPostTick_Patch.Postfix | |
| Map.MapPreTick: post: ReGrowthCore.Patch_Map_MapPreTick.Postfix | |
| Map.MapUpdate: PRE: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.GridRegen_Prefix | |
| Map.get_AnyBuildingBlockingMapRemoval: post: VanillaGravshipExpanded.Map_AnyBuildingBlockingMapRemoval_Patch.Postfix | |
| Map.get_Biomes: PRE: GeologicalLandforms.Patches.Patch_Verse_Map.GetBiomes_Prefix | |
| Map.get_MixedBiomeComp: (no patches) | |
| MapComponentUtility.FinalizeInit: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData | |
| MapComponentUtility.MapComponentUpdate: post: ReGrowthCore.MapComponentUtility_MapComponentUpdate_Patch.Postfix | |
| MapComponentUtility.MapGenerated: post: HugsLib.Patches.MapComponentUtility_MapGenerated_Patch.MapGeneratedHook, VFEInsectoids.MapComponentUtility_GenerateMap_Patch.Postfix | |
| MapComponent_Beacon.CanLightBeacon: PRE: TooManyMods.TMMP_VCE_BeaconPostfix.Prefix | |
| MapComponent_GeneGoodies.FinalizeInit: (no patches) | |
| MapComponent_IdeologicalGoodies.FinalizeInit: (no patches) | |
| MapComponent_RenderManager.TriggerCurrentMapManualRendering: (no patches) | |
| MapComponent_RoyaltyTracker.Room_UpdateRoomStatsAndRole_Postfix: (no patches) | |
| MapComponent_SmartFarming.CalculateTotalHungerRate: (no patches) | |
| MapComponent_Submap.GetComp: (no patches) | |
| MapDeiniter.Deinit: PRE: VEF.Buildings.DoorTeleporterPatches.VanillaExpandedFramework_MapDeiniter_Deinit_Prefix, PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData post: SmashTools.ComponentCache.ClearMap, VanillaPsycastsExpanded.GenRadialCached.Deinit_Postfix | |
| MapDrawLayer_OrbitalDebris.Regenerate: TRANS: VanillaGravshipExpanded.VanillaGravshipExpanded_MapDrawLayer_OrbitalDebris_Regenerate_Patch.Transpiler | |
| MapEdgeClipDrawer.DrawClippers: PRE: ProgressRenderer.Harmony_MapEdgeClipDrawer_DrawClippers.Prefix | |
| MapEvents.Notify_GameConditionAdded: post: USH_GE.Patch_GameConditionManager_RegisterCondition.Postfix | |
| MapGenUtility.BiomeAt: PRE: [600]GeologicalLandforms.Patches.Patch_RimWorld_MapGenUtility.BiomeAt_Prefix | |
| MapGenUtility.IsMixedBiome: PRE: [600]GeologicalLandforms.Patches.Patch_RimWorld_MapGenUtility.IsMixedBiome_Prefix | |
| MapGenerator.GenerateContentsIntoMap: PRE: [800]GeologicalLandforms.Patches.Patch_Verse_MapGenerator.GenerateContentsIntoMap_Prefix, [-2147483648]VanillaGravshipExpanded.SpaceMapDropPatches.Prefix post: [2147483647]VanillaGravshipExpanded.SpaceMapDropPatches.Postfix, [0]GeologicalLandforms.Patches.Patch_Verse_MapGenerator.GenerateContentsIntoMap_Postfix | |
| MapGenerator.GenerateMap: PRE: [800]MapPreview.Patches.Patch_Verse_MapGenerator.GenerateMap, VanillaGravshipExpanded.MapGenerator_GenerateMap_Patch.Prefix, SpaceTurbulence.Patch_Size.prefix post: VEF.Maps.VanillaExpandedFramework_MapGenerator_GenerateMap_Patch.Postfix, VFETribals.MapGenerator_GenerateMap_Patch.Postfix TRANS: [200]MapPreview.Patches.Patch_Verse_MapGenerator.GenerateMap_Transpiler | |
| MapHelper.AnyAerialVehiclesInRecon: (no patches) | |
| MapInfo.get_Tile: PRE: Shashlichnik.MapInfo_Tile_Patch.Prefix | |
| MapInterface.HandleMapClicks: post: PerformanceOptimizer.Optimization_UIToggle.Postfix | |
| MapInterface.MapInterfaceOnGUI_AfterMainTabs: PRE: RimHUD.Access.Patch.Verse_MapInterface_MapInterfaceOnGUI_AfterMainTabs.Prefix post: Vehicles.Patch_MapHandling.DebugOnGUIVehicleRegions, UINotIncluded.MapInterfaceOnGUI_AfterMainTabsPatch.Postfix | |
| MapInterface.MapInterfaceOnGUI_BeforeMainTabs: PRE: UINotIncluded.MapInterfaceOnGUI_BeforeMainTabsPatch.Prefix post: Bubbles.Access.RimWorld_MapInterface_MapInterfaceOnGUI_BeforeMainTabs.Postfix | |
| MapInterface.MapInterfaceUpdate: post: Vehicles.Patch_MapHandling.DebugUpdateVehicleRegions | |
| MapInterface.Notify_SwitchedMap: post: RimHUD.Access.Patch.Verse_MapInterface_Notify_SwitchedMap.Postfix, ReGrowthCore.Patch_Notify_SwitchedMap.Postfix | |
| MapNoiseUtility.AddDisplacementNoise: PRE: MapPreview.Patches.Patch_RimWorld_MapNoiseUtility.AddDisplacementNoise_Prefix | |
| MapParent.RecalculateHibernatableIncidentTargets: post: GeneticRim.GeneticRim_MapParent_RecalculateHibernatableIncidentTargets_Patch.AddEndParts | |
| MapParent.get_MapGeneratorDef: post: KCSG.Postfix_MapParent_MapGeneratorDef+MapParent_MapGeneratorDef_Patch.Postfix | |
| MapPawns.DeRegisterPawn: post: PsiTech.Utility.MapPawnDeregisterPatch.Postfix | |
| MapPawns.PlayerEjectablePodHolder: PRE: Vehicles.Patch_MapPawns.PlayerEjectableVehicles | |
| MapPawns.RegisterPawn: post: PsiTech.Utility.MapPawnRegisterPatch.Postfix | |
| MapPawns.get_AnyPawnBlockingMapRemoval: post: Vehicles.Patch_MapHandling.AnyVehicleBlockingMapRemoval | |
| MapPlantGrowthRateCalculator.BuildFor: TRANS: GeologicalLandforms.Patches.Patch_Verse_MapPlantGrowthRateCalculator.BuildFor_Transpiler | |
| MapPreviewGenerator.ConstructMinimalMapComponents: (no patches) | |
| MapPreviewToolbar.ButtonRerollMapUndo.OnAction: (no patches) | |
| MapSeedRerollWindow.PreOpen: (no patches) | |
| MapTemperature.SeasonAcceptableFor: post: VEF.AnimalBehaviours.VanillaExpandedFramework_MapTemperature_SeasonAcceptableFor_Patch.AllowAnimalSpawns, ErinsFluffyFauna.Megafauna_MapTemperature_SeasonAcceptableFor_Patch.AllowAnimalSpawns, AlphaBehavioursAndEvents.AlphaAnimals_MapTemperature_SeasonAcceptableFor_Patch.AllowAnimalSpawns | |
| MapTemperature.get_OutdoorTemp: PRE: Shashlichnik.MapTemperature_Patch+OutdoorTemperature_Patch.Prefix post: VanillaGravshipExpanded.VanillaGravshipExpanded_MapTemperature_OutdoorTemp_Patch.Postfix | |
| MapTemperature.get_SeasonalTemp: PRE: Shashlichnik.MapTemperature_Patch+SeasonalTemperature_Patch.Prefix | |
| MarriageCeremonyUtility.Married: post: VSIERationalTraitDevelopment.MarriageCeremonyUtility_Married_Patch.Postfix | |
| MassUtility.CanEverCarryAnything: PRE: Vehicles.Patch_CaravanHandling.CanCarryIfVehicle, Vehicles.Patch_CaravanHandling.CanCarryIfVehicle | |
| MassUtility.Capacity: PRE: Vehicles.Patch_CaravanHandling.CapacityOfVehicle post: AlphaMechs.AlphaMechs_MassUtility_Capacity_Patch.IncreaseCarrying, GeneticRim.GeneticRim_MassUtility_Capacity_Patch.MakeHybridsCarryMore TRANS: VEF.Pawns.VanillaExpandedFramework_MassUtility_Capacity_Patch.Transpiler | |
| MechClusterGenerator.GenerateClusterSketch: TRANS: VisibleRaidPoints.Patch_MechClusterGenerator_GenerateClusterSketch.Transpiler | |
| MechClusterGenerator.MechKindSuitableForCluster: post: VFEPirates.HarmonyPatches.MechKindSuitableForCluster_Patch.Postfix | |
| MechRepairUtility.RepairTick: post: AlphaGenes_MechRepairUtility_RepairTick_Patch.AddHediff | |
| MedicalCareUtility.MedicalCareSelectButton: PRE: [2147483647]VREAndroids.MedicalCareUtility_MedicalCareSelectButton_Patch.Prefix | |
| MedicalCareUtility.MedicalCareSetter: PRE: [2147483647]VREAndroids.MedicalCareUtility_MedicalCareSetter_Patch.Prefix | |
| MedicalRecipesUtility.<GetMedicalStatsFromRecipeDefs>d__6.MoveNext: (no patches) | |
| MedicalRecipesUtility.IsCleanAndDroppable: post: BigAndSmall.HealthPatches+IsCleanAndDroppable_Patch.Postfix | |
| MedicalRecipesUtility.SpawnThingsFromHediffs: PRE: [2147483647]VREAndroids.MedicalRecipesUtility_SpawnThingsFromHediffs_Patch.Prefix, GeneticRim.VanillaGeneticsExpanded_MedicalRecipesUtility_SpawnThingsFromHediffs_Prefix.AddQualityToImplant | |
| Medicine.GetMedicineCountToFullyHeal: PRE: ChooseYourMedicine.GetMedicineCountToFullyHeal_Prefix.Prefix | |
| MeditationFocusDef.EnablingThingsExplanation: post: VanillaRacesExpandedPhytokin.VanillaRacesExpandedPhytokin_MeditationFocusDef_EnablingThingsExplanation_Patch.Postfix, AlphaGenes.AlphaGenes_MeditationFocusDef_EnablingThingsExplanation_Patch.Postfix, VanillaPsycastsExpanded.MeditationFocusDef_EnablingThingsExplanation_Patch.Postfix | |
| MeditationFocusTypeAvailabilityCache.PawnCanUseInt: post: VanillaRacesExpandedPhytokin.VanillaRacesExpandedPhytokin_MeditationFocusTypeAvailabilityCache_PawnCanUse_Patch.Postfix, AlphaGenes.AlphaGenes_MeditationFocusTypeAvailabilityCache_PawnCanUse_Patch.Postfix, VanillaPsycastsExpanded.MeditationFocusTypeAvailabilityCache_PawnCanUse_Patch.Postfix, [-2147483648]VREAndroids.MeditationFocusTypeAvailabilityCache_PawnCanUseInt_Patch.Postfix | |
| MeditationUtility.<FocusObjectsForPawnHyperlinks>d__18.MoveNext: (no patches) | |
| MeditationUtility.CanMeditateNow: post: [-2147483648]VREAndroids.MeditationUtility_CanMeditateNow_Patch.Postfix | |
| MeditationUtility.FocusTypeAvailableExplanation: (no patches) | |
| MeditationUtility.SafeEnvironmentalConditions: post: Mashed_Ashlands.MeditationUtility_SafeEnvironmentalConditions_Patch.Mashed_Ashlands_SafeEnvironmentalConditions_Patch | |
| MemoryThoughtHandler.ExposeData: (no patches) | |
| MemoryThoughtHandler.TryGainMemory: PRE: BigAndSmall.DeathThoughtPatches.TryGainMemoryPrefix, SimsTraits.MemoryThoughtHandler_TryGainMemory_Patch.Prefix, VanillaTraitsExpanded.TryGainMemory_Patch.Prefix, BetterRomance.HarmonyPatches.MemoryThoughtHandler_TryGainMemory.Prefix, ReGrowthCore.MemoryThoughtHandler_TryGainMemory_Patch.Prefix post: VEF.Pawns.VanillaExpandedFramework_MemoryThoughtHandler_TryGainMemory_Patch.Postfix, VAspirE.SatisfactionPatches.CheckGeneral, SimsTraits.MemoryThoughtHandler_TryGainMemory_Patch.Postfix, VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_MemoryThoughtHandler_TryGainMemory_Patch.HandlePawnMemories, VanillaSocialInteractionsExpanded.TryGainMemory_Patch.Postfix, VanillaTraitsExpanded.TryGainMemory_Patch.Postfix, ReGrowthCore.MemoryThoughtHandler_TryGainMemory_Patch.Postfix TRANS: VFEEmpire.HarmonyPatches.Patch_ThoughtStacking.Transpiler | |
| MemoryThoughtHandler.TryGainMemory: PRE: SoftWarmBeds.MemoryThoughtHandler_TryGainMemory.Prefix post: MemoryThoughtHandler_TryGainMemory_Patch.Postfix | |
| MemoryThoughtHandler_TryGainMemory_Patch.Prefix: (no patches) | |
| MemoryUtility.ClearAllMapsAndWorld: PRE: SmashTools.GameEvent.RaiseOnWorldUnloading, DubsBadHygiene.Patches.HarmonyPatches+Harmony_ClearAllMapsAndWorld.Prefix, Bubbles.Access.Verse_Profile_MemoryUtility_ClearAllMapsAndWorld.Prefix, RimHUD.Access.Patch.Verse_Profile_MemoryUtility_ClearAllMapsAndWorld.Prefix, BunkBeds.MemoryUtility_ClearAllMapsAndWorld_Patch.Prefix, VanillaGravshipExpanded.MemoryUtility_ClearAllMapsAndWorld_Patch.Prefix, Worldbuilder.MemoryUtility_ClearAllMapsAndWorld_Patch.Prefix, ProgressionEducation.MemoryUtility_ClearAllMapsAndWorld_Patch.Prefix, AchtungMod.MemoryUtility_ClearAllMapsAndWorld_Patch.Prefix, DubsMintMenus.HarmonyPatches+Patch_ClearAllMapsAndWorld.Prefix, ToggleHarvest.Patch.Verse_Profile_MemoryUtility_ClearAllMapsAndWorld.Prefix post: SmashTools.GameEvent.RaiseOnWorldRemoved, ShowHair.HarmonyPatches.MemoryUtility_ClearAllMapsAndWorld_Patch.Postfix, GeologicalLandforms.Patches.Patch_Verse_MemoryUtility.ClearAllMapsAndWorld, MapPreview.Patches.Patch_Verse_MemoryUtility.ClearAllMapsAndWorld_Postfix | |
| MemoryUtility.UnloadUnusedUnityAssets: post: VEF.VanillaExpandedFramework_MemoryUtility_UnloadUnusedUnityAssets.Postfix, VREAndroids.MemoryUtility_UnloadUnusedUnityAssets_Patch.Postfix, VFETribals.MemoryUtility_UnloadUnusedUnityAssets_Patch.Postfix, VanillaVehiclesExpanded.MemoryUtility_UnloadUnusedUnityAssets_Patch.Postfix | |
| MemoryUtils.CreatePostExtractionHediff: (no patches) | |
| MentalBreakWorker.BreakCanOccur: PRE: Vehicles.Patch_HealthAndStats.VehiclesCantEnterMentalBreak, VanillaRacesExpandedHighmate.MentalBreakWorker_BreakCanOccur_Patch.Prefix post: VEF.Pawns.VanillaExpandedFramework_MentaBreakWorker_Patches.BreakCanOccur_PostFix, AlphaMemes.AlphaMemes_MentalBreakWorker_BreakCanOccur_Patch.DisableMostMentalBreaksIfPacifist, VanillaMemesExpanded.VanillaMemesExpanded_MentalBreakWorker_BreakCanOccur_Patch.DisableMostMentalBreaksIfPacifist | |
| MentalBreakWorker.CommonalityFor: post: VEF.Pawns.VanillaExpandedFramework_MentaBreakWorker_Patches.CommonalityFor_PostFix, VanillaRacesExpandedHighmate.MentalBreakWorker_CommonalityFor_Patch.Postfix | |
| MentalBreakWorker.TryStart: PRE: VFEMedieval.MentalBreakWorker_TryStart_Patch.Prefix, VREHussars.MentalWorker_Patches.Prefix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_MentalWorker_Patches.Prefix | |
| MentalBreakWorker_Catatonic.TryStart: PRE: VREHussars.MentalWorker_Patches.Prefix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_MentalWorker_Patches.Prefix post: VanillaSocialInteractionsExpanded.MentalBreakWorker_Catatonic_Patch.Postfix | |
| MentalBreakWorker_HumanityBreak.TryStart: PRE: VREHussars.MentalWorker_Patches.Prefix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_MentalWorker_Patches.Prefix | |
| MentalBreakWorker_MinorCatatonic.TryStart: PRE: VREHussars.MentalWorker_Patches.Prefix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_MentalWorker_Patches.Prefix | |
| MentalBreakWorker_RunWild.BreakCanOccur: PRE: [2147483647]VREAndroids.MentalBreakWorker_RunWild_BreakCanOccur_Patch.Prefix post: Mashed_Ashlands.MentalBreakWorker_RunWild_BreakCanOccur_Patch.Mashed_Ashlands_MentalBreakWorker_RunWild_Patch | |
| MentalBreakWorker_RunWild.TryStart: PRE: [2147483647]VREAndroids.MentalBreakWorker_RunWild_TryStart_Patch.Prefix, VREHussars.MentalWorker_Patches.Prefix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_MentalWorker_Patches.Prefix post: VanillaSocialInteractionsExpanded.MentalBreakWorker_RunWild_Patch.Postfix | |
| MentalBreakWorker_TinyCatatonic.TryStart: PRE: VREHussars.MentalWorker_Patches.Prefix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_MentalWorker_Patches.Prefix | |
| MentalBreakWorker_TryStart_Patch.Prefix: (no patches) | |
| MentalBreakWorker_WildDecree.TryStart: PRE: VREHussars.MentalWorker_Patches.Prefix, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_MentalWorker_Patches.Prefix | |
| MentalBreaker.get_BreakExtremeIsApproaching: post: [-2147483648]VREAndroids.MentalBreaker_BreakExtremeIsApproaching_Patch.Postfix | |
| MentalBreaker.get_BreakExtremeIsImminent: post: [-2147483648]VREAndroids.MentalBreaker_BreakExtremeIsImminent_Patch.Postfix | |
| MentalBreaker.get_BreakMajorIsImminent: post: [-2147483648]VREAndroids.MentalBreaker_BreakMajorIsImminent_Patch.Postfix | |
| MentalBreaker.get_BreakMinorIsImminent: post: [-2147483648]VREAndroids.MentalBreaker_BreakMinorIsImminent_Patch.Postfix | |
| MentalBreaker.get_BreakThresholdExtreme: PRE: [2147483647]PerformanceOptimizer.Optimization_MentalBreaker_BreakThresholdExtreme.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_MentalBreaker_BreakThresholdExtreme.Postfix | |
| MentalBreaker.get_CanDoRandomMentalBreaks: post: [-2147483648]VREAndroids.MentalBreaker_CanDoRandomMentalBreaks_Patch.Postfix | |
| MentalBreaker.get_CurrentPossibleMoodBreaks: PRE: DubsBreakMod.Harmony_CurrentPossibleMoodBreaks.Prefix | |
| MentalFitDef.CalculateMTBDays: post: SimsTraits.MentalFitDef_CalculateMTBDays_Patch.Postfix | |
| MentalState.RecoverFromState: PRE: SimsTraits.MentalState_RecoverFromState_Patch.Prefix, VanillaSocialInteractionsExpanded.RecoverFromState_Patch.Prefix post: SimsTraits.MentalState_RecoverFromState_Patch.Postfix | |
| MentalStateHandler.TryStartMentalState: PRE: [2147483647]VREAndroids.MentalStateHandler_TryStartMentalState_Patch.Prefix, Vehicles.Patch_PawnAi.EjectPawnForMentalState, VFEMedieval.MentalStateHandler_TryStartMentalState_Patch.Prefix, VREHussars.MentalStateHandler_TryStartMentalState_Patch.Prefix, VFEPirates.MentalStateHandler_TryStartMentalState_Patch.Prefix, VanillaRacesExpandedHighmate.MentalStateHandler_TryStartMentalState_Patch.Prefix, VanillaSocialInteractionsExpanded.TryStartMentalState_Patch.Prefix, VanillaTraitsExpanded.Patch_TryStartMentalState.Prefix post: RunAndGun.Harmony.MentalStateHandler_TryStartMentalState.Postfix, SimsTraits.MentalStateHandler_TryStartMentalState_Patch.Postfix, VanillaRacesExpandedFungoid.VanillaRacesExpandedFungoid_MentalStateHandler_TryStartMentalState_Patch.CauseCoalescentMentalBreaks, VanillaSocialInteractionsExpanded.TryStartMentalState_Patch.Postfix | |
| MentalStateHandler_TryStartMentalState_Patch.Prefix: (no patches) | |
| MentalStateWorker.StateCanOccur: PRE: Vehicles.Patch_HealthAndStats.VehiclesCantEnterMentalState | |
| MentalStateWorker_SlaveRebellion.StateCanOccur: post: SimsTraits.MentalStateWorker_SlaveRebellion_StateCanOccur_Patch.Postfix | |
| MentalState_InsultingSpreeAll.ChooseNextTarget: post: SimsTraits.MentalState_InsultingSpree_Patch.Postfix | |
| MentalState_Jailbreaker.Notify_InducedPrisonerToEscape: post: VanillaSocialInteractionsExpanded.Notify_InducedPrisonerToEscape_Patch.Postfix | |
| MentalState_Manhunter.ForceHostileTo: post: Vehicles.Patch_Misc.ManhunterDontAttackVehicles, VanillaQuestsExpandedAncients.MentalState_Manhunter_ForceHostileTo_Patch.Postfix | |
| MentalState_MurderousRage.TryFindNewTarget: post: SimsTraits.MentalState_MurderousRage_TryFindNewTarget_Patch.Postfix | |
| MentalState_SlaughterThing.Notify_SlaughteredTarget: post: VanillaSocialInteractionsExpanded.MentalState_SlaughterThing_Notify_SlaughteredTarget_Patch.Postfix | |
| MentalState_SocialFighting.PostEnd: post: VanillaSocialInteractionsExpanded.PostEnd_Patch.Postfix | |
| MentalState_SocialFighting.get_IsOtherPawnSocialFightingWithMe: post: VanillaSocialInteractionsExpanded.IsOtherPawnSocialFightingWithMe_Patch.Postfix | |
| MentalState_TantrumRandom.ChooseNextTarget: post: SimsTraits.MentalState_TantrumRandom_ChooseNextTarget_Patch.Postfix | |
| MentalState_TargetedInsultingSpree.TryFindNewTarget: post: SimsTraits.MentalState_InsultingSpree_Patch.Postfix | |
| MentalState_TargetedTantrum.TryFindNewTarget: post: VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_MentalState_TargetedTantrum_TryFindNewTarget_Patch.TargetARC | |
| MerchantGuild.GiveSoldThingToPlayer: PRE: VanillaTradingExpanded.GiveSoldThingToPlayer_Patch.Prefix | |
| MerchantGuild.GiveSoldThingToTrader: PRE: VanillaTradingExpanded.GiveSoldThingToTrader_Patch.Prefix | |
| Messages.Message: PRE: VREAndroids.Messages_Message_Patch.Prefix | |
| Messages.MessagesDoGUI: TRANS: UINotIncluded.MessagesDoGUIPatch.Transpiler | |
| MetalhorrorUtility.CanBeInfected: PRE: [2147483647]VREAndroids.MetalhorrorUtility_CanBeInfected_Patch.Prefix | |
| MetapodHediff.PostRemoved: (no patches) | |
| MineAIUtility.JobOnThing: PRE: ReGrowthCore.MineAIUtility_JobOnThing_Patch.Prefix | |
| MineAIUtility.PotentialMineables: post: ReGrowthCore.MineAIUtility_PotentialMineables_Patch.Postfix | |
| Mineable.DestroyMined: post: VanillaSocialInteractionsExpanded.DestroyMined_Patch.Postfix | |
| Mineable.ExposeData: post: ReGrowthCore.Mineable_ExposeData_Patch.Postfix | |
| Mineable.TrySpawnYield: post: AlphaBiomes.AlphaBiomes_Mineable_TrySpawnYield_Patch.ExtraYields, ReGrowthCore.Mineable_TrySpawnYield.Postfix TRANS: VanillaSocialInteractionsExpanded.MineableYield_Patch.Transpiler | |
| Minified.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| MinifiedThing.Destroy: PRE: DLWDFramework.Patch_MinifiedThing_Destroy.Prefix | |
| MinifiedThing.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| MinifiedTree.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| MinifyUtility.MakeMinified: TRANS: AdaptiveStorage.HarmonyPatches.EnablePackingOnMinify.Transpiler | |
| MinifyUtility.Uninstall: PRE: VanillaQuestsExpandedAncients.MinifyUtility_Uninstall_Patch.Prefix | |
| ModBase.ApplyHarmonyPatches: TRANS: Analyzer.Profiling.RememberHarmonyIDs.Transpiler | |
| ModContentLoader`1.LoadTexture: PRE: GraphicSetter.Patches.TextureLoadingPatch+LoadTexture_Patch.Prefix | |
| ModContentPack.AnyContentLoaded: post: Worldbuilder.ModContentPack_AnyContentLoaded_Patch.Postfix | |
| ModContentPack.LoadPatches: post: ModSettingsFramework.ModContentPack_LoadPatches_Patch.Postfix | |
| ModDependency.get_IsSatisfied: post: Prepatcher.HarmonyPatches.IsSatisfiedPostfix | |
| ModLister.RebuildModList: PRE: Prepatcher.HarmonyPatches.ProfilingPrefix post: Prepatcher.HarmonyPatches.ProfilingPostfix, Brrainz.CrossPromotion.ModLister_RebuildModList_Postfix | |
| ModMetaData.Init: PRE: Prepatcher.HarmonyPatches.ProfilingPrefix post: Prepatcher.HarmonyPatches.ProfilingPostfix | |
| ModMetaData.ModMetaDataInternal.InitVersionedData: post: Prepatcher.HarmonyPatches.InitVersionedDataPostfix | |
| ModsConfig.RestartFromChangedMods: PRE: HugsLib.Patches.ModsConfig_RestartFromChangedMods_Patch.QuickRestartInDevMode | |
| ModsConfig.TrySortMods: (no patches) | |
| MoodCache.DoIllness: (no patches) | |
| MoodThresholdExtensions.CurrentMoodThresholdFor: PRE: [2147483647]PerformanceOptimizer.Optimization_MoodThresholdExtensions_CurrentMoodThresholdFor.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_MoodThresholdExtensions_CurrentMoodThresholdFor.Postfix | |
| MoteMaker.MakeMoodThoughtBubble: PRE: [2147483647]VREAndroids.MoteMaker_MakeMoodThoughtBubble_Patch.Prefix | |
| MoteSpotLight.ApplyHediffToParts: (no patches) | |
| MouseoverReadout.MouseoverReadoutOnGUI: PRE: UINotIncluded.MouseoverReadoutPatches.Prefix post: DubsBadHygiene.Patches.HarmonyPatches_Fertilizer+H_MouseoverReadoutOnGUI.Postfix, UINotIncluded.MouseoverReadoutPatches.Postfix, ReGrowthCore.MouseoverReadout_MouseoverReadoutOnGUI_Patch.Postfix TRANS: DubsBadHygiene.Patches.HarmonyPatches_Fertilizer+H_MouseoverReadoutOnGUI.Transpiler, VEE.MouseoverReadout_Patch.Transpiler, VanillaQuestsExpandedCryptoforge.MouseoverReadout_MouseoverReadoutOnGUI_Patch.Transpiler, ReGrowthCore.MouseoverReadout_MouseoverReadoutOnGUI_Patch.Transpiler, VanillaPlantsExpandedMushrooms.MouseoverReadout_MouseoverReadoutOnGUI_Patch.Transpiler | |
| MoveColonyUtility.MoveColonyAndReset: (no patches) | |
| MultipleLives_Component.GameComponentTick: (no patches) | |
| MultipleLives_Component.Initialize: (no patches) | |
| MultipleLives_Component.RecordPawnData: (no patches) | |
| MultipleLives_Component.ResurrectPawn: (no patches) | |
| MutantUtility.CanResurrectAsShambler: PRE: [2147483647]VREAndroids.MutantUtility_CanResurrectAsShambler_Patch.Prefix | |
| MutantUtility.ResurrectAsShambler: PRE: VanillaQuestsExpandedDeadlife.MutantUtility_ResurrectAsShambler_Patch.Prefix post: VanillaQuestsExpandedDeadlife.MutantUtility_ResurrectAsShambler_Patch.Postfix | |
| MutantUtility.SetPawnAsMutantInstantly: post: VEF.Genes.VanillaExpandedFramework_MutantUtility_SetPawnAsMutantInstantly_Patch.ActivateGhoulGenes | |
| MuzzleFlashUtility.SpawnMuzzleFlash: (no patches) | |
| NameUseChecker.XenotypeNameIsUsed: PRE: XenotypeSpawnControl.HarmonyPatches.XenotypeNameIsUsed.Prefix | |
| Need.get_IsFrozen: post: SimsTraits.Need_IsFrozen_Patch.Postfix | |
| Need.get_ShowOnNeedList: PRE: [2147483647]VREAndroids.Need_ShowOnNeedList_Patch.Prefix | |
| Need_Beauty.CurrentInstantBeauty: PRE: [2147483647]PerformanceOptimizer.Optimization_Need_Beauty_CurrentInstantBeauty.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_Need_Beauty_CurrentInstantBeauty.Postfix | |
| Need_Beauty.get_CurCategory: PRE: VanillaTraitsExpanded.CurCategory_Patch.Prefix | |
| Need_Deathrest.NeedInterval: post: EBSGFramework.HarmonyPatches.DeathrestNeedIntervalPostfix | |
| Need_Food.FoodFallPerTickAssumingCategory: PRE: BigAndSmall.Need_Food_FoodFallPerTickAssumingCategory.Prefix post: BigAndSmall.Need_Food_FoodFallPerTickAssumingCategory.Postfix, EBSGFramework.HarmonyPatches.FoodFallRatePostfix | |
| Need_Food.get_IsFrozen: post: EBSGFramework.HarmonyPatches.NeedFrozenPostfix | |
| Need_Food.get_MaxLevel: post: VEF.Genes.VanillaExpandedFramework_Patch_FoodCapacity.FoodCapacity_Postfix | |
| Need_Indoors.NeedInterval: post: EBSGFramework.HarmonyPatches.IndoorsIntervalPostfix | |
| Need_Joy.GainJoy: PRE: EBSGFramework.HarmonyPatches.GainJoyPrefix, VanillaSocialInteractionsExpanded.GainJoy_Patch.Prefix post: SimsTraits.Need_Joy_GainJoy_Patch.Postfix | |
| Need_Joy.get_FallPerInterval: post: VanillaTraitsExpanded.FallPerInterval_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_Need_Joy_FallPerInterval_Patch.ModifyFallIntervalForPartyHost | |
| Need_KillThirst.NeedInterval: post: EBSGFramework.HarmonyPatches.KillThirstPostfix | |
| Need_Learning.get_IsFrozen: post: EBSGFramework.HarmonyPatches.NeedFrozenPostfix | |
| Need_Lovin.get_IsFrozen: TRANS: BetterRomance.HarmonyPatches.VREPatches.Need_LovinMinAgeTranspiler | |
| Need_Lovin.get_ShowOnNeedList: TRANS: BetterRomance.HarmonyPatches.VREPatches.Need_LovinMinAgeTranspiler | |
| Need_Outdoors.NeedInterval: post: EBSGFramework.HarmonyPatches.OutdoorsIntervalPostfix TRANS: Dubs_Skylight.Patch_NeedInterval.Transpiler, ReBuildDoorsAndCorners.Need_Outdoors_NeedInterval_Patch.Transpiler | |
| Need_Outdoors_NeedInterval_Patch.TryOverrideNeed: (no patches) | |
| Need_Rest.TickResting: PRE: SoftWarmBeds.Need_Rest_TickResting.Prefix | |
| Need_Seeker.NeedInterval: post: EBSGFramework.HarmonyPatches.SeekerNeedMultiplier | |
| NeedsCardUtility.DoMoodAndThoughts: PRE: [2147483647]VREAndroids.NeedsCardUtility_DoMoodAndThoughts_Patch.Prefix | |
| NegativeInteractionUtility.NegativeInteractionChanceFactor: post: BigAndSmall.NegativeInteractionChanceFactor_Patch.Postfix, VanillaRacesExpandedHighmate.NegativeInteractionUtility_NegativeInteractionChanceFactor_Patch.Postfix | |
| NotifyPawnDiedPatch.Postfix: (no patches) | |
| NotifyResurrectedPatch.Postfix: (no patches) | |
| Object.Finalize: TRANS: FixesForSBZFridge.CommsConsoleWorksWithoutTradeBeaconIfFridgeExists.FridgesAllowCommsToBeInitiated_Transpiler | |
| Object.Finalize: TRANS: FixesForSBZFridge.CommsConsoleWorksWithoutTradeBeaconIfFridgeExists.FridgesAllowCommsToBeInitiated_Transpiler | |
| ObserveSurroundingThings_Patch.Postfix: (no patches) | |
| OptionListingUtility.DrawOptionListing: PRE: XenotypeAndIdeologyButtonsTitleScreen.MainPatches+OptionListingUtility_Patch.Prefix, ProgressRenderer.MenuOption.Prefix | |
| Outpost.OutpostHealthTickInterval: (no patches) | |
| OverlayDrawHandler.get_ShouldDrawPowerGrid: PRE: ProgressRenderer.Harmony_OverlayDrawHandler_ShouldDrawPowerGrid.Prefix | |
| OverlayDrawer.DisposeHandle: post: VEF.Graphics.OverlayDrawer_DisposeHandle_Patch.Postfix | |
| OverlayDrawer.DrawAllOverlays: PRE: ProgressRenderer.Harmony_OverlayDrawer_DrawAllOverlays.Prefix TRANS: VEF.Graphics.OverlayDrawer_DrawAllOverlays_Patch.Transpiler | |
| OverlayDrawer.RenderForbiddenOverlay: PRE: [600]AdaptiveStorage.HarmonyPatches.HideStoredThingsFromSectionLayerAndOverlayDrawer.Prefix | |
| OverlayDrawer.RenderOutOfFuelOverlay: PRE: Vehicles.Patch_Rendering.RenderVehicleOutOfFuelOverlay | |
| Page.DoBack: post: LunarFramework.Internal.Patches.Patch_RimWorld_Page.DoBack_Postfix | |
| Page.DoBottomButtons: post: ChooseBiomeCommonality.Page_DoBottomButtons.Postfix | |
| Page.DrawPageTitle: PRE: FactionCustomizer.PlanetGUIPatch.DrawPageTitlePrefix | |
| PageUtility.StitchedPages: PRE: ProgressionStorytellers.PageUtility_StitchedPages_Patch.Prefix, Mashed_Ashlands.CreateWorldParams_DoWindowContents_Patch.Prefix | |
| Page_ChooseIdeoPreset.DoNext: PRE: VFETribals.Page_ChooseIdeoPreset_DoNext_Patch.Prefix | |
| Page_ChooseIdeoPreset.PostOpen: post: VFETribals.Page_ChooseIdeoPreset_PostOpen_Patch.Postfix | |
| Page_ConfigureIdeo.CanDoNext: PRE: VFETribals.Page_ConfigureIdeo_CanDoNext_Patch.Prefix | |
| Page_ConfigureIdeo.DoWindowContents: post: VFETribals.Page_ConfigureIdeo_DoWindowContents_Patch.Postfix | |
| Page_ConfigureIdeo.SelectOrMakeNewIdeo: PRE: VFETribals.Page_ConfigureIdeo_SelectOrMakeNewIdeo_Patch.Prefix | |
| Page_ConfigureIdeo.get_PageTitle: PRE: VFETribals.Page_ConfigureIdeo_PageTitle_Patch.Prefix | |
| Page_ConfigureStartingPawns.DoWindowContents: (no patches) | |
| Page_ConfigureStartingPawns.DrawXenotypeEditorButton: PRE: PawnEditor.PawnEditorMod.AddEditorButton TRANS: VREAndroids.Page_ConfigureStartingPawns_DrawXenotypeEditorButton_Patch.Transpiler | |
| Page_ConfigureStartingPawns.PreOpen: PRE: PawnEditor.PawnEditorMod.Notify_ConfigurePawns post: KCSG.Postfix_Page_ConfigureStartingPawns_PreOpen.Postfix | |
| Page_CreateWorldParams.DoWindowContents: post: Worldbuilder.Page_CreateWorldParams_DoWindowContents_Patch.Postfix TRANS: VFEInsectoids.Page_CreateWorldParams_DoWindowContents_Patch.Transpiler, [200]GeologicalLandforms.Patches.Patch_RimWorld_Page_CreateWorldParams.DoWindowContents_Transpiler | |
| Page_CreateWorldParams.Reset: post: Worldbuilder.Page_CreateWorldParams_Reset_Patch.Postfix, GeologicalLandforms.Patches.Patch_RimWorld_Page_CreateWorldParams.Reset | |
| Page_ModsConfig.DoModInfo: PRE: Brrainz.CrossPromotion.Page_ModsConfig_DoModInfo_Prefix TRANS: ModSettingsFramework.Page_ModsConfig_DoModInfo_Transpiler.Transpiler | |
| Page_SelectScenario.PreOpen: PRE: PawnEditor.StartingThingsManager.RestoreScenario | |
| Page_SelectStartingSite.DoCustomBottomButtons: PRE: FactionCustomizer.PlanetGUIPatch.DoCustomBottomButtonsPrefix | |
| Page_SelectStartingSite.PreOpen: post: MapPreview.Patches.Patch_RimWorld_Page_SelectStartingSite.PreOpen_Postfix | |
| Page_SelectStoryteller.CanDoNext: post: VFEPirates.Page_SelectStoryteller_CanDoNext_Patch.ChangeNext | |
| Page_SelectStoryteller.PreOpen: TRANS: ProgressionStorytellers.StorytellerUI_DrawStorytellerSelectionInterface_Patch.Transpiler | |
| Page_SelectStorytellerInGame.PreClose: post: VFEPirates.Page_SelectStorytellerInGame_PreClose_Patch.OpenCurses | |
| PassingShip.<>c__DisplayClass23_0.<CommFloatMenuOption>b__0: TRANS: FixesForSBZFridge.CommsConsoleWorksWithoutTradeBeaconIfFridgeExists.FridgesAllowCommsToBeInitiated_Transpiler | |
| PassingShip.<>c__DisplayClass23_0.<CommFloatMenuOption>b__1: TRANS: FixesForSBZFridge.CommsConsoleWorksWithoutTradeBeaconIfFridgeExists.FridgesAllowCommsToBeInitiated_Transpiler | |
| PatchOperation.Apply: PRE: XmlExtensions.PatchOperation_Patch.Prefix, VisualXMLPatches.PatchOperation_Apply.Prefix | |
| PatchOperationAdd.ApplyWorker: (no patches) | |
| PatchOperationAddModExtension.ApplyWorker: (no patches) | |
| PatchOperationAttributeAdd.ApplyWorker: (no patches) | |
| PatchOperationAttributeRemove.ApplyWorker: (no patches) | |
| PatchOperationAttributeSet.ApplyWorker: (no patches) | |
| PatchOperationConditional.ApplyWorker: (no patches) | |
| PatchOperationFindMod.ApplyWorker: (no patches) | |
| PatchOperationInsert.ApplyWorker: (no patches) | |
| PatchOperationRemove.ApplyWorker: (no patches) | |
| PatchOperationReplace.ApplyWorker: (no patches) | |
| PatchOperationSequence.ApplyWorker: (no patches) | |
| PatchOperationSetName.ApplyWorker: (no patches) | |
| PatchSet_Hediffs.PostRemoved_Prefix: (no patches) | |
| Patch_AddPawn.Postfix: (no patches) | |
| Patch_ApplyDamageToPart.GetAlcoholHediff: (no patches) | |
| Patch_Construction.CompleteConstructionVehicle: PRE: VanillaVehiclesExpanded.PatchConstruction_CompleteConstructionVehicle_Patch.Prefix | |
| Patch_Debug.DebugGroundAllAerialVehicles: (no patches) | |
| Patch_DefOfHelper_RebindAllDefOfs.ShouldTurretBeHackable: (no patches) | |
| Patch_DrugPolicy.VanillaExpandedFramework_DrugPolicy_ExposeData_Patch.<>c.<Prefix>b__0_0: (no patches) | |
| Patch_DrugPolicy.VanillaExpandedFramework_DrugPolicy_ExposeData_Patch.<>c.<Prefix>b__0_1: (no patches) | |
| Patch_FormCaravanDialog.<>c__DisplayClass37_0.<TryFormCaravanInstantly>b__0: (no patches) | |
| Patch_FormCaravanDialog.DaysOfWorthOfFoodWithVehicles: (no patches) | |
| Patch_FormCaravanDialog.TicksToArriveWithVehicles: (no patches) | |
| Patch_FormCaravanDialog.WorldRoutePannerReroute: (no patches) | |
| Patch_GameConditionManager_RegisterCondition.Postfix: (no patches) | |
| Patch_HealthCardUtility.GenerateListing: PRE: VREAndroids.DubsMintMenus_Patch_HealthCardUtility_GenerateListing_Patch.Prefix | |
| Patch_Lords.MakeNewLord_Postfix: (no patches) | |
| Patch_Lords.RemoveLord_Prefix: (no patches) | |
| Patch_MapPawns.AllAerialVehicles_AliveOrDead: (no patches) | |
| Patch_Rendering.RecacheAerialVehicleEntries: (no patches) | |
| Patch_SectionLayer_LightingOverlay_Regenerate.Postfix: (no patches) | |
| Patch_SectionLayer_LightingOverlay_Regenerate.Prefix: (no patches) | |
| Patch_Stat.postfix: (no patches) | |
| Patch_WorldHandling.AddVehicleObjectToCache: (no patches) | |
| Patch_WorldHandling.GameEnderWithVehicles: (no patches) | |
| Patch_WorldHandling.RecacheVehicleObjectCache: (no patches) | |
| Patch_WorldHandling.RemoveVehicleObjectToCache: (no patches) | |
| Patch_WorldPathing.VehicleRoutePlannerButton: (no patches) | |
| Patcher.AreaTarget: (no patches) | |
| Patcher.Connect: (no patches) | |
| PathFinder.CreateRequest: PRE: VEF.Hediffs.PhasingPatches.CreateRequest_Prefix | |
| PathGrid.CalculatedCostAt: post: VFESecurity.PathGrid_CalculatedCostAt_Patch.Postfix TRANS: VanillaRacesExpandedInsector.PathGrid_CalculatedCostAt_Patch.Transpiler | |
| PathGridDoorsBlockedJob.Execute: post: FixesForSBZFridge.IncreasePathCostThroughPrison.Postfix | |
| Pathing.RecalculatePerceivedPathCostAt: post: Vehicles.Patch_VehiclePathing.RecalculatePerceivedPathCostForVehicle | |
| Pawn.<GetDisabledWorkTypes>g__FillList|373_0: PRE: VEF.Apparels.VanillaExpandedFramework_Pawn_GetDisabledWorkTypes_Patch.Prefix post: VFETribals.Pawn_GetDisabledWorkTypes_FillList_Patch.Postfix TRANS: VFEEmpire.HarmonyPatches.Patch_Conceit+Work.Transpiler | |
| Pawn.<GetGizmos>d__344.MoveNext: TRANS: BetterRomance.HarmonyPatches.Pawn_GetGizmos.Transpiler | |
| Pawn.AnythingToStrip: PRE: VFEPirates.Pawn_AnythingToStrip_Patch.Prefix | |
| Pawn.ButcherProducts: post: VEF.Genes.VanillaExpandedFramework_Pawn_ButcherProducts_Patch.Postfix, AnimalsLogic.TastesLikeChicken+Pawn_ButcherProducts_Patch.Postfix, VREAndroids.Pawn_ButcherProducts_Patch.Postfix, VFEPirates.Pawn_ButcherProducts_Patch.Postfix, BigAndSmall.ButcheringHarmonyPatches.ButcherProductsPostfix, EBSGFramework.HarmonyPatches.ButcherProductsPostfix | |
| Pawn.CheckAcceptArrest: post: VEF.Planet.HireableSystemStaticInitialization.CheckAcceptArrestPostfix | |
| Pawn.CheckForDisturbedSleep: PRE: VanillaPlantsExpandedMushrooms.VanillaPlantsExpandedMushrooms_Pawn_CheckForDisturbedSleep_Patch.NullifyDisturbedSleepThought TRANS: ReSpliceCharmweavers.Pawn_CheckForDisturbedSleep_Patch.Transpiler | |
| Pawn.DeSpawn: PRE: ImprovedWorkbenches.Detours.Pawn_DeSpawn_Detour.Prefix, VCR.Pawn_DeSpawn_Patch.Prefix, MVCF.PatchSets.PatchSet_IndependentVerbs.Postfix_Pawn_DeSpawn post: ShowHair.HarmonyPatches.Pawn_Removed_Patch.Postfix, VEF.Hediffs.ShieldsSystem.OnPawnDespawn, VEF.Hediffs.PhasingPatches.Despawn_Postfix, AchtungMod.Pawn_DeSpawn_Patch.Postfix, VanillaPsycastsExpanded.Pawn_Spawn_Patches.PawnPostDeSpawned, VanillaRacesExpandedHighmate.Pawn_Despawn_Patch.Postfix | |
| Pawn.Destroy: PRE: VFEInsectoids.Pawn_Destroy_Patch.Prefix, VanillaSocialInteractionsExpanded.Destroy_Patch.Prefix, VanillaTraitsExpanded.Destroy_Patch.Prefix post: ShowHair.HarmonyPatches.Pawn_Removed_Patch.Postfix, ReSpliceCharmweavers.Pawn_Destroy_Patch.Postfix TRANS: Vehicles.Patch_Construction.ValidDestroyModeForVehicles | |
| Pawn.Discard: post: VFEEmpire.HarmonyPatches.Patch_HonorsMisc.Discard_Postfix | |
| Pawn.DoKillSideEffects: post: EBSGFramework.HarmonyPatches.DoKillSideEffectsPostfix | |
| Pawn.DrawAt: post: VEF.Hediffs.ShieldsSystem.PawnPostDrawAt | |
| Pawn.ExitMap: PRE: VAEInsanity.Pawn_ExitMap_Patch.Prefix post: VanillaTraitsExpanded.ExitMap_Patch.Postfix | |
| Pawn.ExposeData: post: ReSpliceCore.Pawn_ExposeData_Patch.Postfix, VFEEmpire.HarmonyPatches.Patch_HonorsMisc.ExposeData_Postfix, ProgressionEducation.Pawn_ExposeData_Patch.Postfix, SimsTraits.Pawn_ExposeData_Patch.Postfix, VanillaVehiclesExpanded.Pawn_ExposeData_Patch.Postfix, MVCF.PatchSets.PatchSet_Base.PostExposeDataPawn | |
| Pawn.GetDisabledWorkTypes: PRE: SimsTraits.Titles_Patch.Prefix post: VFEPirates.Pawn_GetDisabledWorkTypes_Patch.Postfix, SimsTraits.Titles_Patch.Postfix, [0]Brrainz.DynamicWorkTypes.Pawn_GetDisabledWorkTypes_Postfix | |
| Pawn.GetGizmos: post: AllowTool.Patches.Pawn_GetGizmos_Patch.InsertPartyHuntGizmo, VEF.Weapons.VanillaExpandedFramework_Pawn_GetGizmos_Lasers_Patch.GetGizmos_PostFix, VEF.AnimalBehaviours.Pawn_GetGizmos_Patch.Postfix, RunAndGun.Harmony.Pawn_DraftController_GetGizmos_Patch.Postfix, PeteTimesSix.SimpleSidearms.Intercepts.Pawn_GetGizmos_Postfix.Postfix, VFEEmpire.HarmonyPatches.Patch_HonorsMisc.GetGizmos_Postfix, Worldbuilder.Pawn_GetGizmos_Patch.Postfix, PawnEditor.PawnEditorMod.AddEditButton, SaveStorageSettings.Patch_Pawn_GetGizmos.Postfix, PsiTech.Utility.PawnGizmosPatch.Postfix, VanillaAnimalsExpandedEndangered.Pawn_GetGizmos_Patch.Postfix, BetterRomance.HarmonyPatches.Pawn_GetGizmos.Postfix, MVCF.PatchSets.PatchSet_Animals.Pawn_GetGizmos_Postfix | |
| Pawn.GetInspectString: post: VanillaGravshipExpanded.Pawn_GetInspectString_Patch.Postfix, VFEPirates.Pawn_GetInspectString_Patch.Postfix, AchtungMod.Pawn_GetInspectString_Patch.Postfix, VanillaQuestsExpandedDeadlife.Pawn_GetInspectString_Patch.Postfix | |
| Pawn.GetReasonsForDisabledWorkType: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix, VFETribals.Pawn_GetReasonsForDisabledWorkType_Patch.Postfix TRANS: VFEEmpire.HarmonyPatches.Patch_Conceit+Work.Transpiler | |
| Pawn.GiveSoldThingToPlayer: PRE: VanillaTradingExpanded.GiveSoldThingToPlayer_Patch.Prefix | |
| Pawn.GiveSoldThingToTrader: PRE: VanillaTradingExpanded.GiveSoldThingToTrader_Patch.Prefix | |
| Pawn.HearClamor: PRE: VFETribals.Pawn_HearClamor_Patch.Prefix | |
| Pawn.Kill: PRE: VEF.Storyteller.VanillaExpandedFramework_Pawn_Kill_Patch.Prefix, Vehicles.Patch_Misc.MoveOnDeath, VEF.Apparels.VanillaExpandedFramework_Pawn_Kill_Patch.Prefix, BloodAnimations.Pawn_Kill.Kill, USH_GE.Patch_Pawn_Kill.Prefix, BigAndSmall.NotifyEvents.PawnKillPrefix, VAE_Accessories.HarmonyPatches.BeltsOnDeath, VFE_Settlers.Utilities.Harmony+PawnKill_Patch.PreFix, VanillaPsycastsExpanded.Pawn_Kill_Patch.Prefix, VanillaPsycastsExpanded.Skipmaster.SkipdoorPatches.Pawn_Kill_Prefix, VanillaSocialInteractionsExpanded.Pawn_Kill_Patch.Prefix post: AllowTool.Patches.Pawn_Kill_Patch.UnforbidDraftedHuntBody, VEF.Pawns.VanillaExpandedFramework_Pawn_Kill.Postfix, VEF.Apparels.VanillaExpandedFramework_Pawn_Kill_Patch.Postfix, VFEEmpire.HarmonyPatches.ColonistTitleCache+OnPawn.Postfix, VFED.HarmonyPatches.MiscPatches.ExplodePackOnDeath, AlphaGenes.AlphaGenes_Pawn_Kill_Patch.RemovePocketPlanes, BigAndSmall.OnKillPatch.OnKillPostfix, ProgressionEducation.Pawn_Kill_Patch.Postfix, PsiTech.Utility.NotifyPawnDiedPatch.Postfix, VAEInsanity.Pawn_Kill_Patch.Postfix, VFEC.Senators.WorldComponent_Senators.Notify_PawnDied, VanillaPsycastsExpanded.Pawn_Kill_Patch.Postfix, ReSpliceCharmweavers.Pawn_Kill_Patch.Postfix TRANS: AnimalsLogic.NoToxicRot.KillPatch | |
| Pawn.MakeCorpse: post: BigAndSmall.MakeCorpse_Patch.Postfix | |
| Pawn.Notify_BillDeleted: post: ReSpliceCore.Pawn_Notify_BillDeleted_Patch.Postfix | |
| Pawn.Notify_DisabledWorkTypesChanged: PRE: [800]Brrainz.DynamicWorkTypes.Pawn_Notify_DisabledWorkTypesChanged_Prefix | |
| Pawn.Notify_UsedVerb: post: VAEInsanity.Pawn_Notify_UsedVerb_Patch.Postfix | |
| Pawn.PostMapInit: post: VEF.Genes.VanillaExpandedFramework_Pawn_PostMapInit_Patch.Postfix, BigAndSmall.Pawn_PostMapInit.Postfix | |
| Pawn.PreApplyDamage: PRE: PsiTech.Utility.PawnPreApplyDamagePatch.Prefix post: VREHussars.Pawn_PreApplyDamage_Patch.Postfix | |
| Pawn.PreTraded: post: Vehicles.Patch_CaravanHandling.RemoveSoldPawnFromVehicle | |
| Pawn.ProcessPostTickVisuals: PRE: Vehicles.Patch_Rendering.ProcessVehiclePostTickVisuals | |
| Pawn.SetFaction: PRE: VanillaSocialInteractionsExpanded.SetFaction_Patch.Prefix post: VFEEmpire.HarmonyPatches.ColonistTitleCache+OnPawn.Postfix | |
| Pawn.SpawnSetup: post: VEF.Apparels.CompShieldField+SpawnSetup_Patch.Postfix, ImprovedWorkbenches.Detours.Pawn_SpawnSetup_Detour.Postfix, VEF.Hediffs.ShieldsSystem.OnPawnSpawn, BigAndSmall.Pawn_SpawnSetup.Postfix, VEF.Hediffs.PhasingPatches.CheckPhasing, VCR.Pawn_SpawnSetup_Patch.Postfix, VanillaPsycastsExpanded.Pawn_Spawn_Patches.PawnPostSpawned, VanillaRacesExpandedHighmate.Pawn_SpawnSetup_Patch.Postfix, VanillaSocialInteractionsExpanded.SpawnSetup_Patch.Postfix, VanillaTraitsExpanded.SpawnSetup_Patch.Postfix, MVCF.PatchSets.PatchSet_IndependentVerbs.Postfix_Pawn_SpawnSetup | |
| Pawn.SpecialDisplayStats: post: VREAndroids.Pawn_SpecialDisplayStats_Patch.Postfix, VREArchon.Pawn_SpecialDisplayStats_Patch.Postfix | |
| Pawn.Strip: PRE: VFEPirates.Pawn_Strip_Patch.Prefix | |
| Pawn.ThreatDisabled: post: Vehicles.Patch_PawnAi.VehicleThreatDisabled | |
| Pawn.ThreatDisabledBecauseNonAggressiveRoamer: post: VanillaRacesExpandedInsector.Pawn_ThreatDisabledBecauseNonAggressiveRoamer_Patch.Postfix | |
| Pawn.TickRare: post: SirRandoo.MSF.Patches.PawnTickRare.Postfix, VanillaGravshipExpanded.Pawn_TickRare_Patch.Postfix, VFE_Settlers.Utilities.Harmony+PawnTickRare_Patch.PostFix | |
| Pawn.TicksPerMove: PRE: Vehicles.Patch_HealthAndStats.VehicleMoveSpeed post: RunAndGun.Harmony.Pawn_TicksPerMove.Postfix | |
| Pawn.TryGetAttackVerb: PRE: MVCF.PatchSets.PatchSet_MultiVerb.TryGetAttackVerb_Prefix post: VEF.Abilities.VanillaExpandedFramework_Pawn_TryGetAttackVerb_Patch.Postfix, MVCF.PatchSets.PatchSet_MultiVerb.TryGetAttackVerb_Postfix | |
| Pawn.WorkTypeIsDisabled: post: VEF.AnimalBehaviours.VanillaExpandedFramework_Pawn_WorkTypeIsDisabled_Patch.RemoveTendFromAnimals | |
| Pawn.get_BodySize: post: VEF.Genes.VanillaExpandedFramework_Pawn_BodySize.Postfix, BigAndSmall.Pawn_BodySize.Postfix, GeneticRim.Patch_BodySize.Postfix | |
| Pawn.get_CanTakeOrder: post: Vehicles.Patch_Components.CanVehicleTakeOrder, VEF.AnimalBehaviours.VanillaExpandedFramework_Pawn_CanTakeOrder_Patch.MakePawnControllable | |
| Pawn.get_CombinedDisabledWorkTags: post: VFEEmpire.HarmonyPatches.Patch_HonorsMisc.Postfix_Disabled, VFETribals.Pawn_CombinedDisabledWorkTags_Patch.Postfix TRANS: VFEEmpire.HarmonyPatches.Patch_Conceit+Work.Transpiler | |
| Pawn.get_CurrentEffectiveVerb: PRE: MVCF.PatchSets.PatchSet_TargetFinder.CurrentEffectiveVerb_Prefix | |
| Pawn.get_DescriptionFlavor: PRE: [2147483647]VREAndroids.Pawn_DescriptionFlavor_Patch.Prefix post: Worldbuilder.Pawn_LabelDescription_Patch.DescriptionFlavor_Postfix | |
| Pawn.get_DrawPos: PRE: [2147483647]PerformanceOptimizer.Optimization_Pawn_DrawPos.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_Pawn_DrawPos.Postfix | |
| Pawn.get_HealthScale: post: VEF.Genes.VanillaExpandedFramework_Pawn_HealthScale.HealthScale_Postfix, BigAndSmall.Pawn_HealthScale.Postfix, VSEWW.Pawn_HealthScale.Postfix, GeneticRim.Patch_HealthScale.Postfix | |
| Pawn.get_IsColonistPlayerControlled: post: VEF.AnimalBehaviours.VanillaExpandedFramework_Pawn_IsColonistPlayerControlled_Patch.AddAnimalAsColonist | |
| Pawn.get_LabelNoCount: post: Worldbuilder.Pawn_LabelDescription_Patch.LabelNoCount_Postfix, GeneticRim.Patch_PawnLabel.Postfix, TooManyMods.TMM_VGE_HybridQuality_CapitalizationFix.Postfix | |
| Pawn.get_UpdateRateTicks: post: SlowerPawnTickRate.UpdateRateTicks_AllPawnsPatch.Postfix | |
| Pawn.set_Name: PRE: VFEEmpire.HarmonyPatches.Patch_HonorsMisc.Set_Name_Prefix | |
| PawnAddictionHediffsGenerator.<>c.<GenerateAddictionsAndTolerancesFor>b__4_0: (no patches) | |
| PawnAddictionHediffsGenerator.<>c__DisplayClass6_0.<PossibleWithTechLevel>b__0: (no patches) | |
| PawnAddictionHediffsGenerator.DoIngestionOutcomeDoers: (no patches) | |
| PawnApparelGenerator.GenerateStartingApparelFor: post: VEF.Apparels.Patch_PawnApparelGenerator.GenerateStartingApparelFor_Postfix, TooManyMods.TMM_GenerateStartingApparelFor_Postfix.Postfix | |
| PawnApparelGenerator.IsHeadgear: post: VCR.PawnApparelGenerator_IsHeadgear_Patch.Postfix | |
| PawnApparelGenerator.PossibleApparelSet.CoatButNoShirt: TRANS: VEF.Apparels.Patch_PawnApparelGenerator+PossibleApparelSet+manual_CoatButNoShirt.Transpiler | |
| PawnAttackGizmoUtility.AtLeastTwoSelectedPlayerPawnsHaveDifferentWeapons: post: VEF.Graphics.VanillaExpandedFramework_PawnAttackGizmoUtility_AtLeastTwoSelectedPlayerPawnsHaveDifferentWeapons_Patch.Postfix | |
| PawnAttackGizmoUtility.GetAttackGizmos: post: ReGrowthCore.ScatteredFlames_Patch_GetGizmos.Postfix, MVCF.PatchSets.PatchSet_HumanoidGizmos.GetAttackGizmos_Postfix | |
| PawnBioAndNameGenerator.GiveAppropriateBioAndNameTo: PRE: BigAndSmall.GenerateNewPawnInternal.GiveAppropriateBioAndNameToPrefix | |
| PawnBioAndNameGenerator.GiveShuffledBioTo: PRE: [2147483647]VREAndroids.PawnBioAndNameGenerator_GiveShuffledBioTo_Patch.Prefix | |
| PawnBreathMoteMaker.ProcessPostTickVisuals: PRE: [2147483647]VREAndroids.PawnBreathMoteMaker_ProcessPostTickVisuals_Patch.Prefix | |
| PawnCapacitiesHandler.Notify_CapacityLevelsDirty: PRE: Vehicles.Patch_Misc.RecheckVehicleHandlerCapacities | |
| PawnCapacityDef.GetLabelFor: post: BigAndSmall.CapacityPatches.GetLabelForPostfix | |
| PawnCapacityUtility.CalculateCapacityLevel: post: VEF.Apparels.VanillaExpandedFramework_PawnCapacityUtility_CalculateCapacityLevel.Postfix, AlphaMemes.PawnCapacityUtility_CalculateCapacityLevel_Patch.Postfix, PsiTech.Utility.PawnCapacityPatch.Postfix, VAEInsanity.PawnCapacityUtility_CalculateCapacityLevel_Patch.Postfix | |
| PawnCapacityUtility.CalculatePartEfficiency: TRANS: SimsTraits.PawnCapacityUtility_CalculatePartEfficiency_Patch.Transpiler | |
| PawnCapacityWorker_Consciousness.CalculateCapacityLevel: post: RimEffectAR.Harmony.Patch_HediffSet_CalculateCapacity.Postfix | |
| PawnCapacityWorker_Manipulation.CalculateCapacityLevel: post: RimEffectAR.Harmony.Patch_HediffSet_CalculateCapacity.Postfix | |
| PawnCapacityWorker_Moving.CalculateCapacityLevel: post: RimEffectAR.Harmony.Patch_HediffSet_CalculateCapacity.Postfix | |
| PawnCollisionTweenerUtility.PawnCollisionPosOffsetFor: PRE: [2147483647]PerformanceOptimizer.Optimization_PawnCollisionPosOffsetFor.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_PawnCollisionPosOffsetFor.Postfix | |
| PawnColumnWorker_Designator.SetValue: PRE: VFETribals.PawnColumnWorker_Designator_SetValue_Patch.Prefix | |
| PawnColumnWorker_FoodRestriction.DoAssignFoodRestrictionButtons: PRE: [2147483647]VREAndroids.PawnColumnWorker_FoodRestriction_DoAssignFoodRestrictionButtons_Patch.Prefix | |
| PawnColumnWorker_Label.DoCell: TRANS: ReSpliceCharmweavers.PawnColumnWorker_Label_DoCell_Patch.Transpiler | |
| PawnColumnWorker_RemainingSpace.GetMinWidth: PRE: CompactWorkTab.Patches.PawnColumnWorker_RemainingSpace_GetMinWidth.Prefix | |
| PawnColumnWorker_Timetable.DoTimeAssignment: PRE: ProgressionEducation.PawnColumnWorker_Timetable_Patch.Prefix | |
| PawnColumnWorker_WorkPriority.DoCell: post: CompactWorkTab.Patches.PawnColumnWorker_WorkPriority_DoCell.Postfix | |
| PawnColumnWorker_WorkPriority.DoHeader: PRE: CompactWorkTab.Patches.PawnColumnWorker_WorkPriority_DoHeader.Prefix | |
| PawnColumnWorker_WorkPriority.GetMinHeaderHeight: post: CompactWorkTab.Patches.PawnColumnWorker_WorkPriority_GetMinHeaderHeight.Postfix | |
| PawnComponentsUtility.AddAndRemoveDynamicComponents: PRE: Vehicles.Patch_Components.AddAndRemoveVehicleComponents post: VEF.AnimalBehaviours.VanillaExpandedFramework_PawnComponentsUtility_AddAndRemoveDynamicComponents_Patch.AddDraftability, VREAndroids.PawnComponentsUtility_AddAndRemoveDynamicComponents.Postfix TRANS: SimsTraits.PawnComponentsUtility_AddAndRemoveDynamicComponents_Patch.Transpiler | |
| PawnComponentsUtility.AddComponentsForSpawn: post: [-2147483648]AchtungMod.PawnComponentsUtility_AddComponentsForSpawn_Patch.Postfix | |
| PawnComponentsUtility.CreateInitialComponents: PRE: Vehicles.Patch_Components.CreateInitialVehicleComponents post: VEF.Pawns.VanillaExpandedFramework_PawnComponentsUtility_CreateInitialComponents_Patch.Postfix | |
| PawnDiedOrDownedThoughtsUtility.AppendThoughts_ForHumanlike: PRE: [2147483647]VREAndroids.PawnDiedOrDownedThoughtsUtility_AppendThoughts_ForHumanlike_Patch.Prefix | |
| PawnDiedOrDownedThoughtsUtility.AppendThoughts_Relations: PRE: BigAndSmall.DeathThoughtPatches.AppendThoughts_RelationsPrefix, SimsTraits.PawnDiedOrDownedThoughtsUtility_AppendThoughts_Relations_Patch.Prefix | |
| PawnDiedOrDownedThoughtsUtility.GiveVeneratedAnimalDiedThoughts: post: AlphaMemes.AlphaMemes_PawnDiedOrDownedThoughtsUtility_GiveVeneratedAnimalDiedThoughts_Patch.HorseDied | |
| PawnDiedOrDownedThoughtsUtility.TryGiveThoughts: post: VanillaTraitsExpanded.TryGiveThoughts_Patch.Postfix, ReSpliceCharmweavers.PawnDiedOrDownedThoughtsUtility_TryGiveThoughts_Patch.Postfix | |
| PawnFlyer.MakeFlyer: TRANS: VEF.Abilities.VanillaExpandedFramework_PawnFlyer_MakeFlyer_Patch.Transpiler | |
| PawnFlyer.RecomputePosition: PRE: VEF.Abilities.VanillaExpandedFramework_PawnFlyer_RecomputePosition_Patch.Prefix | |
| PawnGenerator.AdjustXenotypeForFactionlessPawn: PRE: [100]XenotypeSpawnControl.HarmonyPatches.PawnGenerator_AdjustXenotypeForFactionlessPawn.Prefix TRANS: VREAndroids.PawnGenerator_AdjustXenotypeForFactionlessPawn_Patch.Transpiler | |
| PawnGenerator.ApplyMiscDamage: (no patches) | |
| PawnGenerator.FinalLevelOfSkill: TRANS: BetterRomance.HarmonyPatches.PawnGenerator_FinalLevelOfSkill.Transpiler | |
| PawnGenerator.GenerateBodyType: post: [100]BigAndSmall.HarmonyPatches.PawnGenerator_GenerateBodyType | |
| PawnGenerator.GenerateGearFor: post: PeteTimesSix.SimpleSidearms.Intercepts.PawnGenerator_GenerateGearFor_Postfix.GenerateGearFor | |
| PawnGenerator.GenerateGenes: PRE: VREAndroids.PawnGenerator_GenerateGenes_Patch.Prefix, XenotypeSpawnControl.HarmonyPatches.PawnGenerator_GenerateGenes.Prefix post: VEF.Genes.VanillaExpandedFramework_PawnGenerator_GenerateGenes_Patch.Postfix, VREAndroids.PawnGenerator_GenerateGenes_Patch.Postfix, BigAndSmall.GeneSetupHarmonyPatches.GenerateGenes_Postfix TRANS: VREAndroids.PawnGenerator_GenerateGenes_Patch.Transpiler | |
| PawnGenerator.GenerateInitialHediffs: post: EBSGFramework.HarmonyPatches.GenerateInitialHediffsPostfix, Mashed_Ashlands.PawnGenerator_GenerateInitialHediffs_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.PawnGenerator_GenerateInitialHediffs.Transpiler | |
| PawnGenerator.GenerateNewPawnInternal: PRE: BigAndSmall.GenerateNewPawnInternal.MaySetForcedGender post: VEF.Abilities.VanillaExpandedFramework_PawnGenerator_GenerateNewPawnInternal_Patch.Postfix, VanillaPsycastsExpanded.PawnGen_Patch.Postfix | |
| PawnGenerator.GenerateOrRedressPawnInternal: PRE: BreadMoFuckIdeoApprelAM.FuckIdeoApparel.FuckingIdeoApparel | |
| PawnGenerator.GeneratePawn: PRE: Vehicles.Patch_Construction.GenerateVehiclePawn, ReSpliceCharmweavers.Patch_PawnGenerator_GeneratePawn.Prefix post: BigAndSmall.PregnancyPatches.MaySetBabyGenesIfBabyBirth, BigAndSmall.GeneratePawns_Patch.GeneratePawnPostfix, ProgressionEducation.PawnGenerator_GeneratePawn_Patch.Postfix, Ammunition.Harmony.AmmoHarmonyPatches.GeneratePawn_PostFix, PsiTech.Utility.PsiPawnGenerationPatch.Postfix, SimsTraits.PawnGenerator_GeneratePawn_Patch.Postfix, VanillaQuestsExpandedAncients.PawnGenerator_GeneratePawn_Patch.Postfix, VFEPirates.PawnGenerator_GeneratePawn_Patch.Postfix | |
| PawnGenerator.GeneratePawn: post: BigAndSmall.GeneratePawns_Patch.GeneratePawnPostfix | |
| PawnGenerator.GeneratePawnRelations: PRE: [2147483647]VREAndroids.PawnGenerator_GeneratePawnRelations_Patch.Prefix, [2147483647]BigAndSmall.PawnGenerator_GeneratePawnRelations_Patch.DisableRelationsForForceGenderedPawns, VEF.Genes.VanillaExpandedFramework_PawnGenerator_GeneratePawnRelations_Patch.DisableRelations, AlphaGenes.AlphaGenes_PawnGenerator_GeneratePawnRelations_Patch.DisableRelations, EBSGFramework.HarmonyPatches.GeneratePawnRelationsPrefix, RimEffectAR.Patch_PawnGenerator_GeneratePawnRelations.DisableRelations | |
| PawnGenerator.GenerateSkills: PRE: [2147483647]VREAndroids.PawnGenerator_GenerateSkills_Patch.Prefix TRANS: BetterRomance.HarmonyPatches.PawnGenerator_GenerateSkills.Transpiler | |
| PawnGenerator.GenerateTraits: PRE: VREAndroids.PawnGenerator_GenerateTraits_Patch.Prefix TRANS: BetterRomance.HarmonyPatches.PawnGenerator_GenerateTraits.Transpiler | |
| PawnGenerator.GetBodyTypeFor: post: [100]BigAndSmall.HarmonyPatches.PawnGenerator_GetBodyTypeFor | |
| PawnGenerator.RedressPawn: post: Ammunition.Harmony.AmmoHarmonyPatches.RedressPawn_PostFix | |
| PawnGenerator.TryGenerateNewPawnInternal: PRE: VREAndroids.PawnGenerator_TryGenerateNewPawnInternal_Patch.Prefix post: EBSGFramework.HarmonyPatches.TryGenerateNewPawnInternalPostfix, [-2147483648]VREAndroids.PawnGenerator_TryGenerateNewPawnInternal_Patch.Postfix TRANS: VFEEmpire.HarmonyPatches.Patch_PawnGenerator.Transpiler | |
| PawnGenerator.TryGenerateSexualityTraitFor: PRE: BetterRomance.HarmonyPatches.PawnGenerator_TryGenerateSexualityTraitFor.Prefix | |
| PawnGenerator.XenotypesAvailableFor: post: [-2147483648]VREAndroids.PawnGenerator_XenotypesAvailableFor_Patch.Postfix | |
| PawnGraphicUtils.TryGetAlternate: post: Bestiary.HarmonyPatches.TryGetAlternatePostfix | |
| PawnGroupKindWorker.GeneratePawns: PRE: VFEInsectoids.PawnGroupKindWorker_GeneratePawns_Patch.Prefix post: VAEInsanity.PawnGroupKindWorker_GeneratePawns_Patch.Postfix | |
| PawnGroupMaker.CanGenerateFrom: post: VanillaPsycastsExpanded.PawnGroupMaker_CanGenerateFrom_Patch.Postfix TRANS: UnlimitedThreatScale.Patch_PawnGroupMaker_CanGenerateFrom.Transpiler | |
| PawnGroupMakerUtility.<>c__DisplayClass14_0.<TryGetRandomFactionForCombatPawnGroup>b__0: PRE: RimEffectAR.Harmony.Raid_Patches+FactionForCombatGroup_Patch.Prefix | |
| PawnGroupMakerUtility.GeneratePawnKindsExample: PRE: VFED.HarmonyPatches.ImperialForcesSizePatches.Prefix | |
| PawnGroupMakerUtility.GeneratePawns: PRE: VFED.HarmonyPatches.ImperialForcesSizePatches.Prefix post: BigAndSmall.GeneratePawns_Patch.GeneratePawnsPatch, VAEInsanity.PawnGroupMakerUtility_GeneratePawns.Postfix, VFEInsectoids.PawnGroupMakerUtility_GeneratePawns.Postfix | |
| PawnGroupMakerUtility.PawnGenOptionValid: post: VFED.HarmonyPatches.MiscPatches.CheckDeserterSpawn | |
| PawnHairColors.RandomHairColorGene: PRE: [2147483647]VREAndroids.PawnHairColors_RandomHairColorGene_Patch.Prefix | |
| PawnHairColors.RandomHairColorGeneFor: post: [0]BigAndSmall.PawnGeneColorsPatches.RandomHairColorGeneFor_Postfix | |
| PawnHairColors.get_HairColorGenes: TRANS: VREAndroids.PawnHairColors_HairColorGenes_Patch.Transpiler | |
| PawnIncoming.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| PawnInventoryGenerator.<>c__DisplayClass3_1.<GiveDrugsIfAddicted>b__0: (no patches) | |
| PawnInventoryGenerator.<>c__DisplayClass4_0.<GiveCombatEnhancingDrugs>b__0: (no patches) | |
| PawnKindDef.<ConfigErrors>d__156.MoveNext: (no patches) | |
| PawnLeaving.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| PawnNameColorUtility.PawnNameColorOf: post: EBSGFramework.HarmonyPatches.PawnNameColorOfPostfix, ReSpliceCharmweavers.PawnNameColorUtility_PawnNameColorOf_Patch.Postfix | |
| PawnObserver.<ObserveSurroundingThings>b__7_3: post: VAEInsanity.PawnObserver_ObserveSurroundingThings_Patch.Postfix | |
| PawnObserver.<ObserveSurroundingThings>g__TryCreateObservedThought|7_0: post: PrisonersShouldFearTurrets.PawnObserver_ObserveSurroundingThings_TryCreateObservedThought.Postfix | |
| PawnObserver.ObserveSurroundingThings: post: VanillaTraitsExpanded.ObserveSurroundingThings_Patch.Postfix | |
| PawnPortraitIconsDrawer.CalculatePawnPortraitIcons: TRANS: AlphaMemes.FuneralFramework_Dialog_BeginRitual_CalculatePawnPortraitIcons_Patch.Transpiler | |
| PawnPsiCard.<>c__DisplayClass74_0.<DrawAbilitySlot>g__Remove|0: (no patches) | |
| PawnPsiCard.<>c__DisplayClass75_0.<GenerateAbilityOption>b__0: (no patches) | |
| PawnPsiCard.DrawPsiCard: (no patches) | |
| PawnRelationWorker.BaseGenerationChanceFactor: post: [-2147483648]VREAndroids.PawnRelationWorker_BaseGenerationChanceFactor_Patch.Postfix | |
| PawnRelationWorker_Child.CreateRelation: TRANS: BetterRomance.HarmonyPatches.PawnRelationWorker_Child_CreateRelation.Transpiler | |
| PawnRelationWorker_Fiance.GenerationChance: post: BetterRomance.HarmonyPatches.PawnRelationWorker_Fiance_GenerationChance.Postfix | |
| PawnRelationWorker_Fiance.GetOldAgeFactor: PRE: BetterRomance.HarmonyPatches.PawnRelationWorker_Fiance_GetOldAgeFactor.Prefix | |
| PawnRelationWorker_Parent.CreateRelation: PRE: BetterRomance.HarmonyPatches.PawnRelationWorker_Parent_CreateRelation.Prefix | |
| PawnRelationWorker_Sibling.CreateRelation: TRANS: BetterRomance.HarmonyPatches.PawnRelationWorker_Sibling_CreateRelation.Transpiler | |
| PawnRelationWorker_Sibling.GenerateParent: TRANS: BetterRomance.HarmonyPatches.PawnRelationWorker_Sibling_GenerateParent.Transpiler | |
| PawnRelationWorker_Sibling.GenerationChance: TRANS: BetterRomance.HarmonyPatches.PawnRelationWorker_Sibling_GenerationChance.Transpiler | |
| PawnRelationWorker_Spouse.GenerationChance: post: BetterRomance.HarmonyPatches.PawnRelationWorker_Spouse_GenerationChance.Postfix | |
| PawnRenderNode.AddChildren: post: FacialAnimation.HarmonyPatches.PostfixAddChildren | |
| PawnRenderNode.ColorFor: post: VEF.Genes.VanillaExpandedFramework_PawnRenderNode_ColorFor_Patch.Postfix | |
| PawnRenderNode.EnsureInitialized: post: VFEInsectoids.PawnRenderNode_EnsureInitialized_Patch.Postfix | |
| PawnRenderNode.GraphicFor: post: [-2147483648]ErinsAuraeyl.PawnRenderNode_GraphicFor_Patch.Postfix | |
| PawnRenderNode.get_DebugEnabled: TRANS: BigAndSmall.NalsToggles.DebugEnabledTranspiler | |
| PawnRenderNodeWorker.AppendDrawRequests: PRE: VEF.Apparels.VanillaExpandedFramework_PawnRenderNodeWorker_AppendDrawRequests_Patch.Prefix | |
| PawnRenderNodeWorker.GetMaterial: post: ReGrowthCore.PawnRenderNodeWorker_GetMaterial_Patch.Postfix | |
| PawnRenderNodeWorker.OffsetFor: post: ReGrowthCore.PawnRenderNodeWorker_OffsetFor_Patch.Postfix | |
| PawnRenderNodeWorker.RotationFor: post: ReGrowthCore.PawnRenderNodeWorker_RotationFor_Patch.Postfix | |
| PawnRenderNodeWorker.ScaleFor: post: VEF.Genes.VanillaExpandedFramework_PawnRenderNodeWorker_ScaleFor_Patch.Postfix, BigAndSmall.RenderingPatches.ScaleForPatch | |
| PawnRenderNodeWorker_Apparel_Body.CanDrawNow: post: VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_PawnRenderNodeWorker_Apparel_Body_CanDrawNow_Patch.Postfix, ReGrowthCore.PawnRenderNodeWorker_Apparel_Body_CanDrawNow_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_PawnRenderNodeWorker_Apparel_Body_CanDrawNow_Patch.Postfix | |
| PawnRenderNodeWorker_Apparel_Head.CanDrawNow: PRE: VEF.Apparels.VanillaExpandedFramework_PawnRenderNodeWorker_Apparel_Head_CanDrawNow_Patch.Prefix TRANS: VanillaHairExpanded.Patch_PawnRenderer+RenderPawnInternal.Transpiler | |
| PawnRenderNodeWorker_Apparel_Head.HeadgearVisible: post: VFEPirates.HarmonyPatches.PawnRenderNodeWorker_Apparel_Head_HeadgearVisible_Patch.Postfix, VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_PawnRenderNodeWorker_Apparel_Head_HeadgearVisible_Patch.Postfix, ReGrowthCore.PawnRenderNodeWorker_Apparel_Head_HeadgearVisible_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_PawnRenderNodeWorker_Apparel_Head_HeadgearVisible_Patch.Postfix TRANS: VEF.Apparels.VanillaExpandedFramework_PawnRenderNodeWorker_Apparel_Head_HeadgearVisible_Patch.Transpiler, VanillaHairExpanded.Patch_PawnRenderer+RenderPawnInternal.Transpiler | |
| PawnRenderNodeWorker_Beard.OffsetFor: post: FacialAnimation.HarmonyPatches.PostfixBeardOffsetFor | |
| PawnRenderNodeWorker_Body.CanDrawNow: post: VEF.Apparels.VanillaExpandedFramework_PawnRenderNodeWorker_Body_CanDrawNow_Patch.Postfix, SoftWarmBeds.PawnRenderNodeWorker_Body_CanDrawNow.Postfix | |
| PawnRenderNode_AnimalPack.GraphicFor: post: VEF.Pawns.PawnRenderNode_AnimalPack_GraphicFor_Patch.Postfix | |
| PawnRenderNode_AnimalPart.GraphicFor: post: VFEInsectoids.PawnRenderNode_AnimalPart_GraphicFor_Patch.Postfix, EmergingAnimals.HarmonyPatches.GraphicForPostfix | |
| PawnRenderNode_Body.GraphicFor: post: VEF.Genes.VanillaExpandedFramework_PawnRenderNode_Body_GraphicFor_Patch.Postfix, EBSGFramework.HarmonyPatches.GraphicForBodyPostfix, [100]BigAndSmall.PawnRenderNode_Body_GraphicFor_Patch.Postfix | |
| PawnRenderNode_Fur.GraphicFor: PRE: Roos_Faun_Xenotype.PawnRenderer_Prefix.Prefix post: VEF.Genes.VanillaExpandedFramework_PawnRenderNode_Fur_GraphicFor_Patch.Postfix, [-2147483648]ErinsAuraeyl.PawnRenderNode_Fur_GetGraphic_Patch.Postfix | |
| PawnRenderNode_Head.GraphicFor: post: VEF.Genes.VanillaExpandedFramework_PawnRenderNode_Head_GraphicFor_Patch.Postfix, BigAndSmall.PawnRenderNode_Head_Patches.PawnRenderNode_Head_GraphicFor_Patch, EBSGFramework.HarmonyPatches.GraphicForHeadPostfix, [-2147483648]ErinsAuraeyl.PawnRenderNode_Head_GetGraphic_Patch.Postfix | |
| PawnRenderTree.AddChild: PRE: FacialAnimation.HarmonyPatches.Prefix_AddChild | |
| PawnRenderTree.AdjustParms: PRE: ShowHair.HarmonyPatches.PawnRenderTree_AdjustParms_Patch.Prefix TRANS: ShowHair.HarmonyPatches.PawnRenderTree_AdjustParms_Patch.Transpiler | |
| PawnRenderTree.InitializeAncestors: post: BigAndSmall.NalsToggles.InitializeAncestorsPostfix | |
| PawnRenderTree.ParallelPreDraw: post: FacialAnimation.HarmonyPatches.PostfixParallelPreDraw | |
| PawnRenderTree.ShouldAddNodeToTree: PRE: [800]BigAndSmall.ShouldAddNodeToTree_Prefix.Prefix | |
| PawnRenderUtility.CarryWeaponOpenly: post: PeteTimesSix.SimpleSidearms.Intercepts.PawnRenderUtility_CarryWeaponOpenly.PawnRenderUtility_CarryWeaponOpenly_Postfix | |
| PawnRenderUtility.DrawCarriedWeapon: TRANS: YayoAnimation.HarmonyPatches.PawnPatches.CarriedWeaponDrawing.Transpiler | |
| PawnRenderUtility.DrawEquipmentAiming: PRE: [800]VEF.Pawns.VanillaExpandedFramework_PawnRenderer_DrawEquipmentAiming_Patch.Prefix, VEF.Weapons.VanillaExpandedFramework_PawnRenderUtility_Draw_EquipmentAiming_Patch.Prefix, VFEPirates.HarmonyPatches.PawnRenderUtility_DrawEquipmentAiming_Patch.Prefix, Gunplay.Patch.PatchPawnRenderUtilityDrawEquipmentAiming.Prefix, MoteDraw_Libraray.HarmonyPatches+HarmonyPatch_PawnWeaponRenderer.Prefix, [0]VEF.Graphics.VanillaExpandedFramework_DynamicGraphicPatches.DrawEquipmentAimingPrefix post: MuzzleFlash.Patch.HarmonyPatch_PawnRenderer.Postfix | |
| PawnRenderUtility.DrawEquipmentAndApparelExtras: PRE: [800]VFEMedieval.VFEMedieval_PawnRenderUtility_DrawEquipmentAndApparelExtras_Patch.Prefix, [800]ProgressionEducation.PawnRenderUtility_DrawEquipmentAndApparelExtras_Patch.Prefix, YayoAnimation.HarmonyPatches.PawnPatches.AimingPatch.Prefix post: RimEffect.Patch_PawnRenderUtility_DrawEquipmentAndApparelExtras.Postfix, MVCF.PatchSets.PatchSet_Drawing.DrawVerbExtras TRANS: YayoAnimation.HarmonyPatches.PawnPatches.AimingPatch.Transpiler | |
| PawnRenderer.BaseHeadOffsetAt: post: VEF.Genes.VanillaExpandedFramework_PawnRenderer_BaseHeadOffsetAt.Postfix, BigAndSmall.PawnRenderer_BaseHeadOffsetAt.Postfix, FacialAnimation.HarmonyPatches.PostfixBaseHeadOffsetAt | |
| PawnRenderer.BodyAngle: PRE: VFEEmpire.HarmonyPatches.PawnRenderer_BodyAngle_Patch.Prefix post: DubsBadHygiene.Patches.HarmonyPatches+H_BodyAngle.Postfix, YayoAnimation.HarmonyPatches.PawnPatches.BodyAnglePatch.Postfix | |
| PawnRenderer.GetBodyPos: post: VEF.Apparels.VanillaExpandedFramework_PawnRenderer_GetBodyPos_Patch.Postfix, BunkBeds.PawnRenderer_GetBodyPos_Patch.Postfix, YayoAnimation.HarmonyPatches.PawnPatches.GetBodyPosPatch.Postfix, SoftWarmBeds.PawnRenderer_GetBodyPos.Postfix TRANS: SmashTools.PawnOverlayRenderer.ShowBodyTranspiler | |
| PawnRenderer.GetDrawParms: PRE: ReGrowthCore.PawnRenderer_GetDrawParms_Patch.Prefix post: DubsBadHygiene.Patches.HarmonyPatches+Patch_GetDrawParms.Postfix | |
| PawnRenderer.LayingFacing: PRE: SmashTools.PawnOverlayRenderer.LayingFacing post: YayoAnimation.HarmonyPatches.PawnPatches.LayingFacingPatch.Postfix | |
| PawnRenderer.OverrideMaterialIfNeeded: post: ReGrowthCore.PawnRenderer_OverrideMaterialIfNeeded_Patch.Postfix | |
| PawnRenderer.ParallelGetPreRenderResults: PRE: Vehicles.Patch_Rendering.DisableCachingPawnOverlays, VEF.AestheticScaling.VanillaExpandedFramework_PawnRenderer_ParallelGetPreRenderResults_Patch.Prefix, YayoAnimation.HarmonyPatches.PawnPatches.ParallelGetPreRenderResultsPatch.Prefix, BigAndSmall.ParallelGetPreRenderResults_Patch.Prefix, FacialAnimation.HarmonyPatches.PrefixParallelGetPreRenderResults TRANS: YayoAnimation.HarmonyPatches.PawnPatches.ParallelGetPreRenderResultsPatch.Transpiler | |
| PawnRenderer.RenderPawnAt: PRE: VFEC.VFEC_PawnRenderer_RenderPawnAt_Patch.PreFix, VREAndroids.PawnRenderer_RenderPawnAt_Patch.Prefix post: VREAndroids.PawnRenderer_RenderPawnAt_Patch.Postfix, EBSGFramework.HarmonyPatches.RenderPawnAtPostfix | |
| PawnRenderer.get_CurRotDrawMode: post: BigAndSmall.RotDrawModePatch.CurRotDrawModePostfix | |
| PawnShieldGenerator.<Reset>g__isShield|2_0: (no patches) | |
| PawnShieldGenerator.TryGenerateShieldFor: (no patches) | |
| PawnSkinColors.RandomSkinColorGene: PRE: [2147483647]VREAndroids.PawnSkinColors_RandomSkinColorGene_Patch.Prefix post: [0]BigAndSmall.PawnGeneColorsPatches.RandomSkinColorGene_Postfix | |
| PawnSkinColors.get_SkinColorGenesInOrder: TRANS: VREAndroids.PawnSkinColors_SkinColorGenesInOrder_Patch.Transpiler | |
| PawnStatusEffecters.EffectersTick: (no patches) | |
| PawnTable.RecacheIfDirty: PRE: CompactWorkTab.Patches.PawnTable_RecacheIfDirty.Prefix post: CompactWorkTab.Patches.PawnTable_RecacheIfDirty.Postfix | |
| PawnTechHediffsGenerator.InstallPart: (no patches) | |
| PawnUIOverlay.DrawPawnGUIOverlay: PRE: VEF.Apparels.VanillaExpandedFramework_PawnUIOverlay_Patch.GhillieException, VEF.AestheticScaling.VanillaExpandedFramework_PawnUIOverlay_DrawPawnGUIOverlay_Patch.Prefix, BunkBeds.DrawPawnGUIOverlay_DrawPawnGUIOverlay_Patch.Prefix, BigAndSmall.PawnUIOverlay_DrawSelection_Patch.Prefix post: VEF.AestheticScaling.VanillaExpandedFramework_PawnUIOverlay_DrawPawnGUIOverlay_Patch.Postfix, BigAndSmall.PawnUIOverlay_DrawSelection_Patch.Postfix | |
| PawnUtility.BodyResourceGrowthSpeed: post: VEF.Genes.VanillaExpandedFramework_PawnUtility_BodyResourceGrowthSpeed_Patch.MultiplyPregnancy, AlphaGenes.AlphaGenes_PawnUtility_BodyResourceGrowthSpeed_Patch.MultiplyPregnancy, BigAndSmall.GenderAndSexPatches.Postfix | |
| PawnUtility.CanPickUp: PRE: PickUpAndHaul.HarmonyPatches.CanBeMadeToDropStuff | |
| PawnUtility.CanTakeDrug: (no patches) | |
| PawnUtility.CanTakeDrugForDependency: (no patches) | |
| PawnUtility.GainComfortFromThingIfPossible: PRE: Vehicles.Patch_CaravanHandling.GainComfortFromVehicle | |
| PawnUtility.GetManhunterOnDamageChance: post: VanillaExplorationExpanded.VanillaExplorationExpanded_PawnUtility_GetManhunterOnDamageChance_Patch.IncreaseChance | |
| PawnUtility.GetMaxAllowedToPickUp: PRE: PickUpAndHaul.HarmonyPatches.MaxAllowedToPickUpPrefix | |
| PawnUtility.GetPosture: PRE: [2147483647]VREAndroids.PawnUtility_GetPosture_Patch.Prefix | |
| PawnUtility.IsBiologicallyBlind: post: PsiTech.Utility.BlindThoughtPatch.Postfix | |
| PawnUtility.IsFighting: post: VEF.AnimalBehaviours.VanillaExpandedFramework_PawnUtility_IsFighting_Patch.DontFlee TRANS: AlphaBehavioursAndEvents.AlphaAnimals_PawnUtility_IsFighting_Patch.DisableBlackHive_Transpiler | |
| PawnUtility.IsTeetotaler: PRE: [2147483647]PerformanceOptimizer.Optimization_PawnUtility_IsTeetotaler.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_PawnUtility_IsTeetotaler.Postfix | |
| PawnUtility.IsTravelingInTransportPodWorldObject: post: Vehicles.Patch_WorldHandling.AerialVehiclesDontRandomizePrisoners | |
| PawnUtility.IsWorkTypeDisabledByAge: TRANS: VREArchon.PawnUtility_IsWorkTypeDisabledByAge_Patch.Transpiler | |
| PawnUtility.Mated: PRE: VEF.AnimalBehaviours.PawnUtility_Mated+VanillaExpandedFramework_PawnUtility_Mated_Patch.Prefix | |
| PawnUtility.PawnWouldBeUnhappyTakingDrug: (no patches) | |
| PawnUtility.ShouldSendNotificationAbout: post: Vehicles.Patch_Misc.SendNotificationsVehicle, VanillaPsycastsExpanded.HarmonyPatches.PawnUtility_ShouldSendNotificationAbout_Patch.Postfix | |
| PawnUtility.TrySpawnHatchedOrBornPawn: post: GeneticRim.GeneticRim_PawnUtility_TrySpawnHatchedOrBornPawn_ForEggs_Patch.AddQualityToEgg, GeneticRim.GeneticRim_PawnUtility_TrySpawnHatchedOrBornPawn_Patch.AddQuality | |
| PawnUtility.WillSoonHaveBasicNeed: post: DubsBadHygiene.Patches.HarmonyPatches+Patch_WillSoonHaveBasicNeed.Postfix | |
| PawnWeaponGenerator.TryGenerateWeaponFor: post: USH_GE.Patch_PawnWeaponGenerator_TryGenerateWeaponFor.Postfix | |
| Pawn_AbilityTracker.GainAbility: post: ReSpliceCore.Pawn_AbilityTracker_GainAbility_Patch.Postfix, VAspirE.SatisfactionPatches.CheckGeneral | |
| Pawn_AbilityTracker.Notify_TemporaryAbilitiesChanged: post: VanillaPsycastsExpanded.Pawn_AbilityTracker_Notify_TemporaryAbilitiesChanged_Patch.Postfix | |
| Pawn_AbilityTracker.RemoveAbility: post: ReSpliceCore.Pawn_AbilityTracker_RemoveAbility_Patch.Postfix | |
| Pawn_AgeTracker.BirthdayBiological: PRE: [2147483647]VREAndroids.Pawn_AgeTracker_BirthdayBiological_Patch.Prefix post: VAspirE.SatisfactionPatches.CheckGeneral, VanillaMemesExpanded.VanillaMemesExpanded_Pawn_AgeTracker_BirthdayBiological_Patch.IfElderAddTrait TRANS: VREArchon.Pawn_AgeTracker_BirthdayBiological_Patch.Transpiler, VanillaSocialInteractionsExpanded.BirthdayBiological_Patch.Transpiler | |
| Pawn_AgeTracker.ExposeData: PRE: BetterRomance.HarmonyPatches.Pawn_AgeTracker_ExposeData.Prefix | |
| Pawn_AgeTracker.GrowthPointsPerDayAtLearningLevel: post: VEF.Genes.VanillaExpandedFramework_GrowthPointPerDayAtLearningLevel_Patch.Postfix, BigAndSmall.GrowthPointPerDayAtLearningLevel_Patch.Postfix | |
| Pawn_AgeTracker.RecalculateLifeStageIndex: PRE: [2147483647]VREAndroids.Pawn_AgeTracker_RecalculateLifeStageIndex_Patch.Prefix | |
| Pawn_AgeTracker.ResetAgeReversalDemand: PRE: BetterRomance.HarmonyPatches.Pawn_AgeTracker_ResetAgeReversalDemand.Prefix TRANS: FasterBiosculpterPod.HarmonyPatches+ResetAgeReversalDemandTranspiler.Transpiler, BetterRomance.HarmonyPatches.Pawn_AgeTracker_ResetAgeReversalDemand.Transpiler | |
| Pawn_AgeTracker.TryChildGrowthMoment: post: SimsTraits.Pawn_AgeTracker_TryChildGrowthMoment_Patch.Postfix | |
| Pawn_AgeTracker.get_AgeBiologicalYearsFloat: post: [-2147483648]VREAndroids.Pawn_AgeTracker_AgeBiologicalYearsFloat_Patch.Postfix | |
| Pawn_AgeTracker.get_BiologicalTicksPerTick: TRANS: BetterRomance.HarmonyPatches.Pawn_AgeTracker_BiologicalTicksPerTick.Transpiler | |
| Pawn_AgeTracker.get_GrowthPointsFactor: TRANS: BetterRomance.HarmonyPatches.Pawn_AgeTracker_GrowthPointsFactor.Transpiler | |
| Pawn_AgeTracker.get_GrowthPointsPerDay: post: EBSGFramework.HarmonyPatches.GrowthPointStatPostfix | |
| Pawn_ApparelTracker.Notify_ApparelAdded: post: VEF.Apparels.VanillaExpandedFramework_Pawn_ApparelTracker_Notify_ApparelAdded_Patch.Postfix, VanillaGravshipExpanded.Pawn_ApparelTracker_Notify_ApparelAdded_Patch.Postfix, MVCF.PatchSets.Trackers.PatchSet_Apparel.ApparelAdded_Postfix | |
| Pawn_ApparelTracker.Notify_ApparelChanged: post: NiceInventoryTab.ApparelListener.Postfix | |
| Pawn_ApparelTracker.Notify_ApparelRemoved: PRE: MVCF.PatchSets.Trackers.PatchSet_Apparel.ApparelRemoved_Prefix post: VEF.Weapons.VanillaExpandedFramework_Pawn_ApparelTracker_Notify_ApparelRemoved_Patch.Postfix, VEF.Apparels.VanillaExpandedFramework_Pawn_ApparelTracker_Notify_ApparelRemoved_Patch.Postfix, VanillaGravshipExpanded.Pawn_ApparelTracker_Notify_ApparelRemoved_Patch.Postfix | |
| Pawn_ApparelTracker.TryDrop: post: VEF.Weapons.VanillaExpandedFramework_Pawn_ApparelTracker_TryDrop_Patch.Postfix | |
| Pawn_ApparelTracker.Unlock: PRE: VFEPirates.Pawn_ApparelTracker_Unlock_Patch.Prefix | |
| Pawn_ApparelTracker.Wear: post: RimEffect.Wear_Patch.Postfix, VAspirE.SatisfactionPatches.CheckGeneral, VAEInsanity.Pawn_ApparelTracker_Wear_Patch.Postfix | |
| Pawn_ApparelTracker.get_AllRequirements: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| Pawn_ConnectionsTracker.<GetGizmos>d__10.MoveNext: (no patches) | |
| Pawn_ConnectionsTracker.DrawConnectionLine: PRE: VIEAT.DrawConnectionLine_Patch.Prefix | |
| Pawn_DraftController.GetGizmos: post: VEF.AI.DraftGizmos.GetGizmosPostfix, SearchAndDestroy.Harmony.Pawn_DraftController_GetGizmos.Postfix, MVCF.PatchSets.PatchSet_HumanoidGizmos.GetGizmos_Postfix, DefensivePositions.DraftController_GetGizmos_Patch.InsertDefensivePositionGizmo, [200]BigAndSmall.DraftGizmos.GetGizmosPostfix | |
| Pawn_DraftController.get_ShowDraftGizmo: post: [-2147483648]VREAndroids.Pawn_DraftController_ShowDraftGizmo_Patch.Postfix | |
| Pawn_DraftController.set_Drafted: PRE: [2147483647]VREAndroids.Pawn_DraftController_Drafted_Patch.Prefix, VanillaTraitsExpanded.Drafted_Patch.Prefix post: AllowTool.Patches.DraftController_Drafted_Patch.NotifyPawnUndrafted, SearchAndDestroy.Harmony.Pawn_DraftController_set_Drafted.Postfix, PeteTimesSix.SimpleSidearms.Intercepts.Pawn_DraftController_Drafted_Setter_Postfix.DraftedSetter, VFEMedieval.Pawn_DraftController_Drafted_Patch.Postfix, VanillaGravshipExpanded.Pawn_DraftController_Drafted_Patch.Postfix, VREHussars.Pawn_DraftController_Drafted_Patch.Postfix, AchtungMod.Pawn_DraftController_Drafted_Patch.Postfix, SimsTraits.Pawn_DraftController_Drafted_Patch.Postfix, VCR.Pawn_DraftController_Drafted_Patch.Postfix | |
| Pawn_DrawTracker.Notify_DamageApplied: PRE: RimEffect.Patch_Pawn_DrawTracker_Notify_DamageApplied.Prefix | |
| Pawn_DrawTracker.get_DrawPos: post: VEF.AestheticScaling.VanillaExpandedFramework_Pawn_DrawTracker_DrawPos_Patch.Postfix | |
| Pawn_DrugPolicyTracker.CanCauseOverdose: (no patches) | |
| Pawn_DrugPolicyTracker.ShouldTryToTakeScheduledNow: PRE: [2147483647]VREAndroids.Pawn_DrugPolicyTracker_ShouldTryToTakeScheduledNow_Patch.Prefix | |
| Pawn_EquipmentTracker.AddEquipment: post: VEF.Weapons.VanillaExpandedFramework_Pawn_EquipmentTracker_AddEquipment_Patch.Postfix, VAspirE.SatisfactionPatches.CheckGeneral, ProgressionEducation.Pawn_EquipmentTracker_AddEquipment_Patch.Postfix | |
| Pawn_EquipmentTracker.GetGizmos: post: VFEC.ClassicMod.GetEquipGizmos | |
| Pawn_EquipmentTracker.Notify_EquipmentAdded: post: VEF.Apparels.VanillaExpandedFramework_Pawn_EquipmentTracker_Notify_EquipmentAdded_Patch.Postfix, NiceInventoryTab.EquipmentListener.Postfix, MVCF.PatchSets.Trackers.PatchSet_Equipment.EquipmentAdded_Postfix | |
| Pawn_EquipmentTracker.Notify_EquipmentRemoved: PRE: MVCF.PatchSets.Trackers.PatchSet_Equipment.EquipmentRemoved_Prefix post: VEF.Apparels.VanillaExpandedFramework_Pawn_EquipmentTracker_Notify_EquipmentRemoved_Patch.Postfix, NiceInventoryTab.EquipmentListener2.Postfix | |
| Pawn_EquipmentTracker.TryDropEquipment: post: VEF.Weapons.VanillaExpandedFramework_Pawn_EquipmentTracker_TryDropEquipment_Patch.Postfix | |
| Pawn_EquipmentTracker.TryTransferEquipmentToContainer: post: MVCF.PatchSets.Trackers.PatchSet_Equipment.TryTransferEquipmentToContainer_Postfix | |
| Pawn_FilthTracker.Notify_EnteredNewCell: PRE: VEF.AnimalBehaviours.VanillaExpandedFramework_Pawn_FilthTracker_Notify_EnteredNewCell_Patch.DontDealWithFilth post: VFESecurity.Pawn_FilthTracker_Notify_EnteredNewCell_Patch.Postfix | |
| Pawn_FilthTracker.TryDropFilth: PRE: VanillaTraitsExpanded.TryDropFilth_Patch.Prefix | |
| Pawn_FilthTracker.TryPickupFilth: PRE: VanillaTraitsExpanded.TryPickupFilth_Patch.Prefix, ReGrowthCore.Pawn_FilthTracker_TryPickupFilth_Patch.Prefix post: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.TryPickupFilth_Postfix, ReGrowthCore.Pawn_FilthTracker_TryPickupFilth_Patch.Postfix | |
| Pawn_FlightTracker.GetBestFlyAnimation: PRE: BigAndSmall.GetBestFlyAnimationTranspiler.GetBestFlyAnimation_Prefix | |
| Pawn_GeneTracker.AddGene: post: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_Pawn_GeneTracker_AddGene_Patch.Postfix | |
| Pawn_GeneTracker.AddictionChanceFactor: post: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_Pawn_GeneTracker_AddictionChanceFactor_Patch.Postfix | |
| Pawn_GeneTracker.CheckForOverrides: post: VanillaRacesExpandedStarjack.VanillaRacesExpandedStarjack_Pawn_GeneTracker_CheckForOverrides_Patch.Postfix, VanillaRacesExpandedInsector.Pawn_GeneTracker_CheckForOverrides_Patch.Postfix | |
| Pawn_GeneTracker.ClearXenogenes: PRE: ReSpliceCore.Pawn_GeneTracker_ClearXenogenes_Patch.Prefix post: ReSpliceCore.Pawn_GeneTracker_ClearXenogenes_Patch.Postfix | |
| Pawn_GeneTracker.ExposeData: post: VREAndroids.Pawn_GeneTracker_ExposeData_Patch.Postfix | |
| Pawn_GeneTracker.Notify_GenesChanged: PRE: FacialAnimation.HarmonyPatches.Prefix_Notify_GenesChanged post: VEF.Genes.VanillaExpandedFramework_Notify_GenesChanged_Patch.Postfix, VREAndroids.Pawn_GeneTracker_Notify_GenesChanged_Patch.Postfix, BigAndSmall.NotifyGenesChanges.Notify_GenesChanged_Postfix, FacialAnimationGeneticHeads.Patch_NotifyGenesChanged_AllFacialParts.Postfix, VanillaPsycastsExpanded.Pawn_GeneTracker_Notify_GenesChanged_Patch.Postfix, BetterRomance.HarmonyPatches.Pawn_GeneTracker_Notify_GenesChanged.Postfix | |
| Pawn_GeneTracker.SetXenotype: post: VAspirE.SatisfactionPatches.CheckGeneral | |
| Pawn_GeneTracker.SetXenotypeDirect: post: VAspirE.SatisfactionPatches.CheckGeneral | |
| Pawn_GeneTracker.get_BiologicalAgeTickFactor: TRANS: BetterRomance.HarmonyPatches.Pawn_GeneTracker_BiologicalAgeTickFactor.Transpiler | |
| Pawn_GeneTracker.get_XenotypeDescShort: PRE: [2147483647]VREAndroids.Pawn_GeneTracker_XenotypeDescShort_Patch.Prefix | |
| Pawn_HealthTracker.<>c.<Notify_Resurrected>b__74_0: (no patches) | |
| Pawn_HealthTracker.AddHediff: PRE: [2147483647]VREAndroids.Pawn_HealthTracker_AddHediff_Patch.Prefix, [2147483647]SimsTraits.Pawn_HealthTracker_AddHediff_Patch.Prefix, [2147483647]VAEInsanity.Pawn_HealthTracker_AddHediff_Patch.Prefix, [2147483647]ReSpliceCharmweavers.Pawn_HealthTracker_AddHediff_Patch.Prefix, Vehicles.Patch_HealthAndStats.VehiclesDontAddHediffs, VanillaPsycastsExpanded.Pawn_HealthTracker_AddHediff_Patch.Prefix, ReGrowthCore.Pawn_HealthTracker_AddHediff_Patch.Prefix post: MVCF.PatchSets.Trackers.PatchSet_Hediffs.AddHediff_Postfix | |
| Pawn_HealthTracker.CheckForStateChange: PRE: PsiTech.Utility.HealthTrackerStatePatch.Prefix post: VEF.Apparels.Patch_Pawn_HealthTracker+VanillaExpandedFramework_Pawn_HealthTracker_CheckForStateChange_Patch.Postfix | |
| Pawn_HealthTracker.DropBloodFilth: post: VFEInsectoids.VFEInsectoids_Pawn_HealthTracker_DropBloodFilth_Patch.Postfix TRANS: VEF.Genes.VanillaExpandedFramework_Pawn_HealthTracker_DropBloodFilth_Patch.Transpiler | |
| Pawn_HealthTracker.DropBloodSmear: TRANS: VEF.Genes.VanillaExpandedFramework_Pawn_HealthTracker_DropBloodSmear_Patch.Transpiler | |
| Pawn_HealthTracker.HealthTick: post: BloodAnimations.Pawn_HealthTracker_HealthTick.HealthTick | |
| Pawn_HealthTracker.HealthTickInterval: TRANS: ChooseYourMedicine.HealthTickInterval_Transpiler.Transpiler | |
| Pawn_HealthTracker.MakeDowned: PRE: Vehicles.Patch_HealthAndStats.VehiclesCantBeDowned, VanillaSocialInteractionsExpanded.MakeDowned_Patch.Prefix post: VFEEmpire.HarmonyPatches.Patch_StateChange.Postfix, VFEMedieval.Pawn_HealthTracker_MakeDowned_Patch.Postfix, AlphaGenes.AlphaGenes_Pawn_HealthTracker_MakeDowned_Patch.BreakSomeBones, EBSGFramework.HarmonyPatches.MakeDownedPostfix, VCR.Pawn_HealthTracker_MakeDowned_Patch.Postfix | |
| Pawn_HealthTracker.MakeUndowned: post: VFEEmpire.HarmonyPatches.Patch_StateChange.Postfix, VFEMedieval.Pawn_HealthTracker_MakeUndowned_Patch.Postfix | |
| Pawn_HealthTracker.NotifyPlayerOfKilled: PRE: VFEPirates.HarmonyPatches.Pawn_HealthTracker_NotifyPlayerOfKilled_Patch.Prefix post: AlphaMemes.FuneralFramework_Pawn_HealthTracker_NotifyPlayerOfKilled_AnimalObligationTrigger.Postfix | |
| Pawn_HealthTracker.Notify_Resurrected: post: VFEEmpire.HarmonyPatches.Patch_StateChange.Postfix | |
| Pawn_HealthTracker.PostApplyDamage: PRE: PsiTech.Utility.HealthTrackerPostDamagePatch.Prefix post: VanillaPsycastsExpanded.Chronopath.GameCondition_RaidPause.PostPostApplyDamage | |
| Pawn_HealthTracker.RemoveHediff: post: VAspirE.SatisfactionPatches.CheckGeneral, VanillaRacesExpandedHighmate.Pawn_HealthTracker_RemoveHediff_Patch.Postfix | |
| Pawn_HealthTracker.Reset: post: VFEEmpire.HarmonyPatches.Patch_StateChange.Postfix | |
| Pawn_HealthTracker.RestorePartRecursiveInt: PRE: [2147483647]VREAndroids.Pawn_HealthTracker_RestorePartRecursiveInt_Patch.Prefix | |
| Pawn_HealthTracker.SetDead: post: VFEEmpire.HarmonyPatches.Patch_StateChange.Postfix | |
| Pawn_HealthTracker.ShouldBeDead: post: [-2147483648]VREAndroids.Pawn_HealthTracker_ShouldBeDead_Patch.Postfix | |
| Pawn_HealthTracker.ShouldBeDeadFromLethalDamageThreshold: TRANS: VanillaPsycastsExpanded.Pawn_HealthTracker_ShouldBeDeadFromLethalDamageThreshold_Patch.Transpiler | |
| Pawn_HealthTracker.ShouldBeDeadFromRequiredCapacity: post: [-2147483648]VREAndroids.Pawn_HealthTracker_ShouldBeDeadFromRequiredCapacity_Patch.Postfix | |
| Pawn_HealthTracker.ShouldBeDowned: PRE: [2147483647]VREAndroids.Pawn_HealthTracker_ShouldBeDowned_Patch.Prefix, Vehicles.Patch_HealthAndStats.VehicleShouldBeDowned, VEF.Apparels.VanillaExpandedFramework_Pawn_HealthTracker_ShouldBeDowned_Patch.Prefix | |
| Pawn_HealthTracker.get_InPainShock: post: RimEffectAR.Harmony.HealthTrackerPainShock_Patch.Postfix | |
| Pawn_IdeoTracker.SetIdeo: post: VEF.Memes.VanillaExpandedFramework_Pawn_IdeoTracker_SetIdeo_Patch.ForceTraitAndAbilities | |
| Pawn_IdeoTracker.get_CertaintyChangeFactor: PRE: BetterRomance.HarmonyPatches.Pawn_IdeoTracker_CertaintyChangeFactor.Prefix TRANS: BetterRomance.HarmonyPatches.Pawn_IdeoTracker_CertaintyChangeFactor.Transpiler | |
| Pawn_InteractionsTracker.CanInteractNowWith: PRE: RimEffect.Patch_Pawn_InteractionsTrackeR_CanInteractNowWith.Prefix | |
| Pawn_InteractionsTracker.CheckSocialFightStart: PRE: SimsTraits.Pawn_InteractionsTracker_CheckSocialFightStart_Patch.Prefix | |
| Pawn_InteractionsTracker.InteractionsTrackerTickInterval: PRE: [-2147483648]SimsTraits.Pawn_InteractionsTracker_InteractionsTrackerTickInterval_Patch.Prefix | |
| Pawn_InteractionsTracker.StartSocialFight: post: VanillaRacesExpandedLycanthrope.VanillaRacesExpandedLycanthrope_Pawn_InteractionsTracker_StartSocialFight_Patch.CreateRelationOnSocialFight, AlphaGenes.AlphaGenes_Pawn_InteractionsTracker_StartSocialFight_Patch.ReceiveRecreation | |
| Pawn_InteractionsTracker.TryInteractRandomly: PRE: VanillaSocialInteractionsExpanded.TryInteractRandomly_Patch.Prefix | |
| Pawn_InteractionsTracker.TryInteractWith: PRE: SimsTraits.Pawn_InteractionsTracker_TryInteractWith_Patch.Prefix, VAEInsanity.Pawn_InteractionsTracker_TryInteractWith_Patch.Prefix post: VEF.Hediffs.VanillaExpandedFramework_Pawn_InteractionsTracker_TryInteractWith_Patch.Postfix, VFEPirates.VFEPirates_Pawn_InteractionsTracker_TryInteractWith_Patch.AddInteractionThoughts, VAEInsanity.Pawn_InteractionsTracker_TryInteractWith_Patch.Postfix, VanillaSocialInteractionsExpanded.TryInteractWith_Patch.Postfix TRANS: VFEEmpire.HarmonyPatches.Patch_Pawn_InteractionsTracker_TryInteractWith.Transpiler | |
| Pawn_InteractionsTracker.get_CurrentSocialMode: PRE: [2147483647]PerformanceOptimizer.Optimization_Pawn_InteractionsTracker_CurrentSocialMode.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_Pawn_InteractionsTracker_CurrentSocialMode.Postfix | |
| Pawn_InventoryTracker.Notify_ItemRemoved: post: Vehicles.Patch_Components.RemovePawnFromInventory, NiceInventoryTab.InventoryListener.Postfix, PickUpAndHaul.HarmonyPatches.Pawn_InventoryTracker_PostFix | |
| Pawn_InventoryTracker.get_FirstUnloadableThing: post: PeteTimesSix.SimpleSidearms.Intercepts.Pawn_InventoryTracker_FirstUnloadableThing.Postfix | |
| Pawn_InventoryTracker.set_UnloadEverything: PRE: Vehicles.Patch_CaravanFormation.VehiclesShouldntUnloadEverything | |
| Pawn_JobTracker.CheckForJobOverride: TRANS: Vehicles.Patch_JobSystem.NoOverrideDamageTakenTranspiler | |
| Pawn_JobTracker.DetermineNextJob: post: SearchAndDestroy.Harmony.Pawn_JobTracker_DetermineNextJob.Postfix | |
| Pawn_JobTracker.EndCurrentJob: post: VFEMedieval.Pawn_JobTracker_EndCurrentJob_Patch.Postfix TRANS: AchtungMod.Pawn_JobTracker_EndCurrentJob_Patch.Transpiler | |
| Pawn_JobTracker.IsCurrentJobPlayerInterruptible: PRE: Vehicles.Patch_VehiclePathing.JobInterruptibleForVehicle TRANS: VREAndroids.Pawn_JobTracker_IsCurrentJobPlayerInterruptible_Patch.Transpiler | |
| Pawn_JobTracker.Notify_TuckedIntoBed: post: VREAndroids.Pawn_JobTracker_Notify_TuckedIntoBed_Patch.Postfix | |
| Pawn_JobTracker.ShouldStartJobFromThinkTree: post: AchtungMod.Pawn_JobTracker_ShouldStartJobFromThinkTree_Patch.Postfix | |
| Pawn_JobTracker.StartJob: PRE: VREAndroids.Pawn_JobTracker_StartJob_Patch.Prefix, VFEPirates.Pawn_JobTracker_StartJob_Patch.Prefix, VanillaPsycastsExpanded.Pawn_JobTracker_StartJob_Patch.Prefix, VanillaTraitsExpanded.StartJob_Patch.Prefix post: VFEMedieval.Pawn_JobTracker_StartJob_Patch.Postfix | |
| Pawn_JobTracker.TryTakeOrderedJob: PRE: VanillaTraitsExpanded.TryTakeOrderedJob_Patch.Prefix post: SimsTraits.Pawn_JobTracker_TryTakeOrderedJob_Patch.Postfix, VanillaTraitsExpanded.TryTakeOrderedJob_Patch.Postfix | |
| Pawn_Kill_Patch.Postfix: (no patches) | |
| Pawn_MechanitorTracker.CanCommandTo: post: AlphaGenes.AlphaGenes_Pawn_MechanitorTracker_CanCommandTo_Patch.ModifyRange | |
| Pawn_MechanitorTracker.DrawCommandRadius: post: AlphaGenes.AlphaGenes_Pawn_MechanitorTracker_DrawCommandRadius_Patch.DrawExtraCommandRadius | |
| Pawn_MeleeVerbs.ChooseMeleeVerb: PRE: Vehicles.Patch_Components.VehiclesDontMeleeThings | |
| Pawn_MeleeVerbs.GetUpdatedAvailableVerbsList: post: BigAndSmall.GetUpdatedAvailableVerbsList_Patch.Postfix | |
| Pawn_MeleeVerbs.TryGetMeleeVerb: post: SimsTraits.Pawn_MeleeVerbs_TryGetMeleeVerb_Patch.Postfix | |
| Pawn_MeleeVerbs.TryMeleeAttack: PRE: BigAndSmall.TryMeleeAttack_MeleeAbility_Patch.Prefix post: VanillaTraitsExpanded.TryMeleeAttack_Patch.Postfix | |
| Pawn_MindState.Notify_DamageTaken: post: Bestiary.NotifyDamageTakenPatch.Notify_DamageTakenPostfix | |
| Pawn_MindState.StartFleeingBecauseOfPawnAction: PRE: VEF.AnimalBehaviours.VanillaExpandedFramework_Pawn_MindState_StartFleeingBecauseOfPawnAction_Patch.DontFlee, VFEInsectoids.Pawn_MindState_StartFleeingBecauseOfPawnAction_Patch.Prefix | |
| Pawn_MutantTracker.GetGizmos: post: AnomaliesExpected.HarmonyPatches.T_GetGizmos_Postfix | |
| Pawn_MutantTracker.Revert: (no patches) | |
| Pawn_NeedsTracker.AddNeed: PRE: [2147483647]VREAndroids.Pawn_NeedsTracker_AddNeed_Patch.Prefix | |
| Pawn_NeedsTracker.AddOrRemoveNeedsAsAppropriate: PRE: VEF.AestheticScaling.VanillaExpandedFramework_Pawn_NeedsTracker_AddOrRemoveNeedsAsAppropriate_Patch.Prefix, BigAndSmall.AddOrRemoveNeedsAsAppropriate_Patch.Prefix post: VEF.AestheticScaling.VanillaExpandedFramework_Pawn_NeedsTracker_AddOrRemoveNeedsAsAppropriate_Patch.Postfix, BigAndSmall.AddOrRemoveNeedsAsAppropriate_Patch.Postfix, BetterRomance.HarmonyPatches.Pawn_NeedsTracker_AddOrRemoveNeedsAsAppropriate.Postfix | |
| Pawn_NeedsTracker.BindDirectNeedFields: post: VREAndroids.Pawn_NeedsTracker_BindDirectNeedFields_Patch.Postfix | |
| Pawn_NeedsTracker.RemoveNeed: PRE: VAspirE.AspirationsMod.NoRemovePermanent | |
| Pawn_NeedsTracker.ShouldHaveNeed: PRE: [2147483647]SimsTraits.Pawn_NeedsTracker_ShouldHaveNeed_Patch.Prefix, VanillaPsycastsExpanded.Pawn_NeedsTracker_ShouldHaveNeed_Patch.Prefix, BetterRomance.HarmonyPatches.Pawn_NeedsTracker_ShouldHaveNeed.Prefix post: DubsBadHygiene.Patches.HarmonyPatches+Patch_ShouldHaveNeed.Postfix, [-2147483648]VREAndroids.Pawn_NeedsTracker_ShouldHaveNeed_Patch.Postfix, [-2147483648]SimsTraits.Pawn_NeedsTracker_ShouldHaveNeed_Patch.Postfix | |
| Pawn_Ownership.ClaimBedIfNonMedical: PRE: EBSGFramework.HarmonyPatches.ClaimBedIfNonMedicalPrefix | |
| Pawn_PathFollower.AtDestinationPosition: PRE: VEF.Weapons.VanillaExpandedFramework_Pawn_PathFollower_AtDestinationPosition_Patch.Prefix | |
| Pawn_PathFollower.BuildingBlockingNextPathCell: PRE: VEF.Hediffs.PhasingPatches.NoBuildingBlocking | |
| Pawn_PathFollower.CostToMoveIntoCell: PRE: VanillaRacesExpandedInsector.Pawn_PathFollower_CostToMoveIntoCell_Patch.Prefix post: VEF.AnimalBehaviours.VanillaExpandedFramework_Pawn_PathFollower_CostToMoveIntoCell_Patch.DisablePathCostForFloatingCreatures, EBSGFramework.HarmonyPatches.CostToMoveIntoCellPostfix TRANS: VEF.Genes.VanillaExpandedFramework_Pawn_PathFollower_CostToMoveIntoCell.Transpiler, VEF.Hediffs.PhasingPatches.CostToMoveIntoCell_Transpile | |
| Pawn_PathFollower.SetupMoveIntoNextCell: post: DubsBadHygiene.Patches.HarmonyPatches+Patch_SetupMoveIntoNextCell.Postfix | |
| Pawn_PathFollower.StartPath: PRE: Vehicles.Patch_VehiclePathing.StartVehiclePath, VEF.Hediffs.PhasingPatches.StartPath_Prefix post: VEF.Hediffs.PhasingPatches.StartPath_Postfix | |
| Pawn_PathFollower.TryEnterNextPathCell: post: VEF.Hediffs.PhasingPatches.UnfogEnteredCells | |
| Pawn_PathFollower.TryRecoverFromUnwalkablePosition: TRANS: AchtungMod.Pawn_PathFollower_TryRecoverFromUnwalkablePosition_Patch.Transpiler | |
| Pawn_PlayerSettings.get_RespectsAllowedArea: post: AchtungMod.Pawn_PlayerSettings_RespectsAllowedArea_Patch.Postfix, VFEInsectoids.Pawn_PlayerSettings_RespectsAllowedArea_Patch.Postfix | |
| Pawn_PsychicEntropyTracker.GainPsyfocus_NewTemp: post: VanillaPsycastsExpanded.Pawn_EntropyTracker_GainPsyfocus_Postfix.Postfix | |
| Pawn_PsychicEntropyTracker.GetGizmo: PRE: VanillaPsycastsExpanded.Pawn_EntropyTracker_GetGizmo_Prefix.Prefix | |
| Pawn_PsychicEntropyTracker.Notify_Meditated: post: VAEInsanity.Pawn_PsychicEntropyTracker_Notify_Meditated_Patch.Postfix | |
| Pawn_PsychicEntropyTracker.OffsetPsyfocusDirectly: post: VanillaPsycastsExpanded.Pawn_EntropyTracker_OffsetPsyfocusDirectly_Postfix.Postfix | |
| Pawn_PsychicEntropyTracker.PsychicEntropyTrackerTickInterval: TRANS: VanillaPsycastsExpanded.MinHeatPatches.Transpiler | |
| Pawn_PsychicEntropyTracker.RechargePsyfocus: PRE: VanillaPsycastsExpanded.Pawn_EntropyTracker_RechargePsyfocus_Postfix.Prefix | |
| Pawn_PsychicEntropyTracker.RemoveAllEntropy: TRANS: VanillaPsycastsExpanded.MinHeatPatches.Transpiler | |
| Pawn_PsychicEntropyTracker.TryAddEntropy: PRE: VPEHemosage.Pawn_PsychicEntropyTracker_TryAddEntropy_Patch.Prefix TRANS: VanillaPsycastsExpanded.MinHeatPatches.Transpiler | |
| Pawn_PsychicEntropyTracker.get_MaxEntropy: TRANS: VanillaPsycastsExpanded.Pawn_PsychicEntropyTracker_OptimizeGetters_Patch.Transpiler | |
| Pawn_PsychicEntropyTracker.get_MaxPotentialEntropy: TRANS: VanillaPsycastsExpanded.Pawn_PsychicEntropyTracker_OptimizeGetters_Patch.Transpiler | |
| Pawn_PsychicEntropyTracker.get_PsyfocusFallPerDay: post: EBSGFramework.HarmonyPatches.PsyfocusFallPerDayPostFix | |
| Pawn_RelationsTracker.AddDirectRelation: PRE: VanillaSocialInteractionsExpanded.AddDirectRelation_Patch.Prefix post: ReSpliceCharmweavers.Pawn_RelationsTracker_AddDirectRelation_Patch.Postfix | |
| Pawn_RelationsTracker.CompatibilityWith: PRE: BetterRomance.HarmonyPatches.Pawn_RelationsTracker_CompatibilityWith.Prefix post: RimEffectAR.CompatibilityWith_Patch.Postfix, [200]BigAndSmall.RomancePatches.CompatibilityWith_Postfix TRANS: BetterRomance.HarmonyPatches.Pawn_RelationsTracker_CompatibilityWith.Transpiler | |
| Pawn_RelationsTracker.ExposeData: post: VEF.Pawns.VanillaExpandedFramework_Pawn_RelationsTracker_ExposeData_Patch.Postfix | |
| Pawn_RelationsTracker.GainedOrLostDirectRelation: post: VAspirE.SatisfactionPatches.CheckGeneral | |
| Pawn_RelationsTracker.LovinAgeFactor: PRE: [2147483647]VREAndroids.Pawn_RelationsTracker_LovinAgeFactor_Patch.Prefix, BetterRomance.HarmonyPatches.Pawn_RelationsTracker_LovinAgeFactor.Prefix | |
| Pawn_RelationsTracker.Notify_PawnSold: post: ReSpliceCharmweavers.Pawn_RelationsTracker_Notify_PawnSold_Patch.Postfix | |
| Pawn_RelationsTracker.OpinionExplanation: TRANS: VFEEmpire.HarmonyPatches.Patch_HonorsMisc+RelationsPatches.Transpiler | |
| Pawn_RelationsTracker.OpinionOf: PRE: [2147483647]VREAndroids.Pawn_RelationsTracker_OpinionOf_Patch.Prefix post: SimsTraits.Pawn_RelationsTracker_OpinionOf_Patch.Postfix, VAEInsanity.Pawn_RelationsTracker_OpinionOf_Patch.Postfix TRANS: VFEEmpire.HarmonyPatches.Patch_HonorsMisc+RelationsPatches.Transpiler | |
| Pawn_RelationsTracker.PrettinessFactor: PRE: BetterRomance.HarmonyPatches.Pawn_RelationsTracker_PrettinessFactor.Prefix post: AlphaGenes.AlphaGenes_Pawn_RelationsTracker_PrettinessFactor_Patch.NoUgliness | |
| Pawn_RelationsTracker.SecondaryLovinChanceFactor: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix, BetterRomance.HarmonyPatches.Pawn_RelationsTracker_SecondaryLovinChanceFactor.Prefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix, EBSGFramework.HarmonyPatches.SecondaryLovinChanceFactorPostFix, ReSpliceCharmweavers.Pawn_RelationsTracker_SecondaryLovinChanceFactor_Patch.Postfix, RimEffectAR.SecondaryLovinChanceFactor_Patch.Postfix, [200]BigAndSmall.RomancePatches.LovingFactorPostfix TRANS: BigAndSmall.RomancePatches.LovingFactor_Transpiler, RimEffectAR.SecondaryLovinChanceFactor_Patch.Transpiler | |
| Pawn_RelationsTracker.SecondaryRomanceChanceFactor: post: ReSpliceCharmweavers.Pawn_RelationsTracker_SecondaryRomanceChanceFactor_Patch.Postfix, [200]BigAndSmall.RomancePatches.RomanceFactorPostfix | |
| Pawn_RelationsTracker.SetPregnancyApproach: post: VEF.Pawns.VanillaExpandedFramework_Pawn_RelationsTracker_SetPregnancyApproach_Patch.Postfix | |
| Pawn_RotationTracker.UpdateRotation: PRE: Vehicles.Patch_Rendering.UpdateVehicleRotation | |
| Pawn_RoyaltyTracker.CanRequireBedroom: PRE: [2147483647]VREAndroids.Pawn_RoyaltyTracker_CanRequireBedroom_Patch.Prefix | |
| Pawn_RoyaltyTracker.GainFavor: PRE: SimsTraits.Pawn_RoyaltyTracker_GainFavor_Patch.Prefix | |
| Pawn_RoyaltyTracker.HighestTitleWithBedroomRequirements: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| Pawn_RoyaltyTracker.OnPostTitleChanged: post: VAspirE.SatisfactionPatches.CheckGeneral, VanillaPersonaWeaponsExpanded.Pawn_RoyaltyTracker_OnPostTitleChanged.Postfix, VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_Pawn_RoyaltyTracker_OnPostTitleChanged_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_Pawn_RoyaltyTracker_OnPostTitleChanged_Patch.RemoveMajordomoRole | |
| Pawn_RoyaltyTracker.ReduceTitle: post: VFEEmpire.HarmonyPatches.ColonistTitleCache+RoyaltyTracker.Postfix | |
| Pawn_RoyaltyTracker.SetTitle: post: VFEEmpire.HarmonyPatches.ColonistTitleCache+RoyaltyTracker.Postfix | |
| Pawn_RoyaltyTracker.TryRemoveFavor: post: VanillaMemesExpanded.VanillaMemesExpanded_Pawn_RoyaltyTracker_TryRemoveFavor_Patch.AddExtraFavor | |
| Pawn_RoyaltyTracker.UpdateRoyalTitle: post: VFEEmpire.HarmonyPatches.ColonistTitleCache+RoyaltyTracker.Postfix | |
| Pawn_RoyaltyTracker.get_AllTitlesForReading: post: SimsTraits.Pawn_RoyaltyTracker_AllTitles_Patch.Postfix | |
| Pawn_RoyaltyTracker.get_AllTitlesInEffectForReading: post: SimsTraits.Pawn_RoyaltyTracker_AllTitles_Patch.Postfix | |
| Pawn_RoyaltyTracker_OnPostTitleChanged.Postfix: (no patches) | |
| Pawn_SkillTracker.Learn: PRE: VanillaPsycastsExpanded.Pawn_SkillTracker_Learn_Patch.Prefix post: VEF.Genes.VanillaExpandedFramework_Pawn_SkillTracker_Learn_Patch.GiveRecreation | |
| Pawn_StanceTracker.CancelBusyStanceSoft: post: PsiTech.Utility.CancelSoftPatch.Postfix | |
| Pawn_StanceTracker.SetStance: PRE: MVCF.PatchSets.PatchSet_IndependentVerbs.Pawn_StanceTracker_SetStance | |
| Pawn_StoryTracker.ExposeData: PRE: VREAndroids.Pawn_StoryTracker_ExposeData_Patch.Prefix | |
| Pawn_StoryTracker.TryGetRandomHeadFromSet: PRE: [2147483647]VREAndroids.Pawn_StoryTracker_TryGetRandomHeadFromSet_Patch.Prefix, [0]BigAndSmall.HarmonyPatches+TryGetRandomHeadFromSet_Patch.Prefix post: [800]BigAndSmall.HarmonyPatches+TryGetRandomHeadFromSet_Patch.Postfix | |
| Pawn_StoryTracker.get_SkinColor: post: [-2147483648]VREAndroids.Pawn_StoryTracker_SkinColor_Patch.Postfix | |
| Pawn_StyleTracker.get_CanDesireLookChange: PRE: [2147483647]VREAndroids.Pawn_StyleTracker_CanDesireLookChange_Patch.Prefix, [2147483647]BigAndSmall.MechanicalColonistPatches.CanDesireLookChangePrefix | |
| Pawn_TraderTracker.ColonyThingsWillingToBuy: PRE: MapWideTradeBeacon.Patcher.TargetPT post: [-2147483648]ReSpliceCore.Pawn_TraderTracker_ColonyThingsWillingToBuy_Patch.Postfix | |
| Pawn_TrainingTracker.TrainingTrackerTickRare: TRANS: AnimalsLogic.ForgetMeNot+Pawn_TrainingTracker_TrainingTrackerTickRare_Patch.Transpiler, VFEInsectoids.Pawn_TrainingTracker_TrainingTrackerTickRare_Patch.Transpiler | |
| Pawn_WorkSettings.Notify_DisabledWorkTypesChanged: post: BigAndSmall.Pawn_WorkSettings_Notify_DisabledWorkTypesChanged.Postfix | |
| Pawn_WorkSettings.WorkIsActive: post: AchtungMod.Pawn_WorkSettings_WorkIsActive_Patch.Postfix | |
| PawnsArrivalModeWorker.CanUseWith: post: BigAndSmall.PawnsArrivalModeWorker_CanUseWith.Postfix, VFEInsectoids.PawnsArrivalModeWorker_CanUseWith_Patch.Postfix, [200]GeologicalLandforms.Patches.Patch_RimWorld_PawnsArrivalModeWorker.CanUseWith | |
| PawnsArrivalModeWorker_Airdrop.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_ArchonRaidArrival.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_CenterDrop.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_ClusterDrop.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeDrop.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeDropGroups.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeWalkIn.Arrive: PRE: EnterHere.PawnsArrivalModeWorker_EdgeWalkIn_Arrive.Prefix post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeWalkInDarkness.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeWalkInDistributed.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeWalkInDistributedGroups.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeWalkInGroups.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EdgeWalkInHateChanters.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EmergeFromAsh.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_EmergeFromWater.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_Gauntlet.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_InfestedMeteorRaid.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_RandomDrop.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsArrivalModeWorker_SpecificLocationDrop.Arrive: post: VEF.Storyteller.RaidPatches.RaidGroupChecker, VanillaSocialInteractionsExpanded.RaidPatches.RaidGroupChecker | |
| PawnsFinder.get_AllCaravansAndTravellingTransporters_AliveOrDead: post: Vehicles.Patch_MapPawns.AllAerialVehicles_AliveOrDead | |
| PawnsFinder.get_AllMapsCaravansAndTravellingTransporters_Alive_OfPlayerFaction: post: Vehicles.Patch_MapPawns.AllMapsVehiclePassengers_Alive_OfPlayerFaction | |
| PawnsFinder.get_Temporary: (no patches) | |
| PitGate.BeginCollapsing: post: VAEInsanity.PitGate_BeginCollapsing_Patch.Postfix | |
| PitGate.FireRandomIncidentByWeight: PRE: VanillaExplorationExpanded.VanillaExplorationExpanded_PitGate_FireRandomIncidentByWeight_Patch.DetectInertPitGate | |
| PitGate.TryFireIncident: TRANS: VisibleRaidPoints.Patch_PitGate_TryFireIncident.Transpiler | |
| PlaceWorker_BuildingsValidOverSubstructure.AllowsPlacing: TRANS: VanillaGravshipExpanded.PlaceWorker_BuildingsValidOverSubstructure_AllowsPlacing_Patch.Transpiler | |
| PlaceWorker_CocoonTriggerRadius.DrawGhost: (no patches) | |
| PlaceWorker_CompCustomCauseHediff_AoE.DrawGhost: (no patches) | |
| PlaceWorker_EBSGPlaceworker.AllowsPlacing: (no patches) | |
| PlaceWorker_GathererTerrain.AllowsPlacing: (no patches) | |
| PlaceWorker_GlowRadius.DrawGhost: (no patches) | |
| PlaceWorker_GravshipThruster.DrawGhost: (no patches) | |
| PlaceWorker_IceUserGrid.GetComponentProperties: (no patches) | |
| PlaceWorker_IceUserGrid.GetOverlapCells: (no patches) | |
| PlaceWorker_InRangeOfGravEngine.AllowsPlacing: TRANS: VanillaGravshipExpanded.PlaceWorker_InRangeOfGravEngine_AllowsPlacing_Patch.Transpiler | |
| PlaceWorker_InRangeOfGravEngine.DrawGhost: TRANS: VanillaGravshipExpanded.PlaceWorker_InRangeOfGravEngine_DrawGhost_Patch.Transpiler | |
| PlaceWorker_InRangeOfGravSource.AllowsPlacing: (no patches) | |
| PlaceWorker_InRangeOfGravSource.DrawGhost: (no patches) | |
| PlaceWorker_LuciferiumPump.DrawGhost: (no patches) | |
| PlaceWorker_NeuroclearConsole.WillWork: (no patches) | |
| PlaceWorker_NoiseSource.DrawGhost: (no patches) | |
| PlaceWorker_OxygenPusher.GetOffsetCell: (no patches) | |
| PlaceWorker_Pipe.AllowsPlacing: (no patches) | |
| PlaceWorker_PollutionPump.DrawGhost: (no patches) | |
| PlaceWorker_PollutionPumpArtificialBuildings.DrawGhost: (no patches) | |
| PlaceWorker_ShowCauseHediffAoE.DrawGhost: (no patches) | |
| PlaceWorker_ShowCauseHediffAoEExpanded.DrawGhost: (no patches) | |
| PlaceWorker_ShowCompSendSignalOnPawnProximityRadius.DrawGhost: (no patches) | |
| PlaceWorker_ShowExplosionRadius.DrawGhost: (no patches) | |
| PlaceWorker_ShowFacilitiesRange.DrawGhost: (no patches) | |
| PlaceWorker_ShowMotionDetectionRadius.DrawGhost: (no patches) | |
| PlaceWorker_ShowProjectileInterceptorRadius.DrawGhost: (no patches) | |
| PlaceWorker_ShowTurretRadius.AllowsPlacing: TRANS: VFED.HarmonyPatches.MiscPatches.FixPlaceworkerForLargeRadius | |
| PlaceWorker_SmokeCloudMaker.DrawGhost: (no patches) | |
| PlaceWorker_StableEnough.AllowsPlacing: (no patches) | |
| PlaceWorker_StableEnough.DrawGhost: (no patches) | |
| PlaceWorker_ToxifierGenerator.DrawGhost: (no patches) | |
| PlaceWorker_UserGrid.DrawGhost: (no patches) | |
| PlaceWorker_VariablePollutionPumpArtificialBuildings.DrawGhost: (no patches) | |
| Plant.CropBlighted: post: ReGrowthCore.AutoCutIfBlighted.Postfix | |
| Plant.IngestedCalculateAmounts: PRE: GrazeUp.Patch.PatchPlant_IngestedCalculateAmounts.Prefix | |
| Plant.MakeLeafless: PRE: ReGrowthCore.AutoCutIfDying.Prefix | |
| Plant.PlantCollected: PRE: VEF.Plants.VanillaExpandedFramework_Plant_PlantCollected_Patch.AddSecondaryOutput, VanillaExplorationExpanded.VanillaExplorationExpanded_Plant_PlantCollected_Patch.AddSecondaryOutput, VanillaPlantsExpanded.VanillaCookingExpanded_Plant_PlantCollected_Patch.AccessMap post: VanillaPlantsExpanded.VanillaCookingExpanded_Plant_PlantCollected_Patch.RemoveTilled | |
| Plant.PostMapInit: post: VEE.Plant_PostMapInit_Patch.Postfix | |
| Plant.SpawnSetup: post: AlphaMemes.AlphaMemes_Plant_SpawnSetup_Patch.SetPlantFertility | |
| Plant.TickLong: PRE: [2147483647]PerformanceOptimizer.Optimization_Plant_TickLong.Prefix post: VEE.Plant_TickLong_Patch.Postfix TRANS: PerformanceOptimizer.Optimization_Plant_TickLong.Transpiler | |
| Plant.TrySpawnStump: post: AlphaMemes.AlphaMemes_Plant_TrySpawnStump_Patch.NotifyGauranlenTreeDead | |
| Plant.YieldNow: post: AlphaMemes.AlphaMemes_Plant_YieldNow_Patch.IncreaseTeaYield, VanillaMemesExpanded.VanillaMemesExpanded_Plant_YieldNow_Patch.IncreaseTreeCuttingYield | |
| Plant.get_Graphic: PRE: ReGrowthCore.Plant_Graphic_Patch.Prefix post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Plant.get_GrowthRate: post: AlphaMemes.AlphaMemes_Plant_GrowthRate_Patch.GetPlantFertility, VEE.Plant_GrowthRate_Patch.Postfix, VSEWW.Plant_GrowthRate.Postfix | |
| Plant.get_GrowthRateFactor_Drought: post: VanillaExplorationExpanded.VanillaExplorationExpanded_Plant_GrowthRateFactor_Drought_Patch.DetectFertileRains | |
| Plant.get_GrowthRateFactor_Light: post: ReGrowthCore.Plant_GrowthRateFactor_Light_Patch.Postfix | |
| Plant.get_IngestibleNow: PRE: GrazeUp.Patch.PatchPlant_GetIngestibleNow.Prefix | |
| PlantFallColors.GetFallColorFactor: PRE: [2147483647]PerformanceOptimizer.Optimization_PlantFallColors_GetFallColorFactor.Prefix post: ReGrowthCore.PlantFallColors_GetFallColorFactor_Patch.Postfix, [-2147483648]PerformanceOptimizer.Optimization_PlantFallColors_GetFallColorFactor.Postfix | |
| PlantProperties.get_LifespanDays: post: GrazeUp.Patch.PatchPlantProperties_GetLifespanDays.Postfix | |
| PlantToGrowSettableUtility.SetPlantToGrowCommand: PRE: ProgressionAgriculture.PlantToGrowSettableUtility_SetPlantToGrowCommand_Patch.Prefix | |
| PlantUtility.CanEverPlantAt: post: AlphaBiomes.AlphaBiomes_PlantUtility_CanEverPlantAt_Patch.DetectMaxFertility, ReGrowthCore.CanEverPlantAt_Patch.Postfix | |
| PlantUtility.CanSowOnGrower: post: VFEF.VFEF_PlantUtility_CanSowOnGrower_Patch.Postfix, ProgressionAgriculture.PlantUtility_CanSowOnGrower_Patch.Postfix, Mashed_Ashlands.PlantUtility_CanSowOnGrower_Patch.Postfix, VanillaPlantsExpandedMorePlants.VanillaPlantsExpandedMorePlants_PlantUtility_CanSowOnGrower_Patch.SowTagsOnAquaticPlants, VanillaPlantsExpandedMushrooms.VanillaPlantsExpandedMushrooms_PlantUtility_CanSowOnGrower_Patch.SowTagsOnAquaticPlants TRANS: VEF.Plants.VanillaExpandedFramework_PlantUtility_CanSowOnGrower_Patch.Transpiler | |
| PlantUtility.ValidPlantTypesForGrowers: post: ProgressionAgriculture.PlantUtility_ValidPlantTypesForGrowers_Patch.Postfix | |
| Plant_PostMapInit_Patch.Postfix: (no patches) | |
| Plant_Thermoregulating.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Plant_WinterBlooming.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Plant_WinterBlooming.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| PlayDataLoader.DoPlayLoad: post: HugsLib.Patches.PlayDataLoader_Patch.InitModsHook | |
| PlayDataLoader.ResetStaticDataPost: PRE: AdaptiveStorage.HarmonyPatches.InitializeGraphicsDefs.PlayDataLoadingFinished | |
| PlayLog.Add: post: Bubbles.Access.Verse_PlayLog_Add.Postfix | |
| PlayLogEntryUtility.RulesForOptionalWeapon: post: MVCF.PatchSets.PatchSet_BatteLog.PlayLogEntryUtility_RulesForOptionalWeapon_Postfix | |
| PlaySettings.DoPlaySettingsGlobalControls: post: DubsMintMinimap.H_DoPlaySettingsGlobalControls.Postfix, FactionCustomizer.PlaySettingPatch.DoPlaySettingsGlobalControls, Bubbles.Access.RimWorld_PlaySettings_DoPlaySettingsGlobalControls.Postfix, RimHUD.Access.Patch.RimWorld_PlaySettings_DoPlaySettingsGlobalControls.Postfix, Worldbuilder.PlaySettings_DoPlaySettingsGlobalControls_Patch.Postfix, FacialAnimation.HarmonyPatches.PostfixDoPlaySettingsGlobalControls, AnomaliesExpected.HarmonyPatches.PC_DoPlaySettingsGlobalControls_Postfix, VHelixienGasE.PlaySettings_DoPlaySettingsGlobalControls.Postfix, ReGrowthCore.PlaySettings_DoPlaySettingsGlobalControls_Patch.Postfix | |
| PlayerItemAccessibilityUtility.Accessible: post: ProgressionAgriculture.PlayerItemAccessibilityUtility_Accessible_Patch.Postfix | |
| PlayerItemAccessibilityUtility.PlayerOrQuestRewardHas: (no patches) | |
| PlayerItemAccessibilityUtility.PlayerOrQuestRewardHas: (no patches) | |
| PlayerItemAccessibilityUtility.PossiblyAccessible: post: ProgressionAgriculture.PlayerItemAccessibilityUtility_PossiblyAccessible_Patch.Postfix | |
| PlayerItemAccessibilityUtility_Accessible_Patch.Postfix: (no patches) | |
| PlayerItemAccessibilityUtility_PossiblyAccessible_Patch.Postfix: (no patches) | |
| PlayerKnowledgeDatabase.ReloadAndRebind: PRE: VEF.DefIndicesFixer.Prefix | |
| PollutionGrid.SetPolluted: post: ReGrowthCore.PollutionGrid_SetPolluted_Patch.Postfix | |
| PollutionInfo.MapRemoved: (no patches) | |
| PollutionUtility.PawnPollutionTickInterval: post: Mashed_Ashlands.BiotechHarmonyPatches.PollutionUtility_PawnPollutionTickInterval_Patch | |
| PollutionUtility.StimulatedByPollution: post: Mashed_Ashlands.BiotechHarmonyPatches.PollutionUtility_StimulatedByPollution_Patch | |
| PortraitsCache.Get: PRE: Worldbuilder.PortraitsCache_Get_Patch.Prefix | |
| PowerBeam.StartStrike: post: VFEEmpire.HarmonyPatches.Patch_PowerBeam_StartStrike.Postfix | |
| PowerNet.PowerNetTick: post: VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_PowerNet_PowerNetTick_Patch.PowerBatteries TRANS: VanillaQuestsExpandedTheGenerator.VanillaQuestsExpandedTheGenerator_PowerNet_PowerNetTick_Patch.PowerNetOnSolarFlareTranspiler | |
| PowerNetGraphics.PrintWirePieceConnecting: PRE: ReBuildDoorsAndCorners.PowerNetGraphics_PrintWirePieceConnecting_Patch.Prefix | |
| PreceptComp_BedThought.HasActiveLinkedFacility: post: GlitterNet.SleepAcceleratorPatch.Postfix | |
| Precept_GravshipLaunch.ExposeData: PRE: VanillaGravshipExpanded.Precept_GravshipLaunch_ExposeData_Patch.Prefix post: VanillaGravshipExpanded.Precept_GravshipLaunch_ExposeData_Patch.Postfix | |
| Precept_Relic.GenerateNameRaw: (no patches) | |
| Precept_Relic.Notify_ThingLost: PRE: AlphaMemes.AlphaMemes_Precept_Relic_Notify_ThingLost_Patch.DontNotifyForIconoclasts | |
| Precept_Ritual.AddObligation: PRE: AlphaMemes.Precept_Ritual_AddObligation.Prefix | |
| Precept_Ritual.ShouldShowGizmo: post: VFETribals.Precept_Ritual_ShouldShowGizmo_Patch.Postfix | |
| Precept_Ritual.ShowRitualBeginWindow: PRE: VanillaGravshipExpanded.Dialog_BeginRitual_ShowRitualBeginWindow_Patch.Prefix | |
| Precept_Role.GenerateNewApparelRequirements: PRE: NoRandomApparelOnIdeoEdit.Harmony.Patches.PatchPreceptRoleGenerateApparelRequirements.Prefix | |
| Precept_Role.get_DisabledWorkTypes: post: VanillaMemesExpanded.VanillaMemesExpanded_Precept_Role_DisabledWorkTypes_Patch.DisableDumbLabor | |
| Precept_RoleMulti.Assign: post: VAspirE.SatisfactionPatches.CheckArgP | |
| Precept_RoleMulti.RecacheActivity: PRE: [2147483647]PerformanceOptimizer.Optimization_Precept_RoleMulti_RecacheActivity.Prefix | |
| Precept_RoleSingle.Assign: post: VAspirE.SatisfactionPatches.CheckArgP | |
| Precept_RoleSingle.RecacheActivity: PRE: [2147483647]PerformanceOptimizer.Optimization_Precept_RoleSingle_RecacheActivity.Prefix | |
| Prefs.get_DevMode: PRE: Analyzer.DebugLogenabler.DevModePrefix | |
| Prefs.set_ResourceReadoutCategorized: post: ToggleableReadouts.ResetCache.Postfix | |
| PregnancyUtility.ApplyBirthOutcome: PRE: BigAndSmall.PregnancyPatches.ApplyBirthOutcome_Prefix, ReSpliceCharmweavers.PregnancyUtility_ApplyBirthOutcome_Patch.Prefix post: AlphaMemes.AlphaMemes_PregnancyUtility_ApplyBirthOutcome_Patch.DevelopmentPointsForChildbirth, VanillaRacesExpandedWaster.VanillaRacesExpandedWaster_PregnancyUtility_ApplyBirthOutcome_Patch.IncreaseInstability, ReSpliceCharmweavers.PregnancyUtility_ApplyBirthOutcome_Patch.Postfix, VSIERationalTraitDevelopment.PregnancyUtility_ApplyBirthOutcome_Patch.Postfix, [200]BGInheritance.HarmonyPatches.ApplyBirthOutcomePostfix | |
| PregnancyUtility.ChanceMomDiesDuringBirth: post: AlphaMemes.AlphaMemes_PregnancyUtility_ChanceMomDiesDuringBirth_Patch.RemoveMaternalMortality | |
| PregnancyUtility.GetInheritedGenes: PRE: BGInheritance.HarmonyPatches.InheritancePrefix post: VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_PregnancyUtility_GetInheritedGenes_Patch.CalculateDominance, RimEffectAR.DomGene_Patches+RE_GetInheritedGenes_Patch.Postfix | |
| PregnancyUtility.PregnancyChanceForPartners: post: VEF.Pawns.VanillaExpandedFramework_PregnancyUtility_PregnancyChanceForPartners_Patch.Postfix | |
| Printer_Plane.PrintPlane: PRE: Worldbuilder.Printer_Plane_PrintPlane_Patch.Prefix, ReGrowthCore.Printer_Plane_PrintPlane_Patch.Prefix | |
| Printer_Shadow.PrintShadow: PRE: ReGrowthCore.Patch_PrintShadow.Prefix | |
| PriorityWork.ClearPrioritizedWorkAndJobQueue: post: BigAndSmall.DraftGizmos.ClearPrioritizedWorkAndJobQueuePostfix, AchtungMod.PriorityWork_ClearPrioritizedWorkAndJobQueue_Patch.Postfix | |
| PriorityWork.GetGizmos: post: AchtungMod.PriorityWork_GetGizmos_Patch.Postfix | |
| Profectus.CanResearch: post: ProgressionCore.Profectus_CanResearch_Patch.Postfix | |
| ProficiencyUtility.GetTechLevelForInt: (no patches) | |
| Projectile.CanHit: PRE: Vehicles.Patch_Combat.TurretHitFlags | |
| Projectile.CheckForFreeIntercept: post: VEF.Weapons.TeslaProjectile+ProjectilePatches.Postfix TRANS: Vehicles.Patch_Combat.VehicleProjectileInterceptor, VEF.Pawns.VanillaExpandedFramework_Projectile_CheckForFreeIntercept_Patch.Transpiler, VEF.Weapons.VanillaExpandedFramework_Projectile_SetTrueOrigin_Patch.Transpiler | |
| Projectile.CheckForFreeInterceptBetween: TRANS: VEF.Weapons.VanillaExpandedFramework_Projectile_SetTrueOrigin_Patch.Transpiler | |
| Projectile.Impact: PRE: VEF.Weapons.VanillaExpandedFramework_Projectile_Impact_Patch.Prefix, RimEffect.Impact_Patch.Prefix, EBSGFramework.HarmonyPatches.ProjectileImpactPrefix, Gunplay.Patch.PatchProjectileImpact.Prefix | |
| Projectile.ImpactSomething: post: VEF.Weapons.TeslaProjectile+ProjectilePatches.Postfix TRANS: Vehicles.Patch_Combat.VehicleProjectileChanceToHit, VEF.Pawns.VanillaExpandedFramework_Projectile_ImpactSomething_Patch.Transpiler, VEF.Weapons.VanillaExpandedFramework_Projectile_SetTrueOrigin_Patch.Transpiler | |
| Projectile.Launch: PRE: RimEffect.Launch_Patch.Prefix post: VEF.Weapons.VanillaExpandedFramework_Projectile_Launch_Patch.Postfix, Gunplay.Patch.PatchProjectileLaunch.Postfix | |
| Projectile.Tick: post: VEF.Weapons.VanillaExpandedFramework_Projectile_Tick_Patch.Postfix | |
| Projectile.get_DamageAmount: post: VEF.Pawns.VanillaExpandedFramework_Projectile_DamageAmount_Patch.Postfix | |
| Projectile.get_HitFlags: post: VFEMedieval.Projectile_HitFlags_Patch.Postfix | |
| Projectile.get_StartingTicksToImpact: post: Vehicles.Patch_Combat.StartingTicksFromTurret, Gunplay.Patch.PatchProjectileStartingTicksToImpact.Postfix | |
| ProjectileProperties.GetArmorPenetration: post: VCR.AdvanceArmor_postfix.Postfix TRANS: VFEMedieval.ProjectileProperties_GetArmorPenetration_Patch.Transpiler | |
| Projectile_Explosive.Impact: PRE: Vehicles.Patch_Combat.ImpactExplosiveProjectiles | |
| PsiTechSettings.DoWindowContents: (no patches) | |
| PsiTechTracker.ActivateTracker: (no patches) | |
| PsiTechTracker.AddAbility: (no patches) | |
| PsychicRitualDef_InvocationCircle.CalculateFacilityQualityOffset: (no patches) | |
| PsychicRitualDef_Psychophagy.OutcomeDescription: (no patches) | |
| PsychicRitualRoleDef.PawnCanDo: post: BigAndSmall.MechanicalColonistPatches.PawnCanDo_Prefix | |
| PsychicRitualToil_AEConnectEntityDatabase.ApplyOutcome: (no patches) | |
| PsychicRitualToil_Brainwipe.ApplyOutcome: (no patches) | |
| PsychicRitualToil_NeurosisPulse.ApplyOutcome: (no patches) | |
| PsychicRitualToil_PleasurePulse.ApplyOutcome: (no patches) | |
| PsychicRitualToil_Psychophagy.ApplyOutcome: (no patches) | |
| PsychicRitualToil_SkipAbduction.ApplyOutcome: (no patches) | |
| PsychicRitualToil_SkipAbductionPlayer.ApplyOutcome: (no patches) | |
| PsychicRitualToil_SummonFleshbeastsCultist.ApplyOutcome: TRANS: VisibleRaidPoints.Patch_PsychicRitualToil_SummonFleshbeastsCultist_ApplyOutcome.Transpiler | |
| PsychicRitualToil_SummonFleshbeastsPlayer.SpawnFleshbeasts: TRANS: VisibleRaidPoints.Patch_PsychicRitualToil_SummonFleshbeastsPlayer_SpawnFleshbeasts.Transpiler | |
| PsychicRitualToil_SummonFleshbeastsPlayer.Start: TRANS: VisibleRaidPoints.Patch_PsychicRitualToil_SummonFleshbeastsPlayer_Start.Transpiler | |
| PsychicRitualToil_SummonShamblers.Start: TRANS: VisibleRaidPoints.Patch_PsychicRitualToil_SummonShamblers_Start.Transpiler | |
| PsychicRitualToil_VoidProvocation.ApplyOutcome: (no patches) | |
| QualityUtility.GenerateQualityCreatedByPawn: PRE: [800]VanillaTraitsExpanded.GenerateQualityCreatedByPawn_Patch.Prefix post: [800]VanillaTraitsExpanded.GenerateQualityCreatedByPawn_Patch.Postfix, VAspirE.SatisfactionPatches.CheckQuality, SimsTraits.QualityUtility_GenerateQualityCreatedByPawn_Patch.Postfix TRANS: VanillaSocialInteractionsExpanded.GenerateQualityCreatedByPawn_Patch.Transpiler | |
| QualityUtility.GenerateQualityCreatedByPawn: post: CraftingQualityRebalanced.HarmonyPatches.Postfix | |
| QualityUtility.SendCraftNotification: PRE: CraftingQualityRebalanced.HarmonyPatches.Prefix post: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_QualityUtility_SendCraftNotification_Patch.HandleCraftModifications | |
| Quest.CleanupQuestParts: PRE: VEF.Storyteller.VanillaExpandedFramework_Quest_CleanupQuestParts_Patch.Prefix | |
| Quest.End: PRE: VEF.Storyteller.VanillaExpandedFramework_Quest_End_Patch.Prefix post: VFEEmpire.Patch_Quest_End.Postfix, VFED.HarmonyPatches.MiscPatches.CheckForPlotEnd | |
| QuestChainsDevWindow.DoWindowContents: (no patches) | |
| QuestGen.AddSlateQuestTags: post: VEF.Storyteller.VanillaExpandedFramework_QuestGen_AddSlateQuestTags_Patch.Postfix | |
| QuestGen_Misc.Letter: post: VisibleRaidPoints.Patch_QuestGen_Misc_Letter.Postfix | |
| QuestGen_Threat.Raid: TRANS: VisibleRaidPoints.Patch_QuestGen_Threat_Raid.Transpiler | |
| QuestManager.Add: post: VEF.Storyteller.VanillaExpandedFramework_QuestManager_Add_Patch.Postfix | |
| QuestManager.ExposeData: PRE: VanillaGravshipExpanded.QuestManager_ExposeData_Patch.Prefix | |
| QuestNode_GenerateCharmweaver.MakePregnant: (no patches) | |
| QuestNode_GeneratePawn.<>c__DisplayClass22_0.<RunInt>b__0: (no patches) | |
| QuestNode_GeneratePawn.RunInt: PRE: VREAndroids.QuestNode_GeneratePawn_RunInt_Patch.Prefix post: VREAndroids.QuestNode_GeneratePawn_RunInt_Patch.Postfix | |
| QuestNode_GetFaction.IsGoodFaction: post: VEF.Factions.VanillaExpandedFramework_QuestNode_GetFaction_IsGoodFaction_Patch.Postfix | |
| QuestNode_GetNearbySettlement.<>c__DisplayClass0_0.<RandomNearbyTradeableSettlement>g__Validator|0: (no patches) | |
| QuestNode_GetPawn.IsGoodPawn: post: VEF.Factions.VanillaExpandedFramework_QuestNode_GetPawn_IsGoodPawn_Patch.Postfix | |
| QuestNode_GetPawn.RunInt: PRE: VFEC.Senators.SenatorQuests.SetSenatorPawn | |
| QuestNode_GetPawn.TestRunInt: PRE: VFEC.Senators.SenatorQuests.CheckSenatorPawn | |
| QuestNode_GetPawnKind.<>c__DisplayClass7_0.<GetKindDef>g__CanHandle|1: post: VEF.AnimalBehaviours.VanillaExpandedFramework_QuestNode_GetPawnKind_SetVars_CanHandle_Patch.Postfix | |
| QuestNode_GetSiteTile.TryFindTile: (no patches) | |
| QuestNode_Raid.RunInt: TRANS: VisibleRaidPoints.Patch_QuestNode_Raid_RunInt.Transpiler | |
| QuestNode_Root_AncientARCStudy.RunInt: (no patches) | |
| QuestNode_Root_DistressCall.FactionUsable: post: VEF.Factions.VanillaExpandedFramework_QuestNode_Root_DistressCall.Postfix | |
| QuestNode_Root_Gravcore_Mechhive.RunInt: post: VanillaGravshipExpanded.QuestNode_Root_Gravcore_Mechhive_RunInt_Patch.Postfix | |
| QuestNode_Root_Gravship_Wreckage.RunInt: TRANS: VanillaGravshipExpanded.QuestNode_Root_Gravship_Wreckage_RunInt_Patch.Transpiler | |
| QuestNode_Root_Hack_AncientComplex.RunInt: (no patches) | |
| QuestNode_Root_Hack_WorshippedTerminal.RunInt: (no patches) | |
| QuestNode_Root_Loot_AncientComplex.RunInt: (no patches) | |
| QuestNode_Root_Mission_AncientComplex.RunInt: (no patches) | |
| QuestNode_Root_MysteriousCargo.ValidatePawn: PRE: [2147483647]VREAndroids.QuestNode_Root_MysteriousCargo_ValidatePawn_Patch.Prefix | |
| QuestNode_Root_MysteriousCargoUnnaturalCorpse.ValidatePawn: post: ReSpliceCharmweavers.NoUnnaturalCorpseForPawns_Patch.Postfix | |
| QuestNode_Root_PollutionRaid.RunInt: TRANS: VisibleRaidPoints.Patch_QuestNode_Root_PollutionRaid_RunInt.Transpiler | |
| QuestNode_Root_RefugeePodCrash_Ghoul.GeneratePawn: (no patches) | |
| QuestNode_Root_RelicHunt.RunInt: PRE: VFETribals.QuestNode_Root_RelicHunt_RunInt_Patch.Prefix | |
| QuestNode_Root_SanguophageMeetingHost.RunInt: TRANS: VisibleRaidPoints.Patch_QuestNode_Root_SanguophageMeetingHost_RunInt.Transpiler | |
| QuestNode_Root_ShuttleCrash_Rescue.TryFindRaidWalkInPosition: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.TryFindRaidWalkInPosition | |
| QuestNode_Root_WandererJoinAbasia.GeneratePawn: PRE: VREAndroids.QuestNode_Root_WandererJoinAbasia_GeneratePawn_Patch.Prefix post: VREAndroids.QuestNode_Root_WandererJoinAbasia_GeneratePawn_Patch.Postfix | |
| QuestNode_Root_WandererJoin_WalkIn.GeneratePawn: PRE: BigAndSmall.PawnKindSwapPatches.GenerateWandererFactionPrefix | |
| QuestNode_SpawnMechCluster.TestRunInt: post: GeologicalLandforms.Patches.Patch_RimWorld_QuestNode_SpawnMechCluster.TestRunInt | |
| QuestNode_TradeRequest_GetRequestedThing.<>c__DisplayClass4_0.<TryFindRandomRequestedThingDef>g__GlobalValidator|0: (no patches) | |
| QuestPart_ConcludeLastQuest.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_DisableTradeRequest.<>c.<AssignDebugData>b__8_0: (no patches) | |
| QuestPart_DisableTradeRequest.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_EntityArrival.Notify_QuestSignalReceived: TRANS: VisibleRaidPoints.Patch_QuestPart_EntityArrival_Notify_QuestSignalReceived.Transpiler | |
| QuestPart_FlagshipFight.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_Incident.SetIncidentParmsAndRemoveTarget: post: VisibleRaidPoints.Patch_QuestPart_Incident_SetIncidentParmsAndRemoveTarget.Postfix | |
| QuestPart_InitiateTradeRequest.<>c.<AssignDebugData>b__15_0: (no patches) | |
| QuestPart_InitiateTradeRequest.Cleanup: (no patches) | |
| QuestPart_InitiateTradeRequest.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_Letter.ExposeData: post: VisibleRaidPoints.Patch_QuestPart_Letter_ExposeData.Postfix | |
| QuestPart_Letter.Notify_QuestSignalReceived: TRANS: VisibleRaidPoints.Patch_QuestPart_Letter_Notify_QuestSignalReceived.Transpiler | |
| QuestPart_MarkObjectives.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_Noctoliths.SpawnNoctols: TRANS: VisibleRaidPoints.Patch_QuestPart_Noctoliths_SpawnNoctols.Transpiler | |
| QuestPart_RandomRaid.Notify_QuestSignalReceived: TRANS: VisibleRaidPoints.Patch_QuestPart_RandomRaid_Notify_QuestSignalReceived.Transpiler | |
| QuestPart_SignalSystemWakeManager.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_StartDetectionRaids.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_StartNextQuest.Notify_QuestSignalReceived: (no patches) | |
| QuestPart_SubquestGenerator_Gravcores.get_CanGenerateSubquest: TRANS: VanillaGravshipExpanded.QuestPart_SubquestGenerator_Gravcores_CanGenerateSubquest_Patch.Transpiler | |
| QuestPart_ThreatsGenerator.MakeIntervalIncidents: PRE: VisibleRaidPoints.Patch_QuestPart_ThreatsGenerator.Prefix | |
| QuestPart_TradeRequestInactive.QuestPartTick: (no patches) | |
| QuestPart_TransporterPawns_Feed.Process: post: DubsBadHygiene.Patches.HarmonyPatches+Harmony_QuestPart_FeedPawns.Postfix | |
| QuestUtility.IsQuestLodger: PRE: [2147483647]PerformanceOptimizer.Optimization_QuestUtility_IsQuestLodger.Prefix post: VEF.Planet.HireableSystemStaticInitialization.IsQuestLodger_Postfix, [-2147483648]PerformanceOptimizer.Optimization_QuestUtility_IsQuestLodger.Postfix | |
| RCellFinder.CanWanderToCell: post: DubsBadHygiene.Patches.HarmonyPatches+Patch_CanWanderToCell.Postfix, WanderPreference.HarmonyPatches.CanWanderToCellPostfix | |
| RCellFinder.FindSiegePositionFrom: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.FindSiegePositionFrom | |
| RCellFinder.TryFindBestExitSpot: PRE: EnterHere.RCellFinder_TryFindExitSpot.Prefix post: [200]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.TryFindBestExitSpot | |
| RCellFinder.TryFindRandomExitSpot: PRE: [600]GeologicalLandforms.Patches.Patch_RimWorld_CellFinder.TryFindRandomExitSpot, EnterHere.RCellFinder_TryFindExitSpot.Prefix | |
| RaceHelper.<>c.<GetRaceComps>b__2_0: (no patches) | |
| RaceProperties.CanEverEat: post: [-2147483648]VREAndroids.RaceProperties_CanEverEat_Patch.Postfix | |
| RaceProperties.NutritionEatenPerDayExplanation: (no patches) | |
| RaceProperties.get_IsAnomalyEntity: post: AnomaliesExpected.HarmonyPatches.RP_IsAnomalyEntity_Postfix | |
| RaidPatches.RaidGroupChecker: (no patches) | |
| RaidPatches.RaidGroupChecker: (no patches) | |
| RaidRestlessness.GetThoughtState: (no patches) | |
| RaidStrategyWorker.CanUseWith: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_RaidStrategyWorker.CanUseWith | |
| RaidStrategyWorker.SpawnThreats: PRE: [200]EnterHere.RaidStrategyWorker_SpawnThreats.Prefix | |
| RaidStrategyWorker_ScorpionRaid.SpawnThreats: PRE: [200]EnterHere.RaidStrategyWorker_SpawnThreats.Prefix | |
| RaidStrategyWorker_Siege.MakeLordJob: PRE: VEF.Planet.Patch_RaidStrategyWorker_Siege+VanillaExpandedFramework_RaidStrategyWorker_Siege_MakeLordJob_Patch.Prefix | |
| RaidStrategyWorker_SiegeMechanoid.SpawnThreats: PRE: [200]EnterHere.RaidStrategyWorker_SpawnThreats.Prefix | |
| ReGrowthCore_SmartFarming.ApplySettings: (no patches) | |
| Reachability.CanReach: PRE: VEF.Hediffs.PhasingPatches.AllReachable TRANS: Reachability_CanReachTranspiler.Transpiler | |
| ReachabilityImmediate.CanReachImmediate: post: VEF.Weapons.VanillaExpandedFramework_ReachabilityImmediate_CanReachImmediate_Patch.Postfix | |
| ReadingOutcomeDoerGainAnomalyResearch.OnReadingTick: post: VAEInsanity.ReadingOutcomeDoerGainAnomalyResearch_OnReadingTick_Patch.Postfix TRANS: VAEInsanity.ReadingOutcomeDoerGainAnomalyResearch_OnReadingTick_Patch.Transpiler | |
| ReadingOutcomeDoerGainResearch.OnReadingTick: PRE: VanillaVehiclesExpanded.ReadingOutcomeDoerGainResearch_OnReadingTick_Patch.Prefix post: VanillaVehiclesExpanded.ReadingOutcomeDoerGainResearch_OnReadingTick_Patch.Postfix | |
| ReadingPolicyDatabase.GenerateStartingPolicies: post: SaveStorageSettings.Patch_ReadingPolicyDatabase_GenerateStartingPolicies.Postfix | |
| RecipeDef.AvailableOnNow: PRE: ProgressionAgriculture.RecipeDef_AvailableOnNow_Patch.Prefix | |
| RecipeDef.get_AvailableNow: post: [-2147483648]VREAndroids.RecipeDef_AvailableNow_Patch.Postfix TRANS: VFETribals.RecipeDef_AvailableNow_Patch.Transpiler | |
| RecipeDefGenerator.DrugAdministerDefs: post: VREAndroids.RecipeDefGenerator_DrugAdministerDefs_Patch.Postfix | |
| RecipeDef_AvailableOnNow_Patch.Prefix: (no patches) | |
| RecipeWorker.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| RecipeWorker.ConsumeIngredient: PRE: AncientMarket_Libraray.Patch_Recipe.prefix | |
| RecipeWorker.Notify_IterationCompleted: post: VAspirE.SatisfactionPatches.CheckRecipes | |
| RecipeWorkerCounter.CountProducts: post: ImprovedWorkbenches.RecipeWorkerCounter_CountProducts_Detour.Postfix | |
| RecipeWorker_WarcasketRemoval.AvailableOnNow: post: AlphaMemes.RecipeWorker_WarcasketRemoval_AvailableOnNow_Patch.Postfix, [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_AddHediff.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_AddHediff.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_AdministerIngestible.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_AdministerNeutroamineForAndroid.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_AdministerUsableItem.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_BloodTransfusion.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_ExtractHemogen.AvailableOnNow: post: BigAndSmall.BloodPatches.Recipe_ExtractHemogen_Postfix, [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_ExtractOvum.AvailableReport: TRANS: BetterRomance.HarmonyPatches.Recipe_ExtractOvum_AvailableReport.Transpiler | |
| Recipe_ExtractOvum.CompletableEver: post: VanillaRacesExpandedPhytokin.VanillaRacesExpandedPhytokin_Recipe_ExtractOvum_CompletableEver.Postfix, VRESaurids.Patch_Recipe_ExtractOvum_CompletableEver.Postfix, VanillaRacesExpandedInsector.VanillaRacesExpandedInsector_Recipe_ExtractOvum_CompletableEver.Postfix | |
| Recipe_ExtractOvum.OnSurgerySuccess: post: ReSpliceCharmweavers.Recipe_ExtractOvum_OnSurgerySuccess_Patch.Postfix | |
| Recipe_ExtractOvum_OnSurgerySuccess_Patch.Postfix: (no patches) | |
| Recipe_GhoulInfusion.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_ImplantEmbryo.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_ImplantEmbryo.CompletableEver: post: VanillaRacesExpandedPhytokin.VanillaRacesExpandedPhytokin_Recipe_ImplantEmbryo_CompletableEver.Postfix, VRESaurids.Patch_Recipe_ImplantEmbryo_CompletableEver.Postfix, VanillaRacesExpandedInsector.VanillaRacesExpandedInsector_Recipe_ImplantEmbryo_CompletableEver.Postfix | |
| Recipe_ImplantIUD.AvailableOnNow: PRE: BetterRomance.HarmonyPatches.Recipe_ImplantIUD_AvailableOnNow.Prefix post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.Recipe_ImplantIUD_AvailableOnNow.Transpiler | |
| Recipe_ImplantXenogerm.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_InfuseDarkArchite.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_InstallAndroidPart.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_InstallArtificialBodyPart.ApplyOnPawn: post: GeneticRim.VanillaGeneticsExpanded_Recipe_InstallArtificialBodyPart_ApplyOnPawn.AddQualityToHediff, VanillaMemesExpanded.VanillaMemesExpanded_Recipe_InstallArtificialBodyPart_ApplyOnPawn_Patch.InstalledNonNaturalBodyPart | |
| Recipe_InstallGeneticBodyPart.ApplyOnPawn: (no patches) | |
| Recipe_LowerSeverity.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_RemoveArtificialBodyPart.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_RemoveBodyPart.ApplyOnPawn: PRE: VanillaSocialInteractionsExpanded.Recipe_Patch.Prefix, VanillaSocialInteractionsExpanded.Recipe_Patch.Postfix, VanillaTraitsExpanded.ApplyOnPawn_Patch.Prefix post: VanillaTraitsExpanded.ApplyOnPawn_Patch.Postfix | |
| Recipe_RemoveHediff.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_RemoveImplant.ApplyOnPawn: PRE: GeneticRim.VanillaGeneticsExpanded_Recipe_RemoveImplant_ApplyOnPawn_Prefix.AddQualityToImplant | |
| Recipe_RemoveImplantation.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_StabilizeCryogenicNexus.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_Surgery.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_Surgery.CheckSurgeryFail: PRE: [2147483647]VREAndroids.Recipe_Surgery_CheckSurgeryFail_Patch.Prefix, VanillaSocialInteractionsExpanded.CheckSurgeryFail_Patch.Prefix post: SimsTraits.Recipe_Surgery_CheckSurgeryFail_Patch.Postfix, VanillaSocialInteractionsExpanded.CheckSurgeryFail_Patch.Postfix | |
| Recipe_SurgicalInspection.ApplyOnPawn: (no patches) | |
| Recipe_TempDependant.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| Recipe_TerminatePregnancy.AvailableOnNow: post: [-2147483648]VREAndroids.RecipeWorker_AvailableOnNow_Patch.Postfix | |
| RecordsUtility.Notify_PawnDowned: post: VanillaMemesExpanded.VanillaMemesExpanded_RecordsUtility_Notify_PawnDowned_Patch.ThrowPawnDownedEvent | |
| RecordsUtility.Notify_PawnKilled: post: VAspirE.SatisfactionPatches.OnPawnKilled, VSEWW.RecordsUtility_Notify_PawnKilled.Postfix | |
| RecordsUtility_Notify_PawnKilled.Postfix: (no patches) | |
| RecruitUtility.Recruit: post: Mashed_Ashlands.InteractionWorker_RecruitAttempt_DoRecruit_Patch.Mashed_Ashlands_TameAnimal_Patch | |
| RefuelWorkGiverUtility.CanRefuel: PRE: VanillaGravshipExpanded.CompBoxRefuel.CanRefuel_Prefix, VFED.CompBoxRefuel.CanRefuel_Prefix | |
| Regeneration.TickEvent: (no patches) | |
| Region.Allows: TRANS: VFEArchitect.ArchitectMod.PrisonerProof | |
| RegionDirtyer.SetRegionDirty: (no patches) | |
| RegionProcessorClosestThingReachable.ProcessThing: TRANS: FixesForSBZFridge.RegionProcessorClosestThingReachable_ProcessThingTranspiler.Transpiler | |
| RegionTypeUtility.GetExpectedRegionType: post: ReBuildDoorsAndCorners.RegionTypeUtility_GetExpectedRegionType_Patch.Postfix | |
| RelationsUtility.AttractedToGender: PRE: BetterRomance.HarmonyPatches.RelationsUtility_AttractedToGender.Prefix | |
| RelationsUtility.IsDisfigured: post: AlphaGenes.AlphaGenes_RelationsUtility_IsDisfigured_Patch.RemoveDisfigurement, BigAndSmall.IsDisfigured_Patch.RemoveDisfigurement | |
| RelationsUtility.RomanceEligible: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix, [-2147483648]VREAndroids.RelationsUtility_RomanceEligible_Patch.Postfix TRANS: BetterRomance.HarmonyPatches.RelationsUtility_RomanceEligible.Transpiler | |
| RelationsUtility.RomanceEligiblePair: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix, BetterRomance.HarmonyPatches.RelationsUtility_RomanceEligiblePair.RobotPrefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix, [200]BigAndSmall.RomancePatches.RomanceEligiblePairPostfix TRANS: BetterRomance.HarmonyPatches.RelationsUtility_RomanceEligiblePair.OrientationTranspiler, BetterRomance.HarmonyPatches.RelationsUtility_RomanceEligiblePair.OpinionTranspiler | |
| RelationsUtility.TryDevelopBondRelation: PRE: [2147483647]VREAndroids.RelationsUtility_TryDevelopBondRelation_Patch.Prefix, VanillaTraitsExpanded.TryDevelopBondRelation_Patch.Prefix | |
| ReleaseAnimalToWildUtility.DoReleaseAnimal: post: AlphaMemes.AlphaMemes_ReleaseAnimalToWildUtility_DoReleaseAnimal_Patch.AnnounceAnimalReleased, SimsTraits.ReleaseAnimalToWildUtility_DoReleaseAnimal_Patch.Postfix, Mashed_Ashlands.ReleaseAnimalToWildUtility_DoReleaseAnimal_Patch.Mashed_Ashlands_ReleaseAnimal_Patch | |
| RelevantStatsInDescription.GetUpdatedDescription: (no patches) | |
| ReloadableUtility.OwnerOf: post: VanillaVehiclesExpanded.ReloadableUtility_OwnerOf_Patch.Postfix | |
| RepairUtility.PawnCanRepairEver: post: VFEInsectoids.RepairUtility_PawnCanRepairEver_Patch.Postfix | |
| ResearchManager.ExposeData: PRE: DubsMintMenus.HarmonyPatches+Patch_ResearchManager.Prefix post: VanillaGravshipExpanded.ResearchManager_ExposeData_Patch.Postfix | |
| ResearchManager.FinishProject: PRE: ResearchPowl.DoCompletionDialog.Prefix, ProgressionCore.ResearchManager_FinishProject_Patch.Prefix, DubsMintMenus.HarmonyPatches+Patch_FinishProject.Prefix post: ResearchPowl.DoCompletionDialog.Postfix, VanillaGravshipExpanded.ResearchManager_FinishProject_Patch.Postfix, ProgressionCore.ResearchManager_FinishProject_Patch.Postfix, ProgressionEducation.ResearchManager_FinishProject_Patch.Postfix, DubsMintMenus.HarmonyPatches+Patch_FinishProject.Postfix, VFETribals.ResearchManager_FinishProject_Patch.Postfix, VanillaSocialInteractionsExpanded.FinishProject_Patch.Postfix | |
| ResearchManager.IsCurrentProject: PRE: VanillaGravshipExpanded.ResearchManager_IsCurrentProject_Patch.Prefix | |
| ResearchManager.ResearchPerformed: PRE: VFEMedieval.ResearchManager_ResearchPerformed_Patch.Prefix | |
| ResearchManager.SetCurrentProject: PRE: VanillaGravshipExpanded.ResearchManager_SetCurrentProject_Patch.Prefix | |
| ResearchManager.StopProject: PRE: VanillaGravshipExpanded.ResearchManager_StopProject_Patch.Prefix | |
| ResearchManager_FinishProject_Patch.Postfix: TRANS: ProgressionCore.VFETribals_ResearchManager_FinishProject_Patch.Transpiler | |
| ResearchProjectDef.<get_Techprint>b__73_0: (no patches) | |
| ResearchProjectDef.CanBeResearchedAt: post: RimEffect.Patch_CanBeResearchedAt_Postfix.Postfix | |
| ResearchProjectDef.CostFactor: PRE: VanillaGravshipExpanded.ResearchProjectDef_CostFactor_Patch.Prefix | |
| ResearchProjectDef.GetTip: TRANS: VEF.VanillaExpandedFramework_ResearchProjectDef_GetTip_Patch.Transpiler | |
| ResearchProjectDef.get_AnalyzedThingsCompleted: (no patches) | |
| ResearchProjectDef.get_CanStartNow: post: VanillaVehiclesExpanded.ResearchProjectDef_CanStartNow_Patch.Postfix | |
| ResearchProjectDef.get_CostApparent: post: VFEMedieval.ResearchProjectDef_CostApparent_Patch.Postfix | |
| ResearchProjectDef.get_IsHidden: PRE: AnomaliesExpected.HarmonyPatches.RPD_IsHidden_Prefix | |
| ResearchProjectDef.get_PlayerHasAnyAppropriateResearchBench: post: VanillaGravshipExpanded.ResearchProjectDef_PlayerHasAnyAppropriateResearchBench_Patch.Postfix | |
| ResearchProjectDef.get_ProgressApparent: post: VFEMedieval.ResearchProjectDef_ProgressApparent_Patch.Postfix | |
| ResearchProjectDef.get_UnlockedDefs: post: VEF.Buildings.VanillaExpandedFramework_ResearchProjectDef_UnlockedDefs_Patch.Postfix, PipeSystem.ResearchProjectDef_UnlockedDefs_Patch.Postfix TRANS: VFETribals.ResearchProjectDef_UnlockedDefs_Patch.Transpiler | |
| ResearchProjectUtility.AutoAssignRules: (no patches) | |
| ReservationManager.CanReserve: PRE: ProgressionEducation.ReservationManager_CanReserve_Patch.Prefix | |
| ReservationUtility.CanReserveSittableOrSpot: PRE: ProgressionEducation.ReservationUtility_CanReserveSittableOrSpot_Patch.Prefix | |
| ResourceCounter.get_TotalHumanEdibleNutrition: post: VNPE.ResourceCounter_TotalHumanEdibleNutrition.Postfix | |
| ResourceCounter_TotalHumanEdibleNutrition.Postfix: (no patches) | |
| ResourceReadout.DoReadoutCategorized: PRE: [800]UINotIncluded.DoReadoutCategorizedPatch.Prefix, DubsMintMenus.PinningSys+Patch_DoReadoutCategorized.Prefix TRANS: DubsMintMenus.PinningSys+Patch_DoReadoutCategorized.Transpiler, [0]ToggleableReadouts.Replace_DoReadoutCategorized.Transpiler | |
| ResourceReadout.DoReadoutSimple: PRE: [800]UINotIncluded.DoReadoutSimplePatch.Prefix TRANS: [0]ToggleableReadouts.Replace_DoReadoutSimple.Transpiler | |
| Resources.FindArchitectTabCategoryIcon: PRE: TabSorting.TabSorting.architectIconsPrefix | |
| RestUtility.BedOwnerWillShare: TRANS: BunkBeds.RestUtility_BedOwnerWillShare_Patch.Transpiler | |
| RestUtility.CanUseBedEver: post: [-2147483648]VREAndroids.RestUtility_CanUseBedEver_Patch.Postfix | |
| RestUtility.FindBedFor: PRE: VREAndroids.RestUtility_FindBedFor_Patch.Prefix post: VREAndroids.RestUtility_FindBedFor_Patch.Postfix | |
| RestUtility.GetBedSleepingSlotPosFor: post: BunkBeds.RestUtility_GetBedSleepingSlotPosFor_Patch.Postfix | |
| RestUtility.IsValidBedFor: post: [-2147483648]BunkBeds.RestUtility_IsValidBedFor_Patch.Postfix, [-2147483648]VREAndroids.RestUtility_IsValidBedFor_Patch.Postfix | |
| Restartable.<GetGizmos>b__3_0: (no patches) | |
| Restartable.SpawnSetup: (no patches) | |
| ResurrectionUtility.TryResurrect: PRE: GeneticRim.GeneticRim_ResurrectionUtility_TryResurrect_Patch.DisallowResurrection post: PsiTech.Utility.NotifyResurrectedPatch.Postfix | |
| ResurrectionUtility.TryResurrectWithSideEffects: PRE: [2147483647]VREAndroids.ResurrectionUtility_TryResurrectWithSideEffects_Patch.Prefix, GeneticRim.GeneticRim_ResurrectionUtility_TryResurrectWithSideEffects_Patch.DisallowResurrection | |
| ReverseDesignatorDatabase.InitDesignators: post: AllowTool.Patches.ReverseDesignatorDatabase_Init_Patch.InjectReverseDesignators, Ammunition.Harmony.AmmoHarmonyPatches.InitDesignators_PostFix | |
| RewardsGenerator.DoGenerate: PRE: VFEEmpire.HarmonyPatches.Patch_GenerateRewards.Prefix post: VFEEmpire.HarmonyPatches.Patch_GenerateRewards.Postfix, VFEC.Senators.SenatorQuests.AddFavorReward | |
| RimWorld_InspectPaneUtility_InspectPaneOnGUI.Prefix: PRE: Vehicles.Compatibility.Compatibility_RimHUD.DontRenderRimHUDForVehicles_InspectPaneUtility | |
| RitualAttachableOutcomeEffectDef.CanAttachToRitual: post: Sinnamon_Ritual.Patch.Postfix | |
| RitualBehaviorWorker.Cleanup: post: VAspirE.SatisfactionPatches.CheckRituals | |
| RitualBehaviorWorker_GravshipLaunch.TryExecuteOn: post: VanillaGravshipExpanded.RitualBehaviorWorker_GravshipLaunch_TryExecuteOn_Patch.Postfix | |
| RitualObligationTargetWorker_AnyGatherSpotForAdvancement.CanUseTargetInternal: TRANS: ProgressionCore.RitualObligationTargetWorker_AnyGatherSpotForAdvancement_CanUseTargetInternal_Patch.Transpiler | |
| RitualObligationTargetWorker_IdeoBuildingOrRitualSpot.CanUseTargetInternal: post: VanillaMemesExpanded.VanillaMemesExpanded_RitualObligationTargetWorker_IdeoBuildingOrRitualSpot_CanUseTargetInternal_Patch.DontAllowWickerManToActAsSpeechFocus | |
| RitualObligationTrigger_MemberCorpseDestroyed.Notify_MemberCorpseDestroyed: PRE: AlphaMemes.RitualObligationTrigger_MemberCorpseDestroyed_Patch+FuneralFramework_RitualObligationTrigger_MemberCorpseDestroyed.Prefix | |
| RitualObligationTrigger_SecondDefeat.Tick: (no patches) | |
| RitualOutcomeComp_AverageMaintenance.GetQualityFactor: (no patches) | |
| RitualOutcomeComp_GravshipFacilities.GetQualityFactor: (no patches) | |
| RitualOutcomeComp_MannedGravshipFacilities.GetQualityFactor: (no patches) | |
| RitualOutcomeComp_PawnAge.GetDesc: TRANS: BetterRomance.HarmonyPatches.RitualOutcomeComp_PawnAge_Desc.Transpiler | |
| RitualOutcomeComp_PawnAge.GetQualityFactor: TRANS: BetterRomance.HarmonyPatches.RitualOutcomeComp_PawnAge_Desc.Transpiler | |
| RitualOutcomeComp_PawnAge.QualityOffset: TRANS: BetterRomance.HarmonyPatches.RitualOutcomeComp_PawnAge_QualityOffset.Transpiler | |
| RitualOutcomeEffectWorker_AdvanceToIndustrial.Apply: (no patches) | |
| RitualOutcomeEffectWorker_AdvanceToMedieval.Apply: (no patches) | |
| RitualOutcomeEffectWorker_AdvanceToNeolithic.Apply: (no patches) | |
| RitualOutcomeEffectWorker_AdvanceToSpacer.Apply: (no patches) | |
| RitualOutcomeEffectWorker_AdvanceToUltra.Apply: (no patches) | |
| RitualOutcomeEffectWorker_AnimaTreeLinking.Apply: post: VAspirE.SatisfactionPatches.OnTreeLinkPsychic | |
| RitualOutcomeEffectWorker_BestowTitle.Apply: post: VFEEmpire.HarmonyPatches.Patch_Bestowing.Postfix | |
| RitualOutcomeEffectWorker_Bestowing.Apply: TRANS: VanillaPsycastsExpanded.RitualOutcomeEffectWorker_Bestowing_Apply_Patch.Transpiler | |
| RitualOutcomeEffectWorker_ConnectToTree.Apply: post: VAspirE.SatisfactionPatches.OnTreeLinkGauranlen | |
| RitualOutcomeEffectWorker_FromQuality.GetQuality: post: VAEInsanity.RitualOutcomeEffectWorker_FromQuality_GetQuality_Patch.Postfix | |
| RitualOutcomeEffectWorker_FuneralDreadnought.ApplyOn: (no patches) | |
| RitualOutcomeEffectWorker_GravshipLaunch.Apply: post: VanillaGravshipExpanded.RitualOutcomeEffectWorker_GravshipLaunch_Apply_Patch.Postfix TRANS: VanillaGravshipExpanded.RitualOutcomeEffectWorker_GravshipLaunch_Apply_Patch.Transpiler | |
| RitualOutcomeEffectWorker_Trial.GetOutcome: post: SimsTraits.RitualOutcomeEffectWorker_Trial_GetOutcome_Patch.Postfix | |
| RitualPatternDef.Fill: post: AlphaMemes.RitualPatternDef_Fill_Patch.Postfix | |
| RitualRoleAssignments.ExposeData: post: AlphaMemes.RitualRoleAssignments_ExposeData_Patch.Postfix | |
| RitualRoleAssignments.FillPawns: post: AlphaMemes.FuneralFramework_RitualRoleAssignments_FillPawns_Patch.Postfix | |
| RitualRoleAssignments.PawnNotAssignableReason: post: AlphaMemes.AlphaMemes_RitualRoleAssignments_PawnNotAssignableReason_Patch.Postfix, VFETribals.VFETribals_RitualRoleAssignments_PawnNotAssignableReason_Patch.Postfix | |
| RitualRoleAssignments.Setup: PRE: AlphaMemes.FuneralFramework_RitualRoleAssignments_Setup_Patch.SelectViableCorpse | |
| RitualRole_Suicidal.AppliesToPawn: (no patches) | |
| RoadDefGenStep_Place.Place: post: Mashed_Ashlands.RoadDefGenStep_Place_Place_Patch.Postfix | |
| RoofCollapseUtility.WithinRangeOfRoofHolder: PRE: [600]GeologicalLandforms.Patches.Patch_Verse_RoofCollapseUtility.WithinRangeOfRoofHolder | |
| RoofGrid.RoofGridUpdate: PRE: ProgressRenderer.Harmony_RoofGrid_RoofGridUpdate.Prefix | |
| RoofGrid.SetRoof: post: Dubs_Skylight.Patch_SetRoof.Postfix, ReBuildDoorsAndCorners.RoofGrid_SetRoof_Patch.Postfix, ReGrowthCore.Patch_RoofGrid_SetRoof.Postfix | |
| RoofGrid_SetRoof_Patch.Postfix: PRE: MapPreview.Compatibility.ModCompat_ReBuildDoorsAndCorners.RoofGrid_SetRoof_Patch_Postfix | |
| Room.GetRoomRoleLabel: post: ProgressionEducation.Room_GetRoomRoleLabel_Patch.Postfix | |
| Room.Notify_RoomShapeChanged: PRE: FixesForSBZFridge.TrackChangeOfPrisonCellStatusForRoom.Prefix post: FixesForSBZFridge.TrackChangeOfPrisonCellStatusForRoom.Postfix, VNPE.Room_NotifyRoomShapeChanged.Postfix | |
| Room.UpdateRoomStatsAndRole: post: VFEEmpire.MapComponent_RoyaltyTracker.Room_UpdateRoomStatsAndRole_Postfix | |
| RoomContents_Obelisk.FillRoom: (no patches) | |
| RoomRequirement_AllThingsAnyOfAreGlowing.<ConfigErrors>d__2.MoveNext: (no patches) | |
| RoomRequirement_AllThingsAreGlowing.<ConfigErrors>d__2.MoveNext: (no patches) | |
| RoomRoleDef.PostProcessedLabel: post: ProgressionEducation.RoomRoleDef_PostProcessedLabel_Patch.Postfix | |
| RoomRoleWorker_Bedroom.IsBedroomHelper: PRE: BunkBeds.RoomRoleWorker_Bedroom_IsBedroomHelper_Patch.Prefix | |
| RoomRoleWorker_ComaRestChamber.get_Cache: (no patches) | |
| RoomRoleWorker_IndoorGarden.GetScore: (no patches) | |
| RoomRoleWorker_Kitchen.GetScore: TRANS: TabSorting.RoomRoleWorker_Kitchen_GetScore.Transpiler | |
| RoomStatDef.GetScoreStageIndex: post: VanillaPsycastsExpanded.RoomStatDef_GetScoreStageIndex_Patch.Postfix | |
| RoomStatWorker_Beauty.GetScore: post: AlphaBehavioursAndEvents.AlphaAnimals_RoomStatWorker_Beauty_GetScore_Patch.IncreaseRoomBeautyIfPedigreedRaptorDetected | |
| RoomStatWorker_Cleanliness.GetScore: post: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.GetScore_Postfix | |
| Root.OnGUI: post: HugsLib.Patches.Root_OnGUI_Patch.OnGUIHookUnfiltered | |
| Root.Start: post: GlitterNet.StartNotifyPatch.Postfix, PsiTech.Utility.StartNotifyPatch.Postfix | |
| Root.Update: post: HugsLib.Patches.Root_Patch.UpdateHook, Brrainz.ModFeatures.Root_Update_Postfix | |
| Root_Play.SetupForQuickTestPlay: post: GeologicalLandforms.Patches.Patch_Verse_Root_Play.SetupForQuickTestPlay | |
| Root_Play.Update: post: GeneticRim.Root_Play_Update_Patch.TickCountDown | |
| RoyalTitleDef.SpecialDisplayStats: post: VFEEmpire.HarmonyPatches.Patch_RoyalTitleDef_SpecialDisplayStats.Postfix | |
| RoyalTitlePermitDef.get_CooldownTicks: post: VanillaMemesExpanded.VanillaMemesExpanded_RoyalTitlePermitDef_CooldownTicks_Patch.AdjustPreceptCooldown | |
| RoyalTitlePermitWorker.FillAidOption: TRANS: VanillaMemesExpanded.RoyalTitlePermitWorker_FillAidOption_Patch.Transpiler | |
| RoyalTitlePermitWorker_CallShuttle.GetReportFromCell: PRE: NepLandOnAnything.ShuttlePrivatePatch.Prefix | |
| RoyalTitleUtility.ShouldGetBestowingCeremonyQuest: post: VFEEmpire.HarmonyPatches.Patch_ShouldGetBestowingCeremonyQuest.Postfix | |
| RoyalTitleUtility.ShouldGetBestowingCeremonyQuest: post: VFEEmpire.HarmonyPatches.Patch_ShouldGetBestowingCeremonyQuest.Postfix | |
| SanguineSpear.Impact: (no patches) | |
| SanguophageUtility.DoBite: post: BigAndSmall.SanguophageUtility_DoBite_Patch.Postfix | |
| SanguophageUtility.InSunlight: post: AlphaBiomes.AlphaBiomes_SanguophageUtility_InSunlight_Patch.VampiresAreFine | |
| SanitationUtil.GiveNastyGutBug: PRE: VanillaTraitsExpanded.GiveNastyGutBug_Patch.Prefix | |
| SavedGameLoaderNow.LoadGameFromSaveFileNow: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData | |
| Scannable.<GetGizmos>b__8_0: (no patches) | |
| Scannable.SpawnSetup: (no patches) | |
| ScenPart_ConfigPage_ConfigureStartingPawnsBase.PostIdeoChosen: PRE: VFETribals.ScenPart_ConfigPage_ConfigureStartingPawnsBase_PostIdeoChosen_Patch.Prefix | |
| ScenPart_ForcedTrait.PawnHasTraitForcedByBackstory: post: BetterRomance.HarmonyPatches.ScenPart_ForcedTrait_PawnHasTraitForcedByBackstory.Postfix | |
| ScenPart_PlayerPawnsArriveMethod.DoGravship: PRE: VanillaGravshipExpanded.ScenPart_PlayerPawnsArriveMethod_DoGravship_Patch.Prefix | |
| ScenPart_PursuingMechanoids.Tick: TRANS: VanillaGravshipExpanded.ScenPart_PursuingMechanoids_Tick_Patch.Transpiler | |
| ScenPart_StartingMech.<>c.<get_PossibleMechs>b__3_0: (no patches) | |
| Scenario.PostMapGenerate: PRE: [-2147483648]VanillaGravshipExpanded.SpaceMapDropPatches.Prefix post: [2147483647]VanillaGravshipExpanded.SpaceMapDropPatches.Postfix | |
| ScenarioLister.ScenariosInCategory: post: ProgressionScenarios.ScenarioLister_ScenariosInCategory_Patch.Postfix | |
| SchoolUtility.CanTeachNow: PRE: Vehicles.Patch_HealthAndStats.CantTeachVehicles, VEF.AnimalBehaviours.VanillaExpandedFramework_SchoolUtility_CanTeachNow_Patch.RemoveTeaching | |
| SchoolUtility.FindTeacher: PRE: ProgressionEducation.SchoolUtility_FindTeacher_Patch.Prefix | |
| Scorpion.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| ScreenshotModeHandler.ScreenshotModesOnGUI: post: ProgressRenderer.Harmony_ScreenshotModeHandler_ScreenshotModesOnGUI.Postfix | |
| Section.TryUpdate: PRE: DubsMintMinimap.Harmony_TryUpdate.Prefix | |
| SectionLayer_BridgeProps.ShouldDrawPropsBelow: post: VFEArchitect.ArchitectMod.IsVanillaBridge | |
| SectionLayer_GravshipHull.EnsureInitialized: PRE: ReBuildDoorsAndCorners.SectionLayer_GravshipHull_EnsureInitialized_Patch.Prefix | |
| SectionLayer_GravshipHull.Regenerate: PRE: ReBuildDoorsAndCorners.SectionLayer_GravshipHull_Regenerate_Patch.Prefix | |
| SectionLayer_IndoorMask.GenerateSectionLayer: TRANS: VanillaGravshipExpanded.SectionLayer_IndoorMask_GenerateSectionLayer_Patch.Transpiler | |
| SectionLayer_LightingOverlay.GenerateLightingOverlay: TRANS: ReBuildDoorsAndCorners.SectionLayer_LightingOverlay_GenerateLightingOverlay_Patch.Transpiler | |
| SectionLayer_LightingOverlay.Regenerate: PRE: Dubs_Skylight.Patch_SectionLayer_LightingOverlay_Regenerate.Prefix post: Dubs_Skylight.Patch_SectionLayer_LightingOverlay_Regenerate.Postfix | |
| SectionLayer_LightingOverlay_GenerateLightingOverlay_Patch.TryInterceptRoof: (no patches) | |
| SectionLayer_LightingOverlay_GenerateLightingOverlay_Patch.TryInterceptRoofed: (no patches) | |
| SectionLayer_PipeOverlay.DrawLayer: (no patches) | |
| SectionLayer_SubstructureProps.Regenerate: TRANS: VanillaGravshipExpanded.SectionLayer_SubstructureProps_Regenerate_Patch.Transpiler | |
| SectionLayer_SubstructureProps.ShouldDrawPropsOn: PRE: VanillaGravshipExpanded.SectionLayer_SubstructureProps_ShouldDrawPropsOn_Patch.Prefix | |
| SectionLayer_SunShadows.Regenerate: TRANS: VFESecurity.SectionLayer_SunShadows_Regenerate_Patch.Transpiler | |
| SectionLayer_Terrain.Regenerate: PRE: VanillaGravshipExpanded.SectionLayer_Terrain_Regenerate_Patch.Prefix post: VanillaGravshipExpanded.SectionLayer_Terrain_Regenerate_Patch.Postfix TRANS: VanillaGravshipExpanded.SectionLayer_Terrain_Regenerate_Patch.Transpiler, PerspectivePaths.Patch_SectionLayer_Terrain.Transpiler | |
| SectionLayer_TerrainEdges.ShouldDrawRockEdges: PRE: VanillaGravshipExpanded.SectionLayer_TerrainEdges_ShouldDrawRockEdges_Patch.Prefix post: VanillaGravshipExpanded.SectionLayer_TerrainEdges_ShouldDrawRockEdges_Patch.Postfix | |
| SectionLayer_ThingsGeneral.TakePrintFrom: PRE: [600]AdaptiveStorage.HarmonyPatches.HideStoredThingsFromSectionLayerAndOverlayDrawer.Prefix | |
| SeedRerollData.GetFor: (no patches) | |
| SelectionDrawer.DrawSelectionBracketFor: PRE: Vehicles.Patch_Rendering.DrawSelectionBracketsVehicles, VEF.AestheticScaling.VanillaExpandedFramework_SelectionDrawer_DrawSelectionBracketFor_Patch.Prefix, BigAndSmall.SelectionDrawer_DrawSelection_Patch.Prefix, SimpleCameraSetting.DrawSelectionBracketForPatch.Prefix post: VEF.AestheticScaling.VanillaExpandedFramework_SelectionDrawer_DrawSelectionBracketFor_Patch.Postfix, BigAndSmall.SelectionDrawer_DrawSelection_Patch.Postfix TRANS: ReGrowthCore.Patch_DrawSelectionBracketFor.Transpiler | |
| SelectionDrawer.DrawSelectionOverlays: PRE: RangeFinder.SelectionDrawer_DrawSelectionOverlays_Patch.Prefix post: AchtungMod.SelectionDrawer_DrawSelectionOverlays_Patch.Postfix | |
| SelectionDrawer.Notify_Selected: post: AdaptiveStorage.HarmonyPatches.AutomaticallyOpenTab.Postfix | |
| SelectionDrawerUtility.CalculateSelectionBracketPositionsWorld: PRE: AdaptiveStorage.HarmonyPatches.AdjustSelectionBracketPosition.Prefix | |
| Selector.HandleMapClicks: PRE: Vehicles.Patch_Misc.MultiSelectFloatMenu | |
| Selector.HandleMultiselectGoto: PRE: Vehicles.Patch_VehiclePathing.MultiselectGotoDraggingBlocked | |
| Selector.Select: post: ImprovedWorkbenches.Open_Bills_Tab_On_Select.Postfix | |
| Selector.SelectableObjectsUnderMouse: post: AdaptiveStorage.HarmonyPatches.PreventSelectionUnderMouse.Postfix | |
| Selector.SelectorOnGUI: PRE: AchtungMod.Selector_SelectorOnGUI_Patch.Prefix | |
| Selector.SelectorOnGUI_BeforeMainTabs: PRE: AchtungMod.Selector_SelectorOnGUI_BeforeMainTabs_Patch.Prefix | |
| SettingsApplier.ApplySettings: (no patches) | |
| SettleInEmptyTileUtility.<>c__DisplayClass4_0.<SetupCamp>b__1: (no patches) | |
| Settlement.ExposeData: post: Worldbuilder.Settlement_ExposeData_Patch.Postfix | |
| Settlement.GetCaravanGizmos: post: Vehicles.Patch_Gizmos.NoAttackSettlementWhenDocked, VFE_Settlers.Utilities.Harmony+SettlementGetCaravanGizmos_Patch.PostFix | |
| Settlement.GetFloatMenuOptions: post: VEF.Buildings.DoorTeleporterPatches.VanillaExpandedFramework_Settlement_GetFloatOptions_Postfix, VFEC.Senators.WorldComponent_Senators.AddSenatorsOption | |
| Settlement.GetGizmos: post: Vehicles.Patch_Gizmos.AddVehicleCaravanGizmoPassthrough, Worldbuilder.Settlement_GetGizmos_Patch.Postfix, CustomPlayerIcon.Settlement_GetGizmos.Postfix, WDYS.Settlement_Gizmo_Patch.Postfix | |
| Settlement.GiveSoldThingToPlayer: PRE: VanillaTradingExpanded.GiveSoldThingToPlayer_Patch.Prefix | |
| Settlement.GiveSoldThingToTrader: PRE: VanillaTradingExpanded.GiveSoldThingToTrader_Patch.Prefix | |
| Settlement.get_ExpandingIcon: post: Worldbuilder.Settlement_ExpandingIcon_Patch.Postfix | |
| Settlement.get_MapGeneratorDef: post: KCSG.Postfix_Settlement_MapGeneratorDef+Settlement_MapGeneratorDef_Patch.Postfix | |
| SettlementAbandonUtility.Abandon: post: VanillaMemesExpanded.VanillaMemesExpanded_SettlementAbandonUtility_Abandon_Patch.SetAbandonedTimeToZero | |
| SettlementDefeatUtility.CheckDefeated: TRANS: Vehicles.Patch_CaravanHandling.CheckDefeatedWithVehiclesTranspiler | |
| SettlementDefeatUtility.IsDefeated: post: VEF.Storyteller.VanillaExpandedFramework_SettlementDefeatUtility_IsDefeated_Patch.Postfix, VFEInsectoids.SettlementDefeatUtility_IsDefeated_Patch.Postfix, RimEffectAR.Harmony.SettlementDefeatedUtility_Patch.Postfix | |
| SettlementProximityGoodwillUtility.CheckConfirmSettle: PRE: VanillaGravshipExpanded.SettlementProximityGoodwillUtility_CheckConfirmSettle_Patch.Prefix | |
| SettlementProximityGoodwillUtility.GetConfirmationDescriptions: post: VFEInsectoids.SettlementProximityGoodwillUtility_GetConfirmationDescriptions_Patch.Postfix, Mashed_Ashlands.SettlementProximityGoodwillUtility_GetConfirmationDescriptions_Patch.Postfix | |
| SettlementUtility.AttackNow: PRE: KCSG.Postfix_SettlementUtility_Attack.Prefix | |
| Settlement_TraderTracker.ColonyThingsWillingToBuy: PRE: Vehicles.Patch_CaravanHandling.AerialVehicleInventoryItems post: PeteTimesSix.SimpleSidearms.Intercepts.Settlement_TraderTracker_ColonyThingsWillingToBuy.Postfix | |
| Settlement_TraderTracker.GiveSoldThingToPlayer: TRANS: Vehicles.Patch_CaravanHandling.GiveSoldThingToVehicleTranspiler | |
| ShaderUtility.GetSkinShader: post: FacialAnimation.HarmonyPatches.PostfixGetSkinShader | |
| ShipLandingBeaconUtility.DrawLinesToNearbyBeacons: (no patches) | |
| ShipUtility.<>c__DisplayClass8_0.<ShipStartupGizmos>b__0: (no patches) | |
| ShootLine.ChangeDestToMissWild: TRANS: VCR.ShootLine_ChangeDestToMissWild_Patch.Transpiler | |
| ShortCircuitUtility.DoShortCircuit: TRANS: VanillaPlantsExpandedMushrooms.ShortCircuitUtility_DoShortCircuit_Patch.Transpiler | |
| ShortCircuitUtility.DrainBatteriesAndCauseExplosion: TRANS: VanillaPlantsExpandedMushrooms.ShortCircuitUtility_DrainBatteriesAndCauseExplosion_Patch.Transpiler | |
| ShotReport.GetTextReadout: PRE: VCR.ShotReport_GetTextReadout_Patch.Prefix TRANS: VEF.Pawns.ShotReport_GetTextReadout_Patch.Transpiler | |
| ShotReport.HitFactorFromShooter: post: VanillaGravshipExpanded.ShotReport_HitFactorFromShooter_Patch.Postfix | |
| ShotReport.HitReportFor: PRE: VEF.Weapons.VanillaExpandedFramework_ShotReport_HitReportFor_Patch.Prefix, VCR.ShotReport_HitReportFor_Patch.Prefix post: VanillaGravshipExpanded.ShotReport_HitReportFor_Patch.Postfix TRANS: VCR.ShotReport_HitReportFor_Patch.Transpiler | |
| ShotReport.get_AimOnTargetChance_IgnoringPosture: post: VCR.ShotReport_AimOnTargetChance_IgnoringPosture_Patch.Postfix | |
| ShotReport.get_AimOnTargetChance_StandardTarget: post: VEF.Weapons.VanillaExpandedFramework_ShotReport_AimOnTargetChance_StandardTarget.Postfix | |
| SilhouetteUtility.CanHighlightAny: PRE: SimpleCameraSetting.CanHighlightAnyPatch.Prefix | |
| SilhouetteUtility.GetAlpha: PRE: SimpleCameraSetting.GetAlphaPatch.Prefix | |
| SimpleCurve.Evaluate: PRE: UnlimitedThreatScale.Patch_SimpleCurve_Evaluate.Prefix | |
| SimpleCurveDrawer.DrawCurvesLegend: PRE: VanillaTradingExpanded.SimpleCurveDrawer_Patch.Prefix | |
| Singularity.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Site.GetGizmos: PRE: AncientMarket_Libraray.Site_GetGizmos_Patch.Site_GetGizmosPrefix | |
| Site.PostMapGenerate: (no patches) | |
| Site.ShouldRemoveMapNow: PRE: AncientMarket_Libraray.Site_ShouldRemoveMapNow_Patch.Site_ShouldRemoveMapNowPrefix post: Shashlichnik.Site_ShouldRemoveMap_Patch.Postfix, VFEMedieval.Site_ShouldRemoveMapNow_Patch.Postfix, VFED.HarmonyPatches.MiscPatches.NoRemoveObjectiveMaps, VFEInsectoids.Site_ShouldRemoveMapNow_Patch.Postfix, VanillaQuestsExpandedCryptoforge.Site_ShouldRemoveMapNow_Patch.Postfix | |
| Site.get_PreferredMapSize: post: AncientMarket_Libraray.Patch_QuestMapSize.postfix | |
| SiteMakerHelper.FactionCanOwn: post: VEF.Factions.VanillaExpandedFramework_SiteMakerHelper_FactionCanOwn_Patch.Postfix | |
| SitePart.SitePartTickInterval: PRE: VFETribals.SitePart_SitePartTickInterval_Patch.Prefix | |
| SitePartDef.FactionCanOwn: post: VFEMedieval.SitePartDef_FactionCanOwn_Patch.Postfix, VFEInsectoids.SitePartDef_FactionCanOwn_Patch.Postfix | |
| SitePartWorker_AncientResearchTerminal.GetArrivedLetterPart: (no patches) | |
| SitePartWorker_ConditionCauser.GetPostProcessedThreatLabel: (no patches) | |
| SitePartWorker_ConditionCauser.PostDrawExtraSelectionOverlays: (no patches) | |
| SitePartWorker_Objectives.ShouldKeepSiteForObjectives: (no patches) | |
| SitePartWorker_WorshippedTerminal.GetArrivedLetterPart: (no patches) | |
| SituationalThoughtHandler.UpdateAllMoodThoughts: post: VAspirE.SatisfactionPatches.CheckGeneral | |
| SketchGenUtility.IsFloorAllowed: post: DubsBadHygiene.Patches.HarmonyPatches+H_IsFloorAllowed.Postfix | |
| SketchGenUtility.IsStuffAllowed: post: DubsBadHygiene.Patches.HarmonyPatches+H_IsStuffAllowed.Postfix | |
| SketchGenUtility.PlayerCanBuildNow: post: AlphaMemes.AlphaMemes_SketchGenUtility_PlayerCanBuildNow_Patch.DisableIdeoFloors | |
| SkillRecord.DirtyAptitudes: PRE: LevelUp.Patcher.Prefix post: LevelUp.Patcher.DirtyAptitudesPostfix | |
| SkillRecord.Interval: PRE: [2147483647]VREAndroids.SkillRecord_Interval_Patch.Prefix, [800]VFEEmpire.HarmonyPatches.Patch_HonorsMisc.Prefix_Interval, [500]RTMadSkills.Patch_SkillRecordInterval.Prefix, VEF.Genes.VanillaExpandedFramework_SkillRecord_Interval_Patch.Prefix, VanillaTraitsExpanded.Interval_Patch.Prefix post: VEF.Genes.VanillaExpandedFramework_SkillRecord_Interval_Patch.Postfix TRANS: VEF.Genes.VanillaExpandedFramework_SkillRecord_Interval_Transpiler_Patch.Transpiler, VanillaRacesExpandedHighmate.SkillRecord_Interval_Patch.Transpiler | |
| SkillRecord.Learn: PRE: [2147483647]VREAndroids.SkillRecord_Learn_Patch.Prefix, VEF.Apparels.VanillaExpandedFramework_SkillRecord_Learn_Patch.Prefix, LevelUp.Patcher.Prefix, EBSGFramework.HarmonyPatches.SkillFallPrefix, VanillaSocialInteractionsExpanded.Learn_Patch.Prefix post: LevelUp.Patcher.LearnPostfix, VanillaSocialInteractionsExpanded.Learn_Patch.Postfix TRANS: LevelUp.Patcher.RemoveMoteThrowCall, VanillaQuestsExpandedCryptoforge.SkillRecord_Learn_Patch.Transpiler | |
| SkillRecord.LearnRateFactor: PRE: [2147483647]PerformanceOptimizer.Optimization_SkillRecord_LearnRateFactor.Prefix post: VFEMedieval.VFEMedieval_SkillRecord_LearnRateFactor_Patch.ModifyLearnRate, BigAndSmall.SkillRecord_Patch.Postfix, AlphaBooks.AlphaBooks_SkillRecord_LearnRateFactor_Patch.ModifyLearnFactor, [-2147483648]PerformanceOptimizer.Optimization_SkillRecord_LearnRateFactor.Postfix TRANS: RTMadSkills.Patch_SkillRecordLearnRateFactor.Transpiler | |
| SkillRecord.Notify_SkillDisablesChanged: post: BigAndSmall.SkillRecord_Notify_SkillDisablesChanged.Postfix | |
| SkillRecord.get_Aptitude: post: EBSGFramework.HarmonyPatches.SkillAptitudePostfix TRANS: VREAndroids.SkillRecord_Aptitude_Patch.Transpiler, BigAndSmall.SkillAndAptitude.AptitudeTranspiler | |
| SkillRecord.get_LearningSaturatedToday: PRE: RTMadSkills.Patch_SkillRecordLearningSaturatedToday.Prefix | |
| SkillRecord.get_Level: post: PsiTech.Utility.SkillLevelPatch.Postfix | |
| SkillUI.GetSkillDescription: post: AlphaBooks.AlphaBooks_SkillUI_GetSkillDescription_Patch.ModifySkillDescription TRANS: RTMadSkills.Patch_LearningSaturationUI.Transpiler, VREAndroids.SkillUI_GetSkillDescription_Patch.Transpiler | |
| Skyfaller.SpawnThings: PRE: ReGrowthCore.Skyfaller_SpawnThings_Patch.Prefix | |
| Skyfaller.Tick: PRE: VEF.Apparels.Patch_Tick.Prefix post: VFED.HarmonyPatches.MiscPatches.CheckForIntercept | |
| Skyfaller.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| SlaveRebellionUtility.CanApplyWeaponFactor: post: MVCF.PatchSets.PatchSet_MultiVerb.CanApplyWeaponFactor | |
| SlaveRebellionUtility.CanParticipateInSlaveRebellion: post: EBSGFramework.HarmonyPatches.ParticipateInSlaveRebellionPostfix, SimsTraits.SlaveRebellionUtility_CanParticipateInSlaveRebellion_Patch.Postfix | |
| SlaveRebellionUtility.InitiateSlaveRebellionMtbDays: post: EBSGFramework.HarmonyPatches.InitiateSlaveRebellionPostfix, VanillaMemesExpanded.VanillaMemesExpanded_SlaveRebellionUtility_InitiateSlaveRebellionMtbDays_Patch.SetCorruptedSlaveToMinusOne | |
| SocialCardUtility.CanDrawTryRomance: PRE: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Prefix post: VREAndroids.HarmonyPatches_ForRomanceReasonsChangeAge.Postfix, BetterRomance.HarmonyPatches.SocialCardUtility_CanDrawTryRomance.Postfix TRANS: BetterRomance.HarmonyPatches.SocialCardUtility_CanDrawTryRomance.Transpiler | |
| SocialCardUtility.DrawPawnRoleSelection: PRE: VFETribals.SocialCardUtility_DrawPawnRoleSelection_Patch.Prefix | |
| SocialCardUtility.DrawPregnancyApproach: TRANS: VEF.Pawns.VanillaExpandedFramework_SocialCardUtility_DrawPregnancyApproach_Patch.Transpiler | |
| SocialCardUtility.DrawRelationsAndOpinions: PRE: [2147483647]VREAndroids.SocialCardUtility_DrawRelationsAndOpinions_Patch.Prefix TRANS: BetterRomance.HarmonyPatches.SocialCardUtility_DrawRelationsAndOpinions.Transpiler | |
| SocialCardUtility.DrawTryRomance: PRE: BetterRomance.HarmonyPatches.SocialCardUtility_DrawTryRomance.Prefix | |
| SocialCardUtility.GetPawnRowTooltip: TRANS: BetterRomance.HarmonyPatches.SocialCardUtility_GetPawnRowTooltip.Transpiler | |
| SocialCardUtility.ShouldShowPawnRelations: post: AnimalsLogic.ShowAnimalRelations.ShouldShowPawnRelations_Postfix | |
| SocialInteractionUtility.CanInitiateRandomInteraction: PRE: SimsTraits.SocialInteractionUtility_CanInitiateRandomInteraction_Patch.Prefix post: [-2147483648]VREAndroids.SocialInteractionUtility_CanInitiateRandomInteraction_Patch.Postfix | |
| SocialInteractionUtility.CanReceiveInteraction: post: VanillaMemesExpanded.VanillaMemesExpanded_SocialInteractionUtility_CanReceiveInteraction_Patch.DontInteract | |
| SocialInteractionUtility.IsGoodPositionForInteraction: post: VanillaRacesExpandedFungoid.VanillaRacesExpandedFungoid_SocialInteractionUtility_IsGoodPositionForInteraction_Patch.AlwaysInteract | |
| SocialInteractionsManager.TryAssignThoughtsAfterRaid: PRE: VSIERationalTraitDevelopment.SocialInteractionsManager_TryAssignThoughtsAfterRaid.Prefix | |
| SocialInteractionsManager.TryDevelopNewTrait: PRE: [2147483647]VREAndroids.VSIE_SocialInteractionsManager_TryDevelopNewTrait_Patch.Prefix, VSIERationalTraitDevelopment.SocialInteractionsManager_TryDevelopNewTrait_Patch.Prefix | |
| SocialInteractionsManager_TryDevelopNewTrait_Patch.Prefix: (no patches) | |
| SocialProperness.IsSociallyProper: TRANS: FixesForSBZFridge.SocialProperness_IsSociallyProperTranspiler.Transpiler | |
| SpecialThingFilterWorker_DeadmansApparel.Matches: post: SoftWarmBeds.SpecialThingFilterWorker_DeadmansApparel_Matches.Postfix | |
| SpecialThingFilterWorker_Fresh.AlwaysMatches: (no patches) | |
| SpecialThingFilterWorker_Fresh.CanEverMatch: (no patches) | |
| SpecialThingFilterWorker_NonDeadmansApparel.Matches: post: SoftWarmBeds.SpecialThingFilterWorker_NonDeadmansApparel_Matches.Postfix | |
| SpecialThingFilterWorker_Rotten.CanEverMatch: (no patches) | |
| SpecialThingFilterWorker_Vegetarian.Matches: PRE: AdaptiveStorage.HarmonyPatches.FixVanillaVegetarianFilter.Prefix | |
| SpinningLaserGunBase.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| SpouseRelationUtility.GetHistoryEventForSpouseAndFianceCountPlusOne: TRANS: BetterRomance.HarmonyPatches.SpouseRelationUtility_GetHistoryEventForSpouseAndFianceCountPlusOne.Transpiler | |
| StaggerHandler.StaggerFor: PRE: Vehicles.Patch_HealthAndStats.StaggerVehicle | |
| Stance_Warmup..ctor: post: EBSGFramework.HarmonyPatches.StanceWarmupPostfix | |
| Stance_Warmup.Interrupt: post: EBSGFramework.HarmonyPatches.WarmupInterruptPostfix | |
| Stance_Warmup.StanceDraw: post: VEF.Hediffs.VanillaExpandedFramework_Stance_Warmup_StanceDraw_Patch.Postfix | |
| Stance_Warmup.StanceTick: post: PeteTimesSix.SimpleSidearms.Intercepts.Stance_Warmup_StanceTick_Postfix.StanceTick | |
| StandardLetter.get_Choices: post: VisibleRaidPoints.Patch_StandardLetter_get_Choices.Postfix | |
| StartingPawnUtility.<>c__DisplayClass35_0.<GeneratePossessions>b__3: (no patches) | |
| StartingPawnUtility.GeneratePossessions: (no patches) | |
| StartingPawnUtility.GetGenerationRequest: PRE: [800]XenotypeSpawnControl.HarmonyPatches.StartingPawnUtility+GetGenerationRequest.Prefix | |
| StartingPawnUtility.SetGenerationRequest: PRE: [800]XenotypeSpawnControl.HarmonyPatches.StartingPawnUtility+SetGenerationRequest.Prefix | |
| Startup.AddAffectedByFacilityComp: (no patches) | |
| Startup.AddAffectedByFacilityComp: (no patches) | |
| Startup.AddFacilityComp: (no patches) | |
| StashedVehicle.Create: (no patches) | |
| StatCalculator.GetVerbsAndTools: (no patches) | |
| StatDef.PopulateMutableStats: post: VanillaGravshipExpanded.StatDef_PopulateMutableStats_Patch.Postfix | |
| StatDef_PopulateMutableStats_Patch.Postfix: (no patches) | |
| StatExtension.GetStatValue: post: VanillaSocialInteractionsExpanded.GetStatValue_Patch.Postfix | |
| StatPart_Age.ActiveFor: post: [-2147483648]VREAndroids.StatPart_Age_ActiveFor_Patch.Postfix | |
| StatPart_Age.AgeMultiplier: PRE: BetterRomance.HarmonyPatches.StatPart_Age_AgeEffect.Prefix | |
| StatPart_AgeOffset.AgeOffset: PRE: BetterRomance.HarmonyPatches.StatPart_Age_AgeEffect.Prefix | |
| StatPart_FertilityByGenderAge.AgeFactor: PRE: BetterRomance.HarmonyPatches.StatPart_FertilityByGenderAge_AgeFactor.Prefix post: BigAndSmall.GenderAndSexPatches.EveryFertileFix, EBSGFramework.HarmonyPatches.FertilityByAgeAgeFactorPostfix | |
| StatPart_GearStatOffset.ExplanationPart: post: SoftWarmBeds.StatPart_GearStatOffset_ExplanationPart.Postfix | |
| StatPart_GearStatOffset.GetInfoCardHyperlinks: post: SoftWarmBeds.StatPart_GearStatOffset_GetInfoCardHyperlinks.Postfix | |
| StatPart_Glow.ActiveFor: post: VanillaPsycastsExpanded.Nightstalker.Hediff_Darkvision.NoDarkPenalty | |
| StatPart_SanityNeedOffset.TryGetSanityValue: (no patches) | |
| StatPart_Slave.ActiveFor: post: SimsTraits.StatPart_Slave_ActiveFor_Patch.Postfix | |
| StatPart_TerrainMoveSpeed.ExplanationPart: PRE: VEF.Genes.VanillaExpandedFramework_StatPart_TerrainMoveSpeed_ExplanationPart.Prefix | |
| StatWorker.<RelevantGear>d__23.MoveNext: TRANS: VEF.Apparels.VanillaExpandedFramework_StatWorker_RelevantGear_Transpiler.Transpiler | |
| StatWorker.FinalizeValue: TRANS: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_StatWorker_FinalizeValue_Patch.Transpiler | |
| StatWorker.GetBaseValueFor: PRE: VanillaTradingExpanded.StatWorker_GetBaseValueFor_Patch.Prefix, MVCF.PatchSets.PatchSet_Stats.GetBaseValue_Prefix | |
| StatWorker.GetExplanationUnfinalized: post: GlitterNet.StatExplanationPatch.StatExplanationPostfix, PsiTech.Utility.StatExplanationPatch.Postfix, VFETribals.StatWorker_GetExplanationUnfinalized_Patch.Postfix | |
| StatWorker.GetOffsetsAndFactorsExplanation: TRANS: VEF.Apparels.VanillaExpandedFramework_StatWorker_GetOffsetsAndFactorsExplanation_Transpiler.Transpiler | |
| StatWorker.GetValueUnfinalized: post: GlitterNet.StatValuePatch.StatValuePostfix, PsiTech.Utility.StatValuePatch.Postfix, VFETribals.StatWorker_GetValueUnfinalized_Patch.Postfix TRANS: VEF.Apparels.VanillaExpandedFramework_StatWorker_GetValueUnfinalized_Transpiler.Transpiler, VFETribals.StatWorker_GetValueUnfinalized_Patch.Transpiler | |
| StatWorker.IsDisabledFor: PRE: Vehicles.Patch_HealthAndStats.StatDisabledForVehicle | |
| StatWorker.ShouldShowFor: post: [-2147483648]VREAndroids.StatWorker_ShouldShowFor_Patch.Postfix | |
| StatWorker.StatOffsetFromGear: TRANS: VREHussars.StatWorker_StatOffsetFromGear_Patch.Transpiler | |
| StatWorker_ContainmentStrength.CalculateValues: TRANS: ReBuildDoorsAndCorners.StatWorker_ContainmentStrength_CalculateValues_Patch.Transpiler | |
| StatWorker_MarketValue.CalculableRecipe: PRE: [2147483647]PerformanceOptimizer.Optimization_StatWorker_MarketValue_CalculableRecipe.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_StatWorker_MarketValue_CalculableRecipe.Postfix | |
| StatWorker_MeleeAverageDPS.GetVerbsAndTools: (no patches) | |
| StatWorker_MeleeDPS.GetMeleeDamage: post: EBSGFramework.HarmonyPatches.MeleeDPSPostfix | |
| StatWorker_MeleeDamageAmountTrap.GetExplanationUnfinalized: TRANS: VFESecurity.StatWorker_MeleeDamageAmountTrap_MultiHitSupport_Patch.Transpiler | |
| StatWorker_MeleeDamageAmountTrap.GetValueUnfinalized: TRANS: VFESecurity.StatWorker_MeleeDamageAmountTrap_MultiHitSupport_Patch.Transpiler | |
| StatWorker_PossibleCompOffsets.AbstractValueRange: (no patches) | |
| StatWorker_PossibleCompOffsets.GetExplanationUnfinalized: (no patches) | |
| StatWorker_Wildness.GetExplanationFinalizePart: TRANS: AnimalsLogic.ForgetMeNot+StatWorker_Wildness_GetExplanationFinalizePart_Patch.Transpiler | |
| StaticCollections.<>c.<.cctor>b__19_0: (no patches) | |
| StaticCollections.<>c.<.cctor>b__1_0: (no patches) | |
| StaticCollectionsClass.<>c.<.cctor>b__2_0: (no patches) | |
| StaticConstructorOnStartupUtility.CallAll: post: PerformanceOptimizer.InitializeMod.Postfix, VanillaTradingExpanded.Initializer.Postfix | |
| StatsReportUtility.DescriptionEntry: post: PsiTech.Utility.ThingDescPatch.Postfix | |
| StatsReportUtility.DrawStatsReport: PRE: VEF.Weapons.VanillaExpandedFramework_StatsReportUtility_DrawStatsReport_Patch.Prefix | |
| StatsReportUtility.StatsToDraw: post: Worldbuilder.StatsReportUtility_Patch.StatsToDraw_WorldObject_Postfix | |
| StatsReportUtility.StatsToDraw: post: Worldbuilder.StatsReportUtility_Patch.StatsToDraw_Thing_Postfix, SoftWarmBeds.StatsReportUtility_StatsToDraw.Postfix | |
| SteadyEnvironmentEffects.DoCellSteadyEffects: TRANS: ReGrowthCore.Patch_DoCellSteadyEffects.Transpiler | |
| SteadyEnvironmentEffects.FinalDeteriorationRate: post: VREAndroids.SteadyEnvironmentEffects_FinalDeteriorationRate_Patch.Postfix | |
| SteadyEnvironmentEffects.SteadyEnvironmentEffectsTick: post: ReGrowthCore.SteadyEnvironmentEffects_SteadyEnvironmentEffectsTick_Patch.Postfix | |
| StoreUtility.NoStorageBlockersIn: TRANS: AdaptiveStorage.HarmonyPatches.StoreUtilityPatches+FixMissingValidStackDestinationCheck.Transpiler | |
| StoreUtility.TryFindBestBetterStoreCellForWorker: PRE: AdaptiveStorage.HarmonyPatches.StoreUtilityPatches+PreventStorageLookupFaster.Prefix | |
| StoryWatcher_PopAdaptation.Notify_PawnEvent: post: VAspirE.VAspirE_StoryWatcher_PopAdaptation_Notify_PawnEvent_Patch.RefreshNeedList, VanillaCookingExpandedVariety.VanillaCookingExpandedVariety_StoryWatcher_PopAdaptation_Notify_PawnEvent_Patch.RefreshNeedList | |
| Storyteller.TryFire: PRE: VEF.Storyteller.VanillaExpandedFramework_Storyteller_TryFire_Patch.Prefix | |
| StorytellerComp.IncidentChanceFinal: post: VEF.Storyteller.VanillaExpandedFramework_StorytellerComp_IncidentChanceFinal_Patch.Postfix, VFETribals.StorytellerComp_IncidentChanceFinal_Patch.Postfix | |
| StorytellerComp.UsableIncidentsInCategory: post: VFEInsectoids.StorytellerComp_UsableIncidentsInCategory_Patch.Postfix | |
| StorytellerComp_Disease.<MakeIntervalIncidents>d__3.MoveNext: TRANS: VEF.Maps.VanillaExpandedFramework_StorytellerComp_Disease_MakeIntervalIncidents_Patch.ModifyBiomeDiseaseMTB | |
| StorytellerComp_ImportantQuest.get_BeenGivenQuest: post: ProgressionGravship.StorytellerComp_ImportantQuest_BeenGivenQuest_Patch.Postfix | |
| StorytellerComp_ImportantQuestAfterResearch.get_BeenGivenQuest: post: ProgressionGravship.VanillaGravshipExpanded_StorytellerComp_ImportantQuestAfterResearch_BeenGivenQuest_Patch.Postfix | |
| StorytellerComp_RandomMain.ChooseRandomCategory: TRANS: VFEPirates.StorytellerComp_RandomMain_ChooseRandomCategory_Transpiler.Transpiler | |
| StorytellerComp_RandomMain.GenerateParms: TRANS: VisibleRaidPoints.Patch_StorytellerComp_RandomMain_GenerateParms.Transpiler | |
| StorytellerDef.ResolveReferences: PRE: VEF.MergeablePatches+VanillaExpandedFramework_StorytellerDef_ResolveReferences_Patch.Prefix | |
| StorytellerUI.DrawCustomDifficultySlider: PRE: UnlimitedThreatScale.Patch_StorytellerUI_DrawCustomDifficultySlider.Prefix | |
| StorytellerUI.DrawStorytellerSelectionInterface: TRANS: ProgressionStorytellers.StorytellerUI_DrawStorytellerSelectionInterface_Patch.Transpiler | |
| StorytellerUtility.DefaultThreatPointsNow: TRANS: UnlimitedThreatScale.Patch_StorytellerUtility_DefaultThreatPointsNow.Transpiler, VisibleRaidPoints.Patch_StorytellerUtility_DefaultThreatPointsNow.Transpiler | |
| StorytellerUtilityPopulation.CalculatePopulationIntent: post: VFEPirates.StorytellerUtilityPopulation_CalculatePopulationIntent_Patch.Postfix | |
| StudiableBuilding.get_InteractablesMapComp: (no patches) | |
| StudyManager.ExposeData: (no patches) | |
| StunHandler.CanAdaptToDamage: PRE: USH_GE.Patch_StunHandler_CanAdaptToDamage.Prefix | |
| StunHandler.CanBeStunnedByDamage: PRE: USH_GE.Patch_StunHandler_CanBeStunnedByDamage.Prefix, BigAndSmall.CanBeStunnedByDamagePatch.CanBeStunnedByDamage_Prefix | |
| StunHandler.Notify_DamageApplied: post: USH_GE.Patch_StunHandler_Notify_DamageApplied.Postfix, VREAndroids.StunHandler_Notify_DamageApplied_Patch.Postfix | |
| StunHandler.StunFor: PRE: Vehicles.Patch_HealthAndStats.StunVehicle | |
| StunHandler_Notify_DamageApplied_Patch.Postfix: (no patches) | |
| SubstructureGrid.DrawSubstructureCountOnGUI: TRANS: VanillaGravshipExpanded.ListAllGravEngines_Patch.Transpiler | |
| SubstructureGrid.DrawSubstructureFootprint: TRANS: VanillaGravshipExpanded.ListAllGravEngines_Patch.Transpiler | |
| SuppressionFieldAccessUtility.GetSuppressionFieldManager: (no patches) | |
| SurfaceLayer.SerializeMutators: TRANS: GeologicalLandforms.Patches.Patch_RimWorld_SurfaceLayer.SerializeMutators_Transpiler | |
| SurgeryOutcomeEffectDef.GetQuality: post: SimsTraits.SurgeryOutcomeEffectDef_GetQuality_Patch.Postfix | |
| SurgeryOutcome_Failure.Apply: PRE: VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_SurgeryOutcome_Failure_Apply_Patch.RemoveFailures | |
| SurgeryOutcome_HediffWithDuration.Apply: (no patches) | |
| SymbolResolver_Interior_AncientTemple.Resolve: post: USH_GE.Patch_SymbolResolver_Interior_AncientTemple_Resolve.Postfix | |
| SymbolResolver_Interior_Brewery.get_SpawnPassiveCoolerIfTemperatureAbove: (no patches) | |
| SymbolResolver_LootScatter.Resolve: PRE: ProgressionAgriculture.SymbolResolver_LootScatter_Resolve_Patch.Prefix | |
| SymbolResolver_Settlement.AddHostilePawnGroup: PRE: VFEInsectoids.SymbolResolver_Settlement_AddHostilePawnGroup_Patch.Prefix | |
| SymbolResolver_SingleThing.Resolve: PRE: SoftWarmBeds.SymbolResolver_SingleThing_Resolve.Prefix | |
| TabSorting.<>c.<sortDecorations>b__39_2: (no patches) | |
| TabSorting.<>c__DisplayClass46_0.<sortLights>g__lightValidator|0: (no patches) | |
| TabSorting.sortBedroomFurniture: (no patches) | |
| TabSorting.sortHospitalFurniture: (no patches) | |
| TabSorting.sortKitchenFurniture: (no patches) | |
| TabSorting.sortResearchFurniture: (no patches) | |
| TabWorker_Health.<>c__DisplayClass9_1.<GetRows>b__1: (no patches) | |
| Tab_LevelPower.FillTab: (no patches) | |
| Tab_LevelTransmit.FillTab: (no patches) | |
| TaleUtility.Notify_PawnDied: post: VREAndroids.TaleUtility_Notify_PawnDied_Patch_Patch.Postfix, VFEPirates.VFEPirates_TaleUtility_Notify_PawnDied_Patch.NotifyCrewmanDied, AlphaMemes.AlphaMemes_TaleUtility_Notify_PawnDied_Patch.NotifyEnemyDied, VanillaMemesExpanded.VanillaMemesExpanded_TaleUtility_Notify_PawnDied_Patch.NotifyEnemyDied | |
| Tale_DoublePawn.Concerns: PRE: Vehicles.Patch_CaravanHandling.ConcernNullThing | |
| Targeter.GetTargetingVerb: PRE: MVCF.PatchSets.PatchSet_MultiVerb.Prefix_GetTargetingVerb | |
| Targeter.ProcessInputEvents: post: Vehicles.Patch_Rendering.ProcessTargeterInputEvents | |
| Targeter.TargeterOnGUI: post: Vehicles.Patch_Rendering.DrawTargeters | |
| Targeter.TargeterUpdate: PRE: ProgressRenderer.Harmony_Targeter_TargeterUpdate.Prefix post: Vehicles.Patch_Rendering.TargeterUpdate | |
| TattooDef.GraphicFor: post: VEF.Genes.VanillaExpandedFramework_TattooDef_GraphicFor_Patch.Postfix | |
| TechprintUtility.<>c__DisplayClass0_0.<GetResearchProjectsNeedingTechprintsNow>b__0: (no patches) | |
| TendUtility.CalculateBaseTendQuality: TRANS: SimsTraits.TendUtility_CalculateBaseTendQuality_Patch.Transpiler | |
| TendUtility.DoTend: PRE: RimEffect.TendUtility_DoTend.Prefix, VanillaQuestsExpandedAncients.TendUtility_DoTend_Patch.Prefix, VanillaSocialInteractionsExpanded.DoTend_Patch.Prefix, AncientMarket_Libraray.Patch_Tend.prefix post: VanillaQuestsExpandedAncients.TendUtility_DoTend_Patch.Postfix, VanillaSocialInteractionsExpanded.DoTend_Patch.Postfix | |
| TendUtility.GetOptimalHediffsToTendWithSingleTreatment: (no patches) | |
| TerrainComp_Healer.FirstInjuryToThreat: (no patches) | |
| TerrainDef.Named: post: ReplaceLib.TerrainDef_Named.Postfix | |
| TerrainDef.PostLoad: PRE: DubsBadHygiene.Patches.HarmonyPatches+Harmony_TerrainPostLoad.Prefix | |
| TerrainDef.get_IsCarpet: post: VanillaRecyclingExpanded.VanillaRecyclingExpanded_TerrainDef_IsCarpet_Patch.RemoveFloor | |
| TerrainGrid.DoTerrainChangedEffects: PRE: Vehicles.Patch_VehiclePathing.SetTerrainAndUpdateVehiclePathCosts post: DubsBadHygiene.Patches.HarmonyPatches+H_DoTerrainChangedEffects.Postfix | |
| TerrainGrid.GetMaterial: PRE: ReGrowthCore.TerrainGrid_GetMaterial_Patch.Prefix | |
| TerrainGrid.Notify_TerrainDestroyed: TRANS: AnomaliesExpected.HarmonyPatches.TG_Notify_TerrainDestroyed_Transpiler | |
| TerrainGrid.RemoveTopLayer: PRE: VEF.Maps.VanillaExpandedFramework_TerrainGrid_RemoveTopLayer.Prefix post: ReGrowthCore.Patch_TerrainGrid_RemoveTopLayer.Postfix | |
| TerrainGrid.SetTerrain: PRE: VEF.Maps.VanillaExpandedFramework_TerrainGrid_SetTerrain.Prefix post: VEF.Maps.VanillaExpandedFramework_TerrainGrid_SetTerrain.Postfix, ReGrowthCore.Patch_TerrainGrid_SetTerrain.Postfix | |
| TerrainPatchMaker.Init: PRE: [750]MapPreview.Patches.Patch_RimWorld_TerrainPatchMaker.Init_Prefix post: GeologicalLandforms.Patches.Patch_RimWorld_TerrainPatchMaker.Init | |
| TerrorUtility.GetTerrorLevel: PRE: BigAndSmall.GetTerrorLevel_Patch.Prefix | |
| TerrorUtility.GetTerrorThoughts: PRE: BigAndSmall.GetTerrorThoughts_Patch.Prefix | |
| Thing.ButcherProducts: post: GeneticRim.GeneticRim_Thing_ButcherProducts_Patch.ChangeMeatAmountByAge | |
| Thing.DeSpawn: PRE: VanillaPsycastsExpanded.GenRadialCached.DeSpawn_Prefix, [200]Flecker.ExtensionUtility+Patch_DeSpawn.Prefix TRANS: Vehicles.Patch_VehiclePathing.DeSpawnAndUpdateVehicleRegionsTranspiler | |
| Thing.Destroy: PRE: Vehicles.Patch_Combat.ProjectileMapToWorld, VFEInsectoids.CompInsectSpawner+Thing_Destroy_Patch.Prefix | |
| Thing.DrawExtraSelectionOverlays: post: GlitterNet.OverlaysPatch.OverlaysPostfix | |
| Thing.DrawGUIOverlay: PRE: [0]ToggleableOverlays.Patch_Thing_DrawGUIOverlay.Prefix | |
| Thing.ExposeData: post: Worldbuilder.Thing_ExposeData_Patch.Postfix TRANS: SaveGameCompatibility.ExposeDataPatch.Transpiler | |
| Thing.GetFloatMenuOptions: post: VanillaRacesExpandedSanguophage.VanillaRacesExpandedSanguophage_Thing_GetFloatMenuOptions_Patch.Postfix | |
| Thing.GetGizmos: post: Vehicles.Patch_Gizmos.ThingTransferToVehicleGizmo, Worldbuilder.Thing_GetGizmos_Patch.Postfix, AnomaliesExpected.HarmonyPatches.T_GetGizmos_Postfix | |
| Thing.GetInspectString: post: VanillaGravshipExpanded.Thing_GetInspectString_Patch.Postfix | |
| Thing.GetInspectTabs: post: AdaptiveStorage.HarmonyPatches.AddITabToLegacyStorages.Postfix | |
| Thing.Ingested: PRE: VEF.Genes.ThingIngestingPatches.Prefix, GeneticRim.GeneticRim_Thing_Ingested_Patch.DetectSargSyndrome post: VFEEmpire.HarmonyPatches.Patch_Thing_Ingested.Postfix, BigAndSmall.DietPatch.Ingested_Postfix, AlphaMemes.AlphaMemes_Thing_Ingested_Patch.IngestedNutrientPaste, SimsTraits.Thing_Ingested_Patch.Postfix, VanillaCookingExpandedVariety.VanillaCookingExpandedVariety_Thing_Ingested_Patch.CommunicateIngestion, VanillaSocialInteractionsExpanded.Thing_Ingested.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_Thing_Ingested_Patch.NotifyAnimalProducstIngested | |
| Thing.IngestedCalculateAmounts: post: VAEInsanity.Thing_IngestedCalculateAmounts_Patch.Postfix | |
| Thing.Notify_ColorChanged: post: SoftWarmBeds.Thing_Notify_ColorChanged.Postfix | |
| Thing.Notify_Equipped: post: BigAndSmall.EquipNotifyPatches.Notify_Notify_Equipped | |
| Thing.Notify_Unequipped: post: BigAndSmall.EquipNotifyPatches.Notify_Notify_Unequipped | |
| Thing.PostMapInit: PRE: PipeSystem.PipeSystem_Thing_PostMapInit_Patch.Prefix | |
| Thing.PreApplyDamage: post: EBSGFramework.HarmonyPatches.PreApplyDamagePostfix | |
| Thing.PreSwapMap: post: VanillaMemesExpanded.VanillaMemesExpanded_Thing_PreSwapMap_Patch.SetPawnCaravanTimerToZero | |
| Thing.Print: post: ReGrowthCore.Thing_Print_Patch.Postfix | |
| Thing.SetFaction: post: ProgressionEducation.Thing_SetFaction_Patch.Postfix | |
| Thing.SetFactionDirect: post: Worldbuilder.Thing_SetFactionDirect_Patch.Postfix | |
| Thing.SpawnSetup: post: Worldbuilder.Thing_SpawnSetup_Patch.Postfix, VanillaPsycastsExpanded.GenRadialCached.SpawnSetup_Postfix, Flecker.ExtensionUtility+Patch_SpawnSetup.Postfix TRANS: Vehicles.Patch_VehiclePathing.SpawnAndUpdateVehicleRegionsTranspiler, PipeSystem.PipeSystem_Thing_SpawnSetup_Patch.Transpiler | |
| Thing.TakeDamage: PRE: VEF.AnimalBehaviours.Patch_TakeDamage.Prefix, RimEffect.TakeDamage_Patch.Prefix, ReBuildDoorsAndCorners.Thing_TakeDamage_Patch.Prefix, BigAndSmall.TakeDamagePatch.Prefix, EBSGFramework.HarmonyPatches.TakeDamagePrefix, SimsTraits.Thing_TakeDamage_Patch.Prefix, VFETribals.Thing_TakeDamage_Patch.Prefix post: VEF.Weapons.VanillaExpandedFramework_Thing_TakeDamage_Patch.Postfix, EBSGFramework.HarmonyPatches.TakeDamagePostfix, SimsTraits.Thing_TakeDamage_Patch.Postfix, VanillaTraitsExpanded.TakeDamage_Patch.Postfix | |
| Thing.get_AmbientTemperature: post: AdaptiveStorage.HarmonyPatches.AdjustThingTemperature.Postfix | |
| Thing.get_DefaultGraphic: PRE: VEF.Graphics.VanillaExpandedFramework_Thing_DefaultGraphic_Patch.Prefix | |
| Thing.get_DescriptionFlavor: post: Worldbuilder.Thing_DescriptionFlavor_Patch.Postfix | |
| Thing.get_MarketValue: post: BigAndSmall.MarketValuePatch.MarketValuePostfix | |
| Thing.get_MaxTickIntervalRate: post: SlowerPawnTickRate.MaxTickIntervalRate_ThingPatch.Postfix | |
| Thing.set_Position: post: Vehicles.Patch_VehiclePathing.SetPositionAndUpdateVehicleRegions | |
| Thing.set_Rotation: PRE: Vehicles.Patch_VehiclePathing.SetRotationAndUpdateVehicleRegionsClipping | |
| ThingDef.ConfigErrors: post: AdaptiveStorage.HarmonyPatches.ImprovedConfigErrors.Postfix | |
| ThingDef.Named: post: ReplaceLib.ThingDef_Named.Postfix | |
| ThingDef.ResolveReferences: PRE: VEF.MergeablePatches+VanillaExpandedFramework_ThingDef_ResolveReferences_Patch.Prefix | |
| ThingDef.SpecialDisplayStats: post: VEF.Apparels.VanillaExpandedFramework_ThingDef_SpecialDisplayStats_Patch.Postfix, VEF.Apparels.VanillaExpandedFramework_ThingDef_SpecialDisplayStats_Postfix_Patch+SetFaction.Postfix, VEF.AnimalBehaviours.ThingDef_Patch+VanillaExpandedFramework_ThingDef_SpecialDisplayStats_Nocturnal_Patch.Postfix, VEF.AnimalBehaviours.Patch_ThingDef+VanillaExpandedFramework_ThingDef_SpecialDisplayStats_Patch.Postfix, VREAndroids.ThingDef_SpecialDisplayStats_Patch.Postfix, AdaptiveStorage.HarmonyPatches.ThingDefStatDrawEntries.Postfix, MVCF.PatchSets.PatchSet_InfoCard.ReplaceVerbStatDisplay | |
| ThingDef.get_CoexistsWithFloors: post: ReBuildDoorsAndCorners.ThingDef_CoexistsWithFloors_Patch.Postfix | |
| ThingDef.get_DescriptionDetailed: TRANS: VEF.Apparels.VanillaExpandedFramework_ThingDef_DescriptionDetailed_Transpiler.Transpiler | |
| ThingDef.get_HasThingIDNumber: post: VanillaPsycastsExpanded.HarmonyPatches.ThingDef_HasThingIDNumber_Patch.Postfix | |
| ThingDef.get_IsAddictiveDrug: (no patches) | |
| ThingDef.get_IsIngestible: PRE: RimEffectAR.Harmony.ThingDefIsIngestible_Patch.Prefix | |
| ThingDef.get_IsRangedWeapon: post: VEF.Weapons.VanillaExpandedFramework_FloatMenuOptionProvider_Equip_GetSingleOptionFor_Patch.IsRangedWeapon | |
| ThingDef.get_IsShell: post: VFESecurity.ThingDef_IsShell_Patch.Postfix | |
| ThingDef.get_IsShieldThatBlocksRanged: (no patches) | |
| ThingDef.get_IsWeapon: post: VEF.Weapons.VanillaExpandedFramework_FloatMenuOptionProvider_Equip_GetSingleOptionFor_Patch.IsWeapon | |
| ThingDefCountClass..ctor: PRE: ReplaceLib.ThingDefCountClass_GetDefSilentFail.Prefix | |
| ThingDefGenerator_Buildings.NewBlueprintDef_Thing: post: VEF.Buildings.CustomizableGraphicsPatches+InjectImpliedDefComps.Postfix | |
| ThingDefGenerator_Buildings.NewFrameDef_Thing: post: VEF.Buildings.CustomizableGraphicsPatches+InjectImpliedDefComps.Postfix | |
| ThingDefGenerator_Corpses.GenerateCorpseDef: post: CorpseDescriptionFix.ThingDefGenerator_Corpses_GenerateCorpseDef_Patch.Postfix TRANS: BigAndSmall.DefGeneratorPatches.GenerateCorpseDef_Transpiler | |
| ThingDefGenerator_Corpses.ImpliedCorpseDefs: post: VEF.Pawns.VanillaExpandedFramework_ThingDefGenerator_Corpses_ImpliedCorpseDefs_Patch.Postfix | |
| ThingDefGenerator_Neurotrainer.ImpliedThingDefs: post: VanillaPsycastsExpanded.ThingDefGenerator_Neurotrainer_ImpliedThingDefs_Patch.Postfix | |
| ThingFilter.ExposeData: PRE: DefNameLink.ThingFilterExposeDataStrip.Prefix post: AdaptiveStorage.HarmonyPatches.RemoveInvalidDefsOnStorageSettingsLoading.Postfix | |
| ThingFilter.get_AllowedThingDefs: post: EBSGFramework.HarmonyPatches.AllowedThingDefsPostfix | |
| ThingGrid.Deregister: PRE: Vehicles.Patch_VehiclePathing.MonitorThingGridDeregisterStart | |
| ThingGrid.DeregisterInCell: TRANS: AdaptiveStorage.HarmonyPatches.DeregisteredAtThingGridEvent.Transpiler | |
| ThingGrid.Register: PRE: Vehicles.Patch_VehiclePathing.MonitorThingGridRegisterStart | |
| ThingGrid.RegisterInCell: TRANS: AdaptiveStorage.HarmonyPatches.RegisteredAtThingGridEvent.Transpiler | |
| ThingListGroupHelper.Includes: PRE: AntimatterAnnihilation.Patches.Patch_RefuelableFix.Prefix post: VNPE.ThingListGroupHelper_Includes.Postfix TRANS: VFED.HarmonyPatches.MiscPatches.FixLudeonsStupidHardcoding | |
| ThingMaker.MakeThing: PRE: ReplaceLib.ThingMaker_MakeThing.Prefix post: AlphaBooks.AlphaBooks_ThingMaker_MakeThing_Patch.HandleCraftModifications, VanillaQuestsExpandedAncients.VanillaQuestsExpandedAncients_ThingMaker_MakeThing_Patch.HandleCraftModifications, SoftWarmBeds.ThingMaker_MakeThing.Postfix | |
| ThingOverlays.ThingOverlaysOnGUI: post: AchtungMod.ThingOverlays_ThingOverlaysOnGUI_Patch.Postfix TRANS: AdaptiveStorage.HarmonyPatches.CacheZoomAndMousePosition.Transpiler, ToggleableOverlays.Patch_ThingOverlays_ThingOverlaysOnGUI.Transpiler | |
| ThingRequest.Accepts: post: Vehicles.Patch_JobSystem.AcceptsVehicleRefuelable | |
| ThingSelectionUtility.MultiSelectableThingsInScreenRectDistinct: post: AdaptiveStorage.HarmonyPatches.PreventSelectionInRect.Postfix | |
| ThingSelectionUtility.SelectableByMapClick: post: VEF.Apparels.VanillaExpandedFramework_ThingSelectionUtility_Patch.GhillieException | |
| ThingSetMaker.Generate: post: ProgressionAgriculture.ThingSetMaker_Generate_Patch.Postfix | |
| ThingSetMakerUtility.<>c__DisplayClass3_0.<GetAllowedThingDefs>b__1: (no patches) | |
| ThingSetMakerUtility.CanGenerate: post: DubsBadHygiene.Patches.HarmonyPatches+Harmony_ThingSetMakerUtility.Postfix | |
| ThingSetMaker_Meteorite.Reset: post: VanillaPsycastsExpanded.ThingSetMaker_Meteorite_Reset.Postfix | |
| ThingSetMaker_RefugeePod.Generate: PRE: BigAndSmall.PawnKindSwapPatches.GenerateRefugeePodPrefix | |
| ThingSetMaker_ResourcePod.PossiblePodContentsDefs: post: DubsBadHygiene.Patches.HarmonyPatches+Harmony_ThingSetMaker_ResourcePod.Postfix | |
| ThingStuffPair.get_Commonality: post: VEF.Things.VanillaExpandedFramework_ThingStuffPair_Commonality_Patch.Postfix | |
| ThingWithComps.DrawGUIOverlay: TRANS: ToggleableOverlays.Patch_ThingWithComps_DrawGUIOverlay.Transpiler | |
| ThingWithComps.ExposeData: post: VEF.Weapons.VanillaExpandedFramework_ThingWithComps_ExposeData_Patch.Postfix | |
| ThingWithComps.GetFloatMenuOptions: post: AllowTool.Patches.Thing_GetFloatMenuOptions_Patch.FinishOffWhenDrafted | |
| ThingWithComps.GetGizmos: post: PsiTech.Utility.ThingGizmosPatch.Postfix | |
| ThingWithComps.PreApplyDamage: post: VEF.Hediffs.ShieldsSystem.PostPreApplyDamage | |
| ThingWithComps.SpawnSetup: post: VEF.Weapons.VanillaExpandedFramework_ThingWithComps_SpawnSetup_Patch.Postfix, GeneticRim.VanillaGeneticsExpanded_ThingWithComps_SpawnSetup.Postfix | |
| ThingWithFloorGraphic.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Thing_GetInspectString_Patch.Postfix: (no patches) | |
| Thing_Print_Patch.Postfix: (no patches) | |
| ThinkNode_ChancePerHour_Lovin.MtbHours: TRANS: BetterRomance.HarmonyPatches.ThinkNode_ChancePerHour_Lovin_MtbHours.Transpiler | |
| ThinkNode_ConditionalBurning.Satisfied: PRE: [2147483647]VREAndroids.ThinkNode_ConditionalBurning_Satisfied_Patch.Prefix | |
| ThinkNode_Priority_GetJoy.GetPriority: PRE: ProgressionEducation.ThinkNode_Priority_GetJoy_GetPriority_Patch.Prefix | |
| ThinkNode_Priority_Learn.GetPriority: TRANS: SimsTraits.ThinkNode_Priority_Learn_GetPriority_Patch.Transpiler | |
| ThornPod.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| Thought.MoodOffset: post: EBSGFramework.HarmonyPatches.GeneticThoughtMultiplier, PsiTech.Utility.PsychicThoughtPatch.Postfix, SimsTraits.Thought_MoodOffset_Patch.Postfix, VanillaTraitsExpanded.MoodOffset_Patch.Postfix | |
| ThoughtHandler.GetSocialThoughts: PRE: [2147483647]VREAndroids.ThoughtHandler_GetSocialThoughts_Patch.Prefix | |
| ThoughtHandler.TotalMoodOffset: PRE: [2147483647]PerformanceOptimizer.Optimization_ThoughtHandler_TotalMoodOffset.Prefix post: [-2147483648]PerformanceOptimizer.Optimization_ThoughtHandler_TotalMoodOffset.Postfix | |
| ThoughtUtility.GiveThoughtsForPawnOrganHarvested: PRE: VanillaRacesExpandedPigskin.VanillaRacesExpandedPigskin_ThoughtUtility_GiveThoughtsForPawnOrganHarvested_Patch.SkipIfPigskinAndPrecept, VanillaSocialInteractionsExpanded.GiveThoughtsForPawnOrganHarvested_Patch.Prefix post: AlphaMemes.AlphaMemes_ThoughtUtility_GiveThoughtsForPawnOrganHarvested_Patch.NotifySurgeryToNonColonist | |
| ThoughtUtility.NullifyingHediff: post: VanillaPsycastsExpanded.Nightstalker.Hediff_Darkvision.NullDarkness | |
| ThoughtUtility.RemovePositiveBedroomThoughts: post: AlphaMemes.AlphaMemes_ThoughtUtility_RemovePositiveBedroomThoughts_Patch.RemoveBarrackThoughts | |
| ThoughtWorker_AgeReversalDemanded.CanHaveThought: PRE: [2147483647]VREAndroids.ThoughtWorker_AgeReversalDemanded_CanHaveThought_Patch.Prefix | |
| ThoughtWorker_AgeReversalDemanded.ShouldHaveThought: PRE: [2147483647]VREAndroids.ThoughtWorker_AgeReversalDemanded_ShouldHaveThought_Patch.Prefix TRANS: BetterRomance.HarmonyPatches.ThoughtWorker_AgeReversalDemanded_ShouldHaveThought.Transpiler | |
| ThoughtWorker_ApparelDamaged.CurrentStateInternal: TRANS: SimsTraits.ThoughtWorker_ApparelDamaged_CurrentStateInternal_Patch.Transpiler | |
| ThoughtWorker_Ascetic.CurrentStateInternal: PRE: VanillaPsycastsExpanded.ThoughtWorker_Ascetic_CurrentStateInternal_Patch.Prefix post: VanillaPsycastsExpanded.ThoughtWorker_Ascetic_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_Cold.CurrentStateInternal: post: VanillaPsycastsExpanded.ThoughtWorker_Cold_CurrentStateInternal.Postfix | |
| ThoughtWorker_ComaRestChamber.get_Cache: (no patches) | |
| ThoughtWorker_Dark.CurrentStateInternal: post: AlphaGenes.AlphaGenes_ThoughtWorker_Dark_CurrentStateInternal_Postfix.PostFix | |
| ThoughtWorker_Expectations.CurrentStateInternal: post: SimsTraits.ThoughtWorker_Expectations_CurrentStateInternal_Patch.Postfix, VFETribals.VFETribals_ThoughtWorker_Expectations_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_ExpectationsSlave.CurrentStateInternal: post: SimsTraits.ThoughtWorker_ExpectationsSlave_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_Greedy.CurrentStateInternal: PRE: VanillaPsycastsExpanded.ThoughtWorker_Greedy_CurrentStateInternal_Patch.Prefix post: VanillaPsycastsExpanded.ThoughtWorker_Greedy_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_HospitalPatientRoomStats.CurrentStateInternal: PRE: VanillaPsycastsExpanded.ThoughtWorker_HospitalPatientRoomStats_CurrentStateInternal_Patch.Prefix post: VanillaPsycastsExpanded.ThoughtWorker_HospitalPatientRoomStats_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_HumanLeatherApparel.CurrentThoughtState: post: VEF.Genes.VanillaExpandedFramework_ThoughtWorker_HumanLeatherApparel_CurrentThoughtState.Postfix | |
| ThoughtWorker_IsCarryingRangedWeapon.CurrentStateInternal: PRE: MVCF.PatchSets.PatchSet_Brawlers.CurrentStateInternal_Prefix | |
| ThoughtWorker_LoveReading.CurrentStateInternal: TRANS: SimsTraits.ThoughtWorker_LoveReading_CurrentStateInternal_Patch.Transpiler | |
| ThoughtWorker_MoodSwing.CurrentStateInternal: (no patches) | |
| ThoughtWorker_MusicalInstrumentListeningBase.CurrentStateInternal: post: SimsTraits.ThoughtWorker_MusicalInstrumentListeningBase_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_NeedFood.CurrentStateInternal: post: VEF.Genes.VanillaExpandedFramework_CurrentSocialStateInternal_Patch.CurrentStateInternal_Postfix | |
| ThoughtWorker_NeedNeuralSupercharge.ShouldHaveThought: PRE: [2147483647]VREAndroids.ThoughtWorker_NeedNeuralSupercharge_ShouldHaveThought_Patch.Prefix | |
| ThoughtWorker_Pain.CurrentThoughtState: PRE: [2147483647]VREAndroids.ThoughtWorker_Pain_CurrentThoughtState_Patch.Prefix | |
| ThoughtWorker_Precept_HalfBlind.IsHalfBlind: post: PsiTech.Utility.HalfBlindThoughtPatch.Postfix | |
| ThoughtWorker_Pretty.CurrentSocialStateInternal: post: BigAndSmall.CurrentSocialStateInternal_Patch.Postfix, SimsTraits.ThoughtWorker_Pretty_CurrentSocialStateInternal_Patch.Postfix | |
| ThoughtWorker_PsychicDrone.CurrentStateInternal: post: AlphaGenes.AlphaGenes_ThoughtWorker_PsychicDrone_CurrentStateInternal_Patch.InvertPsychicDrone, VanillaPsycastsExpanded.ThoughtWorker_PsychicDrone_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_PsychicEruption.<>c.<ValidVolcanos>b__0_0: (no patches) | |
| ThoughtWorker_PsychicEruption.CurrentStateInternal: (no patches) | |
| ThoughtWorker_RoomImpressiveness.CurrentStateInternal: PRE: VanillaPsycastsExpanded.ThoughtWorker_RoomImpressiveness_CurrentStateInternal_Patch.Prefix post: VanillaPsycastsExpanded.ThoughtWorker_RoomImpressiveness_CurrentStateInternal_Patch.Postfix | |
| ThoughtWorker_RoyalTitleApparelMinQualityNotMet.Validate: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| ThoughtWorker_RoyalTitleApparelRequirementNotMet.GetAllRequiredApparelPerGroup: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| ThoughtWorker_RoyalTitleApparelRequirementNotMet.Validate: PRE: SimsTraits.Titles_Patch.Prefix post: SimsTraits.Titles_Patch.Postfix | |
| ThoughtWorker_Sick.CurrentStateInternal: post: VanillaMemesExpanded.VanillaMemesExpanded_ThoughtWorker_Sick_CurrentStateInternal_Patch.DontShowIfHolyDisease | |
| ThoughtWorker_Ugly.CurrentSocialStateInternal: post: AlphaGenes.AlphaGenes_ThoughtWorker_Ugly_CurrentSocialStateInternal_Patch.NoUgliness, BigAndSmall.ThoughtWorker_Ugly_Patch.Postfix, SimsTraits.ThoughtWorker_Ugly_CurrentSocialStateInternal_Patch.Postfix | |
| Thought_DisableFirstDefeatThought.MoodOffset: (no patches) | |
| Thought_Memory.TryMergeWithExistingMemory: TRANS: VFEEmpire.HarmonyPatches.Patch_ThoughtStacking.Transpiler | |
| Thought_Memory.get_DurationTicks: post: VFEMedieval.VFEMedieval_Thought_Memory_DurationTicks_Patch.ModifyDuration | |
| Thought_PsychicHarmonizer.get_ShouldDiscard: (no patches) | |
| Thought_Situational.Notify_BecameInactive: post: SimsTraits.Thought_Situational_Notify_BecameInactive_Patch.Postfix | |
| Thought_SituationalSocial.OpinionOffset: post: EBSGFramework.HarmonyPatches.GeneticThoughtMultiplier | |
| ThreatsGenerator.GetIncidentParms: TRANS: VisibleRaidPoints.Patch_ThreatsGenerator.Transpiler | |
| TickManager.DoSingleTick: PRE: VEF.Maps.VanillaExpandedFramework_DoSingleTick_Patch.Prefix, AchtungMod.TickManager_DoSingleTick_Patch.Prefix post: VEF.Maps.VanillaExpandedFramework_DoSingleTick_Patch.Postfix, RimEffect.Patch_TickManager_DoSingleTick.Postfix, ReGrowthCore.Patch_TickManager_DoSingleTick.Postfix | |
| TickManager.get_CurTimeSpeed: post: Vehicles.Patch_Misc.ForcePauseFromVehicles | |
| TickManager.get_Paused: post: Vehicles.Patch_Misc.PausedFromVehicles | |
| TickManager.get_TickRateMultiplier: PRE: SmartSpeed.SmartSpeed_TickManager_TickRateMultiplier_PreAndPostfix.ModifyTickRate | |
| Tile.AddMutator: PRE: GeologicalLandforms.Patches.Patch_RimWorld_Tile.AddMutator_Prefix post: GeologicalLandforms.Patches.Patch_RimWorld_Tile.AddMutator_Postfix | |
| Tile.RemoveMutator: PRE: GeologicalLandforms.Patches.Patch_RimWorld_Tile.RemoveMutator_Prefix post: GeologicalLandforms.Patches.Patch_RimWorld_Tile.RemoveMutator_Postfix | |
| Tile.get_AllowRoofedEdgeWalkIn: post: GeologicalLandforms.Patches.Patch_RimWorld_Tile.AllowRoofedEdgeWalkIn_Postfix | |
| Tile.get_AnimalDensity: post: GeologicalLandforms.Patches.Patch_RimWorld_Tile.AnimalDensity_Postfix | |
| Tile.get_Biomes: post: GeologicalLandforms.Patches.Patch_RimWorld_Tile.GetBiomes_Postfix | |
| Tile.get_MaxFishPopulation: post: VCE_Fishing.VCE_Fishing_Tile_MaxFishPopulation_Patch.MultiplyMaxFish | |
| Tile.get_Mutators: post: GeologicalLandforms.Patches.Patch_RimWorld_Tile.GetMutators_Postfix | |
| TileFinder.<>c__DisplayClass2_0.<RandomSettlementTileFor>b__1: PRE: VFEInsectoids.TileFinder_RandomSettlementTileFor_Patch.Prefix post: VEF.Factions.VanillaExpandedFramework_TileFinder_RandomSettlementTileFor_Patch.Postfix | |
| TileFinder.IsValidTileForNewSettlement: TRANS: [200]GeologicalLandforms.Patches.Patch_RimWorld_TileFinder.IsValidTileForNewSettlement_Transpiler | |
| TileFinder.RandomSettlementTileFor: PRE: VEF.Factions.VanillaExpandedFramework_TileFinder_RandomSettlementTileFor_Patch+VanillaExpandedFramework_TileFinder_RandomSettlementTileFor_Prefix_Patch.Prefix post: Vehicles.Patch_MapHandling.AdjustSettlement, VEF.Factions.VanillaExpandedFramework_TileFinder_RandomSettlementTileFor_Patch+VanillaExpandedFramework_TileFinder_RandomSettlementTileFor_Prefix_Patch.Postfix | |
| TileMutatorWorker_ArcheanTrees.GenerateCriticalStructures: (no patches) | |
| TileMutatorWorker_Caves.GeneratePostTerrain: post: Mashed_Ashlands.TileMutatorWorker_Caves_GeneratePostTerrain_Patch.Postfix | |
| TileMutatorWorker_Coast.get_CoastOffset: post: Vehicles.Patch_MapHandling.CoastSizeMultiplier | |
| TileMutatorWorker_River.GenerateRiverLookupTexture: PRE: [700]MapPreview.Patches.Patch_RimWorld_TileMutatorWorker_River.GenerateRiverLookupTexture | |
| TileMutatorWorker_River.GetRiverWidthAt: post: Vehicles.Patch_MapHandling.RiverNodeWidth | |
| TileMutatorWorker_River.RiverBankTerrainAt: TRANS: VEF.Maps.VanillaExpandedFramework_TileMutatorWorker_River_RiverBankTerrainAt_Patch.MultiplyRiverBankSize | |
| TilePicker.StopTargeting: PRE: VanillaGravshipExpanded.TilePicker_StopTargeting_Patch.Prefix | |
| TilesPerDayCalculator.ApproxTilesPerDay: PRE: Vehicles.Patch_FormCaravanDialog.ApproxTilesForVehicleTransferables | |
| TilesPerDayCalculator.ApproxTilesPerDay: PRE: Vehicles.Patch_FormCaravanDialog.ApproxTilesForVehicles | |
| TimeControls.DoTimeControlsGUI: PRE: SmartSpeed.SmartSpeed_TimeControls_DoTimeControlsGUI_Prefix.CallGUIConfig TRANS: SmartSpeed.SmartSpeed_TimeControls_DoTimeControlsGUI_Transpiler.Transpiler | |
| TimeSlower.SignalForceNormalSpeed: PRE: [800]No_Forced_Slowdown.HarmonyPatches.Patch_SignalForceNormalSpeed_Prefix | |
| TimeSlower.SignalForceNormalSpeedShort: PRE: [800]No_Forced_Slowdown.HarmonyPatches.Patch_SignalForceNormalSpeed_Prefix | |
| TimedDetectionRaids.StartDetectionCountdown: PRE: VFEInsectoids.TimedDetectionRaids_StartDetectionCountdown_Patch.Prefix | |
| Toil..ctor: post: PeteTimesSix.SimpleSidearms.Intercepts.Toil_ctor_Postfix._ctor | |
| Toil.AddEndCondition: PRE: AchtungMod.Toil_AddEndCondition_Patch.Prefix | |
| Toil.AddFailCondition: PRE: AchtungMod.Toil_AddFailCondition_Patch.Prefix | |
| ToilEffects.WithEffect: post: VanillaSocialInteractionsExpanded.WithEffect_Patch.Postfix | |
| ToilEffects.WithProgressBar: post: VanillaSocialInteractionsExpanded.WithProgressBar_Patch.Postfix, VanillaTraitsExpanded.WithProgressBar_Patch.Postfix | |
| ToilFailConditions.<>c__DisplayClass29_0`1.<FailOnChildLearningConditions>b__0: post: SimsTraits.ToilFailConditions_FailOnChildLearningConditions_Patch.Postfix | |
| ToilMaker.MakeToil: PRE: PeteTimesSix.SimpleSidearms.Intercepts.ToilMaker_MakeToil_Patches.Prefix post: PeteTimesSix.SimpleSidearms.Intercepts.ToilMaker_MakeToil_Patches.Postfix | |
| Toils_Bed.<>c__DisplayClass0_0.<GotoBed>b__1: PRE: BunkBeds.Toils_Bed_GotoBed_TickAction_Patch.Prefix | |
| Toils_Combat.<>c__DisplayClass1_0.<GotoCastPosition>b__0: TRANS: VEF.Weapons.VanillaExpandedFramework_Toils_Combat_GotoCastPosition_Patch.Transpiler | |
| Toils_Combat.<>c__DisplayClass6_0.<FollowAndMeleeAttack>b__0: PRE: VEF.Weapons.VanillaExpandedFramework_Toils_Combat_FollowAndMeleeAttack_Patch.Prefix TRANS: VEF.Weapons.VanillaExpandedFramework_Toils_Combat_FollowAndMeleeAttack_Patch.Transpiler | |
| Toils_Combat.TrySetJobToUseAttackVerb: PRE: MVCF.PatchSets.PatchSet_Hunting.TrySetJobToUseAttackVerb | |
| Toils_Construct.<>c__DisplayClass0_0.<MakeSolidThingFromBlueprintIfNecessary>b__0: TRANS: AchtungMod.Toils_Construct_MakeSolidThingFromBlueprintIfNecessary_Patch.Transpiler | |
| Toils_General.Open: post: AlphaBooks.AlphaBooks_Toils_General_Open_Patch.CheckForHermetic | |
| Toils_Haul.PlaceHauledThingInCell: post: AllowTool.Patches.ToilsHaul_PlaceInCell_Patch.ClearHaulUrgently | |
| Toils_Ingest.<>c__DisplayClass14_0.<FinalizeIngest>b__0: PRE: VanillaPsycastsExpanded.Toils_Ingest_FinalizeIngest_Patch.Prefix post: VanillaPsycastsExpanded.Toils_Ingest_FinalizeIngest_Patch.Postfix | |
| Toils_Interpersonal.<>c__DisplayClass10_0.<TryTrain>b__0: TRANS: AnimalsLogic.Patches.GetThemYoung.TryTrain_Transpiler | |
| Toils_LayDown.<>c__DisplayClass6_0.<LayDown>b__0: TRANS: BunkBeds.LayDown_InitAction_Patch.Transpiler | |
| Toils_LayDown.ApplyBedThoughts: PRE: VanillaPsycastsExpanded.Toils_LayDown_ApplyBedThoughts_Patch.Prefix post: VFEC.ClassicMod.TellBedAboutThoughts, AlphaMemes.AlphaMemes_Toils_LayDown_ApplyBedThoughts_Patch.ApplyBarrackThoughts, VanillaPsycastsExpanded.Toils_LayDown_ApplyBedThoughts_Patch.Postfix, Mashed_Ashlands.Toils_LayDown_ApplyBedThoughts_Patch.Postfix | |
| Toils_Recipe.ConsumeIngredients: PRE: PsiTech.Utility.ConsumeIngredientsPatch.Prefix | |
| Toils_Recipe.FinishRecipeAndStartStoringProduct: post: NiceInventoryTab.BillFinished_Patch.Postfix | |
| TooltipUtility.ShotCalculationTipString: post: PsiTech.Utility.TooltipUtilityPatch.Postfix, VCR.TooltipUtility_ShotCalculationTipString_Patch.Postfix | |
| Tornado.CellImmuneToDamage: post: VEF.Apparels.CellImmuneToDamage.Postfix | |
| TradeDeal.InSellablePosition: post: Vehicles.Patch_CaravanHandling.NegotiatorInVehicle | |
| TradeDeal.TryExecute: PRE: VEF.Factions.TradeDeal_TryExecute_Patch.Prefix, VanillaPsycastsExpanded.TradeDeal_TryExecute_Patch.Prefix post: VEF.Factions.TradeDeal_TryExecute_Patch.Postfix, AlphaMemes.AlphaMemes_TradeDeal_TryExecute_Patch.NotifySuccessfulTrade, VanillaPsycastsExpanded.TradeDeal_TryExecute_Patch.Postfix, VanillaMemesExpanded.VanillaMemesExpanded_TradeDeal_TryExecute_Patch.NotifySuccessfulTrade TRANS: SimsTraits.TradeDeal_TryExecute_Patch.Transpiler, VanillaSocialInteractionsExpanded.TryExecute_Patch.Transpiler | |
| TradeDeal.get_CurrencyTradeable: post: VFEMedieval.TradeDeal_CurrencyTradeable_Patch.Postfix | |
| TradeDeal_TryExecute_Patch.Postfix: (no patches) | |
| TradeDeal_TryExecute_Patch.ProcessCaughtContraband: (no patches) | |
| TradeEncounter.GiveSoldThingToPlayer: PRE: VanillaTradingExpanded.GiveSoldThingToPlayer_Patch.Prefix | |
| TradeEncounter.GiveSoldThingToTrader: PRE: VanillaTradingExpanded.GiveSoldThingToTrader_Patch.Prefix | |
| TradeShip.GiveSoldThingToPlayer: PRE: VanillaTradingExpanded.GiveSoldThingToPlayer_Patch.Prefix | |
| TradeShip.GiveSoldThingToTrader: PRE: VanillaTradingExpanded.GiveSoldThingToTrader_Patch.Prefix | |
| TradeUtility.AllLaunchableThingsForTrade: post: FixesForSBZFridge.FridgeItemsTradeableAtCommsConsole.Postfix, [0]MapWideTradeBeacon.Patcher.AllLaunchableThingsForTrade, [-2147483648]ReSpliceCore.TradeUtility_AllLaunchableThingsForTrade_Patch.Postfix | |
| TradeUtility.LaunchThingsOfType: PRE: MapWideTradeBeacon.Patcher.LaunchThingOfType | |
| Tradeable.GetPriceTooltip: post: VFEEmpire.HarmonyPatches.DestroyerPatches.AddToTooltip | |
| Tradeable.InitPriceDataIfNeeded: PRE: VFEEmpire.HarmonyPatches.DestroyerPatches.CheckShouldModify post: VFEEmpire.HarmonyPatches.DestroyerPatches.ModifySellPrice | |
| Tradeable.get_Interactive: post: Vehicles.Patch_CaravanHandling.AerialVehicleSlaveTradeRoomCheck | |
| Tradeable.get_IsCurrency: post: VFEMedieval.Tradeable_IsCurrency_Patch.Postfix | |
| Tradeable_Pawn.ResolveTrade: post: VanillaMemesExpanded.VanillaMemesExpanded_Tradeable_Pawn_ResolveTrade_Patch.DetectSlaveBought | |
| Tradeable_Pawn.get_Label: post: AnimalsLogic.Patch_Tradeable_Pawn_Label.Postfix | |
| TrainableUtility.DegradationPeriodTicks: TRANS: AnimalsLogic.ForgetMeNot.TrainableUtility_DegradationPeriodTicks_Patch | |
| TrainableUtility.DegradationPeriodTicks: TRANS: AnimalsLogic.ForgetMeNot.TrainableUtility_DegradationPeriodTicks_Patch | |
| TrainableUtility.TamenessCanDecay: PRE: VEF.AnimalBehaviours.VanillaExpandedFramework_TrainableUtility_TamenessCanDecay_Patch.RemoveTamenessDecayCheck TRANS: AnimalsLogic.ForgetMeNot.TrainableUtility_TamenessCanDecay_Patch | |
| TrainableUtility.TamenessCanDecay: PRE: VEF.AnimalBehaviours.VanillaExpandedFramework_TrainableUtility_TamenessCanDecay_ForThingDef_Patch.RemoveTamenessDecayCheck TRANS: AnimalsLogic.ForgetMeNot.TrainableUtility_TamenessCanDecay_Patch | |
| Trait.AllowsWorkType: post: VFEPirates.Trait_AllowsWorkType_Patch.Postfix | |
| Trait.TipString: post: TraitIcons.Trait_TipString_Patch.Postfix, BetterRomance.HarmonyPatches.Trait_TipString.Postfix | |
| TraitDegreeData.GetLabelCapFor: PRE: TraitIcons.TraitDegreeData_GetLabelCapFor_Patch.Prefix | |
| TraitDegreeData.get_LabelCap: PRE: TraitIcons.TraitDegreeData_LabelCap_Getter_Patch.Prefix | |
| TraitSet.GainTrait: PRE: [2147483647]VREAndroids.TraitSet_GainTrait_Patch.Prefix, VEF.Apparels.VanillaExpandedFramework_TraitSet_GainTrait_Patch.Prefix, BetterRomance.HarmonyPatches.TraitSet_GainTrait.Prefix post: VAspirE.SatisfactionPatches.CheckGeneral, EBSGFramework.HarmonyPatches.GainTraitPostfix, SimsTraits.TraitSet_GainTrait_Patch.Postfix, VAEInsanity.TraitSet_GainTrait_Patch.Postfix, VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_TraitSet_GainTrait_Patch.AddToStaticList, VanillaTraitsExpanded.GainTrait_Patch.Postfix, BetterRomance.HarmonyPatches.TraitSet_GainTrait.Postfix | |
| TraitSet.RemoveTrait: PRE: EBSGFramework.HarmonyPatches.RemoveTraitPrefix post: SimsTraits.TraitSet_RemoveTrait_Patch.Postfix, VAEInsanity.TraitSet_RemoveTrait_Patch.Postfix, VanillaRacesExpandedHighmate.VanillaRacesExpandedHighmate_TraitSet_RemoveTrait_Patch.RemoveFromStaticList, VanillaTraitsExpanded.RemoveTrait_Patch.Postfix | |
| TraitsManager.TryInterruptForcedJobs: TRANS: SimsTraits.TraitsManager_TryInterruptForcedJobs_Patch.Transpiler | |
| Transferable.CanAdjustBy: post: VEF.Factions.Transferable_CanAdjustBy_Patch.Postfix, VanillaPsycastsExpanded.Transferable_CanAdjustBy_Patch.Postfix | |
| TransferableOneWay.get_Label: post: AnimalsLogic.Patch_TransferableOneWay_Label.Postfix | |
| TransferableOneWayWidget.DoRow: TRANS: ReSpliceCharmweavers.TransferableOneWayWidget_DoRow_Patch.Transpiler | |
| TransferableUIUtility.ContentSourceDescription: PRE: VEF.VanillaExpandedFramework_TransferableUIUtility_ContentSourceDescription_Patch.Prefix | |
| TransferableUIUtility.DoCountAdjustInterfaceInternal: PRE: Vehicles.Patch_FormCaravanDialog.CanAdjustPawnTransferable | |
| TransferableUIUtility.DoExtraIcons: post: ProgressionAgriculture.TransferableUIUtility_DoExtraIcons_Patch.Postfix, ReSpliceCharmweavers.TransferableUIUtility_DoExtraIcons_Patch.Postfix | |
| TransferableUIUtility_DoExtraIcons_Patch.Postfix: (no patches) | |
| TransferableUtility.CanStack: post: Vehicles.Patch_CaravanFormation.CanStackVehicle | |
| TransferableVehicleWidget.Init: (no patches) | |
| Transition.Execute: PRE: VEF.Storyteller.VanillaExpandedFramework_Transition_Execute_Patch.Prefix, VanillaSocialInteractionsExpanded.Patch_Execute.Prefix | |
| TransportersArrivalActionUtility.AnyNonDownedColonist: post: EBSGFramework.HarmonyPatches.AnyNonDownedColonistPostfix | |
| TransportersArrivalActionUtility.AnyPotentialCaravanOwner: post: EBSGFramework.HarmonyPatches.AnyNonDownedColonistPostfix | |
| TransportersArrivalAction_GiveGift.<>c__DisplayClass9_0.<GetFloatMenuOptions>b__2: (no patches) | |
| TravellingTransporters.Arrived: PRE: VFEPirates.TravelingPawn+TravelingTransportPods_Arrived.Prefix | |
| Tree.InitializeNodesStructures: PRE: VanillaGravshipExpanded.ResearchTree_Compat_Patches.Tree_Generation_Prefix post: VanillaGravshipExpanded.ResearchTree_Compat_Patches.Tree_Generation_Postfix | |
| Trigger_UrgentlyHungry.ActivateOn: PRE: RimEffectAR.Trigger_UrgentlyHungry_Patch.Prefix | |
| TryGainMemory_Patch.Prefix: (no patches) | |
| TunnelHiveSpawner.Spawn: PRE: VFEInsectoids.TunnelHiveSpawner_Spawn_Patch.Prefix post: VFEInsectoids.TunnelHiveSpawner_Spawn_Patch.Postfix | |
| TurretTop.DrawTurret: PRE: [800]VFESecurity.TurretTop_DrawTurret_Patch.Prefix, VEF.Weapons.VanillaExpandedFramework_TurretTop_DrawTurret_Patch.Prefix, VanillaGravshipExpanded.TurretTop_DrawTurret_Patch.Prefix | |
| TurretTop.TurretTopTick: PRE: VanillaGravshipExpanded.TurretTop_TurretTopTick_Patch.Prefix | |
| TurretTop.get_CurRotation: PRE: VEF.Weapons.VanillaExpandedFramework_TurretTop_get_CurRotation_Patch.Prefix | |
| Tutor.TutorOnGUI: PRE: RimHUD.Access.Patch.RimWorld_Tutor_TutorOnGUI.Prefix | |
| UIRoot.UIRootOnGUI: post: HugsLib.Patches.UIRoot_OnGUI_Patch.OnGUIHook TRANS: MoreWidgets.Patch_DoTooltipGUI.Transpiler | |
| UIRoot_Entry.Init: PRE: AntimatterAnnihilation.Temp+OnMainMenuShow.Prefix, DivineFramework.StartupPatch.Prefix post: SmashTools.GameEvent.RaiseOnMainMenu, [0]UpdateLogTool.Patches.UpdateOnStartup | |
| UIRoot_Entry.UIRootOnGUI: PRE: Analyzer.H_KeyPresses.OnGUI | |
| UIRoot_Play.UIRootOnGUI: PRE: Analyzer.H_KeyPresses.OnGUI | |
| UIRoot_Play.UIRootUpdate: post: PsiTech.Utility.UIRootPatch.Postfix | |
| UI_BackgroundMain.DoOverlay: post: VBE.BackgroundController.DoOverlay | |
| UndercaveMapComponent.Notify_BeginCollapsing: (no patches) | |
| UnnaturalCorpse.GetGizmos: post: AnomaliesExpected.HarmonyPatches.T_GetGizmos_Postfix | |
| UnnaturalCorpseTracker.ApplyCorpseDestroyedThoughts: (no patches) | |
| UnnaturalCorpseTracker.Notify_AwokenAttackStarting: (no patches) | |
| Util.FoodValidator: (no patches) | |
| UtilityEvent.AnyQuestExistsFrom: (no patches) | |
| UtilityEvent.GenerateBounty: (no patches) | |
| UtilityPawn.GenerateWanted: (no patches) | |
| UtilityPawn.GetWantedComponent: (no patches) | |
| UtilityPawn.GetWantedComponent: (no patches) | |
| Utility_GetList.GetTheCorrectMedicalCareCategory: (no patches) | |
| Utils.AndroidCanCatch: (no patches) | |
| Utils.Initialize: (no patches) | |
| Utils.IsDisabled: (no patches) | |
| Utils.IsValidGeneForInjection: PRE: TooManyMods.Patch_IsValidGeneForInjection.Prefix | |
| VEF_HarmonyCategories.IsMoveSpeedFactorByTerrainTagActive: (no patches) | |
| VFEGlobal.GeneralSettings: (no patches) | |
| VSIE_Utils.GetSpouseOrLoverOrFiance: post: BetterRomance.HarmonyPatches.VSIEPatches.GetSpouseOrLoverOrFiancePostfix | |
| VSIE_Utils.get_SocialInteractionsManager: (no patches) | |
| VanillaExpandedFramework_CompEggLayer_ProduceEgg.<ModifyCrossbreedEgg>g__GetEggForPawnKind|1_0: (no patches) | |
| VanillaExpandedFramework_DoSingleTick_Patch.Postfix: (no patches) | |
| VanillaExpandedFramework_GameComponentUtility_LoadedGame_Patch.LoadedGame.CollectPotentialFactionsToSpawn: (no patches) | |
| VanillaExpandedFramework_GameComponentUtility_LoadedGame_Patch.StartedNewGame.OnNewGame: (no patches) | |
| VanillaExpandedFramework_Hediff_Pregnant_PostAdd_Patch.CauseEggFertilization: (no patches) | |
| VanillaExpandedFramework_IncidentWorker_Raid_TryExecuteWorker_Patch.Prefix: (no patches) | |
| VanillaExpandedFramework_Lord_AddPawn_Patch.Postfix: (no patches) | |
| VanillaExpandedFramework_Lord_Cleanup_Patch.Prefix: (no patches) | |
| VanillaExpandedFramework_Pawn_InteractionsTracker_TryInteractWith_Patch.TryGetCachedSpreadableComp: (no patches) | |
| VanillaExpandedFramework_Pawn_Kill_Patch.ShouldTriggerReinforcements: (no patches) | |
| VanillaExpandedFramework_Projectile_Launch_Patch.<>c.<Postfix>b__0_0: (no patches) | |
| VanillaExpandedFramework_Quest_End_Patch.Prefix: (no patches) | |
| VanillaExpandedFramework_SettlementDefeatUtility_IsDefeated_Patch.Postfix: (no patches) | |
| VanillaExpandedFramework_Stance_Warmup_StanceDraw_Patch.Postfix: (no patches) | |
| VanillaExpandedFramework_StatPart_TerrainMoveSpeed_ExplanationPart.FillSpeedFactorsData: (no patches) | |
| VanillaExpandedFramework_StatsReportUtility_DrawStatsReport_Patch.Prefix: PRE: SimsTraits.VEF_VerbProps_Patch.Prefix post: SimsTraits.VEF_VerbProps_Patch.Postfix | |
| VanillaExpandedFramework_TerrainGrid_RemoveTopLayer.Prefix: (no patches) | |
| VanillaExpandedFramework_TerrainGrid_SetTerrain.Postfix: PRE: MapPreview.Compatibility.ModCompat_VE_VEF.TerrainGrid_SetTerrain_Postfix | |
| VanillaExpandedFramework_TerrainGrid_SetTerrain.Prefix: (no patches) | |
| VanillaExpandedFramework_Transition_Execute_Patch.Prefix: (no patches) | |
| VanillaGeneticsExpanded_MedicalRecipesUtility_SpawnThingsFromHediffs_Prefix.AddQualityToImplant: (no patches) | |
| VanillaGeneticsExpanded_Recipe_InstallArtificialBodyPart_ApplyOnPawn.AddQualityToHediff: (no patches) | |
| VanillaGeneticsExpanded_Recipe_RemoveImplant_ApplyOnPawn_Prefix.AddQualityToImplant: (no patches) | |
| VanillaRacesExpandedHighmate_Gene_Notify_PawnDied_Patch.RemoveFromStaticList: (no patches) | |
| VanillaRacesExpandedHighmate_MemoryThoughtHandler_TryGainMemory_Patch.HandlePawnMemories: (no patches) | |
| VanillaRacesExpandedHighmate_TraitSet_GainTrait_Patch.AddToStaticList: (no patches) | |
| VanillaRacesExpandedHighmate_TraitSet_RemoveTrait_Patch.RemoveFromStaticList: (no patches) | |
| VanillaRacesExpandedInsector_Hediff_Pregnant_Tick.Prefix: (no patches) | |
| VanillaRacesExpandedStarjack_GeneDefGenerator_ImpliedGeneDefs_Patch.Postfix: PRE: TooManyMods.AstrogeneWhitelistPatch.Prefix | |
| VanillaShieldsExpandedStartup.<>c.<.cctor>b__1_0: (no patches) | |
| VehicleCaravanPathingHelper.EstimatedTicksToArrive: (no patches) | |
| VehicleDef.CacheCompProperties: (no patches) | |
| VehicleDef.CreateRole: (no patches) | |
| VehicleInfoCard.DrawStatsWorker: PRE: VanillaVehiclesExpanded.VanillaVehiclesExpanded_VehicleInfoCard_DrawStatsWorker_Patch.Prefix | |
| VehicleInfoCard.StatsToDraw: post: VanillaVehiclesExpanded.VanillaVehiclesExpanded_VehicleInfoCard_StatsToDraw_Patch.Postfix | |
| VehicleMod.GenerateImpliedDefs: (no patches) | |
| VehiclePathFollower.CostToPayThisTick: post: VanillaVehiclesExpanded.Vehicle_PathFollower_CostToPayThisTick_Patch.Postfix | |
| VehiclePawn.DisembarkPawn: post: VanillaVehiclesExpanded.VehiclePawn_DisembarkPawn_Pawn.Postfix, VanillaVehiclesExpanded_Tier3.VehiclePawn_DisembarkPawn_Pawn.Postfix | |
| VehiclePawn.TotalAllowedFor: post: VanillaVehiclesExpanded.VanillaVehiclesExpanded_VehiclePawn_TotalAllowedFor_Patch.Postfix | |
| VehiclePawn.TryAddPawn: post: VanillaVehiclesExpanded.VehiclePawn_Notify_Boarded_Pawn.Postfix | |
| VehiclePawn.get_PawnCollisionMultiplier: post: VanillaVehiclesExpanded.VanillaVehiclesExpanded_VehiclePawn_PawnCollisionMultiplier_Patch.Postfix | |
| VehiclePawn.get_WorldSpeedMultiplier: post: VanillaVehiclesExpanded.VanillaVehiclesExpanded_VehiclePawn_WorldSpeedMultiplier_Patch.Postfix | |
| VehicleRoutePlanner.FinalizeInit: (no patches) | |
| VehicleSkyfaller_Arriving.get_VehicleLauncherProps: (no patches) | |
| VehicleTurret.<ConfigErrors>d__189.MoveNext: (no patches) | |
| VehicleTurret.FireTurret: PRE: VEF.Weapons.VanillaExpandedFramework_VehicleFramework_Turret_Patch.Prefix | |
| VehicleWorldObjectsHolder.get_Instance: (no patches) | |
| VeniVidiVici.AddGizmo: PRE: TooManyMods.TMMP_VCE_NoVeniVidiVici.Prefix | |
| Verb.Available: post: VEF.Weapons.VanillaExpandedFramework_Verb_Available_Patch.Postfix, VEF.Buildings.Verb_Available_Patch.Postfix, Ammunition.Harmony.AmmoHarmonyPatches.Available_PostFix, MVCF.PatchSets.PatchSet_VerbComps.Available_Postfix | |
| Verb.CanHitCellFromCellIgnoringRange: PRE: VFEMedieval.Verb_CanHitCellFromCellIgnoringRange_Patch.Prefix | |
| Verb.CanHitTarget: post: VFESecurity.Verb_CanHitTarget_Patch.Postfix, VEF.Hediffs.ShieldsSystem.CanHitTargetFrom_Postfix | |
| Verb.CanHitTargetFrom: post: EBSGFramework.HarmonyPatches.CanHitTargetFromPostfix, SimsTraits.Verb_CanHitTargetFrom_Patch.Postfix | |
| Verb.ExposeData: post: MVCF.PatchSets.PatchSet_Base.PostExposeDataVerb | |
| Verb.Notify_EquipmentLost: TRANS: PeteTimesSix.SimpleSidearms.Intercepts.Verb_Notify_EquipmentLost_Patches.Verb_Notify_EquipmentLost_Transpiler | |
| Verb.OrderForceTarget: PRE: SimsTraits.Verb_OrderForceTarget_Patch.Prefix, ReSpliceCharmweavers.Verb_OrderForceTarget_Patch.Prefix, MVCF.PatchSets.PatchSet_MultiVerb.Prefix_OrderForceTarget | |
| Verb.TryCastNextBurstShot: PRE: SimsTraits.Verb_TryCastNextBurstShot_Patch.Prefix, [150]Ammunition.Harmony.AmmoHarmonyPatches.TryCastNextBurstShot_PreFix post: BloodAnimations.Verb_TryCastNextBurstShot.TryCastNextBurstShot, MuzzleFlash.Patch.HarmonyPatch_Verb.Postfix, MVCF.PatchSets.PatchSet_VerbComps.TryCastNextBurstShot_Postfix TRANS: RunAndGun.Harmony.Verb_TryCastNextBurstShot.Transpiler, MVCF.PatchSets.PatchSet_VerbComps.TryCastNextBurstShot_Transpiler | |
| Verb.TryFindShootLineFromTo: PRE: VEF.Weapons.VanillaExpandedFramework_Verb_TryFindShootLineFromTo_Patch.Prefix | |
| Verb.TryStartCastOn: PRE: RunAndGun.Harmony.Verb_TryStartCastOn.Prefix, [100]VEF.Weapons.VanillaExpandedFramework_Verb_TryStartCastOn_Lasers_Patch.TryStartCastOn_RapidFire_Prefix post: [401]VEF.Weapons.VanillaExpandedFramework_Verb_TryStartCastOn_Lasers_Patch.TryStartCastOn_RapidFire_Postfix | |
| Verb.WarmupComplete: PRE: [150]Ammunition.Harmony.AmmoHarmonyPatches.WarmupComplete_PreFix post: DubsMintMinimap.Harmony_WarmupComplete.Postfix | |
| Verb.get_EquipmentSource: PRE: MVCF.PatchSets.PatchSet_MultiVerb.Prefix_EquipmentSource post: VanillaVehiclesExpanded.Verb_EquipmentSource_Patch.Postfix | |
| Verb.get_TicksBetweenBurstShots: post: USH_GE.Verb_TicksBetweenBurstShots_Postfix.Postfix | |
| VerbAccuracyUtility.CheckAccuracyEffects: (no patches) | |
| VerbManagerUtility.AddVerbs: (no patches) | |
| VerbProperties.AdjustedAccuracy: post: RunAndGun.Harmony.VerbProperties_AdjustedAccuracy.Postfix TRANS: MVCF.PatchSets.PatchSet_Stats.AccuracyTranspiler | |
| VerbProperties.AdjustedArmorPenetration: post: SimsTraits.VerbProperties_AdjustedArmorPenetration_Patch.Postfix | |
| VerbProperties.AdjustedArmorPenetration: post: BigAndSmall.Balancing.VerbProperties_AdjustedArmorPenetration_Patch.Postfix, PsiTech.Utility.ArmorPenetationPatch.Postfix, VCR.AdvanceArmor_postfix.Postfix | |
| VerbProperties.AdjustedArmorPenetration: post: VCR.AdvanceArmor_postfix.Postfix | |
| VerbProperties.AdjustedCooldown: TRANS: MVCF.PatchSets.PatchSet_Stats.CooldownTranspiler2 | |
| VerbProperties.AdjustedCooldown: post: VEF.AnimalBehaviours.VanillaExpandedFramework_VerbProperties_AdjustedCooldown_Patch.LastStand, BigAndSmall.VerbProperties_AdjustedCooldown_Patch.Postfix, MeleeWeaponSpeedAndDamage.AdjustedCooldown_Patch.Postfix TRANS: MVCF.PatchSets.PatchSet_Stats.CooldownTranspiler1 | |
| VerbProperties.AdjustedMeleeDamageAmount: post: VEF.Pawns.VanillaExpandedFramework_AdjustedMeleeDamageAmount_Patch.Postfix, VFEMedieval.VerbProperties_AdjustedMeleeDamageAmount_Patch.Postfix, VanillaPsycastsExpanded.VerbProperties_AdjustedMeleeDamageAmount_Patch.Postfix | |
| VerbProperties.AdjustedMeleeDamageAmount: post: BigAndSmall.Balancing.AdjustedMeleeDamageAmount_Patch.Postfix, MeleeWeaponSpeedAndDamage.AdjustedMeleeDamageAmount_Patch.Postfix | |
| VerbProperties.AdjustedMeleeDamageAmount: post: BigAndSmall.Balancing.AdjustedMeleeDamageAmount_Patch_2.Postfix | |
| VerbProperties.GetDamageFactorFor: post: RimEffectAR.Harmony.Patch_VerbProperties_GetDamageFactorFor.Postfix, GeneticRim.Patch_GetDamageFactor.Postfix | |
| VerbProperties.GetForceMissFactorFor: PRE: MVCF.PatchSets.Trackers.PatchSet_Hediffs.GetForceMissFactorFor_Prefix | |
| VerbProperties.get_CausesExplosion: (no patches) | |
| VerbProperties_AdjustedMeleeDamageAmount_Patch.Postfix: PRE: TooManyMods.TMM_VPE_KillskipFix.Prefix | |
| VerbTracker.CreateVerbTargetCommand: post: VEF.Graphics.VanillaExpandedFramework_VerbTracker_CreateVerbTargetCommand_Patch.Postfix, Ammunition.Harmony.AmmoHarmonyPatches.CreateVerbTargetCommand_PostFix | |
| VerbTracker.InitVerb: post: MVCF.PatchSets.PatchSet_Base.PostInitVerb | |
| VerbUtility.GetConcreteExampleVerbs: (no patches) | |
| VerbUtility.GetVerbRangeMultiplier: post: SimsTraits.VEF_VerbProps_GetVerbRangeMultiplier_Patch.Postfix | |
| VerbUtility.IsEMP: post: AnomaliesExpected.HarmonyPatches.VU_IsEMP_Postfix | |
| VerbUtility.ProjectileFliesOverhead: PRE: VanillaGravshipExpanded.VerbUtility_ProjectileFliesOverhead_Patch.Prefix | |
| VerbUtility.TryModifyThingsVerbs: PRE: SimsTraits.VEF_VerbProps_Patch.Prefix post: SimsTraits.VEF_VerbProps_Patch.Postfix | |
| Verb_AEPowerBeam.Available: post: MVCF.PatchSets.PatchSet_VerbComps.Available_Postfix | |
| Verb_BeatFire.TryCastShot: PRE: VanillaGravshipExpanded.VanillaGravshipExpanded_Verb_BeatFire_TryCastShot_Patch.Prefix | |
| Verb_CastAbility.CanHitTarget: PRE: Vehicles.Patch_HealthAndStats.VehiclesImmuneToPsycast | |
| Verb_CastAbility.DrawHighlight: PRE: GeneticRim.GeneticRim_Verb_CastAbility_DrawHighlight_Patch.DisableRadius post: AlphaBooks.AlphaBooks_Verb_CastAbility_DrawHighlight_Patch.DrawExtraRing, AlphaMemes.AlphaMemes_Verb_CastAbility_DrawHighlight_Patch.DrawExtraRing | |
| Verb_CastAbility.OrderForceTarget: PRE: ReSpliceCharmweavers.Verb_CastAbility_VEF_OrderForceTarget_Patch.Prefix | |
| Verb_CastAbility.OrderForceTarget: PRE: ReSpliceCharmweavers.Verb_CastAbility_OrderForceTarget_Patch.Prefix | |
| Verb_CastTargetEffect.TryCastShot: TRANS: MVCF.PatchSets.Trackers.PatchSet_Hediffs.FixTargetEffectVerb | |
| Verb_LaunchProjectile.Available: post: MVCF.PatchSets.PatchSet_VerbComps.Available_Postfix | |
| Verb_LaunchProjectile.GetForcedMissTarget: PRE: VanillaGravshipExpanded.Verb_LaunchProjectile_GetForcedMissTarget_Patch.Prefix | |
| Verb_LaunchProjectile.TryCastShot: PRE: VEF.Weapons.VanillaExpandedFramework_Verb_LaunchProjectile_TryCastShot.Prefix, SimsTraits.Verb_LaunchProjectile_TryCastShot_Patch.Prefix post: VEF.Buildings.Verb_LaunchProjectile_TryCastShot_Patch.Postfix, SimsTraits.Verb_LaunchProjectile_TryCastShot_Patch.Postfix TRANS: VanillaGravshipExpanded.CastSourceReplacer.Transpiler, VanillaGravshipExpanded.Verb_LaunchProjectile_TryCastShot_Patch.Transpiler, VFED.HarmonyPatches.MiscPatches.APAlwaysHits, VFED.Building_TurretGunBarrels+CastSourceReplacer.ReplaceCall | |
| Verb_LaunchProjectile.get_Projectile: PRE: [150]Ammunition.Harmony.AmmoHarmonyPatches.Projectile_PreFix post: EBSGFramework.HarmonyPatches.LaunchProjectileProjectilePostfix, MVCF.PatchSets.PatchSet_VerbComps.Projectile_Postfix | |
| Verb_LaunchProjectileStatic.OrderForceTarget: PRE: ReSpliceCharmweavers.Verb_OrderForceTarget_Patch.Prefix | |
| Verb_LaunchProjectileStaticOneUse.OrderForceTarget: PRE: ReSpliceCharmweavers.Verb_OrderForceTarget_Patch.Prefix | |
| Verb_MeleeAttack.GetDodgeChance: post: BigAndSmall.VerbMeleeAttack_GetDodgeChance.Postfix, SimsTraits.Verb_MeleeAttack_GetDodgeChance_Patch.Postfix | |
| Verb_MeleeAttack.TryCastShot: PRE: SimsTraits.Verb_MeleeAttack_TryCastShot_Patch.Prefix post: PeteTimesSix.SimpleSidearms.Intercepts.Verb_MeleeAttack_TryCastShot_PostFix.TryCastShot, SimsTraits.Verb_MeleeAttack_TryCastShot_Patch.Postfix TRANS: VCR.Verb_MeleeAttack_TryCastShot_Patch.Transpiler | |
| Verb_MeleeAttackDamage.DamageInfosToApply: post: EBSGFramework.HarmonyPatches.DamageInfosToApplyPostfix | |
| Verb_RandomShot.get_Projectile: post: MVCF.PatchSets.PatchSet_VerbComps.Projectile_Postfix | |
| Verb_ShieldDetonation.Available: post: MVCF.PatchSets.PatchSet_VerbComps.Available_Postfix | |
| Verb_Shoot.TryCastShot: post: VanillaQuestsExpandedDeadlife.Verb_Shoot_TryCastShot_Patch.Postfix | |
| Verb_ShootBeam.ApplyDamage: TRANS: MVCF.PatchSets.Trackers.PatchSet_Hediffs.FixBeamVerb | |
| Verb_ShootOneUse.SelfConsume: post: PeteTimesSix.SimpleSidearms.Intercepts.Verb_ShootOneUse_SelfConsume_Postfix.SelfConsume | |
| Verb_ShootWithWorldTargeting.get_Projectile: post: MVCF.PatchSets.PatchSet_VerbComps.Projectile_Postfix | |
| Verb_SpewFire.Available: post: MVCF.PatchSets.PatchSet_VerbComps.Available_Postfix | |
| Verb_Spray.Available: post: MVCF.PatchSets.PatchSet_VerbComps.Available_Postfix | |
| VersionControl.DrawInfoInCorner: post: HarmonyMod.VersionControl_DrawInfoInCorner_Patch.Postfix | |
| VirtualMiner.get_Graphic: post: Worldbuilder.WorldbuilderMod.GraphicGetterPostfix | |
| VoidAwakeningUtility.DisruptTheLink: post: VAEInsanity.VoidAwakeningUtility_DisruptTheLink_Patch.Postfix | |
| Volcano.<get_SpecialDisplayStats>d__24.MoveNext: (no patches) | |
| WITab_Caravan_Health.get_Pawns: PRE: Vehicles.Patch_CaravanHandling.VehicleHealthTabPawns | |
| WITab_Caravan_Social.get_Pawns: PRE: Vehicles.Patch_CaravanHandling.VehicleSocialTabPawns | |
| WITab_Planet..ctor: post: Worldbuilder.WITab_Planet_Constructor_Patch.Postfix | |
| WITab_Planet.FillTab: post: Worldbuilder.WITab_Planet_FillTab_Patch.Postfix | |
| WITab_Terrain.DrawScrollContents: TRANS: [200]GeologicalLandforms.Patches.Patch_RimWorld_WITab_Terrain.DrawScrollContents_Transpiler | |
| WITab_Terrain.FillTab: PRE: [200]GeologicalLandforms.Patches.Patch_RimWorld_WITab_Terrain.FillTab_Prefix TRANS: [200]GeologicalLandforms.Patches.Patch_RimWorld_WITab_Terrain.FillTab_Transpiler | |
| WITab_Terrain.ListGeometricDetails: post: GeologicalLandforms.Patches.Patch_RimWorld_WITab_Terrain.ListGeometricDetails_Postfix | |
| WITab_Terrain.ListMiscDetails: post: VFEInsectoids.WITab_Terrain_ListMiscDetails_Patch.Postfix, GeologicalLandforms.Patches.Patch_RimWorld_WITab_Terrain.ListMiscDetails_Postfix TRANS: VEF.Maps.VanillaExpandedFramework_WITab_Terrain_ListMiscDetails_Patch.CorrectlyOutputBiomeDiseaseMTB | |
| WalkPathFinder.<TryFindWalkPath>g__ValidCell|6_0: TRANS: [200]GeologicalLandforms.Patches.Patch_RimWorld_WalkPathFinder.TryFindWalkPath_Transpiler | |
| WatchBuildingUtility.EverPossibleToWatchFrom: post: VFEMedieval.VFEMedieval_WatchBuildingUtility_EverPossibleToWatchFrom_Patch.Postfix | |
| WaterBody.SetFishTypes: post: Bestiary.WaterBody_SetFishTypes.Postfix | |
| WaterBody.get_Population: post: VCE_Fishing.VCE_Fishing_WaterBody_Population_Patch.MultiplyMaxFish | |
| WealthWatcher.ForceRecount: PRE: BigAndSmall.WealthWatcher_ForceRecount_Patch.WealthCountStart post: BigAndSmall.WealthWatcher_ForceRecount_Patch.WealthCountEnd TRANS: VREAndroids.WealthWatcher_ForceRecount_Patch.Transpiler, AlphaGenes.AlphaGenes_WealthWatcher_ForceRecount_Patch.Transpiler | |
| WeatherBuildupUtility.AddSnowRadial: PRE: VanillaPsycastsExpanded.Conflagrator.FireTornado.FixSnowUtility | |
| WeatherDecider.CurrentWeatherCommonality: post: ReGrowthCore.WeatherDecider_CurrentWeatherCommonality_Patch.Postfix | |
| WeatherEvent_LightningStrike.FireEvent: PRE: GeologicalLandforms.Patches.Patch_RimWorld_WeatherEvent_LightningStrike.FireEvent post: Dolinskaja.HarmonyPatches.LightningStrikePatches.FireEvent_PostFix | |
| WeatherManager.TransitionTo: post: AlphaBiomes.AlphaBiomes_WeatherManager_TransitionTo_Patch.DecideForsakenWeathers | |
| WeatherManager.get_CurWeatherPerceived: post: VEF.Weathers.VanillaExpandedFramework_WeatherManager_CurWeatherPerceived_Patch.Postfix, ReGrowthCore.WeatherManager_CurWeatherPerceived_Patch.Postfix | |
| WeatherWorker..ctor: post: VEF.Weathers.VanillaExpandedFramework_WeatherWorker_Constructor_Patch.Postfix, ReGrowthCore.WeatherWorker_Constructor_Patch.Postfix | |
| WidgetRow.ToggleableIcon: PRE: FuckLearningHelper.WidgetRow_ToggleableIcon_Patch.Prefix | |
| Widgets.ButtonImage: PRE: ImprovedWorkbenches.Widgets_ButtonImage_Detour.Prefix | |
| Widgets.DefIcon: PRE: VFEEmpire.HarmonyPatches.Patch_RoyalTitleIcons.Widgets_DefIcon_Prefix, PipeSystem.Widgets_DefIcon_Patch.Prefix, EBSGFramework.HarmonyPatches.DefIconPrefix post: VFETribals.Widgets_DefIcon_Patch.Postfix | |
| Widgets.HyperlinkWithIcon: TRANS: VFEEmpire.HarmonyPatches.Patch_RoyalTitleIcons.Widgets_HyperlinkWithIcon_Transpiler | |
| WildAnimalSpawner.CommonalityOfAnimalNow: post: VFEInsectoids.WildAnimalSpawner_CommonalityOfAnimalNow_Patch.Postfix, Mashed_Ashlands.WildAnimalSpawner_CommonalityOfAnimalNow_Patch.Mashed_Ashlands_CliffRacerCommonality_Patch | |
| WildAnimalSpawner.SpawnRandomWildAnimalAt: post: VEF.Maps.VanillaExpandedFramework_WildAnimalSpawner_SpawnRandomWildAnimalAt_Patch.AddExtraAnimalsByMutator TRANS: VFEInsectoids.WildAnimalSpawner_SpawnRandomWildAnimalAt_Patch.Transpiler | |
| WildAnimalSpawner.get_DesiredAnimalDensity: post: VFEInsectoids.WildAnimalSpawner_DesiredAnimalDensity_Patch.Postfix | |
| WildPlantSpawner.CalculatePlantsWhichCanGrowAt: PRE: Mashed_Ashlands.WildPlantSpawner_CalculatePlantsWhichCanGrowAt_Patch.Prefix post: Mashed_Ashlands.WildPlantSpawner_CalculatePlantsWhichCanGrowAt_Patch.Postfix | |
| WildPlantSpawner.PlantChoiceWeight: post: Mashed_Ashlands.WildPlantSpawner_PlantChoiceWeight_Patch.Postfix | |
| WindManager.WindManagerTick: post: VanillaExplorationExpanded.VanillaExplorationExpanded_WindManager_WindManagerTick_Patch.ReduceWindToZero TRANS: [2147483647]PerformanceOptimizer.Optimization_WindManager_WindManagerTick.Transpiler | |
| Window.PostClose: post: Brrainz.CrossPromotion.Page_ModsConfig_PostClose_Postfix, VanillaGravshipExpanded.Window_PostClose_Patch.Postfix | |
| Window.PreClose: post: ImprovedWorkbenches.BillConfig_PreClose_Detour.Postfix | |
| WindowStack.Add: PRE: Worldbuilder.WindowStack_Add_Patch.Prefix post: SmashTools.WindowEvents.WindowAddedToStack | |
| WindowStack.HandleEventsHighPriority: post: SmashTools.WindowEvents.HighPriorityOnGUI | |
| WindowStack.ImmediateWindow: PRE: UINotIncluded.WindowStackPatch.Prefix | |
| WindowStack.TryRemove: post: SmashTools.WindowEvents.WindowRemovedFromStack | |
| Window_Analyzer.PostClose: (no patches) | |
| Window_ArchiteInjection.DoRightColumn: (no patches) | |
| Window_ArchiteInjection.GetMaxCountForEquipment: (no patches) | |
| Window_ChooseReward.PostClose: (no patches) | |
| WinstonMod.DoGameSettings: (no patches) | |
| WinstonMod.WriteSettings: (no patches) | |
| WorkGiverUtility.HaulStuffOffBillGiverJob: TRANS: NeatStorageFix.HarmonyPatch_WorkGiverUtility_HaulStuffOffBillGiverJob.Transpiler | |
| WorkGiver_ArchotechDNAExtraction.JobOnThing: (no patches) | |
| WorkGiver_ArchotechDNAExtraction.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_CleanFilth.HasJobOnThing: post: ReGrowthCore.WorkGiver_CleanFilth_HasJobOnThing_Patch.Postfix | |
| WorkGiver_ConstructDeliverResources.ShouldRemoveExistingFloorFirst: post: VanillaGravshipExpanded.WorkGiver_ConstructDeliverResources_ShouldRemoveExistingFloorFirst_Patch.Postfix | |
| WorkGiver_ConstructDeliverResourcesToBlueprints.JobOnThing: PRE: VEF.Pawns.Workgiver_Patches.Prefix | |
| WorkGiver_ConstructDeliverResourcesToFrames.JobOnThing: PRE: VEF.Pawns.Workgiver_Patches.Prefix | |
| WorkGiver_ConstructFinishFrames.JobOnThing: PRE: VEF.Pawns.Workgiver_Patches.Prefix | |
| WorkGiver_DestroyItem.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_DoBill.AddEveryMedicineToRelevantThings: PRE: [2147483647]VREAndroids.WorkGiver_DoBill_AddEveryMedicineToRelevantThings_Patch.Prefix, ChooseYourMedicine.AddEveryMedicineToRelevantThings_Prefix.Prefix | |
| WorkGiver_DoBill.CannotDoBillDueToMedicineRestriction: post: [-2147483648]VREAndroids.WorkGiver_DoBill_CannotDoBillDueToMedicineRestriction_Patch.Postfix | |
| WorkGiver_DoBill.JobOnThing: PRE: VREAndroids.WorkGiver_DoBill_JobOnThing_Patch.Prefix | |
| WorkGiver_DoBill.StartOrResumeBillJob: post: PsiTech.Utility.DoBillPatch.Postfix | |
| WorkGiver_DoBill.ThingIsUsableBillGiver: post: [-2147483648]VREAndroids.WorkGiver_DoBill_ThingIsUsableBillGiver_Patch.Postfix | |
| WorkGiver_DoBill.TryFindBestBillIngredientsInSet_AllowMix: PRE: VEF.Cooking.VanillaExpandedFramework_WorkGiver_DoBill_TryFindBestBillIngredientsInSet_AllowMix_Patch.Prefix TRANS: VEF.Cooking.VanillaExpandedFramework_WorkGiver_DoBill_TryFindBestBillIngredientsInSet_AllowMix_Patch.Transpiler | |
| WorkGiver_DoBill.TryFindBestIngredientsInSet_NoMixHelper: PRE: VEF.Cooking.VanillaExpandedFramework_WorkGiver_DoBill_TryFindBestIngredientsInSet_NoMixHelper_Patch.Prefix TRANS: VEF.Cooking.VanillaExpandedFramework_WorkGiver_DoBill_TryFindBestIngredientsInSet_NoMixHelper_Patch.Transpiler | |
| WorkGiver_DoBill.TryStartNewDoBillJob: post: ReSpliceCore.WorkGiver_DoBill_TryStartNewDoBillJob_Patch.Postfix | |
| WorkGiver_DraincasketRefuel.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_FillComposter.HasJobOnThing: (no patches) | |
| WorkGiver_FillFermentingBarrel.HasJobOnThing: (no patches) | |
| WorkGiver_FixBlockage.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_FixBlockage.ShouldSkip: (no patches) | |
| WorkGiver_FixBrokenDownBuilding.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_FixBrokenDownBuilding.ShouldSkip: (no patches) | |
| WorkGiver_FixCriticallyBreakdown.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_FixCriticallyBreakdown.ShouldSkip: (no patches) | |
| WorkGiver_GrowerHarvest.HasJobOnCell: post: ToggleHarvest.Patch.RimWorld_WorkGiver_GrowerHarvest_HasJobOnCell.Postfix | |
| WorkGiver_GrowerSow.ExtraRequirements: post: AlphaGenes.AlphaGenes_WorkGiver_GrowerSow_ExtraRequirements_Postfix.PostFix, ProgressionEducation.WorkGiver_GrowerSow_ExtraRequirements_Patch.Postfix | |
| WorkGiver_GrowerSow.JobOnCell: PRE: [0]ReGrowthCore.Patch_JobOnCell.Prefix post: ReGrowthCore.Patch_WorkGiver_GrowerSow_JobOnCell.Postfix, VanillaPlantsExpandedMorePlants.VanillaPlantsExpandedMorePlants_WorkGiver_GrowerSow_JobOnCell_Patch.DontSowPeanuts, [0]ReGrowthCore.Patch_JobOnCell.Postfix TRANS: VanillaSocialInteractionsExpanded.WorkGiver_Patches.JobOnCellTranspiler | |
| WorkGiver_Haul.ShouldSkip: PRE: PickUpAndHaul.HarmonyPatches.SkipCorpses_Prefix | |
| WorkGiver_HunterHunt.HasHuntingWeapon: PRE: MVCF.PatchSets.PatchSet_Hunting.HasHuntingWeapon post: Ammunition.Harmony.AmmoHarmonyPatches.HasHuntingWeapon_PostFix | |
| WorkGiver_InitiateScan.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_InitiateScan.ShouldSkip: (no patches) | |
| WorkGiver_Loot.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_Loot.ShouldSkip: (no patches) | |
| WorkGiver_MaintainGenetron.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_MaintainGenetron.ShouldSkip: (no patches) | |
| WorkGiver_MaintainGrav.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_MaintainGrav.ShouldSkip: (no patches) | |
| WorkGiver_Open.HasJobOnThing: post: VFED.HarmonyPatches.MiscPatches.CheckBiosecurity | |
| WorkGiver_ParagonConversion.JobOnThing: (no patches) | |
| WorkGiver_ParagonConversion.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_PatientGoToBedTreatment.AnyAvailableDoctorFor: PRE: [2147483647]VREAndroids.WorkGiver_PatientGoToBedTreatment_AnyAvailableDoctorFor_Patch.Prefix | |
| WorkGiver_PruneGauranlenTree.HasJobOnThing: post: AlphaMemes.AlphaMemes_WorkGiver_PruneGauranlenTree_HasJobOnThing_Patch.DisallowPruningEvent | |
| WorkGiver_Refuel.CanRefuelThing: post: DubsBadHygiene.Patches.HarmonyPatches_Plumbing.CanRefuelThing_Postfix | |
| WorkGiver_RefuelWithOverdrive.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_RemoveBuilding.HasJobOnThing: post: VFEInsectoids.WorkGiver_RemoveBuilding_HasJobOnThing_Patch.Postfix | |
| WorkGiver_Repair.HasJobOnThing: TRANS: AchtungMod.WorkGiver_Repair_HasJobOnThing_Patch.Transpiler | |
| WorkGiver_Researcher.ShouldSkip: post: VanillaTraitsExpanded.ShouldSkip_Patch.Postfix | |
| WorkGiver_RestartGenerator.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_RestartGenerator.ShouldSkip: (no patches) | |
| WorkGiver_Scanner.GetPriority: post: ReGrowthCore.Patch_WorkGiver_Scanner_GetPriority.Postfix | |
| WorkGiver_Scanner.get_Prioritized: post: ReGrowthCore.Patch_WorkGiver_Scanner_Prioritized.Postfix | |
| WorkGiver_StudyBuilding.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_StudyBuilding.ShouldSkip: (no patches) | |
| WorkGiver_StudyGenetron.PotentialWorkThingsGlobal: (no patches) | |
| WorkGiver_StudyGenetron.ShouldSkip: (no patches) | |
| WorkGiver_Tame.JobOnThing: post: AlphaMemes.AlphaMemes_WorkGiver_Tame_JobOnThing_Patch.DisallowTamingEvent | |
| WorkGiver_Train.JobOnThing: post: AlphaMemes.AlphaMemes_WorkGiver_Train_JobOnThing_Patch.DisallowTamingEvent | |
| WorkGiver_Warden.ShouldTakeCareOfPrisoner: post: VanillaMemesExpanded.PreceptPatches.ShouldTakeCareOfPrisoner_Postfix | |
| WorkGiver_Warden_DeliverDependency.get_Cache: (no patches) | |
| WorkGiver_Warden_DeliverResource.get_Cache: (no patches) | |
| Workgiver_AdministerDependency.get_Cache: (no patches) | |
| Workgiver_AdministerResource.get_Cache: (no patches) | |
| WorkshopItems.Notify_Subscribed: post: Brrainz.CrossPromotion.WorkshopItems_Notify_Subscribed_Postfix | |
| World.ConstructComponents: post: GeologicalLandforms.Patches.Patch_RimWorld_World.ConstructComponents | |
| World.ExposeData: PRE: [700]AchtungMod.World_ExposeData_Patch.Prefix, Worldbuilder.World_ExposeData_Patch.Prefix post: VanillaGravshipExpanded.World_ExposeData_Patch.Postfix | |
| World.FillComponents: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData | |
| World.FinalizeInit: PRE: AchtungMod.World_FinalizeInit_Patch.Prefix, ReGrowthCore.ScatteredFlames_Patch_World_FinalizeInit.Prefix, ReGrowthCore.Patch_LoadGame.Prefix, GeologicalLandforms.Patches.Patch_RimWorld_World.FinalizeInit post: ImprovedWorkbenches.Main+Patch_FinalizeInit.Postfix, PeteTimesSix.SimpleSidearms.Intercepts.Patch_World_FinalizeInit.Postfix, ToggleableReadouts.ResetCache.Postfix, Worldbuilder.World_FinalizeInit_Patch.Postfix, PerspectivePaths.ClearCache.Postfix, ReGrowthCore.Patch_World_FinalizeInit.Postfix, Flecker.ExtensionUtility+Patch_FinalizeInit.Postfix | |
| World.NaturalRockTypesIn: PRE: [0]GeologicalLandforms.Patches.Patch_RimWorld_World.NaturalRockTypesIn_Prefix post: [800]GeologicalLandforms.Patches.Patch_RimWorld_World.NaturalRockTypesIn_Postfix | |
| World.get_PlayerWealthForStoryteller: post: VanillaTradingExpanded.Bank+World_PlayerWealthForStoryteller_Patch.Postfix | |
| WorldCameraDriverReplaced.CalculateCurInputDollyVect: TRANS: UINotIncluded.Patches.WorldCameraDriverPatch.Transpiler | |
| WorldComponentUtility.FinalizeInit: PRE: PerformanceOptimizer.PerformanceOptimizerMod.ResetStaticData | |
| WorldComponent_GravshipController.<>c__DisplayClass51_0.<OnGravshipCaptureComplete>b__2: (no patches) | |
| WorldComponent_GravshipController.InitiateLanding: PRE: VanillaGravshipExpanded.GravshipPlacementUtility_PlaceGravshipInMap_Patch.Prefix, NepLandOnAnything.LandOnAnythingPatches.WorldComponent_GravshipController_InitiateLanding_Patch | |
| WorldComponent_GravshipController.InitiateTakeoff: PRE: SpaceTurbulence.Patch_Launch.prefix post: VanillaGravshipExpanded.WorldComponent_GravshipController_InitiateTakeoff_Patch.Postfix | |
| WorldComponent_GravshipController.LandingEnded: PRE: VanillaGravshipExpanded.WorldComponent_GravshipController_LandingEnded_Patch.Prefix, NepLandOnAnything.LandingPrivatePatch.Prefix post: VanillaGravshipExpanded.WorldComponent_GravshipController_LandingEnded_Patch.Postfix | |
| WorldComponent_GravshipController.RegenerateGravshipMask: post: VanillaGravshipExpanded.WorldComponent_GravshipController_RegenerateGravshipMask_Patch.Postfix | |
| WorldComponent_GravshipController.TakeoffEnded: PRE: VanillaGravshipExpanded.WorldComponent_GravshipController_TakeoffEnded_Patch.Prefix | |
| WorldComponent_GravshipController.WorldComponentOnGUI: TRANS: VanillaGravshipExpanded.WorldComponent_GravshipController_WorldComponentOnGUI_Patch.Transpiler | |
| WorldComponent_GravshipController_LandingEnded_Patch.CalculateMaintenanceLoss: (no patches) | |
| WorldComponent_GravshipController_TakeoffEnded_Patch.ShouldHaveKeepMapUI: (no patches) | |
| WorldComponent_LocationGenerator.GenerateUntilTarget: TRANS: VanillaGravshipExpanded.VanillaGravshipExpanded_WorldComponent_LocationGenerator_GenerateUntilTarget_Patch.Transpiler | |
| WorldComponent_LocationGenerator.WorldComponentTick: TRANS: VanillaGravshipExpanded.VanillaGravshipExpanded_WorldComponent_LocationGenerator_WorldComponentTick_Patch.Transpiler | |
| WorldComponent_Senators.AddSenatorsOption: post: TooManyMods.TMM_VCE_SentorScreenPostfix.Postfix | |
| WorldDrawLayer.TryGetTileFromRayHit: (no patches) | |
| WorldDrawLayer_Hills.Regenerate: PRE: ReGrowthCore.Patch_WorldDrawLayer_Hills_Regenerate.Prefix | |
| WorldDrawLayer_Landmarks.DrawStandard: PRE: GeologicalLandforms.Patches.Patch_RimWorld_WorldDrawLayer_Landmarks.DrawStandard_Prefix | |
| WorldDrawLayer_Rivers..ctor: post: EventsCore.Patches.WorldDrawLayer_Rivers_Constructor_EventsCorePatch.Postfix | |
| WorldFactionsUIUtility.<>c__DisplayClass8_0.<DoWindowContents>g__CanAddFaction|1: TRANS: VEF.Planet.VanillaExpandedFramework_WorldFactionsUIUtility_CanAddFaction_Patch.Transpiler | |
| WorldFactionsUIUtility.DoRow: post: VEF.Factions.VanillaExpandedFramework_WorldFactionsUIUtility_DoRow_Patch.Postfix | |
| WorldFactionsUIUtility.DoWindowContents: TRANS: VEF.Factions.VanillaExpandedFramework_WorldFactionsUIUtility_DoWindowContents_Patch.Transpiler | |
| WorldFeatures.CreateTextsAndSetPosition: PRE: Worldbuilder.WorldFeatures_CreateTextsAndSetPosition_Patch.Prefix | |
| WorldGenStep_Mutators.AddMutatorsFromTile: TRANS: AlphaBiomes.AlphaBiomes_WorldGenStep_Mutators_AddMutatorsFromTile_Patch.Transpiler | |
| WorldGenStep_Pollution.GenerateFresh: post: ReGrowthCore.WorldGenStep_Pollution_GenerateFresh_Patch.Postfix | |
| WorldGenStep_Roads.<>c__DisplayClass12_0.<GenerateRoadEndpoints>b__0: post: VEF.Factions.VanillaExpandedFramework_GenerateRoadEndpoints_Patch.Postfix | |
| WorldGenStep_Terrain.GenerateFresh: post: GeologicalLandforms.Patches.Patch_RimWorld_WorldGenStep_Terrain.GenerateFresh_Postfix | |
| WorldGenStep_Terrain.SetupHillinessNoise: post: GeologicalLandforms.Patches.Patch_RimWorld_WorldGenStep_Terrain.SetupHillinessNoise_Postfix | |
| WorldGenerator.GenerateWorld: PRE: Worldbuilder.WorldGenerator_GenerateWorld_Patch.Prefix | |
| WorldGizmoUtility.TryGetCaravanGizmo: TRANS: Vehicles.Patch_FormCaravanDialog.TryGetCaravanForVehicles | |
| WorldGizmoUtility.WorldUIOnGUI: TRANS: Worldbuilder.WorldGizmoUtility_WorldUIOnGUI_Patch.Transpiler | |
| WorldGlobalControls.WorldGlobalControlsOnGUI: PRE: FactionCustomizer.PlanetGUIPatch.WorldGlobalControlsOnGUIPrefix | |
| WorldInspectPane.get_PaneTopY: post: UINotIncluded.WorldInspectPanePatches.Postfix | |
| WorldInspectPane.get_TileInspectString: post: Worldbuilder.WorldInspectPane_TileInspectString_Patch.Postfix | |
| WorldInterface.CheckOpenOrCloseInspectPane: post: AlphaBiomes.AlphaBiomes_WorldInterface_CheckOpenOrCloseInspectPane_Patch.PopUpPanel | |
| WorldInterface.WorldInterfaceOnGUI: post: FactionCustomizer.MoveSettlement.WorldInterfaceOnGUIPostfix | |
| WorldInterface.WorldInterfaceUpdate: post: FactionCustomizer.WorldInterfaceUpdate.WorldInterfaceUpdatePostfix | |
| WorldLandmarks.AddLandmark: TRANS: AlphaBiomes.AlphaBiomes_WorldLandmarks_AddLandmark_Patch.Transpiler | |
| WorldLandmarks.get_Item: post: GeologicalLandforms.Patches.Patch_RimWorld_WorldLandmarks.GetItem_Postfix | |
| WorldObject.GetDescription: post: Worldbuilder.WorldObject_GetDescription_Patch.Postfix | |
| WorldObject.get_ExpandingIcon: PRE: VanillaGravshipExpanded.WorldObject_ExpandingIcon_Patch.Prefix | |
| WorldObject.get_ExpandingIconColor: PRE: CustomPlayerIcon.WorldObject_ExpandingIconColor.Prefix post: Worldbuilder.WorldObject_ExpandingIconColor_Patch.Postfix, VFEInsectoids.WorldObject_ExpandingIconColor_Patch.Postfix | |
| WorldObject.get_ExpandingMaterial: PRE: VanillaGravshipExpanded.WorldObject_ExpandingMaterial_Patch.Prefix | |
| WorldObjectComp_RandomConditionCauser.DebugConditionCategoryOptions: (no patches) | |
| WorldObjectComp_RandomConditionCauser.TriggerCondition: (no patches) | |
| WorldObjectDef.ResolveReferences: PRE: VEF.MergeablePatches+VanillaExpandedFramework_WorldObjectDef_ResolveReferences_Patch.Prefix | |
| WorldObjectsHolder.Add: PRE: KCSG.Prefix_WorldObjectsHolder_Add.Prefix post: VFEInsectoids.WorldObjectsHolder_Add_Patch.Postfix, GeologicalLandforms.Patches.Patch_RimWorld_WorldObjectsHolder.Add_Postfix | |
| WorldObjectsHolder.AddToCache: post: Vehicles.Patch_WorldHandling.AddVehicleObjectToCache | |
| WorldObjectsHolder.Recache: PRE: Vehicles.Patch_WorldHandling.RecacheVehicleObjectCache | |
| WorldObjectsHolder.Remove: post: VFEInsectoids.WorldObjectsHolder_Remove_Patch.Postfix, GeologicalLandforms.Patches.Patch_RimWorld_WorldObjectsHolder.Remove_Postfix | |
| WorldObjectsHolder.RemoveFromCache: post: Vehicles.Patch_WorldHandling.RemoveVehicleObjectToCache | |
| WorldPathGrid.CalculatedMovementDifficultyAt: PRE: [800]GeologicalLandforms.Patches.Patch_RimWorld_WorldPathGrid.CalculatedMovementDifficultyAt_Prefix TRANS: VEF.Maps.VanillaExpandedFramework_WorldPathGrid_CalculatedMovementDifficultyAt_Patch.TweakMovementDifficulty, [200]GeologicalLandforms.Patches.Patch_RimWorld_WorldPathGrid.CalculatedMovementDifficultyAt_Transpiler | |
| WorldPathGrid.HillinessMovementDifficultyOffset: post: [200]GeologicalLandforms.Patches.Patch_RimWorld_WorldPathGrid.HillinessMovementDifficultyOffset | |
| WorldPawns.GetSituation: post: Vehicles.Patch_WorldHandling.SituationBoardedVehicle | |
| WorldPawns.PassToWorld: PRE: VFEEmpire.HarmonyPatches.Patch_WorldPawns_PassToWorld.Prefix | |
| WorldRoutePlanner.DoRoutePlannerButton: post: Vehicles.Patch_WorldPathing.VehicleRoutePlannerButton | |
| WorldSelector.AutoOrderToTileNow: PRE: Vehicles.Patch_WorldPathing.AutoOrderVehicleCaravanPathing | |
| WorldSelector.Select: PRE: SpaceTurbulence.Patch_Selectable.prefix | |
| WorldTargeter.ProcessInputEvents: post: Vehicles.Patch_WorldHandling.WorldTargeterProcessInputEvents | |
| WorldTargeter.TargeterOnGUI: post: Vehicles.Patch_WorldHandling.WorldTargeterOnGUI | |
| WorldTargeter.TargeterUpdate: post: Vehicles.Patch_WorldHandling.WorldTargeterUpdate | |
| WorldVehiclePathGrid.CancelGridRequests: (no patches) | |
| WorldVehiclePathGrid.RecalculatePathGrid: (no patches) | |
| WorldVehiclePathGrid.RecalculateReachabilityGrid: (no patches) | |
| Xenogerm.<GetGizmos>b__16_0: TRANS: VREAndroids.Xenogerm_GetGizmos_Patch.Transpiler | |
| Xenogerm.GetFloatMenuOptions: post: VREAndroids.Xenogerm_GetFloatMenuOptions_Patch.Postfix | |
| Xenogerm.PawnIdeoDisallowsImplanting: post: BigAndSmall.PawnIdeoDisallowsImplantingPatch.Postfix, EBSGFramework.HarmonyPatches.PawnIdeoDisallowsImplantingPostFix, ReSpliceCharmweavers.Xenogerm_PawnIdeoDisallowsImplanting_Patch.Postfix | |
| Xenogerm.SetTargetPawn: (no patches) | |
| XenotypeDef.SpecialDisplayStats: post: VREAndroids.XenotypeDef_SpecialDisplayStats_Patch.Postfix | |
| XmlToObjectUtils.DoFieldSearch: PRE: SmashTools.Patching.Patch_XmlParsing.PreProcessAttributes post: SmashTools.Patching.Patch_XmlParsing.ReadCustomAttributes | |
| Zone.CheckContiguous: PRE: ReGrowthCore.Patch_CheckContiguous.Prefix | |
| Zone.Deregister: PRE: ReGrowthCore.Patch_Deregister.Prefix | |
| Zone.PostRegister: post: ReGrowthCore.Patch_PostRegister.Postfix | |
| Zone.RemoveCell: post: ReGrowthCore.Patch_RemoveCell.Postfix | |
| Zone_Growing.AddCell: post: ReGrowthCore.Patch_AddCell.Postfix | |
| Zone_Growing.ExposeData: post: ToggleHarvest.Patch.RimWorld_Zone_Growing_ExposeData.Postfix | |
| Zone_Growing.GetGizmos: post: ToggleHarvest.Patch.RimWorld_Zone_Growing_GetGizmos.Postfix, ReGrowthCore.Patch_GetGizmos.Postfix | |
| Zone_Growing.GetInspectString: post: ReGrowthCore.Patch_GetInspectString.Postfix | |
| Zone_Growing.GetPlantDefToGrow: post: ProgressionAgriculture.IPlantToGrowSettable_GetPlantDefToGrow_Patch.Postfix | |
| Zone_Growing.SetPlantDefToGrow: post: ReGrowthCore.Patch_SetPlantDefToGrow.Postfix | |
| Zone_GrowingAquatic.AddCell: post: ReGrowthCore.Patch_AddCell.Postfix | |
| Zone_GrowingAquatic.GetGizmos: post: ReGrowthCore.Patch_GetGizmos.Postfix | |
| Zone_GrowingAquatic.GetInspectString: post: ReGrowthCore.Patch_GetInspectString.Postfix | |
| Zone_GrowingAquatic.GetPlantDefToGrow: post: ProgressionAgriculture.IPlantToGrowSettable_GetPlantDefToGrow_Patch.Postfix | |
| Zone_GrowingAquatic.SetPlantDefToGrow: post: ReGrowthCore.Patch_SetPlantDefToGrow.Postfix | |
| Zone_GrowingAsh.AddCell: post: ReGrowthCore.Patch_AddCell.Postfix | |
| Zone_GrowingFlowerGarden.AddCell: post: ReGrowthCore.Patch_AddCell.Postfix | |
| Zone_GrowingFlowerGarden.GetGizmos: post: ReGrowthCore.Patch_GetGizmos.Postfix | |
| Zone_GrowingFlowerGarden.GetInspectString: post: ReGrowthCore.Patch_GetInspectString.Postfix | |
| Zone_GrowingFlowerGarden.GetPlantDefToGrow: post: ProgressionAgriculture.IPlantToGrowSettable_GetPlantDefToGrow_Patch.Postfix | |
| Zone_GrowingFlowerGarden.SetPlantDefToGrow: post: ReGrowthCore.Patch_SetPlantDefToGrow.Postfix | |
| Zone_GrowingMushroom.AddCell: post: ReGrowthCore.Patch_AddCell.Postfix | |
| Zone_GrowingMushroom.GetGizmos: post: ReGrowthCore.Patch_GetGizmos.Postfix | |
| Zone_GrowingMushroom.GetInspectString: post: ReGrowthCore.Patch_GetInspectString.Postfix | |
| Zone_GrowingMushroom.GetPlantDefToGrow: post: ProgressionAgriculture.IPlantToGrowSettable_GetPlantDefToGrow_Patch.Postfix | |
| Zone_GrowingMushroom.SetPlantDefToGrow: post: ReGrowthCore.Patch_SetPlantDefToGrow.Postfix | |
| Zone_GrowingSandy.AddCell: post: ReGrowthCore.Patch_AddCell.Postfix | |
| Zone_GrowingSandy.GetGizmos: post: ReGrowthCore.Patch_GetGizmos.Postfix | |
| Zone_GrowingSandy.GetInspectString: post: ReGrowthCore.Patch_GetInspectString.Postfix | |
| Zone_GrowingSandy.GetPlantDefToGrow: post: ProgressionAgriculture.IPlantToGrowSettable_GetPlantDefToGrow_Patch.Postfix | |
| Zone_GrowingSandy.SetPlantDefToGrow: post: ReGrowthCore.Patch_SetPlantDefToGrow.Postfix | |
| Zone_Stockpile.GetGizmos: post: SaveStorageSettings.Patch_Zone_Stockpile_GetGizmos.Postfix | |
| Zone_Stockpile.GetInspectTabs: post: AdaptiveStorage.HarmonyPatches.AddITabToStockpileZones.Postfix | |
| Harmony versions present: 2.4.2.0: prepatcher, WorldbuilderMod, ReGrowthCore.WMB, Helixien.ReGrowthCore, CorpseDescriptionFixMod, VFESecurityMod, ProgressionAgricultureMod, BunkBedsMod, vanillaexpanded.gravship, ProgressionEducationMod, com.yayo.yayoAni, RestrictUndrawnApparelMod, ErinsAuraeylMod, Mlie.TabSorting, FuckLearningHelperMod, ProgressionCoreMod, Mlie.RelevantStatsInDescription, ProgressionStorytellersMod, ProgressionGravshipMod, BetterArchitectMod.DubsMintMenusPatch, VanillaGravshipExpanded.DubsMintMenusCompat, VanillaGravshipExpanded.ResearchTreeCompat; 2.4.1.0: SmashPhil.VehicleFramework, net.pardeike.rimworld.lib.harmony, com.github.15adhami.xmlextensions, ModSettingsFrameworkMod, Mlie.VisualXMLPatches, RedMattis.BigAndSmall_Early, GlittertechExpansion, net.pardeike.rimworld.mods.achtung, OskarPotocki.VEF, GonDragon.UINotIncluded, RedMattis.BetterPrerequisites, OskarPotocki.VanillaSocialInteractionsExpanded, SimsTraitsMod, rimworld.divineDerivative.romance, HackingExpansion, Andromeda.NiceInventoryTab, com.VanillaQuestsExpandedAncients, rimworld.mrhydralisk.AnomaliesExpectedPatch, Rimworld.Alite.EBSG.main, ray1203.SimpleCameraSetting, ST_Patch, sd.fageneticheads.startup, brrainz.lib.dynamicworktypes, Owlchemist.ResearchPowl, dawnsglow.fixesforsbzfridge, unlimitedthreatscale.1trickPonyta, Mlie.EnterHere, wara.tmm_vrestarjack, dlwd.minifiedthing.patch, Mlie.EnterHere_VehiclesPatch, LeaveTheMap.Mod, com.github.harmony.rimworld.mod.tainted_renaming, tmm.vpe_path_unlock_on_first_psylink, tmm.vqe.geneinjectionwhitelist, tmm.vge.refund_healthscale_with_power, tmm.ag_germlinemutator_blacklist, toomanymods.merchantguild.vehicleframework; 2.4.0.0: Bubbles, argon.expandedmaterials.masonry, RedMattis.BGInheritance; 2.3.7.0: RimHUD, Mlie.SoftWarmBeds, Argon.CoreLib.MaterialReplacement, kopp.rimworld.chooseyourmedicine, krafs.levelup, Argon.CoreLib, Rimworld.Alite.WanderingPreference; 2.3.6.0: dimonsever000.eventscore, adaptive.storage.framework, ReplaceLibMod, Dubwise.DubsBadHygiene, Kikohi.Jewelry, vanillaexpanded.backgrounds, VREAndroidsMod, VREHussars.Mod, com.vrelycans, com.VanillaRacesExpandedStarjack, OskarPotocki.VFEMedieval, cat2002.showhair, Dubwise.DubsMintMenus, ToggleHarvest, epicguru.AntimatterAnnihilation, divineDerivative.Framework, PerformanceOptimizer.Main, net.pardeike.rimworld.mods.rangefinder, OskarPotocki.VanillaPsycastsExpanded, UnlimitedHugs.HugsLib, Superniquito.DoModOptions, com.telefonmast.graphicssettings.rimworld.mod, VFEInsectoidsMod, MemeGoddess.SearchAndDestroy, brrainz.mod.features, com.vanillageneticrimexpanded, UnlimitedHugs.AllowTool, fuu.bloodanimations, vanillafactionsexpanded.settlers, VFEEmpire.Mod, vanillaexpanded.factions.deserters, K.PsiTech, VAEInsanityMod, oskarpotocki.vfe.classical, ReSpliceCharmweavers.Mod, OskarPotocki.VanillaTraitsExpanded, VCR.Mod, RunAndGun, VanillaAnimalsExpandedEndangered.HarmonyInit, legodude17.mvcf, kathanon.ShowWeaponTallies, VFETribalsMod, mehni.rimworld.pickupandhaul.main, VFEPirates.Mod, Dubwise.PerformanceAnalyzer, CustomPlayerIcon.Mod, com.VQETheGenerator, com.VEHighmate, com.vanillamemesexpanded, Neronix17.RimEffect.RimWorld, com.VEInsector, UnlimitedHugs.DefensivePositions, Neronix17.RimEffectAsariReapers.RimWorld, Kikohi.VESWinstonWave, com.VEFungoid, com.vanillafarmingexpanded, com.Mashed_Ashlands, com.vanillaplantsexpandedmoreplants, com.vanillaplantsexpandedmushrooms, com.VanillaExplorationExpanded, com.vanillaplantsexpanded, rimworld.neptimus7.progressrenderer, vanillaexpanded.aspirations, com.VQEDeadlife, VREArchonMod, Mlie.PrisonersShouldFearTurrets, ReBuildDoorsAndCornersMod, com.VanillaCookingExpandedVariety, bs.xenotypespawncontrol, falconne.BWM, com.VQECryptoforge, K.GlitterNet, com.ErinsFluffyFauna, Rimworld.Alite.BSA, vanillaexpanded.outposts, kenx00x.XenotypeAndIdeologyButtonsTitleScreen15update, VanillaExpanded.VNutrientE, com.vanillaanimalsexpandedroyal, Rimworld.Alite.Bestiary, VanillaCookingExpandedHaute, mlie.compactworktab, DeepAndDeeper, AM_Patch, AncientMall.Harmony, Dubwise.DubsBreakMod, Dubwise.DubsMintMinimap, azravos.factioncustomizer, VE.HelixienGas, Dubwise.Dubs_Skylights, ExplosionEffects.patch, VanillaTradingExpandedEarly.Mod, com.github.automatic1111.recipeicons, ReSpliceCoreMod, com.SupesSolutions.MapWideTradeBeacon, legodude17.smartdecon, VanillaPersonaWeaponsExpanded.Mod, VanillaFurnitureExpanded.Core, vanillaexpanded.furniture.architect, nep.NepLOA, Rimworld.Alite.IllogicalPredators, VSIERationalTraitDevelopmentMod, Superniquito.TraitIcons, VanillaRacesExpanded.Saurids.RimWorld, OskarPotocki.VREPhytokin, com.vanillaanimalsexpandedwaste, OskarPotocki.VRESanguophage, com.harmony.rimworld.example, VPEHemosageMod, com.VERecycling, com.VEWasters, Mlie.ChooseBiomeCommonality, com.VFEFishing, Kikohi.VanillaEventExpanded, com.VEPigskin, syrus.bpansresize, rimworld.kapitanoczywisty.changemapedge, DynamicTradeInterfaceMod, dingo.rimworld.no_forced_slowdown, com.smartspeed, MadaraUchiha.UndraftAfterTucking, com.VEAspirations, OskarPotocki.VanillaTradingExpanded, mehni.rimworld.shipchunks.main, Sinnamon.RitualReward, AppliancesExpanded.Mod, OskarPotocki.VanillaTexturesExpanded, VIEAT.Mod; 2.3.3.0: bs.postinheritanceoperation, bs.defnamelink, io.github.ratysz.madskills, bs.savegamecompatibilityoperation, LunarFramework.Main, com.alphagenes, GeologicalLandforms.Main, MapPreviewMod.Main, ProgressionScenariosMod, legodude17.pawneditor, Owlchemist.Moonlight, Owlchemist.PerspectivePaths, VanillaApparelExpanded.Accessories, net.quicksilverfox.rimworld.mod.animalslogic, com.savestoragesettings.rimworld.mod, com.alphabooks, VanillaVehiclesExpanded.Mod, owlchemist.simplefx.smoke2, XMB.AncientMall.MO, Vodka.MuzzleFlash, MapPreview.Main, rimworld.mod.rooboid.faun, ac.mwsad.patch, com.bymarcin.architecticons, Owlchemist.ToggleableReadouts, LunarFramework.Compat.HugsLib, com.sirrandoo.mvsf, visibleraidpoints.1trickPonyta, bluebird.com.tammybee.raiderinfo, GrillMaster.improvedandbalancedxenotypes, Owlchemist.ToggleableOverlays, NeatStorageFix, com.alpharandom, Inglix.FasterBiosculpterPod, com.flangopink.rimworld.mod.AutoSelectBegone, com.norandomapparelonideoedit.patch, Arkymn.SlowerPawnTickRate, rimworld.gerads.removegradualrelationsdecay, Rimworld.Alite.EmergingAnimals, VanillaVehiclesExpanded_Tier3.Mod, MapPreview.Compat.ReBuildDoorsAndCorners, MapPreview.Compat.VEE, MapPreview.Compat.VEF, GeologicalLandformsMod.Main, MapPreviewMod.Compat.GeologicalLandformsMod; 2.3.2.0: brrainz-crosspromotion, Kikohi.PipeSystem, OskarPotocki.VanillaHairExpanded, Kikohi.KCSG; 2.3.1.1: com.alphamechs, kikohi.WhatsForSale, com.alphamemes, com.alphabiomes, com.alphaanimals, com.dorely.emergencysurgery, kikohi.BetterGroundPenetratingScanner; 2.2.2.0: kathanon.FloatSubMenu, PeteTimesSix.SimpleSidearms, limetreesnake.ammunition, EasyCaravanFormationMod, rimworld.mod.alleykat.persistentprecepts, PeteTimesSix.CompactHediffs, VanillaCookingExpanded, LogModVersion, kittahkhan.grazeup, BreadMoFuckIdeoApprelAM; 2.1.1.0: com.github.bc.rimworld.mod.moodbar; 2.0.2.0: com.github.automatic1111.gunplay; 2.0.0.8: rimworld.Nals.FacialAnimation, rimworld.phomor.craftingqualityrebalanced, rimworld.dolinskaja.harmonylightningstrikepatch, rimworld.dropspottradeships.smashphil | |
| Platform information: (hidden, use publishing options to include) | |
| Log file contents: | |
| Mono path[0] = '[Rimworld_dir]/RimWorldWin64_Data/Managed' | |
| Mono config path = '[Rimworld_dir]/MonoBleedingEdge/etc' | |
| [PhysX] Initialized MultithreadedTaskDispatcher with 16 workers. | |
| Initialize engine version: 2022.3.35f1 (011206c7a712) | |
| [Subsystems] Discovering subsystems at path [Rimworld_dir]/RimWorldWin64_Data/UnitySubsystems | |
| GfxDevice: [Renderer information redacted] | |
| Begin MonoManager ReloadAssembly | |
| - Loaded All Assemblies, in 0.097 seconds | |
| - Finished resetting the current domain, in 0.002 seconds | |
| [PhysX] Initialized MultithreadedTaskDispatcher with 16 workers. | |
| Command line arguments: -popupwindow | |
| RimWorld 1.6.4633 rev1261 | |
| Prepatcher: Starting... (vanilla load took 2.092372s) | |
| Prepatcher: Game processing took 3084.0376ms | |
| Prepatcher: Serializing patched assemblies | |
| Prepatcher: Serializing took 947.7361ms | |
| Prepatcher: Setting refonly | |
| Prepatcher: Loading patched assemblies | |
| Prepatcher: Done loading | |
| Command line arguments: -popupwindow | |
| RimWorld 1.6.4633 rev1261 | |
| Prepatcher: Before reload: Starting... (vanilla load took 2.092372s) | |
| Prepatcher: Before reload: Game processing took 3084.0376ms | |
| Prepatcher: Before reload: Serializing patched assemblies | |
| Prepatcher: Before reload: Serializing took 947.7361ms | |
| Prepatcher: Before reload: Setting refonly | |
| Prepatcher: Before reload: Loading patched assemblies | |
| Prepatcher: Before reload: Done loading | |
| Prepatcher: Restarted with the patched assembly, going silent. | |
| [HugsLib] version 12.0.0 | |
| [HugsLib] early-initializing AllowTool | |
| Hello, world! | |
| Added hook. | |
| Patched 4 methods. | |
| DubsMintMenus v1.3.1086 | |
| [Analyzer] Loaded version 1.6.0 rev 1 | |
| Dubs Skylight 1.5.3114 | |
| [15:24:00] <color=#4494E3FF>:: Erin's Cat Overhaul ::</color> 1.0.9320 :: | |
| FactionCustomizer is successfully initialized! | |
| [1.6]Graphics Setter - Loaded | |
| [Interaction Bubbles v4.2] Initialized | |
| [MadSkills]: settings initialized, multiplier is 0, tiered, daily XP threshold is 4000, saturated XP multiplier is 0.2, Great Memory trait is altered. | |
| [MadSkills]: settings initialized, multiplier is 0, tiered, daily XP threshold is 4000, saturated XP multiplier is 0.2, Great Memory trait is altered. | |
| [MadSkills]: settings initialized, multiplier is 0, tiered, daily XP threshold is 4000, saturated XP multiplier is 0.2, Great Memory trait is altered. | |
| Persistent Precepts Mod class loaded | |
| <color=#00FFFFFF>:: Rim-Effect Renegade: Core :: 1.6.9319 ::</color> | |
| [RimHUD v1.17.5] Initialized | |
| [Unlimited Threat Scale] Loaded. | |
| <color=#00FFFFFF>The almighty power of Harmony has been initialized by the humble mod creator BlueEagle421</color> | |
| [Visible Raid Points] Loaded. | |
| Loaded What's That Mod. | |
| [Mashed's Ashlands] version 1.4.17 | |
| <color=#00FFFFFF>:: Rim-Effect Renegade: Asari & Reapers :: 1.6.9319 ::</color> | |
| ReSplice: Core 1.0.2-Shelley-rev2 | |
| ReGrowth 2 5.1-rev4 | |
| ReSplice: Charmweavers 2.0-Mantis-rev4 | |
| ReBuild: Doors and Corners 1.5-Miller-rev1 | |
| [SafePatcher]The xPath: "Defs/ThingDef[defName="VFES_Gun_HMGComplex"]" not found | |
| [SafePatcher]The xPath: "Defs/ThingDef[defName="VFES_Gun_SentryTurret"]" not found | |
| [SafePatcher]The xPath: "Defs/ThingDef[defName="VFES_Artillery_Weapon"]" not found | |
| [SafePatcher]The xPath: "Defs/ThingDef[defName="VFES_Gun_ChargeComplex"]" not found | |
| Parsed 0.8 as int. | |
| Parsed 4.5 as int. | |
| Parsed 1.5 as int. | |
| Parsed 0.3 as int. | |
| Parsed 0.3 as int. | |
| Failed to patch VFEInsectoids 2's Creep with additional genes. | |
| [Big & Small] Patched 49 PawnRenderNodeProperties to use PawnRenderingProps_Lite for recolorable graphics. | |
| Remember that you can always disable this again in the mod options. | |
| [Hacking Expansion] Turrets patching report: | |
| - Mortar: mannable | |
| - Foam turret: interactable | |
| - Rocketswarm launcher: interactable | |
| - Ancient defender turret: already hackable | |
| - Combat drone: no power and not stunnable by emp | |
| - Holo decoy: no power and not stunnable by emp | |
| - Orbital targeter: interactable | |
| - Scorpion turret: mannable | |
| - Armored shuttle: no power and not stunnable by emp | |
| - Striker turret: no power and not stunnable by emp | |
| - Vilelobber: no power and not stunnable by emp | |
| - Thornworm: no power and not stunnable by emp | |
| - Thornspitter: no power and not stunnable by emp | |
| - Wall-mounted arbalest: mannable | |
| - Wall-mounted arquebus: mannable | |
| - Gatling gun turret: mannable | |
| - Graser cannon complex: mannable | |
| - Heavy incinerator complex: mannable | |
| - Artillery: mannable | |
| - Catapult: mannable | |
| - Ballista: mannable | |
| - HMG complex: mannable | |
| - Minigun complex: mannable | |
| - Charge complex: mannable | |
| - Gauss gun: no power and not stunnable by emp | |
| - Javelin pod: no power and not stunnable by emp | |
| - Reaper bolter: no power and not stunnable by emp | |
| - Reaper heavy bolter: no power and not stunnable by emp | |
| - Reaper missile launcher: no power and not stunnable by emp | |
| - Reaper kinetic artillery: no power and not stunnable by emp | |
| - Reaper orbital beam targeter: no power and not stunnable by emp | |
| - Reaper beam: no power and not stunnable by emp | |
| - Striker turret: no power and not stunnable by emp | |
| - Crashed ship: no power and not stunnable by emp | |
| - Crashed ship: no power and not stunnable by emp | |
| - Crashed ship: no power and not stunnable by emp | |
| - Crashed ship: no power and not stunnable by emp | |
| - Field gun: mannable | |
| - Cannon: mannable | |
| - Black defiler: no power and not stunnable by emp | |
| - Foam belcher: no power and not stunnable by emp | |
| Turrets not valid for patching total: 41 | |
| [MadSkills]: changed behavior of Great Memory trait. | |
| Key binding conflict: MainTab_History and MainTab_AM_LevelSchedule are both bound to F9. | |
| Key binding conflict: MainTab_AM_LevelSchedule and MainTab_History are both bound to F9. | |
| Texture '' has dimensions (112 x 6) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (171 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (256 x 171) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (171 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (280 x 34) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (790 x 790) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (256 x 170) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (170 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (256 x 170) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (170 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (170 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (170 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (267 x 57) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (267 x 267) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (962 x 719) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (610 x 594) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (1463 x 639) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (559 x 559) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (1484 x 879) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (970 x 509) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (512 x 171) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (512 x 171) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (2134 x 2134) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (267 x 267) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (2134 x 2134) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (2134 x 2134) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (2134 x 2134) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (1334 x 1334) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (128 x 123) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (128 x 123) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (410 x 410) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (171 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (171 x 256) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (280 x 34) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (790 x 790) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (268 x 58) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (65 x 65) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (962 x 720) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (65 x 65) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (65 x 65) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (33 x 33) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (33 x 33) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (610 x 595) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (33 x 33) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (543 x 89) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (1470 x 1961) which are not multiples of 4. Compress will not work. | |
| Texture '' has dimensions (626 x 417) which are not multiples of 4. Compress will not work. | |
| [Pawn Editor] Facial Animations compatibility active. | |
| Translation data for language English has 9 errors. Generate translation report for more info. | |
| [XML Extensions] Initialized 5 SettingsMenuDef(s) and found 580 unused key(s) from 2 mod(s) | |
| [XML Extensions] 13901 total patch operations run in 47850ms, 0 failed | |
| [XML Extensions] Emitted 5 mod class(es) | |
| [SmashPhil.SmashTools] Applying compatibility patch for Jaxe.RimHUD. Active: Yes | |
| [SmashPhil.VehicleFramework] Applying compatibility patch for Jaxe.RimHUD. Active: Yes | |
| [SmashPhil.VehicleFramework] Applying compatibility patch for ludeon.rimworld.odyssey. Active: Yes | |
| [SmashPhil.VehicleFramework] Applying compatibility patch for VanillaExpanded.VCEF. Active: Yes | |
| [VehicleFramework] version 1.6.2144 | |
| [Scattered Flames] Integrated with Simple FX: Smoke. | |
| [Scattered Flames] Integrated with Simple FX: Smoke. | |
| KCSG has Created 7225 symbolDefs for vanilla and DLCs | |
| Advanced Unnatural Darkness loaded successfully! | |
| Loaded content. | |
| A wiki was registered for mod 'Antimatter Annihilation', but the InGameWiki mod is not installed. Dummy wiki has been created instead. | |
| [CMColorCodedMoodBar] CMColorCodedMoodBar 1.6.4553.2 initialized | |
| [DLWD] Initializing Harmony patches… | |
| [EnterHere]: Added compatibility with Vehicle Framework | |
| [FA Genetic Heads] Harmony patches applied | |
| Land On Anything: Loaded | |
| Land On Anything: Patching Complete | |
| [TrueTerrainColors v1.12.24] Loaded cached true colors for 3510 terrain defs from file. | |
| MoreCrashedShipParts: Using harmony to patch lightning strikes. | |
| PersistentPrecepts Loaded | |
| PickUpAndHaul v1.1.2¼ welcomes you to RimWorld with pointless logspam. | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Mortar as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Foam turret as its projectile does not cause damage to health | |
| [RelevantStatsInDescription]: Skipping dps-calculation of M3G_UMIN as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of ADP chain pylon as its projectile does not cause damage to health | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Orbital targeter as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Mechhive disruptor as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Graser cannon complex as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Heavy incinerator complex as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Anti-air turret as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Artillery as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Searchlight as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Tesla blaster as its projectile does not cause damage to health | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Point defense turret as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Reaper orbital beam targeter as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Field gun as it has no default projectile defined | |
| [RelevantStatsInDescription]: Skipping dps-calculation of Foam belcher as its projectile does not cause damage to health | |
| [TabSorting]: Fixing kitchen room role worker, thanks slippycheeze! | |
| [TabSorting]: Moved 2346 items to manually designated categories. | |
| [TabSorting]: Removing AM_FLOOR since its empty now. | |
| [TabSorting]: Removing ResearchTab since its empty now. | |
| [TabSorting]: Removing StorageTab since its empty now. | |
| [TabSorting]: Removing BedroomTab since its empty now. | |
| [TabSorting]: Removing TableChairsTab since its empty now. | |
| [TabSorting]: Removing LightsTab since its empty now. | |
| [TabSorting]: Removing CCP_PetBeds since its empty now. | |
| [TabSorting]: Removing BMT_Paleontology since its empty now. | |
| [TabSorting]: Removing Ship since its empty now. | |
| [TabSorting]: Found 216 icons in ArchitectIcons to choose from. | |
| Tainted Renaming Hello World | |
| [SoftWarmBeds] Added softness stat to: Cloth (62%), Synthread (43%), DevilstrandCloth (40%), Hyperweave (44%), WoolSheep (68%), WoolAlpaca (67%), WoolMegasloth (62%), WoolMuffalo (68%), WoolBison (67%), Leather_Plain (32%), Leather_Dog (28%), Leather_Wolf (38%), Leather_Panthera (40%), Leather_Camel (43%), Leather_Bluefur (38%), Leather_Bear (38%), Leather_GuineaPig (61%), Leather_Human (26%), Leather_Pig (21%), Leather_Light (33%), Leather_Bird (25%), Leather_Chinchilla (58%), Leather_Fox (41%), Leather_Lizard (9.2%), Leather_Elephant (17%), Leather_Heavy (50%), Leather_Rhinoceros (19%), Leather_Thrumbo (50%), Leather_Patch (34%), Leather_Dread (38%), WoolMastodon (68%), WoolMuskox (69%), Leather_Mastodon (52%), Leather_Sealskin (54%), Leather_AlphaThrumbo (51%), Leather_Mink (61%), Leather_Hippo (23%), Leather_Armadillo (30%), ABooks_Durathread (61%), ERN_FrystelkFeathers (43%), ERN_AuraeylFur (68%), ERN_ThickBirdLeather (47%), WoolArgali (68%), AEXP_Leather_Wildebeest (33%), AEXP_Leather_Platypus (64%), AEXP_Leather_Lion (51%), WoolCamel (68%), VAEWaste_ToxicLeather (32%), VFEC_Tyrian (64%), VFEI2_Chitin (-10%), VFEM2_Hardweave (41%), VFEM2_Hayweave (61%), VFEM2_HardLeather (5%), VDE_Gaubric (38%), HempCloth (61%), Flaxcloth (40%), VG_BlendedWool (64%), AM_AramidCloth (32%), DA_LeviathanChitin (13%), DA_Leather_Drog (55%), DA_Leather_Karabal (44%), DA_Leather_SilverMole (64%), DA_Leather_Crestel (44%), DA_Leather_RockTroll (30%), DA_Leather_Troll (63%), DA_Leather_Larpah (51%), DA_Leather_Barog (48%), DA_WoolMuffton (71%), DA_WoolGoldilox (70%), DA_BlackChitin (57%), DA_Leather_Snaptoad (40%), Mashed_Ashlands_MouldLeather (49%), Mashed_Ashlands_KreshCloth (67%), Mashed_Ashlands_DurzogLeather (23%), Mashed_Ashlands_CliffRacerLeather (74%), Mashed_Ashlands_FungalLeather (52%), Mashed_Ashlands_GuarLeather (42%), Mashed_Ashlands_HeavyScaledLeather (42%), Mashed_Ashlands_InfernalScaledLeather (49%), Mashed_Ashlands_KwamaChitin (24%), Mashed_Ashlands_NetchLeather (40%), Mashed_Ashlands_NixLeather (22%), Mashed_Ashlands_NixOxChitin (27%), Mashed_Ashlands_RachnoidSilk (54%), Mashed_Ashlands_ShalkChitin (47%), RG_DinosaursHideHeavy (34%), RG_WoolStegosaurus (60%), VPE_Mycothread (61%), AA_Leather_Behemoth (43%), AA_Leather_Aerofleet (52%), AA_ArcticLion_Leather (55%), AA_SandLion_Leather (55%), Leather_Chitin (17%), Leather_IronChitin (3%), Leather_RaptorPlates (6.4%), Leather_Cactus (63%), Leather_BlackChitin (-10%), Leather_Gallatross (51%), Leather_Night (51%), AA_ChameleonYakWoolTemperate (63%), AA_ChameleonYakWoolWinter (69%), AA_ChameleonYakWoolJungle (16%), AA_ChameleonYakWoolDesert (64%), AA_CinderSilk (48%), AA_MothSilk (24%), AA_GiantCrownedSilkieSilk (68%), AA_GreyCoatedMouflonWool (68%), AA_NightWool (59%), AG_Ultima (50%), GR_Boomthread (48%), GR_ThinHybridWool (67%), GR_ThickHybridWool (62%), GR_LuxuriantHybridWool (58%), GR_HybridSilk (30%), GR_HybridChitin (6.4%), GR_HybridScales (49%), GR_MechaWool (42%), GM_Human_Fur (41%) | |
| [Simple FX: Splashes] The following terrains have been defined as being hard: | |
| - rough-hewn basalt | |
| - rough basalt | |
| - rough-hewn basalt | |
| - rough basalt | |
| - rough-hewn schist | |
| - rough schist | |
| - rough-hewn siltstone | |
| - rough siltstone | |
| - rough-hewn shale | |
| - rough shale | |
| - rough-hewn solid snow | |
| - rough solid snow | |
| - rough-hewn ancient metal | |
| - rough-hewn hardened slime | |
| - rough hardened slime | |
| - rough-hewn mudstone | |
| - rough mudstone | |
| - rough-hewn onyxglass | |
| - rough onyxglass | |
| - rough-hewn cragstone | |
| - rough cragstone | |
| - rough-hewn rose quartz | |
| - rough rose quartz | |
| - rough-hewn vacstone | |
| - rough vacstone | |
| - rough-hewn marble | |
| - rough marble | |
| - rough-hewn slate | |
| - rough slate | |
| - rough-hewn limestone | |
| - rough limestone | |
| - rough-hewn granite | |
| - rough granite | |
| - rough-hewn sandstone | |
| - rough sandstone | |
| - pristine limestone cobblestone floor | |
| - pristine limestone polished stone floor | |
| - vacstone cobblestone floor | |
| - vacstone polished stone floor | |
| - mudstone cobblestone floor | |
| - mudstone polished stone floor | |
| - onyxglass cobblestone floor | |
| - onyxglass polished stone floor | |
| - cragstone cobblestone floor | |
| - cragstone polished stone floor | |
| - rose quartz cobblestone floor | |
| - rose quartz polished stone floor | |
| - mudstone mosaics | |
| - onyxglass mosaics | |
| - cragstone mosaics | |
| - rose quartz mosaics | |
| - pristine limestone mosaics | |
| - vacstone mosaics | |
| - bronze studded tile | |
| - bronze grate tile | |
| - fine bronze tile | |
| - ocular vacstone floor | |
| - steampunk vacstone tile | |
| - kemetic fine vacstone tile | |
| - kemetic vacstone tile | |
| - jewish fine vacstone tile | |
| - jewish vacstone tile | |
| - sky steel studded tile | |
| - sky steel grate tile | |
| - fine sky steel tile | |
| - sky steel tile | |
| - fine copper tile | |
| - fine bronze tile | |
| - fine gold tile | |
| - fine silver tile | |
| - fine steel tile | |
| - obsidian akri tile | |
| - obsidian checkered tile | |
| - vacstone checkered tile | |
| - obsidian gravel paving | |
| - vacstone gravel paving | |
| - obsidian circular paving | |
| - vacstone circular paving | |
| - obsidian fishscale paving | |
| - vacstone fishscale paving | |
| - obsidian double diamond tile | |
| - vacstone double diamond tile | |
| - obsidian staggered R M tile | |
| - vacstone staggered R M tile | |
| - obsidian staggered R tile | |
| - vacstone staggered R tile | |
| - obsidian staggered M tile | |
| - vacstone staggered M tile | |
| - obsidian staggered tile | |
| - vacstone staggered tile | |
| - obsidian crosshatch R M tile | |
| - vacstone crosshatch R M tile | |
| - obsidian crosshatch R tile | |
| - vacstone crosshatch R tile | |
| - obsidian crosshatch M tile | |
| - vacstone crosshatch M tile | |
| - obsidian crosshatch tile | |
| - vacstone crosshatch tile | |
| - obsidian grid R tile | |
| - vacstone grid R tile | |
| - obsidian tiny grid M tile | |
| - vacstone tiny grid M tile | |
| - obsidian grid M tile | |
| - vacstone grid M tile | |
| - obsidian grid tile tile | |
| - vacstone grid tile | |
| - obsidian windowpane tile | |
| - vacstone windowpane tile | |
| - obsidian octasquare tile | |
| - vacstone octasquare tile | |
| - obsidian ribbon paving | |
| - vacstone ribbon paving | |
| - obsidian basket weave tile | |
| - vacstone basket weave tile | |
| - obsidian V braided tile | |
| - obsidian H braided tile | |
| - obsidian I braided tile | |
| - obsidian C braided tile | |
| - vacstone V braided tile | |
| - vacstone H braided tile | |
| - vacstone I braided tile | |
| - vacstone C braided tile | |
| - obsidian braided octagon tile | |
| - vacstone braided octagon tile | |
| - obsidian hexagon R M tile | |
| - vacstone hexagon R M tile | |
| - obsidian hexagon R tile | |
| - vacstone hexagon R tile | |
| - obsidian hexagon M tile | |
| - vacstone hexagon M tile | |
| - obsidian hexagon tile | |
| - vacstone hexagon tile | |
| - obsidian pinwheel tile | |
| - vacstone pinwheel tile | |
| - obsidian herringbone tile | |
| - vacstone herringbone tile | |
| - obsidian random lengths R M tile | |
| - vacstone random lengths R M tile | |
| - obsidian random lengths R tile | |
| - vacstone random lengths R tile | |
| - obsidian random lengths M tile | |
| - vacstone random lengths M tile | |
| - vacstone random lengths tile | |
| - obsidian random R M tile | |
| - vacstone random R M tile | |
| - obsidian random R tile | |
| - vacstone random R tile | |
| - obsidian random M tile | |
| - vacstone random M tile | |
| - obsidian random tile | |
| - vacstone random tile | |
| - obsidian T slab | |
| - vacstone T slab | |
| - obsidian R slab | |
| - vacstone R slab | |
| - obsidian slab | |
| - vacstone slab | |
| - basalt checkered tile | |
| - basalt gravel paving | |
| - basalt circular paving | |
| - basalt fishscale paving | |
| - basalt double diamond tile | |
| - basalt staggered R M tile | |
| - basalt staggered R tile | |
| - basalt staggered M tile | |
| - basalt staggered tile | |
| - basalt crosshatch R M tile | |
| - basalt crosshatch R tile | |
| - basalt crosshatch M tile | |
| - basalt crosshatch tile | |
| - basalt grid R tile | |
| - basalt tiny grid M tile | |
| - basalt grid M tile | |
| - basalt grid tile | |
| - basalt windowpane tile | |
| - basalt octasquare tile | |
| - basalt ribbon paving | |
| - basalt basket weave tile | |
| - basalt V braided tile | |
| - basalt H braided tile | |
| - basalt I braided tile | |
| - basalt C braided tile | |
| - basalt braided octagon tile | |
| - basalt hexagon R M tile | |
| - basalt hexagon R tile | |
| - basalt hexagon M tile | |
| - basalt hexagon tile | |
| - basalt pinwheel tile | |
| - basalt herringbone tile | |
| - basalt random lengths R M tile | |
| - basalt random lengths R tile | |
| - basalt random lengths M tile | |
| - basalt random lengths tile | |
| - basalt random R M tile | |
| - basalt random R tile | |
| - basalt random M tile | |
| - basalt random tile | |
| - basalt T slab | |
| - basalt R slab | |
| - basalt slab | |
| - titanium locus tile | |
| - stainless steel locus tile | |
| - iron locus tile | |
| - bronze locus tile | |
| - copper locus tile | |
| - titanium spatium tile | |
| - stainless steel spatium tile | |
| - iron spatium tile | |
| - bronze spatium tile | |
| - copper spatium tile | |
| - titanium trigon tile | |
| - stainless steel trigon tile | |
| - iron trigon tile | |
| - bronze trigon tile | |
| - copper trigon tile | |
| - titanium novis tile | |
| - stainless steel novis tile | |
| - iron novis tile | |
| - bronze novis tile | |
| - copper novis tile | |
| - titanium modular tile | |
| - stainless steel modular tile | |
| - iron modular tile | |
| - bronze modular tile | |
| - copper modular tile | |
| - titanium exo tile | |
| - stainless steel exo tile | |
| - iron exo tile | |
| - bronze exo tile | |
| - copper exo tile | |
| - titanium digital tile | |
| - stainless steel digital tile | |
| - iron digital tile | |
| - bronze digital tile | |
| - copper digital tile | |
| - titanium durus tile | |
| - stainless steel durus tile | |
| - iron durus tile | |
| - bronze durus tile | |
| - copper durus tile | |
| - titanium arx tile | |
| - stainless steel arx tile | |
| - iron arx tile | |
| - bronze arx tile | |
| - copper arx tile | |
| - titanium framed tile | |
| - stainless steel framed tile | |
| - iron framed tile | |
| - bronze framed tile | |
| - copper framed tile | |
| - titanium framed pad plate | |
| - stainless steel framed pad plate | |
| - iron framed pad plate | |
| - bronze framed pad plate | |
| - copper framed pad plate | |
| - titanium pad plate | |
| - stainless steel pad plate | |
| - iron pad plate | |
| - bronze pad plate | |
| - copper pad plate | |
| - titanium cross tread plate | |
| - stainless steel cross tread plate | |
| - iron cross tread plate | |
| - bronze cross tread plate | |
| - copper cross tread plate | |
| - titanium tread sheet | |
| - stainless steel tread sheet | |
| - iron tread sheet | |
| - bronze tread sheet | |
| - copper tread sheet | |
| - titanium vent plate | |
| - iron vent plate | |
| - bronze vent plate | |
| - copper vent plate | |
| - stainless steel vent plate | |
| - titanium hexa grate | |
| - stainless steel hexa grate | |
| - iron hexa grate | |
| - bronze hexa grate | |
| - copper hexa grate | |
| - titanium grate plate | |
| - stainless steel grate plate | |
| - iron grate plate | |
| - bronze grate plate | |
| - copper grate plate | |
| - titanium grate | |
| - stainless steel grate | |
| - iron grate | |
| - bronze grate | |
| - copper grate | |
| - titanium polished plate | |
| - stainless steel polished plate | |
| - iron polished plate | |
| - bronze polished plate | |
| - copper polished plate | |
| - titanium plate | |
| - stainless steel plate | |
| - iron plate | |
| - bronze plate | |
| - copper plate | |
| - onyxglass checkered tile | |
| - cragstone checkered tile | |
| - mudstone checkered tile | |
| - rose quartz checkered tile | |
| - onyxglass gravel paving | |
| - cragstone gravel paving | |
| - mudstone gravel paving | |
| - rose quartz gravel paving | |
| - onyxglass circular paving | |
| - cragstone circular paving | |
| - mudstone circular paving | |
| - rose quartz circular paving | |
| - onyxglass fishscale paving | |
| - cragstone fishscale paving | |
| - mudstone fishscale paving | |
| - rose quartz fishscale paving | |
| - onyxglass double diamond tile | |
| - cragstone double diamond tile | |
| - mudstone double diamond tile | |
| - rose quartz double diamond tile | |
| - onyxglass staggered R M tile | |
| - cragstone staggered R M tile | |
| - mudstone staggered R M tile | |
| - rose quartz staggered R M tile | |
| - onyxglass staggered R tile | |
| - cragstone staggered R tile | |
| - mudstone staggered R tile | |
| - rose quartz staggered R tile | |
| - onyxglass staggered M tile | |
| - cragstone staggered M tile | |
| - mudstone staggered M tile | |
| - rose quartz staggered M tile | |
| - onyxglass staggered tile | |
| - cragstone staggered tile | |
| - mudstone staggered tile | |
| - rose quartz staggered tile | |
| - onyxglass crosshatch R M tile | |
| - cragstone crosshatch R M tile | |
| - mudstone crosshatch R M tile | |
| - rose quartz crosshatch R M tile | |
| - onyxglass crosshatch R tile | |
| - cragstone crosshatch R tile | |
| - mudstone crosshatch R tile | |
| - rose quartz crosshatch R tile | |
| - onyxglass crosshatch M tile | |
| - cragstone crosshatch M tile | |
| - mudstone crosshatch M tile | |
| - rose quartz crosshatch M tile | |
| - onyxglass crosshatch tile | |
| - cragstone crosshatch tile | |
| - mudstone crosshatch tile | |
| - rose quartz crosshatch tile | |
| - onyxglass grid R tile | |
| - cragstone grid R tile | |
| - mudstone grid R tile | |
| - rose quartz grid R tile | |
| - onyxglass tiny grid M tile | |
| - cragstone tiny grid M tile | |
| - mudstone tiny grid M tile | |
| - rose quartz tiny grid M tile | |
| - onyxglass grid M tile | |
| - cragstone grid M tile | |
| - mudstone grid M tile | |
| - rose quartz grid M tile | |
| - onyxglass grid tile | |
| - cragstone grid tile | |
| - mudstone grid tile | |
| - rose quartz grid tile | |
| - onyxglass windowpane tile | |
| - cragstone windowpane tile | |
| - mudstone windowpane tile | |
| - rose quartz windowpane tile | |
| - onyxglass octasquare tile | |
| - cragstone octasquare tile | |
| - mudstone octasquare tile | |
| - rose quartz octasquare tile | |
| - onyxglass ribbon paving | |
| - cragstone ribbon paving | |
| - mudstone ribbon paving | |
| - rose quartz ribbon paving | |
| - onyxglass basket weave tile | |
| - cragstone basket weave tile | |
| - mudstone basket weave tile | |
| - rose quartz basket weave tile | |
| - onyxglass V braided tile | |
| - onyxglass H braided tile | |
| - onyxglass I braided tile | |
| - onyxglass C braided tile | |
| - cragstone V braided tile | |
| - cragstone H braided tile | |
| - cragstone I braided tile | |
| - cragstone C braided tile | |
| - mudstone V braided tile | |
| - mudstone H braided tile | |
| - mudstone I braided tile | |
| - mudstone C braided tile | |
| - rose quartz V braided tile | |
| - rose quartz H braided tile | |
| - rose quartz I braided tile | |
| - rose quartz C braided tile | |
| - onyxglass braided octagon tile | |
| - cragstone braided octagon tile | |
| - mudstone braided octagon tile | |
| - rose quartz braided octagon tile | |
| - onyxglass hexagon R M tile | |
| - cragstone hexagon R M tile | |
| - mudstone hexagon R M tile | |
| - rose quartz hexagon R M tile | |
| - onyxglass hexagon R tile | |
| - cragstone hexagon R tile | |
| - mudstone hexagon R tile | |
| - rose quartz hexagon R tile | |
| - onyxglass hexagon M tile | |
| - cragstone hexagon M tile | |
| - mudstone hexagon M tile | |
| - rose quartz hexagon M tile | |
| - onyxglass hexagon tile | |
| - cragstone hexagon tile | |
| - mudstone hexagon tile | |
| - rose quartz hexagon tile | |
| - onyxglass pinwheel tile | |
| - cragstone pinwheel tile | |
| - mudstone pinwheel tile | |
| - rose quartz pinwheel tile | |
| - onyxglass herringbone tile | |
| - cragstone herringbone tile | |
| - mudstone herringbone tile | |
| - rose quartz herringbone tile | |
| - onyxglass random lengths R M tile | |
| - cragstone random lengths R M tile | |
| - mudstone random lengths R M tile | |
| - rose quartz random lengths R M tile | |
| - onyxglass random lengths R tile | |
| - cragstone random lengths R tile | |
| - mudstone random lengths R tile | |
| - rose quartz random lengths R tile | |
| - onyxglass random lengths M tile | |
| - cragstone random lengths M tile | |
| - mudstone random lengths M tile | |
| - rose quartz random lengths M tile | |
| - onyxglass random lengths tile | |
| - cragstone random lengths tile | |
| - mudstone random lengths tile | |
| - rose quartz random lengths tile | |
| - onyxglass random R M tile | |
| - cragstone random R M tile | |
| - mudstone random R M tile | |
| - rose quartz random R M tile | |
| - onyxglass random R tile | |
| - cragstone random R tile | |
| - mudstone random R tile | |
| - rose quartz random R tile | |
| - onyxglass random M tile | |
| - cragstone random M tile | |
| - mudstone random M tile | |
| - rose quartz random M tile | |
| - onyxglass random tile | |
| - cragstone random tile | |
| - mudstone random tile | |
| - rose quartz random tile | |
| - onyxglass T slab | |
| - cragstone T slab | |
| - mudstone T slab | |
| - rose quartz T slab | |
| - onyxglass R slab | |
| - cragstone R slab | |
| - mudstone R slab | |
| - rose quartz R slab | |
| - onyxglass slab | |
| - cragstone slab | |
| - mudstone slab | |
| - rose quartz slab | |
| - fine pristine limestone tile | |
| - ocular obsidian floor | |
| - ocular cragstone floor | |
| - ocular mudstone floor | |
| - ocular red quartz floor | |
| - fine onyxglass tile | |
| - fine cragstone tile | |
| - fine mudstone tile | |
| - fine rose quartz tile | |
| - shintao fine marble tile | |
| - shintao fine slate tile | |
| - shintao fine limestone tile | |
| - shintao fine granite tile | |
| - shintao fine sandstone tile | |
| - corporate fine marble tile | |
| - corporate fine slate tile | |
| - corporate fine limestone tile | |
| - corporate fine granite tile | |
| - corporate fine sandstone tile | |
| - rusted mech laboratory tile | |
| - mech laboratory tile | |
| - white laboratory tile | |
| - laboratory tile | |
| - rusted laboratory tile | |
| - cracked concrete | |
| - coral floor | |
| - scorched old carpet | |
| - rusted biotech lab tile | |
| - cracked concrete | |
| - burned bioferrite plate | |
| - gray surface | |
| - bronze tile | |
| - copper tile | |
| - bronze studded tile | |
| - copper studded tile | |
| - bronze grate tile | |
| - copper grate tile | |
| - sterile studded tile | |
| - sterile grate tile | |
| - gold studded tile | |
| - silver studded tile | |
| - steel studded tile | |
| - gold grate tile | |
| - silver grate tile | |
| - steel grate tile | |
| - paved hex tile | |
| - basalt flagstone | |
| - basalt tile | |
| - volcanic malachite tile | |
| - volcanic ebony tile | |
| - fine basalt tile | |
| - totemic basalt tile | |
| - basalt spikecore tile | |
| - morbid basalt tile | |
| - basalt tile | |
| - siltstone tile | |
| - schist tile | |
| - shale tile | |
| - fine basalt tile | |
| - fine siltstone tile | |
| - fine schist tile | |
| - fine shale tile | |
| - totemic basalt tile | |
| - totemic schist tile | |
| - totemic shale tile | |
| - totemic siltstone tile | |
| - basalt spikecore tile | |
| - schist spikecore tile | |
| - shale spikecore tile | |
| - siltstone spikecore tile | |
| - morbid basalt tile | |
| - morbid schist tile | |
| - morbid shale tile | |
| - morbid siltstone tile | |
| - basalt slabs | |
| - siltstone slabs | |
| - schist slabs | |
| - shale slabs | |
| - basalt polished stone floor | |
| - siltstone polished stone floor | |
| - schist polished stone floor | |
| - shale polished stone floor | |
| - basalt bridge | |
| - siltstone bridge | |
| - schist bridge | |
| - shale bridge | |
| - shale mosaics | |
| - siltstone mosaics | |
| - basalt mosaics | |
| - schist mosaics | |
| - Striped ceramic tiles | |
| - ceramic tile（black） | |
| - ceramic tile | |
| - trashbrick floor | |
| - ancient carpet | |
| - ancient frozen hull tile | |
| - ancient hull tile | |
| - concrete foundation | |
| - marble bridge | |
| - slate bridge | |
| - limestone bridge | |
| - granite bridge | |
| - sandstone bridge | |
| - marble slabs | |
| - slate slabs | |
| - limestone slabs | |
| - granite slabs | |
| - sandstone slabs | |
| - marble polished stone floor | |
| - slate polished stone floor | |
| - limestone polished stone floor | |
| - granite polished stone floor | |
| - sandstone polished stone floor | |
| - concrete flagstone | |
| - concrete tile | |
| - cuprosteel tiles | |
| - marble mosaics | |
| - slate mosaics | |
| - limestone mosaics | |
| - granite mosaics | |
| - sandstone mosaics | |
| - gold colonial pavement tile | |
| - silver colonial pavement tile | |
| - steel colonial pavement tile | |
| - colonial rubber floor | |
| - gold colonial floor | |
| - silver colonial floor | |
| - steel colonial floor | |
| - athenium tile | |
| - PFS LF | Cyan | |
| - PFS LF | Mint | |
| - PFS LF | Dusty Amethyst | |
| - PFS LF | Cold Black | |
| - PFS LF | Cool Gray | |
| - PFS Luminous Flooring | |
| - PFS Clear Gray Tile | |
| - PFS Clear Blue Tile | |
| - PFS Black Tile | |
| - PFS Gray Tile | |
| - PFS White Tile | |
| - PFS TRON Tile | |
| - PFS Hexa Tile B | |
| - PFS Hexa Tile | |
| - PFS Rust Grate | |
| - PFS Black Composite Hull Plating | |
| - PFS Gray Composite Hull Plating | |
| - PFS Composite Hull Plating | |
| - PFS Black Hull Plating B | |
| - PFS Gray Hull Plating B | |
| - PFS White Hull Plating B | |
| - PFS Black Hull Plating | |
| - PFS Gray Hull Plating | |
| - PFS White Hull Plating | |
| - PFK BlueSky Tiles | |
| - PFK Stars Tiles | |
| - PFK Colorful Tiles C | |
| - PFK Colorful Tiles B | |
| - PFK Colorful Tiles A | |
| - sapphire tile | |
| - ruby tile | |
| - diamond tile | |
| - jade checkered tile | |
| - marble checkered tile | |
| - slate checkered tile | |
| - limestone checkered tile | |
| - granite checkered tile | |
| - sandstone checkered tile | |
| - jade gravel paving | |
| - marble gravel paving | |
| - slate gravel paving | |
| - limestone gravel paving | |
| - granite gravel paving | |
| - sandstone gravel paving | |
| - jade circular paving | |
| - marble circular paving | |
| - slate circular paving | |
| - limestone circular paving | |
| - granite circular paving | |
| - sandstone circular paving | |
| - jade fishscale paving | |
| - marble fishscale paving | |
| - slate fishscale paving | |
| - limestone fishscale paving | |
| - granite fishscale paving | |
| - sandstone fishscale paving | |
| - jade double diamond tile | |
| - marble double diamond tile | |
| - slate double diamond tile | |
| - limestone double diamond tile | |
| - granite double diamond tile | |
| - sandstone double diamond tile | |
| - jade staggered R M tile | |
| - marble staggered R M tile | |
| - slate staggered R M tile | |
| - limestone staggered R M tile | |
| - granite staggered R M tile | |
| - sandstone staggered R M tile | |
| - jade staggered R tile | |
| - marble staggered R tile | |
| - slate staggered R tile | |
| - limestone staggered R tile | |
| - granite staggered R tile | |
| - sandstone staggered R tile | |
| - jade staggered M tile | |
| - marble staggered M tile | |
| - slate staggered M tile | |
| - limestone staggered M tile | |
| - granite staggered M tile | |
| - sandstone staggered M tile | |
| - jade staggered tile | |
| - marble staggered tile | |
| - slate staggered tile | |
| - limestone staggered tile | |
| - granite staggered tile | |
| - sandstone staggered tile | |
| - jade crosshatch R M tile | |
| - marble crosshatch R M tile | |
| - slate crosshatch R M tile | |
| - limestone crosshatch R M tile | |
| - granite crosshatch R M tile | |
| - sandstone crosshatch R M tile | |
| - jade crosshatch R tile | |
| - marble crosshatch R tile | |
| - slate crosshatch R tile | |
| - limestone crosshatch R tile | |
| - granite crosshatch R tile | |
| - sandstone crosshatch R tile | |
| - jade crosshatch M tile | |
| - marble crosshatch M tile | |
| - slate crosshatch M tile | |
| - limestone crosshatch M tile | |
| - granite crosshatch M tile | |
| - sandstone crosshatch M tile | |
| - jade crosshatch tile | |
| - marble crosshatch tile | |
| - slate crosshatch tile | |
| - limestone crosshatch tile | |
| - granite crosshatch tile | |
| - sandstone crosshatch tile | |
| - jade R grid tile | |
| - marble R grid tile | |
| - slate R grid tile | |
| - limestone R grid tile | |
| - granite R grid tile | |
| - sandstone R grid tile | |
| - jade tiny grid M tile | |
| - marble tiny grid M tile | |
| - slate tiny grid M tile | |
| - limestone tiny grid M tile | |
| - granite tiny grid M tile | |
| - sandstone tiny grid M tile | |
| - jade grid M tile | |
| - marble grid M tile | |
| - slate grid M tile | |
| - limestone grid M tile | |
| - granite grid M tile | |
| - sandstone grid M tile | |
| - jade grid tile | |
| - marble grid tile | |
| - slate grid tile | |
| - limestone grid tile | |
| - granite grid tile | |
| - sandstone grid tile | |
| - jade windowpane tile | |
| - marble windowpane tile | |
| - slate windowpane tile | |
| - limestone windowpane tile | |
| - granite windowpane tile | |
| - sandstone windowpane tile | |
| - jade octasquare tile | |
| - marble octasquare tile | |
| - slate octasquare tile | |
| - limestone octasquare tile | |
| - granite octasquare tile | |
| - sandstone octasquare tile | |
| - jade ribbon paving | |
| - marble ribbon paving | |
| - slate ribbon paving | |
| - limestone ribbon paving | |
| - granite ribbon paving | |
| - sandstone ribbon paving | |
| - jade basket weave tile | |
| - marble basket weave tile | |
| - slate basket weave tile | |
| - limestone basket weave tile | |
| - granite basket weave tile | |
| - sandstone basket weave tile | |
| - jade V braided tile | |
| - jade H braided tile | |
| - jade I braided tile | |
| - jade C braided tile | |
| - marble V braided tile | |
| - marble H braided tile | |
| - marble I braided tile | |
| - marble C braided tile | |
| - slate V braided tile | |
| - slate H braided tile | |
| - slate I braided tile | |
| - slate C braided tile | |
| - limestone V braided tile | |
| - limestone H braided tile | |
| - limestone I braided tile | |
| - limestone C braided tile | |
| - granite V braided tile | |
| - granite H braided tile | |
| - granite I braided tile | |
| - granite C braided tile | |
| - sandstone V braided tile | |
| - sandstone H braided tile | |
| - sandstone I braided tile | |
| - sandstone C braided tile | |
| - jade braided octagon tile | |
| - marble braided octagon tile | |
| - slate braided octagon tile | |
| - limestone braided octagon tile | |
| - granite braided octagon tile | |
| - sandstone braided octagon tile | |
| - jade hexagon R M tile | |
| - marble hexagon R M tile | |
| - slate hexagon R M tile | |
| - limestone hexagon R M tile | |
| - granite hexagon R M tile | |
| - sandstone hexagon R M tile | |
| - jade hexagon R tile | |
| - marble hexagon R tile | |
| - slate hexagon R tile | |
| - limestone hexagon R tile | |
| - granite hexagon R tile | |
| - sandstone hexagon R tile | |
| - jade hexagon M tile | |
| - marble hexagon M tile | |
| - slate hexagon M tile | |
| - limestone hexagon M tile | |
| - granite hexagon M tile | |
| - sandstone hexagon M tile | |
| - jade hexagon tile | |
| - marble hexagon tile | |
| - slate hexagon tile | |
| - limestone hexagon tile | |
| - granite hexagon tile | |
| - sandstone hexagon tile | |
| - jade pinwheel tile | |
| - marble pinwheel tile | |
| - slate pinwheel tile | |
| - limestone pinwheel tile | |
| - granite pinwheel tile | |
| - sandstone pinwheel tile | |
| - jade herringbone tile | |
| - marble herringbone tile | |
| - slate herringbone tile | |
| - limestone herringbone tile | |
| - granite herringbone tile | |
| - sandstone herringbone tile | |
| - jade random lengths R M tile | |
| - marble random lengths R M tile | |
| - slate random lengths R M tile | |
| - limestone random lengths R M tile | |
| - granite random lengths R M tile | |
| - sandstone random lengths R M tile | |
| - jade random lengths R tile | |
| - marble random lengths R tile | |
| - slate random lengths R tile | |
| - limestone random lengths R tile | |
| - granite random lengths R tile | |
| - sandstone random lengths R tile | |
| - jade random lengths M tile | |
| - marble random lengths M tile | |
| - slate random lengths M tile | |
| - limestone random lengths M tile | |
| - granite random lengths M tile | |
| - sandstone random lengths M tile | |
| - jade random lengths tile | |
| - marble random lengths tile | |
| - slate random lengths tile | |
| - limestone random lengths tile | |
| - granite random lengths tile | |
| - sandstone random lengths tile | |
| - jade random R M tile | |
| - marble random R M tile | |
| - slate random R M tile | |
| - limestone random R M tile | |
| - granite random R M tile | |
| - sandstone random R M tile | |
| - jade random R tile | |
| - marble random R tile | |
| - slate random R tile | |
| - limestone random R tile | |
| - granite random R tile | |
| - sandstone random R tile | |
| - jade random M tile | |
| - marble random M tile | |
| - slate random M tile | |
| - limestone random M tile | |
| - granite random M tile | |
| - sandstone random M tile | |
| - jade random tile | |
| - marble random tile | |
| - slate random tile | |
| - limestone random tile | |
| - granite random tile | |
| - sandstone random tile | |
| - jade T slab | |
| - marble T slab | |
| - slate T slab | |
| - limestone T slab | |
| - granite T slab | |
| - sandstone T slab | |
| - jade R slab | |
| - marble R slab | |
| - slate R slab | |
| - limestone R slab | |
| - granite R slab | |
| - sandstone R slab | |
| - jade slab | |
| - marble slab | |
| - slate slab | |
| - limestone slab | |
| - granite slab | |
| - sandstone slab | |
| - gold akri tile | |
| - silver akri tile | |
| - jade akri tile | |
| - gold locus tile | |
| - silver locus tile | |
| - plasteel locus tile | |
| - steel locus tile | |
| - gold spatium tile | |
| - silver spatium tile | |
| - plasteel spatium tile | |
| - steel spatium tile | |
| - gold trigon tile | |
| - silver trigon tile | |
| - plasteel trigon tile | |
| - steel trigon tile | |
| - gold novis tile | |
| - silver novis tile | |
| - plasteel novis tile | |
| - steel novis tile | |
| - gold modular tile | |
| - silver modular tile | |
| - plasteel modular tile | |
| - steel modular tile | |
| - gold exo tile | |
| - silver exo tile | |
| - plasteel exo tile | |
| - steel exo tile | |
| - gold digital tile | |
| - silver digital tile | |
| - plasteel digital tile | |
| - steel digital tile | |
| - gold durus tile | |
| - silver durus tile | |
| - plasteel durus tile | |
| - steel durus tile | |
| - gold arx tile | |
| - silver arx tile | |
| - plasteel arx tile | |
| - steel arx tile | |
| - gold framed tile | |
| - silver framed tile | |
| - plasteel framed tile | |
| - steel framed tile | |
| - gold framed pad plate | |
| - silver framed pad plate | |
| - plasteel framed pad plate | |
| - steel framed pad plate | |
| - gold pad plate | |
| - silver pad plate | |
| - plasteel pad plate | |
| - steel pad plate | |
| - gold cross tread plate | |
| - silver cross tread plate | |
| - plasteel cross tread plate | |
| - steel cross tread plate | |
| - gold tread sheet | |
| - silver tread sheet | |
| - plasteel tread sheet | |
| - steel tread sheet | |
| - gold vent plate | |
| - silver vent plate | |
| - plasteel vent plate | |
| - steel vent plate | |
| - gold hexa grate | |
| - silver hexa grate | |
| - plasteel hexa grate | |
| - steel hexa grate | |
| - gold grate plate | |
| - silver grate plate | |
| - plasteel grate plate | |
| - steel grate plate | |
| - gold grate | |
| - silver grate | |
| - plasteel grate | |
| - steel grate | |
| - gold polished plate | |
| - silver polished plate | |
| - plasteel polished plate | |
| - steel polished plate | |
| - gold plate | |
| - silver plate | |
| - plasteel plate | |
| - steel plate | |
| - marble plate floor | |
| - slate plate floor | |
| - limestone plate floor | |
| - granite plate floor | |
| - sandstone plate floor | |
| - polished marble floor | |
| - polished slate floor | |
| - polished limestone floor | |
| - polished granite floor | |
| - polished sandstone floor | |
| - mosaic marble floor | |
| - mosaic slate floor | |
| - mosaic limestone floor | |
| - mosaic granite floor | |
| - mosaic sandstone floor | |
| - check marble floor | |
| - check slate floor | |
| - check limestone floor | |
| - check granite floor | |
| - check sandstone floor | |
| - check marble tile | |
| - check slate tile | |
| - check limestone tile | |
| - check granite tile | |
| - check sandstone tile | |
| - smooth marble tile | |
| - smooth slate tile | |
| - smooth limestone tile | |
| - smooth granite tile | |
| - smooth sandstone tile | |
| - rough marble tile | |
| - rough slate tile | |
| - rough limestone tile | |
| - rough granite tile | |
| - rough sandstone tile | |
| - hexagonal sterile tile | |
| - check sterile tile | |
| - hexagonal plasteel tile | |
| - check plasteel tile | |
| - plasteel tile | |
| - hexagonal gold tile | |
| - check gold tile | |
| - hexagonal silver tile | |
| - check silver tile | |
| - hexagonal steel tile | |
| - check steel tile | |
| - patterned metal sheets | |
| - striped metal sheets | |
| - metal sheets | |
| - fine jade tile | |
| - smooth jade floor | |
| - jade floor | |
| - check jade tile | |
| - jade tile | |
| - marble mosaic tile | |
| - slate mosaic tile | |
| - limestone mosaic tile | |
| - granite mosaic tile | |
| - sandstone mosaic tile | |
| - mosaic tile | |
| - hyper alloy tiles | |
| - ocular marble floor | |
| - ocular slate floor | |
| - ocular limestone floor | |
| - ocular granite floor | |
| - ocular sandstone floor | |
| - restored tile | |
| - restored rusted tile | |
| - neolithic marble packed dirt floor | |
| - neolithic slate packed dirt floor | |
| - neolithic limestone packed dirt floor | |
| - neolithic granite packed dirt floor | |
| - neolithic sandstone packed dirt floor | |
| - steampunk marble tile | |
| - steampunk slate tile | |
| - steampunk limestone tile | |
| - steampunk granite tile | |
| - steampunk sandstone tile | |
| - pristine limestone flagstone | |
| - pristine limestone tile | |
| - futuristic kemetic tile | |
| - kemetic fine pristine limestone tile | |
| - kemetic fine marble tile | |
| - kemetic fine slate tile | |
| - kemetic fine limestone tile | |
| - kemetic fine granite tile | |
| - kemetic fine sandstone tile | |
| - kemetic pristine limestone tile | |
| - kemetic marble tile | |
| - kemetic slate tile | |
| - kemetic limestone tile | |
| - kemetic granite tile | |
| - kemetic sandstone tile | |
| - jewish fine marble tile | |
| - jewish fine slate tile | |
| - jewish fine limestone tile | |
| - jewish fine granite tile | |
| - jewish fine sandstone tile | |
| - jewish marble tile | |
| - jewish slate tile | |
| - jewish limestone tile | |
| - jewish granite tile | |
| - jewish sandstone tile | |
| - horaxian tile | |
| - flesh tile | |
| - cubic tile | |
| - steampunk obsidian tile | |
| - steampunk cragstone tile | |
| - steampunk mudstone tile | |
| - steampunk rose quartz tile | |
| - kemetic fine obsidian tile | |
| - kemetic fine cragstone tile | |
| - kemetic fine mudstone tile | |
| - kemetic fine rose quartz tile | |
| - kemetic obsidian tile | |
| - kemetic cragstone tile | |
| - kemetic mudstone tile | |
| - kemetic rose quartz tile | |
| - jewish fine obsidian tile | |
| - jewish fine cragstone tile | |
| - jewish fine mudstone tile | |
| - jewish fine rose quartz tile | |
| - jewish obsidian tile | |
| - jewish cragstone tile | |
| - jewish mudstone tile | |
| - jewish rose quartz tile | |
| - compacted sand | |
| - onyxglass flagstone | |
| - cragstone flagstone | |
| - mudstone flagstone | |
| - rose quartz flagstone | |
| - onyxglass tile | |
| - cragstone tile | |
| - mudstone tile | |
| - rose quartz tile | |
| - heavy bridge | |
| - gravship substructure | |
| - vacstone flagstone | |
| - vacstone tile | |
| - bioferrite plate | |
| - hex tile | |
| - totemic vacstone tile | |
| - totemic marble tile | |
| - totemic slate tile | |
| - totemic limestone tile | |
| - totemic granite tile | |
| - totemic sandstone tile | |
| - spikecore plates | |
| - vacstone spikecore tile | |
| - marble spikecore tile | |
| - slate spikecore tile | |
| - limestone spikecore tile | |
| - granite spikecore tile | |
| - sandstone spikecore tile | |
| - morbid vacstone tile | |
| - morbid marble tile | |
| - morbid slate tile | |
| - morbid limestone tile | |
| - morbid granite tile | |
| - morbid sandstone tile | |
| - fine vacstone tile | |
| - fine marble tile | |
| - fine slate tile | |
| - fine limestone tile | |
| - fine granite tile | |
| - fine sandstone tile | |
| - broken asphalt | |
| - marble tile | |
| - slate tile | |
| - limestone tile | |
| - granite tile | |
| - sandstone tile | |
| - sterile tile | |
| - gold tile | |
| - silver tile | |
| - steel tile | |
| :: Rim-Effect Renegade: Asari & Reapers :: Harmony patched successfully... | |
| Roos_Faun_Xenotype Mod Harmony Patches Loaded | |
| [Map Preview v1.12.24] Detected potential conflict: The mod "Space Turbulence" (ST_Patch) adds a destructive patch that will likely override or break some functionality of Map Preview. | |
| Patch method: static System.Boolean SpaceTurbulence.Patch_Size::prefix(Verse.IntVec3& mapSize, RimWorld.Planet.MapParent parent) | |
| Target method: static Verse.Map Verse.MapGenerator::GenerateMap(Verse.IntVec3 mapSize, RimWorld.Planet.MapParent parent, Verse.MapGeneratorDef mapGenerator, System.Collections.Generic.IEnumerable`1<Verse.GenStepWithParams> extraGenStepDefs, System.Action`1<Verse.Map> extraInitBeforeContentGen, System.Boolean isPocketMap, System.Boolean stepDebugger) | |
| [Geological Landforms v1.7.11] Found landform data in the following mods: Geological Landforms, Mashed's Ashlands | |
| [Geological Landforms v1.7.11] Loaded 48 landforms of which 0 are edited and 0 are custom. | |
| [LunarFramework v1.1.17] Processed 13 Harmony patches in 2933 ms. | |
| Unloading 5 Unused Serialized files (Serialized files now loaded: 24) | |
| MVCF successfully applied 56 patches | |
| Unloading 649 unused Assets to reduce memory usage. Loaded Objects now: 119866. | |
| Total: 860.637100 ms (FindLiveObjects: 7.715300 ms CreateObjectMapping: 3.135300 ms MarkObjects: 848.494900 ms DeleteObjects: 1.291200 ms) | |
| [DivineFramework] Loaded version 0.12.0.1 | |
| [AllowTool] Applied compatibility patch for "Pick Up And Haul" | |
| Loading asset bundle MuzzleFlash.shaders-windows | |
| Loaded shader Unlit/AnimatedAdditiveInstanced | |
| [Muzzle Flash] Shader loaded from MuzzleFlash: Unlit/AnimatedAdditiveInstanced | |
| --> [What's That Mod] Took 1.11 seconds to scan all patches. <-- | |
| What's That Mod: Wrote to 25322 mod descriptions, 792 patched defs resolved. | |
| What's That Mod took 1148 milliseconds to generate all def descriptions. | |
| [HugsLib] initializing DefensivePositions | |
| [OgreStack]: Modify Stack Sizes Complete | |
| [XenotypeFork] BigAndSmall detected - enabling compatibility | |
| Starting patches: 920 - 2/14/2026 3:27:41 PM | |
| Finished transpiling 919 methods - 2/14/2026 3:27:47 PM | |
| [HugsLib] Quickstarter generating map with scenario: Crashlanded | |
| adding BorealForestto primary biomes | |
| adding Tundrato primary biomes | |
| adding ColdBogto primary biomes | |
| adding IceSheetto primary biomes | |
| adding TemperateForestto primary biomes | |
| adding TemperateSwampto primary biomes | |
| adding TropicalRainforestto primary biomes | |
| adding TropicalSwampto primary biomes | |
| adding AridShrublandto primary biomes | |
| adding Desertto primary biomes | |
| adding ExtremeDesertto primary biomes | |
| adding GlacialPlainto primary biomes | |
| adding Glowforestto primary biomes | |
| adding Grasslandsto primary biomes | |
| adding LavaFieldto primary biomes | |
| adding Scarlandsto primary biomes | |
| adding Mashed_Ashlands_BlightedAshlandsto primary biomes | |
| adding Mashed_Ashlands_BlightedBogAshlandsto primary biomes | |
| adding Mashed_Ashlands_BlightedPetrifiedForestAshlandsto primary biomes | |
| adding Mashed_Ashlands_Ashlandsto primary biomes | |
| adding Mashed_Ashlands_DustplainAshlandsto primary biomes | |
| adding Mashed_Ashlands_GrazelandAshlandsto primary biomes | |
| adding Mashed_Ashlands_HighlandAshlandsto primary biomes | |
| adding Mashed_Ashlands_SwampAshlandsto primary biomes | |
| adding Mashed_Ashlands_ForestAshlandsto primary biomes | |
| adding Mashed_Ashlands_MarshAshlandsto primary biomes | |
| adding Mashed_Ashlands_MeadowAshlandsto primary biomes | |
| adding Mashed_Ashlands_VolcanicAshlandsto primary biomes | |
| adding Mashed_Ashlands_VolcanicBadlandAshlandsto primary biomes | |
| adding Mashed_Ashlands_VolcanicBasaltHillsAshlandsto primary biomes | |
| adding Mashed_Ashlands_VolcanicSulphurPitsAshlandsto primary biomes | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| finished biome cycle | |
| Unloading 3 Unused Serialized files (Serialized files now loaded: 25) | |
| [PhysX] Initialized MultithreadedTaskDispatcher with 16 workers. | |
| FileNotFoundException: Cannot resolve dependency to assembly 'UnityEngine.InputLegacyModule, Version=0.0.0.0, Culture=neutral, PublicKeyToken=null' because it has not been preloaded. When using the ReflectionOnly APIs, dependent assemblies must be pre-loaded or loaded on demand through the ReflectionOnlyAssemblyResolve event. | |
| Unloading 4 unused Assets to reduce memory usage. Loaded Objects now: 120157. | |
| Total: 837.612600 ms (FindLiveObjects: 4.810300 ms CreateObjectMapping: 2.231800 ms MarkObjects: 830.466900 ms DeleteObjects: 0.103300 ms) | |
| Initializing new game with mods: | |
| - jikulopo.prepatcher | |
| - brrainz.harmony | |
| - Ludeon.RimWorld | |
| - Ludeon.RimWorld.Royalty | |
| - Ludeon.RimWorld.Ideology | |
| - Ludeon.RimWorld.Biotech | |
| - Ludeon.RimWorld.Anomaly | |
| - Ludeon.RimWorld.Odyssey | |
| - adaptive.storage.framework | |
| - vanillaexpanded.backgrounds | |
| - imranfish.xmlextensions | |
| - RedMattis.BetterPrerequisites | |
| - SmashPhil.VehicleFramework | |
| - UnlimitedHugs.HugsLib | |
| - OskarPotocki.VanillaFactionsExpanded.Core | |
| - EBSG.Framework | |
| - Boeing.medical.supplies | |
| - kenx00x.XenotypeAndIdeologyButtonsTitleScreen16update | |
| - cat2002.showhair | |
| - FrozenSnowFox.BetterCampLoot | |
| - satoimozou.hair | |
| - JF.RoyalCarpets | |
| - kittahkhan.grazeup | |
| - savestoragesettings.kv.rw.fishtmp | |
| - LazyFridayStudio.GenesExpandedWings | |
| - LimeTreeSnake.Ammunition | |
| - Nals.FacialAnimation | |
| - tradingpost.programmerlily.com | |
| - sbz.NeatStorageFridge | |
| - sbz.GravshipStorage | |
| - sbz.NeatStorage | |
| - sbz.NeatStorageWorkbenchShelf | |
| - brrainz.achtung | |
| - addie.addiesmantlesandcloaks | |
| - ANNOProfi.AdvancedUnnaturalDarkness | |
| - JintuziLamian.Hairstyle.AFUWomenshairstyles | |
| - JintuziLamian.Hairstyle.AFUMenshairstyles | |
| - Newton.AKNExtras.FacialAnimations | |
| - UnlimitedHugs.AllowTool | |
| - sarg.alphabiomes | |
| - sarg.alphabooks | |
| - Sarg.AlphaMemes | |
| - sarg.alpharandom | |
| - Oblitus.AnimalsLogic | |
| - MrHydralisk.AnomaliesExpected | |
| - zoarak.anomalyplat | |
| - co.uk.epicguru.antimatterannihilation | |
| - com.bymarcin.ArchitectIcons | |
| - Argon.CoreLib | |
| - Meltup.BeautifulOutdoors | |
| - ElSov.Beliar | |
| - RedMattis.BetterGeneInheritance | |
| - kikohi.BetterGroundPenetratingScanner | |
| - wastelandr.BetterRoads | |
| - falconne.BWM | |
| - BiomesTeam.BiomesFossils | |
| - automatic.bionicicons | |
| - Syrus.BPaNSResize | |
| - Fuu.BloodAnimations | |
| - bs.mbifvte | |
| - cucumpear.stonetweaksvanilla | |
| - kapitanoczywisty.changemapedge | |
| - zylle.ChildrensDrawings | |
| - Mlie.ChooseBiomeCommonality | |
| - Kopp.ChooseYourMedicine | |
| - CrashM.ColorCodedMoodBar.11 | |
| - kikohi.ColoredDeepResources | |
| - PeteTimesSix.CompactHediffs | |
| - Mlie.CompactWorkTab | |
| - ferny.CorpseDescriptionFix | |
| - phomor.CraftingQualityRebalanced | |
| - Mlie.CustomPlayerIcon | |
| - chris.cutercatearreplacer | |
| - DimonSever000.Events.Specific | |
| - Van.DACrypts | |
| - Shashlichnik.DeepAndDeeper | |
| - UnlimitedHugs.DefensivePositions | |
| - flangopink.disableautoselecttravelsupplies | |
| - proxyer.dismantleancientjunk | |
| - overpl.DormantAm | |
| - Romyashi.DLWDFramework | |
| - Dubwise.DubsBadHygiene | |
| - Dubwise.DubsBreakMod | |
| - Dubwise.DubsMintMenus | |
| - dubwise.dubsmintminimap | |
| - Dubwise.DubsPerformanceAnalyzer.steam | |
| - Dubwise.DubsSkylights | |
| - zeracronius.dynamictradeinterface | |
| - Mlie.EnterHere | |
| - Erin.Auraeyl | |
| - Erin.BG3.Hair | |
| - Erin.Cats | |
| - Erin.CosmeticGenes | |
| - Erin.FluffyFauna | |
| - Erin.Hair2 | |
| - Erin.Palamutes | |
| - SirMashedPotato.ESCP.Skyshards | |
| - Wemd.ExpandedFloors | |
| - Keshash.ExtraExplosionEffects | |
| - MasterLorian.EyeImplantsRetextured | |
| - azravos.factioncustomizer | |
| - Inglix.FasterBiosculptingPod | |
| - ferny.EasyCaravanFormation | |
| - kathanon.FloatSubMenu | |
| - ks.flooringfloors | |
| - Hawkwood.FloorsAreAlmostWorthless | |
| - Crocodil.FoodPoisoningCures | |
| - ferny.FuckLearningHelper | |
| - sd.fa.geneticheadsframework | |
| - m00nl1ght.GeologicalLandforms | |
| - Mlie.GiveUpYourBuilding | |
| - K.GlitterNet | |
| - Telefonmast.GraphicsSettings | |
| - automatic.gunplay | |
| - Hex.Retexture | |
| - yefreitor.historyautocleaner | |
| - HouseplantsRemastered.mp3 | |
| - Zaf.InjectGene | |
| - Jaxe.Bubbles | |
| - kikohi.jewelry | |
| - Dorely.EmergencySurgery | |
| - Timuttie.JustLeaveAlready.fork.mitasamodel | |
| - nep.landonanything | |
| - cucumpear.animalbeds | |
| - Mlie.LargeFactionBases | |
| - Krafs.LevelUp | |
| - ASF.DeepStorage | |
| - ratys.madskills | |
| - m00nl1ght.MapPreview | |
| - Supes.MapWideOrbitalTradeBeacon | |
| - zoarak.mechplat | |
| - EL.InvMech | |
| - Spino.MechanoidsExtraordinaire | |
| - ac.mw.sad | |
| - SA.Metaflora | |
| - Superniquito.ModOptionsSort | |
| - Owlchemist.Moonlight | |
| - AtamanDolinskaja.MoreCrashedShipParts | |
| - tidal.morevanilla.textures | |
| - IssacZhuang.MuzzleFlash | |
| - Sov.Nephilim | |
| - Dingo.NoForcedSlowdown | |
| - Edern.NoRandomApparelOnIdeoEdit | |
| - Ogre.OgreStack | |
| - ISOREX.PawnEditor | |
| - Arkymn.SlowerPawnTickRate | |
| - Taranchuk.PerformanceOptimizer | |
| - Alleykat.PersistentPrecepts | |
| - Owlchemist.PerspectivePaths | |
| - Mehni.PickUpAndHaul | |
| - ponpeco.PonpecoAccessories | |
| - ponpeco.PFKidsRoom | |
| - ponpeco.PFSF | |
| - ponpeco.PPHair | |
| - ponpeco.KidsClothes | |
| - Mlie.PrisonersShouldFearTurrets | |
| - neptimus7.progressrenderer | |
| - K.PsiTech | |
| - pluralled.raiderinfo | |
| - brrainz.rangefinder | |
| - Rah.RBSE | |
| - Mlie.RecipeIcons | |
| - Reel.Hair2 | |
| - Reel.Hair | |
| - Mlie.RelevantStatsInDescription | |
| - gerads.RemoveGradualRelationsDecayPatchy | |
| - ferny.ReplaceLib | |
| - Owlchemist.ResearchPowl | |
| - ReSplice.XOTR.Core | |
| - ferny.RestrictUndrawnApparel | |
| - Rev.IconXenotypes | |
| - RimEffectRenegade.Core | |
| - Jaxe.RimHUD | |
| - Rimsenal.Askbarn | |
| - Rimsenal.Harana | |
| - Rimsenal.Zohar | |
| - River.Tribal.Shoes | |
| - Rooboid.DreadlockHairsHD | |
| - Rooboid.Hdhair | |
| - Rooboid.RoyalhairHD | |
| - Mlie.RoofBomb | |
| - MemeGoddess.RunAndGun | |
| - seohyeon.bestdrugpolicy | |
| - MemeGoddess.SearchAndDestroy | |
| - kathanon.ShowWeaponTallies | |
| - PeteTimesSix.SimpleSidearms | |
| - ray1203.SimpleCameraSetting | |
| - sarg.smartspeed | |
| - Mlie.SmarterDeconstructionAndMining | |
| - weilbyte.snapout | |
| - sirrandoo.msf | |
| - HaiLuan.SpaceTurbulence | |
| - Albion.SparklingWorlds.Addon.BlueMoon | |
| - Mlie.StuffList | |
| - Mlie.TabSorting | |
| - Divinorium.TaintedRenaming | |
| - Goji.TheSimsTraits | |
| - Jaxe.ToggleHarvest | |
| - Owlchemist.ToggleableOverlays | |
| - Owlchemist.ToggleableReadouts | |
| - smashphil.dropspot | |
| - captaingeorge.TradersHaveMoney | |
| - Superniquito.TraitIcons | |
| - mb.TrueUnnaturalDarkness | |
| - GonDragon.UINotIncluded | |
| - UNAGI.Hairs.B.Zibunyou | |
| - UNAGI.Kawaii.hair1 | |
| - UNAGI.Short.hair2 | |
| - AMagicalLime.undraftaftertucking | |
| - unlimitedthreatscale.1trickPwnyta | |
| - Ushanka.GlittertechExpansion | |
| - Ushanka.HackingExpansion | |
| - Ushanka.LuciferiumExpansion | |
| - VanillaExpanded.VanillaAnimalsExpanded | |
| - VanillaExpanded.VAEEndAndExt | |
| - VanillaExpanded.VAERoy | |
| - VanillaExpanded.VAEWaste | |
| - VanillaExpanded.VAnomalyEInsanity | |
| - VanillaExpanded.VAPPE | |
| - VanillaExpanded.VAEAccessories | |
| - VanillaExpanded.VARME | |
| - VanillaExpanded.VanillaAspirationsExpanded | |
| - VanillaExpanded.VanillaBackstoriesExpanded | |
| - VanillaExpanded.BaseGeneration | |
| - VanillaExpanded.VBrewE | |
| - Donald.VCR | |
| - VanillaExpanded.VCookE | |
| - VanillaExpanded.VEE | |
| - OskarPotocki.VFE.Classical | |
| - OskarPotocki.VFE.Empire | |
| - OskarPotocki.VFE.Insectoid2 | |
| - OskarPotocki.VFE.Medieval2 | |
| - OskarPotocki.VanillaFactionsExpanded.SettlersModule | |
| - OskarPotocki.VFE.Tribals | |
| - VanillaExpanded.VCEF | |
| - VanillaExpanded.VanillaFoodVarietyExpanded | |
| - VanillaExpanded.VFECore | |
| - VanillaExpanded.VFEArchitect | |
| - VanillaExpanded.VFEArt | |
| - VanillaExpanded.VFEFarming | |
| - VanillaExpanded.VFEMedical | |
| - VanillaExpanded.VFEPower | |
| - VanillaExpanded.VFEProduction | |
| - VanillaExpanded.VFESecurity | |
| - VanillaExpanded.VFESpacer | |
| - RedMattis.VanillaGenesRebalanced | |
| - vanillaexpanded.gravship | |
| - VanillaExpanded.VHE | |
| - VanillaExpanded.HelixienGas | |
| - VanillaExpanded.Ideo.Dryads | |
| - VanillaExpanded.VIEHAR | |
| - VanillaExpanded.Ideo.IconsandSymbols | |
| - VanillaExpanded.Ideo.RelicsAndArtifacts | |
| - VanillaExpanded.Ideo.SophianStyle | |
| - VanillaExpanded.VExplorationE | |
| - VanillaExpanded.VNutrientE | |
| - vanillaexpanded.outposts | |
| - VanillaExpanded.VPersonaWeaponsE | |
| - VanillaExpanded.VPlantsESucculents | |
| - VanillaExpanded.VPsycastsE | |
| - vanillaquestsexpanded.ancients | |
| - vanillaquestsexpanded.cryptoforge | |
| - vanillaquestsexpanded.deadlife | |
| - vanillaquestsexpanded.generator | |
| - vanillaracesexpanded.android | |
| - vanillaracesexpanded.customicons | |
| - vanillaracesexpanded.fungoid | |
| - vanillaracesexpanded.genie | |
| - vanillaracesexpanded.highmate | |
| - vanillaracesexpanded.hussar | |
| - vanillaracesexpanded.lycanthrope | |
| - vanillaracesexpanded.phytokin | |
| - vanillaracesexpanded.pigskin | |
| - vanillaracesexpanded.sanguophage | |
| - vanillaracesexpanded.saurid | |
| - vanillaracesexpanded.starjack | |
| - vanillaracesexpanded.waster | |
| - VanillaExpanded.Recycling | |
| - VanillaExpanded.VanillaSocialInteractionsExpanded | |
| - VSE.PerryPersistent | |
| - VanillaStorytellersExpanded.WinstonWave | |
| - VanillaExpanded.VanillaTradingExpanded | |
| - VanillaExpanded.VanillaTraitsExpanded | |
| - OskarPotocki.VanillaVehiclesExpanded | |
| - VanillaExpanded.VWE | |
| - VanillaExpanded.VWEC | |
| - VanillaExpanded.VWEG | |
| - VanillaExpanded.VWEL | |
| - VanillaExpanded.VWEMS | |
| - VanillaExpanded.VWENL | |
| - VanillaExpanded.VWETB | |
| - Mlie.VariousSpaceShipChunk | |
| - dismarzero.VGP.VGPGardenFabrics | |
| - visibleraidpoints.1trickPwnyta | |
| - Mlie.VisualXMLPatches | |
| - divineDerivative.Romance | |
| - Xaviien.WeaponConditionMattersAndSoDoesQuality | |
| - bodlosh.WeaponStats | |
| - kikohi.whatsforsale | |
| - co.uk.epicguru.whatsthatmod | |
| - won.hair | |
| - won2.hair | |
| - ferny.Worldbuilder | |
| - bs.xenotypespawncontrol | |
| - Mlie.JPTSoftWarmBeds | |
| - LimeTreeSnake.Ammo | |
| - sarg.alphamechs | |
| - ferny.ambiguousanomaly | |
| - Romyashi.AncientJunkLoot | |
| - XMB.AncientUrbanrUins.MO | |
| - Halituisamaricanous.antimatterannihilationretextured | |
| - CatLover366.BootsAndGloves | |
| - Van.Beasts | |
| - Bishaojiu.DeepAndDeeperCavernTexture | |
| - Deon.DeepAndDeeperLadder | |
| - overpl.DrawnSpots | |
| - Argon.ExpandedMaterials.Masonry | |
| - sd.fa.geneticheadsbiotech | |
| - sd.fa.geneticheadsmods | |
| - SirMashedPotato.Ashlands | |
| - 4loris4.MoreLinkables | |
| - Sinnamon.MoreRitualRewards | |
| - Andromeda.NiceInventoryTab | |
| - proxyer.optionalicons4ai | |
| - ND.RTPJ | |
| - Reel.FacialAnims | |
| - ReGrowth.BOTR.Core | |
| - ReSplice.XOTR.Charmweavers | |
| - RimEffectRenegade.AsariReapers | |
| - V.Rooboid.Faun | |
| - VanillaExpanded.VBrewECandT | |
| - VanillaExpanded.VChemfuelE | |
| - VanillaExpanded.VCookEBakery | |
| - VanillaExpanded.VCookEHaute | |
| - VanillaExpanded.VCookEStews | |
| - VanillaExpanded.VCookESushi | |
| - OskarPotocki.VFE.Deserters | |
| - OskarPotocki.VFE.Pirates | |
| - VanillaExpanded.VCEFAddon | |
| - VanillaExpanded.VPE.Hemosage | |
| - vanillaracesexpanded.archon | |
| - VanillaExpanded.VTEXVariations | |
| - OskarPotocki.VanillaVehiclesExpandedTier3 | |
| - OskarPotocki.VanillaVehiclesExpandedUpgrades | |
| - VanillaExpanded.VWEHW | |
| - VanillaExpanded.VWEQ | |
| - Spacemoth.VFAVCCRsze | |
| - Stagz.VSIERationalTraitDevelopment | |
| - Neronix17.Retexture.WonHairMen | |
| - Neronix17.Retexture.WonHairWomen | |
| - com.yayo.yayoAni.continued | |
| - SamBucher.ADogSaidAnimalProsthetics2 | |
| - scpchemfuel.appliances | |
| - LekkoBot.eyepatchcollection | |
| - ferny.ProgressionStorytellers | |
| - ReBuild.COTR.DoorsAndCorners | |
| - Owlchemist.SimpleFX.Smoke2 | |
| - VanillaExpanded.VPlantsE | |
| - VanillaExpanded.VTEXE | |
| - VanillaExpanded.VTEXE.FacialAnims | |
| - VanillaExpanded.VWEFT | |
| - Oppey.EyeGenes2 | |
| - Harkon.VEAddOn.VanillaExpandedExtraEmbrasures | |
| - RedMattis.BigSmall.Core | |
| - EL.BiotechMechRT | |
| - Erin.Body.Texture | |
| - Argon.ExpandedMaterials.Metals | |
| - sd.fa.vte.moreheadshapes | |
| - sirvan.hemogentexture | |
| - SirVan.MechanitorRetexture | |
| - sirvan.MWRetextured | |
| - sirvan.organretexture | |
| - VanillaExpanded.VIEAT | |
| - VanillaExpanded.VPlantsEMore | |
| - VanillaExpanded.VPlantsEMushrooms | |
| - vanillaracesexpanded.insector | |
| - sarg.alphaanimals | |
| - Jelheb.RusticMealRetexture | |
| - sarg.alphagenes | |
| - IH.Clean.Textures | |
| - ferny.generallymoreresearch | |
| - VanillaExpanded.VGeneticsE | |
| - VanillaExpanded.VMemesE | |
| - FrozenSnowFox.BetterAncientComplexLoot | |
| - FrozenSnowFox.BetterAnomalyLoot | |
| - FrozenSnowFox.FrozenSnowFoxTweaks | |
| - kupa.AlphaGenesIntegrated | |
| - ferny.fleshbeasts | |
| - ferny.progressionagriculture | |
| - shavius.VEpatches | |
| - tests.StylesToVTE | |
| - VanillaExpanded.VGeneticsEMoreLabStuff | |
| - GrillMaster.vanillaxenotypesimproved | |
| - FrozenSnowFox.ComplexJobs | |
| - ferny.progressioncore | |
| - SomethingSomething.PlantsAndStuff | |
| - ferny.progressionproduction | |
| - ferny.ProgressionScenarios | |
| - ferny.ProgressionEducation | |
| - ferny.ProgressionGravship | |
| - Wara.toomanymods | |
| - rev.miscpatch | |
| - rev.xenotypes | |
| [Geological Landforms v1.7.11] Map generator context: TileId: 1215, Landforms: None, BiomeVariants: None, Topology: Inland, TopologyDirection: North (F) | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Not generating ores for asteroid step | |
| Creating unique pawn Droska 'Smertnikov' Smertnikov 48982 with faction Entities for quest chain VQE_DeadlifeQuestChain with tag General | |
| Unloading 0 Unused Serialized files (Serialized files now loaded: 25) | |
| Unloading 0 unused Assets to reduce memory usage. Loaded Objects now: 127561. | |
| Total: 842.191900 ms (FindLiveObjects: 4.805700 ms CreateObjectMapping: 2.030700 ms MarkObjects: 835.256700 ms DeleteObjects: 0.098700 ms) | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Ryu | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinForeheadScar to Ryu | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Grey | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinCheekbones to Grey | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Maya | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinCheekScar to Maya | |
| Could not make building: TorchWallLamp | |
| Could not make building: WallLamp | |
| Could not make building: HiddenConduit | |
| Could not make building: WaterproofConduit | |
| Could not make building: MorbidSlab_Medium | |
| Could not make building: MorbidSlab_Broad | |
| Could not make building: TotemicSlab_Medium | |
| Could not make building: TotemicSlab_Broad | |
| Could not make building: SpikecoreFloorStar_Medium | |
| Could not make building: SpikecoreFloorStar_Broad | |
| Could not make building: RusticRug_Medium | |
| Could not make building: RusticRug_Broad | |
| Could not make building: AnimalistSlab_Medium | |
| Could not make building: AnimalistSlab_Broad | |
| Could not make building: OxygenPump | |
| Could not make building: JFRoyalCarpets_A | |
| Could not make building: JFRoyalCarpets_B | |
| Could not make building: JFRoyalCarpets_C | |
| Could not make building: JFRoyalCarpets_D | |
| Could not make building: JFRoyalCarpets_E | |
| Could not make building: TradingSpot | |
| Could not make building: sbz_ShortWorkbenchShelf | |
| Could not make building: sbz_MidWorkbenchShelf | |
| Could not make building: sbz_WorkbenchShelf | |
| Could not make building: AB_PropanePipe | |
| Could not make building: AB_PropanePipe_Underground | |
| Could not make building: AM_Building_Misc_FleshmassPiece1x1c | |
| Could not make building: AM_Building_Misc_FleshmassPiece2x2c | |
| Could not make building: AM_CubicSlab_Medium | |
| Could not make building: AM_CubicSlab_Broad | |
| Could not make building: AM_FleshSlab_Medium | |
| Could not make building: AM_FleshSlab_Broad | |
| Could not make building: AM_HoraxianSlab_Medium | |
| Could not make building: AM_HoraxianSlab_Broad | |
| Could not make building: AM_FuturisticPyramid | |
| Could not make building: AM_GreatPyramid | |
| Could not make building: AM_JewishSlab_Medium | |
| Could not make building: AM_JewishSlab_Broad | |
| Could not make building: AM_KemeticSlab_Medium | |
| Could not make building: AM_KemeticSlab_Broad | |
| Could not make building: AM_HinduSlab_Medium | |
| Could not make building: AM_HinduSlab_Broad | |
| Could not make building: AM_SteampunkSlab_Medium | |
| Could not make building: AM_SteampunkSlab_Broad | |
| Could not make building: AM_CorsairSlab_Medium | |
| Could not make building: AM_CorsairSlab_Broad | |
| Could not make building: AM_JainSlab_Medium | |
| Could not make building: AM_JainSlab_Broad | |
| Could not make building: AM_SikhSlab_Medium | |
| Could not make building: AM_SikhSlab_Broad | |
| Could not make building: AM_IslamicSlab_Medium | |
| Could not make building: AM_IslamicSlab_Broad | |
| Could not make building: AM_ChristianSlab_Medium | |
| Could not make building: AM_ChristianSlab_Broad | |
| Could not make building: AM_BuddhistSlab_Medium | |
| Could not make building: AM_BuddhistSlab_Broad | |
| Could not make building: ParticleAccelerator_AA | |
| Could not make building: AntimatterReactor_AA | |
| Could not make building: BMT_FossilInfo3Measured | |
| Could not make building: BMT_FossilInfo3Chlorosaurus | |
| Could not make building: BMT_FossilInfo3Cloning | |
| Could not make building: BMT_FossilInfo3Footprints | |
| Could not make building: BMT_FossilInfo3Dying | |
| Could not make building: BMT_FossilInfo3Cycle | |
| Could not make building: BMT_FossilInfo3Raptors | |
| Could not make building: BMT_FossilInfo3Triceratops | |
| Could not make building: BMT_TablePaleontology | |
| Could not make building: BMT_DisplayMedium | |
| Could not make building: BMT_DisplayLarge | |
| Could not make building: BMT_SkeleSmallGallimimus | |
| Could not make building: BMT_SkeleSmallOviraptor | |
| Could not make building: BMT_SkeleSmallPteranodon | |
| Could not make building: BMT_SkeleSmallRaptor | |
| Could not make building: BMT_SkeleMedAllosaurus | |
| Could not make building: BMT_SkeleMedAnkylosaurus | |
| Could not make building: BMT_SkeleMedElasmosaurus | |
| Could not make building: BMT_SkeleMedIguanodon | |
| Could not make building: BMT_SkeleMedParasaur | |
| Could not make building: BMT_SkeleMedStegosaurus | |
| Could not make building: BMT_SkeleMedTriceratops | |
| Could not make building: BMT_SkeleLargeBrachiosaurus | |
| Could not make building: BMT_SkeleLargeMosasaurus | |
| Could not make building: BMT_SkeleLargeSpino | |
| Could not make building: BMT_SkeleLargeTrex | |
| Could not make building: BMT_VelvetRope | |
| Could not make building: BMT_DisplayLight | |
| Could not make building: DA_SepulchralReliquary | |
| Could not make building: DA_DarklightSepulchralReliquary | |
| Could not make building: DA_BloodflameSepulchralReliquary | |
| Could not make building: DA_SepulchralBrazier | |
| Could not make building: DA_DarklightSepulchralBrazier | |
| Could not make building: DA_BloodflameSepulchralBrazier | |
| Could not make building: DA_Candles | |
| Could not make building: DA_DarkCandles | |
| Could not make building: DA_BloodCandles | |
| Could not make building: DA_GrandCandelabra | |
| Could not make building: DA_DarklightGrandCandelabra | |
| Could not make building: DA_BloodGrandCandelabra | |
| Could not make building: DA_Coffin | |
| Could not make building: DA_GrandSarcophagus | |
| Could not make building: DA_ImpStatue | |
| Could not make building: DA_GargoyleStatue | |
| Could not make building: DA_DemonStatue | |
| Could not make building: DA_HeroicMemorial | |
| Could not make building: DA_BurialUrn | |
| Could not make building: DA_SepulchralStatue | |
| Could not make building: DA_DarkligtSepulchralStatue | |
| Could not make building: DA_BloodflameSepulchralStatue | |
| Could not make building: DA_OssuaryWall | |
| Could not make building: DA_WallTomb | |
| Could not make building: ShashlichnikCaveEntrance | |
| Could not make building: sewagePipeStuff | |
| Could not make building: sewagePipeHidden | |
| Could not make building: plumbingValve | |
| Could not make building: airPipe | |
| Could not make building: airPipeHidden | |
| Could not make building: ToiletStallDoor | |
| Could not make building: PitLatrine | |
| Could not make building: PrimitiveWell | |
| Could not make building: WashBucket | |
| Could not make building: LitterBox | |
| Could not make building: BurnPit | |
| Could not make building: BasinStuff | |
| Could not make building: Fountain | |
| Could not make building: KitchenSink | |
| Could not make building: ToiletStuff | |
| Could not make building: ToiletAdvStuff | |
| Could not make building: ToiletSpacer | |
| Could not make building: BathMat | |
| Could not make building: BathtubStuff | |
| Could not make building: ShowerStuff | |
| Could not make building: ShowerSimple | |
| Could not make building: ShowerAdvStuff | |
| Could not make building: DBHSwimmingPool | |
| Could not make building: HotTub | |
| Could not make building: WashingMachine | |
| Could not make building: DBHSaunaHeaterLog | |
| Could not make building: DBHSaunaHeaterElec | |
| Could not make building: DBHSaunaSeating | |
| Could not make building: WaterWellInlet | |
| Could not make building: DeepWaterWellInlet | |
| Could not make building: WaterButt | |
| Could not make building: WaterTowerS | |
| Could not make building: WaterTowerL | |
| Could not make building: WindPump | |
| Could not make building: ElectricPump | |
| Could not make building: PumpingStation | |
| Could not make building: SewageOutlet | |
| Could not make building: SewageSepticTank | |
| Could not make building: SewageTreatment | |
| Could not make building: WaterTreatment | |
| Could not make building: SewageDumpPort | |
| Could not make building: CryogenicExtractionNode | |
| Could not make building: SpacerWaterRecoverySystem | |
| Could not make building: WaterTankSmall | |
| Could not make building: Thermostat | |
| Could not make building: LogBoiler | |
| Could not make building: GasBoiler | |
| Could not make building: ElectricBoiler | |
| Could not make building: SolarHeater | |
| Could not make building: GeothermHeater | |
| Could not make building: HotWaterTank | |
| Could not make building: RadiatorStuffed | |
| Could not make building: RadiatorLarge | |
| Could not make building: RadiatorTowelRail | |
| Could not make building: CeilingFan | |
| Could not make building: CeilingFanS | |
| Could not make building: AirConOutdoorUnit | |
| Could not make building: AirconIndoorUnit | |
| Could not make building: FreezerUnit | |
| Could not make building: IrrigationSprinkler | |
| Could not make building: FireSprinkler | |
| Could not make building: BiosolidsComposter | |
| Could not make building: SkyLightA | |
| Could not make building: SkyLightD | |
| Could not make building: SkyLightB | |
| Could not make building: SkyLightC | |
| Could not make building: EnterHereSpot | |
| Could not make building: ERN_RoundBed | |
| Could not make building: ERN_RoundDoubleBed | |
| Could not make building: ERN_RoundDresser | |
| Could not make building: ERN_RoundEndtable | |
| Could not make building: ERN_RoundStool | |
| Could not make building: ERN_BeanbagChair | |
| Could not make building: ERN_RoundCouch | |
| Could not make building: ERN_RoundTableSmall | |
| Could not make building: ERN_RoundTableLarge | |
| Could not make building: ERN_RoundLamp | |
| Could not make building: ERN_FloorPlant | |
| Could not make building: ERN_MushDecor | |
| Could not make building: ERN_HalfCircleRug | |
| Could not make building: ERN_FluffyRug | |
| Could not make building: ERN_RoundRug | |
| Could not make building: KS_CheqPattern | |
| Could not make building: KS_StoneBorderDark | |
| Could not make building: GNGlitterNetCable | |
| Could not make building: GNGlitterNetCableHidden | |
| Could not make building: GNGlitterNetHub | |
| Could not make building: GNBasicGlitterNetProcessor | |
| Could not make building: GNImprovedGlitterNetProcessor | |
| Could not make building: GNAdvancedGlitterNetProcessor | |
| Could not make building: GNSpecializedEfficiencyProcessor | |
| Could not make building: GNSpecializedOverdriveProcessor | |
| Could not make building: GNSpecializedConcurrencyProcessor | |
| Could not make building: GNSpecializedOverheadProcessor | |
| Could not make building: GNBasicWorkspeedIntegrator | |
| Could not make building: GNImprovedWorkspeedIntegrator | |
| Could not make building: GNAdvancedWorkspeedIntegrator | |
| Could not make building: GNBasicResearchIntegrator | |
| Could not make building: GNImprovedResearchIntegrator | |
| Could not make building: GNAdvancedResearchIntegrator | |
| Could not make building: GNBasicPowerIntegrator | |
| Could not make building: GNImprovedPowerIntegrator | |
| Could not make building: GNAdvancedPowerIntegrator | |
| Could not make building: GNBasicBedIntegrator | |
| Could not make building: GNImprovedBedIntegrator | |
| Could not make building: GNAdvancedBedIntegrator | |
| Could not make building: GNBasicMedicalIntegrator | |
| Could not make building: GNImprovedMedicalIntegrator | |
| Could not make building: GNAdvancedMedicalIntegrator | |
| Could not make building: LaserTableSculpting | |
| Could not make building: CCPMAnimalSleepingSpot | |
| Could not make building: CCPLAnimalSleepingSpot | |
| Could not make building: CCPMAnimalSleepingBox | |
| Could not make building: CCPLAnimalSleepingBox | |
| Could not make building: CCPMAnimalBed | |
| Could not make building: CCPLAnimalBed | |
| Could not make building: CCPSAnimalHospitalBed | |
| Could not make building: CCPMAnimalHospitalBed | |
| Could not make building: CCPLAnimalHospitalBed | |
| Could not make building: TrapIED_AntigrainWarhead_Large | |
| Could not make building: ASF_Basket | |
| Could not make building: ASF_BigShelf | |
| Could not make building: ASF_BigSShelf | |
| Could not make building: ASF_ClothingRack | |
| Could not make building: ASF_FabricHamper | |
| Could not make building: ASF_Hayloft | |
| Could not make building: ASF_MeatHook | |
| Could not make building: ASF_MedCab | |
| Could not make building: ASF_Pallet | |
| Could not make building: ASF_Safe | |
| Could not make building: ASF_Skip | |
| Could not make building: ASF_TrayRack | |
| Could not make building: ASF_VeryBigShelf | |
| Could not make building: ASF_VeryBigSShelf | |
| Could not make building: ASF_WeaponsCabinet | |
| Could not make building: ASF_WeaponsLocker | |
| Could not make building: MF_PoweredPlantPot | |
| Could not make building: PFK_Cradle | |
| Could not make building: PFK_ShelfSmall | |
| Could not make building: PFK_Ball | |
| Could not make building: PFK_Mobile | |
| Could not make building: PFK_Bunting | |
| Could not make building: PFK_BuntingAb | |
| Could not make building: PFK_BuntingB | |
| Could not make building: PFK_Cushion | |
| Could not make building: PFK_GiantPlushie | |
| Could not make building: PFK_GiantPlushieB | |
| Could not make building: PFK_GiantPlushieM | |
| Could not make building: PFK_WoodenToyS | |
| Could not make building: PFK_WoodenToySB | |
| Could not make building: PFK_WoodenToySC | |
| Could not make building: PFK_WoodenToySD | |
| Could not make building: PFK_WoodenToy | |
| Could not make building: PFK_WoodenToyB | |
| Could not make building: PFK_WoodenToyC | |
| Could not make building: PFK_WoodenToyD | |
| Could not make building: PFK_Curtain | |
| Could not make building: PFK_BigCurtain | |
| Could not make building: PFK_PKCRobo | |
| Could not make building: PFK_PKCDog | |
| Could not make building: PFK_Bedroll | |
| Could not make building: PFK_BedAa | |
| Could not make building: PFK_BedAb | |
| Could not make building: PFK_Stool | |
| Could not make building: PFK_DiningChair | |
| Could not make building: PFK_Armchair | |
| Could not make building: PFK_EndTable | |
| Could not make building: PFK_MiniTable | |
| Could not make building: PFK_Table2x2c | |
| Could not make building: PFK_AnimalLamp | |
| Could not make building: PFK_AnimalLampB | |
| Could not make building: PFK_AnimalLampC | |
| Could not make building: PFK_AnimalLampD | |
| Could not make building: PFK_FairyLights | |
| Could not make building: PFK_Dresser | |
| Could not make building: PFK_TubeTelevision | |
| Could not make building: PFK_RingToss | |
| Could not make building: PFK_RingTossB | |
| Could not make building: PFK_RingTossC | |
| Could not make building: PFK_RingTossD | |
| Could not make building: PFK_FluffyRug_A | |
| Could not make building: PFK_FluffyRug_B | |
| Could not make building: PFK_FluffyRug_C | |
| Could not make building: PFK_FluffyRug_D | |
| Could not make building: PFK_ShaggyRug_A | |
| Could not make building: PFK_ShaggyRug_B | |
| Could not make building: PFK_ShaggyRug_C | |
| Could not make building: PFK_ShaggyRug_D | |
| Could not make building: PFS_Crib | |
| Could not make building: PFS_DecoTablewareA | |
| Could not make building: PFS_DecoTablewareB | |
| Could not make building: PFS_DecoTablewareC | |
| Could not make building: PFS_DecoTablewareD | |
| Could not make building: PFS_TabletopPlant | |
| Could not make building: PFS_MetalTeddyBear | |
| Could not make building: PFS_ObsidianFigurine | |
| Could not make building: PFS_HoloGlassPanel | |
| Could not make building: PFS_MiniHoloGlass | |
| Could not make building: PFS_HoloGlassDesktop | |
| Could not make building: PFS_DoorFrameA | |
| Could not make building: PFS_DoorFrameB | |
| Could not make building: PFS_DoorFrameC | |
| Could not make building: PFS_DoorSlope | |
| Could not make building: PFS_Bed | |
| Could not make building: PFS_DoubleBed | |
| Could not make building: PFS_AnimalBed | |
| Could not make building: PFS_EndTable | |
| Could not make building: PFS_TableMini | |
| Could not make building: PFS_TableMiniB | |
| Could not make building: PFS_TableB | |
| Could not make building: PFS_TableC | |
| Could not make building: PFS_HexaTable | |
| Could not make building: PFS_ZFrameTable | |
| Could not make building: PFS_Table3x2a | |
| Could not make building: PFS_Stool | |
| Could not make building: PFS_StoolB | |
| Could not make building: PFS_DiningChair | |
| Could not make building: PFS_Armchair | |
| Could not make building: PFS_ArmchairB | |
| Could not make building: PFS_Couch | |
| Could not make building: PFS_CubeLight | |
| Could not make building: PFS_TriLight | |
| Could not make building: PFS_FloorlineLight | |
| Could not make building: PFS_DresserA | |
| Could not make building: PFS_DresserB | |
| Could not make building: PFS_PokerTable | |
| Could not make building: PFS_BilliardsTable | |
| Could not make building: PFS_FirefoamPopper | |
| Could not make building: PFS_Barricade | |
| Could not make building: PFS_ShelfSmall | |
| Could not make building: PFS_SteelDoor | |
| Could not make building: PFS_AutodoorB | |
| Could not make building: PFS_AutodoorC | |
| Could not make building: PFS_HoloGlassAutodoor | |
| Could not make building: PFS_ColumnA | |
| Could not make building: PFS_ColumnB | |
| Could not make building: PFS_ColumnC | |
| Could not make building: PFS_Heater | |
| Could not make building: PKC_DecorPlushie | |
| Could not make building: PKC_DecorPlushieL | |
| Could not make building: PTPsychicTraier | |
| Could not make building: PTPsychicWorkbench | |
| Could not make building: PTPsychicSuppressionFieldProjector | |
| Could not make building: AdvancedMedicalStation | |
| Could not make building: BionicWorkbench | |
| Could not make building: RS_GeneVault | |
| Could not make building: RS_GeneRepository | |
| Could not make building: RS_GeneCentrifuge | |
| Could not make building: RS_XenoGermDuplicator | |
| Could not make building: RE_KodiakShuttle | |
| Could not make building: RE_MakoTank | |
| Could not make building: RE_PrefabHeater | |
| Could not make building: RE_PrefabStandingLamp | |
| Could not make building: RE_PrefabDresser | |
| Could not make building: RE_PrefabChair | |
| Could not make building: RE_PrefabBed | |
| Could not make building: RE_PrefabDoubleBed | |
| Could not make building: RE_PrefabCooler | |
| Could not make building: RE_PrefabVent | |
| Could not make building: RE_PrefabShelf | |
| Could not make building: RE_PrefabEndTable | |
| Could not make building: RE_PrefabEndTableWithLamp | |
| Could not make building: RE_PrefabMedicalBed | |
| Could not make building: RE_PrefabArmchair | |
| Could not make building: RE_PrefabBedsideTable | |
| Could not make building: RE_PrefabBedsideTableLamp | |
| Could not make building: RE_BriefingTable | |
| Could not make building: RE_PrefabStool | |
| Could not make building: RE_PrefabWardrobe | |
| Could not make building: RE_PrefabPlantPot | |
| Could not make building: RE_PrefabLargePlantPot | |
| Could not make building: RE_PrefabTable1x1c | |
| Could not make building: RE_PrefabTable1x2c | |
| Could not make building: RE_PrefabTable2x2c | |
| Could not make building: RE_PrefabTable2x4c | |
| Could not make building: RE_PrefabTelevision | |
| Could not make building: RE_VIInterface | |
| Could not make building: RE_GraveBodyBag | |
| Could not make building: RE_GalaxyMap | |
| Could not make building: RE_PrefabGenerator | |
| Could not make building: PrefabSolarCollectors | |
| Could not make building: RE_FusionCell | |
| Could not make building: RE_ElementZeroReactor | |
| Could not make building: RE_FusionReactor | |
| Could not make building: RE_PrefabGeothermalPlant | |
| Could not make building: RE_SpacerTechResearchBench | |
| Could not make building: RE_ManufacturingBench | |
| Could not make building: RE_PrefabBarricade | |
| Could not make building: RE_Turret_MassAccelerator | |
| Could not make building: RE_Turret_HeavyMassAccelerator | |
| Could not make building: RE_AllianceTerminal | |
| Could not make building: RE_ElementZeroExtractor | |
| Could not make building: RE_PrefabWall | |
| Could not make building: RE_PrefabColumn | |
| Could not make building: RE_PrefabAutodoor | |
| Could not make building: RoofBomb | |
| Could not make building: DropSpotTradeShip | |
| Could not make building: USH_Turret_ADP | |
| Could not make building: USH_DarkGlitterpanel | |
| Could not make building: USH_LightGlitterpanel | |
| Could not make building: USH_FabricsGlitterpanel | |
| Could not make building: USH_NeuralGlitterpanel | |
| Could not make building: USH_AwareGlitterpanel | |
| Could not make building: USH_GlittertechRepairer | |
| Could not make building: USH_GlittertechTargeter | |
| Could not make building: USH_GlittertechFabricator | |
| Could not make building: USH_MemoryPylon | |
| Could not make building: USH_MolecularDisassembler | |
| Could not make building: USH_NeuroclearConsole | |
| Could not make building: USH_NeutroamineExtractor | |
| Could not make building: USH_ResearchProbe | |
| Could not make building: USH_SolarFlareBank | |
| Could not make building: USH_Telepad | |
| Could not make building: USH_TrapIED_ADP | |
| Could not make building: USH_OptimizationCoprocessor | |
| Could not make building: USH_JammerCoprocessor | |
| Could not make building: USH_VitalityCoprocessor | |
| Could not make building: USH_Cyberpod | |
| Could not make building: USH_DataServer | |
| Could not make building: USH_Turret_MechhiveDisruptor | |
| Could not make building: USH_LuciferiumMedicalSimulator | |
| Could not make building: USH_ScarletAttractor | |
| Could not make building: LuciferiumCollector | |
| Could not make building: AdvancedLuciferiumCollector | |
| Could not make building: LuciferiumCollectorBoosterA | |
| Could not make building: LuciferiumCollectorBoosterB | |
| Could not make building: LuciferiumCollectorBoosterC | |
| Could not make building: VCHE_CompressedScarletSludgePlatform | |
| Could not make building: USH_CompressedScarletSludgePipe | |
| Could not make building: VCHE_ScarletMechanitesPlatform | |
| Could not make building: USH_ScarletMechanitesPipe | |
| Could not make building: USH_LuciferiumSynthesizer | |
| Could not make building: USH_LuciferiumPrecisionBooster | |
| Could not make building: USH_UndergroundScarletPipe | |
| Could not make building: USH_ScarletTank | |
| Could not make building: ScarlettRefinery | |
| Could not make building: VBE_Bar | |
| Could not make building: VBE_SodaFountain | |
| Could not make building: VBE_AmbrandyDistillery | |
| Could not make building: VBE_WhiskeyCask | |
| Could not make building: VBE_TequilaBarrel | |
| Could not make building: VBE_VodkaDrum | |
| Could not make building: VBE_GinStill | |
| Could not make building: VCE_ElectricPot | |
| Could not make building: VCE_Grill | |
| Could not make building: VCE_DeepFrier | |
| Could not make building: VCE_CanningMachine | |
| Could not make building: VCE_CondimentPrepTable | |
| Could not make building: VCE_CheesePress | |
| Could not make building: VFEC_Tent | |
| Could not make building: VFEC_Thermaebath | |
| Could not make building: VFEC_TheatreStage | |
| Could not make building: VFEC_Beacon | |
| Could not make building: VFEC_MeatDryingRack | |
| Could not make building: VFEC_CraftingBench | |
| Could not make building: VFEC_WoodFiredCrematorium | |
| Could not make building: VFEC_ConcretePress | |
| Could not make building: VFEC_TyrianFarm | |
| Could not make building: VFEC_Turret_Scorpion | |
| Could not make building: VFEC_LargePassiveCooler | |
| Could not make building: VFEC_HeatStones | |
| Could not make building: VFEE_GrandTable | |
| Could not make building: VFEE_GrandChair | |
| Could not make building: VFEE_ImperialBanner | |
| Could not make building: VFEE_RoyalStool | |
| Could not make building: VFEE_StellicThrone | |
| Could not make building: VFEE_Candelabra | |
| Could not make building: VFEE_RoyalMirror | |
| Could not make building: VFEE_SteleSmall | |
| Could not make building: VFEE_ImperialSlab | |
| Could not make building: VFEE_LargeRoyalRug | |
| Could not make building: VFEE_GrandRoyalRug | |
| Could not make building: VFEI_HiveWall | |
| Could not make building: VFEI2_InsectJellyWall | |
| Could not make building: VFEI2_RoyalJellyWall | |
| Could not make building: VFEI2_LargeGlowPod | |
| Could not make building: VFEI2_GlowPodFormation | |
| Could not make building: VFEI2_GlowPodSpire | |
| Could not make building: VFEI2_StaticPod | |
| Could not make building: VFEI2_FoamPod | |
| Could not make building: VFEI2_TendrilFarm | |
| Could not make building: VFEI2_Creeper | |
| Could not make building: VFEI2_JellyFarm | |
| Could not make building: VFEI2_ArtificialBasicHive | |
| Could not make building: VFEI2_ArtificialSorneHive | |
| Could not make building: VFEI2_ArtificialNuchadusHive | |
| Could not make building: VFEI2_ArtificialChelisHive | |
| Could not make building: VFEI2_ArtificialKemianHive | |
| Could not make building: VFEI2_ArtificialXanidesHive | |
| Could not make building: VFEI2_HeatPod | |
| Could not make building: VFEI2_DeepHeater | |
| Could not make building: VFEI2_JellyMorpher | |
| Could not make building: VFEI2_Petroglypher | |
| Could not make building: VFEI2_Hivenode | |
| Could not make building: VFEI2_Thornpod | |
| Could not make building: VFEI2_Vilelobber | |
| Could not make building: VFEI2_Thornworm | |
| Could not make building: VFEI2_Thornspitter | |
| Could not make building: VFEI2_HiveDoor | |
| Could not make building: VFEI2_Jellyspreader | |
| Could not make building: VFEI2_RoyalJellyspreader | |
| Could not make building: VFEI2_Thumper_Empress | |
| Could not make building: VFEI2_Thumper_Titantick | |
| Could not make building: VFEI2_Thumper_Teramantis | |
| Could not make building: VFEI2_Thumper_Gigamite | |
| Could not make building: VFEI2_Thumper_Silverfish | |
| Could not make building: VFEM2_HearthDarklight | |
| Could not make building: VFEM2_Viking_Slab_Medium | |
| Could not make building: VFEM2_Viking_Slab_Broad | |
| Could not make building: VFEM2_Apiary | |
| Could not make building: VFEM2_2x1CastleDoor | |
| Could not make building: VFEM2_3x1CastleDoor | |
| Could not make building: VFEM2_4x1CastleDoor | |
| Could not make building: VFEM2_2x1CastleGate | |
| Could not make building: VFEM2_3x1CastleGate | |
| Could not make building: VFEM2_4x1CastleGate | |
| Could not make building: VFEM2_FurBed | |
| Could not make building: VFEM2_DoubleFurBed | |
| Could not make building: VFEM2_Hearth | |
| Could not make building: VFEM2_StandingBanner | |
| Could not make building: VFEM2_ArcheryTarget | |
| Could not make building: VFEM2_TrainingDummy | |
| Could not make building: VFEM2_LeatherBoilpot | |
| Could not make building: VFEM2_SmithingAnvil | |
| Could not make building: VFEM2_ForgeBellows | |
| Could not make building: VFEM2_TailoringLoom | |
| Could not make building: VFEM2_MannequinStand | |
| Could not make building: VFEM2_ChiselRack | |
| Could not make building: VFEM2_StoneClamp | |
| Could not make building: VFEM2_CleaverRack | |
| Could not make building: VFEM2_CarvingBoard | |
| Could not make building: VFEM2_StonePolisher | |
| Could not make building: VFEM2_ArtToolStand | |
| Could not make building: VFEM2_NotesStack | |
| Could not make building: VFEM2_ResearchBoard | |
| Could not make building: VFEM2_SurgicalTools | |
| Could not make building: VFEM2_AilmentsShelf | |
| Could not make building: VFEM2_MeadFermentingBarrel | |
| Could not make building: VFEM2_AlchemicalWorkbench | |
| Could not make building: VFEM2_AlchemicalWorkbench_Electric | |
| Could not make building: VFEM2_Turret_WallMountedArbalest | |
| Could not make building: VFEM2_Turret_WallMountedArquebus | |
| Could not make building: VFEM2_ClothWall | |
| Could not make building: VFEM2_TimberedWall | |
| Could not make building: VFEM2_Palisade | |
| Could not make building: VFEM2_CastleWall | |
| Could not make building: VFEM2_LowCastleWall | |
| Could not make building: VFEM2_WineBarrel | |
| Could not make building: VFEM2_HeraldicRugNarrow | |
| Could not make building: VFEM2_HeraldicRugBroad | |
| Could not make building: VFEM2_HeraldicRugGrand | |
| Could not make building: ChemBoiler | |
| Could not make building: Chemlamp | |
| Could not make building: ChemlampPost | |
| Could not make building: Building_ChemshineBarrel | |
| Could not make building: DoorSaloon | |
| Could not make building: Post | |
| Could not make building: StoolBar | |
| Could not make building: TableCircular | |
| Could not make building: TableFaro | |
| Could not make building: TableFiveFingerFilet | |
| Could not make building: Turret_GatlingGun | |
| Could not make building: Windmill | |
| Could not make building: VFET_FloorPainting | |
| Could not make building: VFET_SittingSpot | |
| Could not make building: VFET_ResearchSpot | |
| Could not make building: VFET_AnimalTrap | |
| Could not make building: VFET_LargeFire | |
| Could not make building: Stone_DarklightCampfire | |
| Could not make building: VFE_AnimalSarcophagus | |
| Could not make building: Bed_StoneSlab | |
| Could not make building: VFE_Bed_StoneSlabDouble | |
| Could not make building: Bed_Simple | |
| Could not make building: VFE_Bed_SimpleDouble | |
| Could not make building: Seat_Cushion | |
| Could not make building: Seat_Bench | |
| Could not make building: Seat_SquareChair | |
| Could not make building: Table_1x1c | |
| Could not make building: Table_Counter | |
| Could not make building: VFE_CoffeeTable | |
| Could not make building: Stone_Campfire | |
| Could not make building: Radio_Industrial | |
| Could not make building: Radio_Spacer | |
| Could not make building: Joy_Arcade | |
| Could not make building: Joy_InudstrialComputer | |
| Could not make building: Joy_ModernComputer | |
| Could not make building: Joy_Piano | |
| Could not make building: Joy_RouletteTable | |
| Could not make building: Joy_DartsBoard | |
| Could not make building: Joy_PunchingBag | |
| Could not make building: VFE_Lounger | |
| Could not make building: Misc_FileCabinet | |
| Could not make building: Shelf_WeaponRack | |
| Could not make building: Bin_Small | |
| Could not make building: Bin_Large | |
| Could not make building: VFE_LongPlantPot | |
| Could not make building: VFE_DeskLamp | |
| Could not make building: VFE_FloorLamp | |
| Could not make building: Light_Streetlamp | |
| Could not make building: Bed_Ergonomic | |
| Could not make building: Bed_DoubleErgonomic | |
| Could not make building: Table_Wardrobe | |
| Could not make building: Seat_ModernChair | |
| Could not make building: VFE_ModularCouch | |
| Could not make building: Bed_Kingsize | |
| Could not make building: Table_RoyalEndTable | |
| Could not make building: Table_RoyalDresser | |
| Could not make building: VFE_RoyalWardrobe | |
| Could not make building: VFE_RoyalLamp | |
| Could not make building: Seat_RoyalChair | |
| Could not make building: Seat_RoyalArmchair | |
| Could not make building: Table_Royal1x1c | |
| Could not make building: Table_Royal1x2c | |
| Could not make building: Table_Royal2x2c | |
| Could not make building: Table_Royal2x4c | |
| Could not make building: Table_Royal3x3c | |
| Could not make building: VFEArch_FineWall | |
| Could not make building: VFEArch_LogWall | |
| Could not make building: VFEArch_ChainlinkFence | |
| Could not make building: VFEArch_PicketFence | |
| Could not make building: VFEArch_BrickFence | |
| Could not make building: VFEArch_InvisibleFence | |
| Could not make building: VFEArch_LowFence | |
| Could not make building: VFEArch_HedgeWall | |
| Could not make building: VFEArch_ArmoredWall | |
| Could not make building: VFEArch_ArmoredDoor | |
| Could not make building: VFEArch_SingleDoor | |
| Could not make building: VFEArch_SingleDoor_Flipped | |
| Could not make building: VFEArch_AnimalGate | |
| Could not make building: VFE_Wallpaper | |
| Could not make building: VFE_PlanterBox | |
| Could not make building: VFE_Ecosystem | |
| Could not make building: VFE_PlanterBox_Tilable | |
| Could not make building: VFE_Hydroponics_Tilable | |
| Could not make building: VFE_Ecosystem_Tilable | |
| Could not make building: VFE_Scarecrow | |
| Could not make building: VFE_Sprinkler | |
| Could not make building: Bed_OperatingTable | |
| Could not make building: Bed_CryptoBed | |
| Could not make building: Facility_VitalsCentre | |
| Could not make building: Facility_IVDrip | |
| Could not make building: Facility_ResearchCounter | |
| Could not make building: VFEM_Wall_Sterile | |
| Could not make building: VFE_AdvancedWindTurbine | |
| Could not make building: VFE_AdvancedSolarGenerator | |
| Could not make building: VFE_AdvancedWatermillGenerator | |
| Could not make building: VPE_AdvancedGeothermalGenerator | |
| Could not make building: VFE_LargeBattery | |
| Could not make building: VFE_SmallBattery | |
| Could not make building: VFE_AdvancedBattery | |
| Could not make building: VFE_LargeAdvancedBattery | |
| Could not make building: VPE_NuclearGenerator | |
| Could not make building: VFE_PortableWoodFiredGenerator | |
| Could not make building: VFE_PortableChemfuelPoweredGenerator | |
| Could not make building: VFE_IndustrialWoodFiredGenerator | |
| Could not make building: VFE_IndustrialChemfuelPoweredGenerator | |
| Could not make building: VFE_TidalGenerator | |
| Could not make building: VFE_DrugCabinet | |
| Could not make building: VFE_MachiningCabinet | |
| Could not make building: VFE_SmithyCabinet | |
| Could not make building: VFE_KitchenSinkCabinet | |
| Could not make building: VFE_TailorCabinet | |
| Could not make building: VFE_FabricationCabinet | |
| Could not make building: VFE_TableMachiningLarge | |
| Could not make building: VFE_TableSmithyLarge | |
| Could not make building: VFE_TableStoveLarge | |
| Could not make building: VFE_TableTailorLarge | |
| Could not make building: VFE_ComponentFabricationBench | |
| Could not make building: VFE_TableButcherElectric | |
| Could not make building: VFE_TableDrugLabElectric | |
| Could not make building: VFE_FueledSmelter | |
| Could not make building: VFE_TableStonecutterElectric | |
| Could not make building: VFES_Turret_NonLethalTurret | |
| Could not make building: VFES_Complex_GraserCannon | |
| Could not make building: VFES_Complex_HeavyIncineratorComplex | |
| Could not make building: VFES_Turret_AntiAir | |
| Could not make building: VFES_Turret_AutomatedMortar | |
| Could not make building: VFES_Turret_Artillery | |
| Could not make building: VFES_Turret_Concealed | |
| Could not make building: VFES_ConcealedBarrier | |
| Could not make building: VFES_SmallRepulsor | |
| Could not make building: VFES_LargeRepulsor | |
| Could not make building: VFES_BearTrap | |
| Could not make building: VFES_CavalrySpikes | |
| Could not make building: VEFS_TrapLandmine | |
| Could not make building: VEFS_TrapShockmine | |
| Could not make building: VFES_BarbedWire | |
| Could not make building: VFES_Dugout | |
| Could not make building: VFES_Trench | |
| Could not make building: VFES_Platform | |
| Could not make building: VFES_AmmoCrate | |
| Could not make building: VFES_Turret_Catapult | |
| Could not make building: VFES_Turret_Ballista | |
| Could not make building: VFES_Turret_MilitaryTurret | |
| Could not make building: VFES_Turret_ArmoredTurret | |
| Could not make building: VFES_Turret_Searchlight | |
| Could not make building: VFES_Turret_Flame | |
| Could not make building: VFES_Turret_ShotgunTurret | |
| Could not make building: VFES_Turret_AutocannonDouble | |
| Could not make building: VFES_Complex_Hmg | |
| Could not make building: VFES_Complex_Minigun | |
| Could not make building: VFES_Turret_Minigun | |
| Could not make building: VFES_Turret_ChargeTurret | |
| Could not make building: VFES_Turret_ChargeRailgun | |
| Could not make building: VFES_Turret_TeslaBlaster | |
| Could not make building: VFES_Complex_Charge | |
| Could not make building: Bed_AdvBed | |
| Could not make building: Bed_AdvDoubleBed | |
| Could not make building: Table_IlluminatedEndTable | |
| Could not make building: Table_IlluminatedDresser | |
| Could not make building: VFES_Table_IlluminatedWardrobe | |
| Could not make building: UltrascreenTV | |
| Could not make building: VFES_WallMountedTelevision | |
| Could not make building: VFES_TelevisionSpeaker | |
| Could not make building: Shelf_RepairRack | |
| Could not make building: Spacer_OutdoorLamp | |
| Could not make building: VFES_AirPurifier | |
| Could not make building: Seat_AdvChair | |
| Could not make building: VFES_ModernArmchair | |
| Could not make building: VFES_ModernCouch | |
| Could not make building: Table_interactive_1x1c | |
| Could not make building: Table_interactive_2x2c | |
| Could not make building: VGE_OperatorSubpersonaCore | |
| Could not make building: VGE_AstrofuelPipe | |
| Could not make building: VGE_HiddenAstrofuelPipe | |
| Could not make building: VGE_AstrofuelValve | |
| Could not make building: VGE_GiantAstrofuelTank | |
| Could not make building: VGE_AstrofuelTap | |
| Could not make building: VGE_AstrofuelDrain | |
| Could not make building: VGE_AstrofuelGenerator | |
| Could not make building: VGE_IndustrialAstrofuelGenerator | |
| Could not make building: VGE_AstrofuelSynthesizer | |
| Could not make building: VGE_GiantThruster | |
| Could not make building: VGE_OxygenPipe | |
| Could not make building: VGE_HiddenOxygenPipe | |
| Could not make building: VGE_OxygenValve | |
| Could not make building: VGE_SmallOxygenTank | |
| Could not make building: VGE_LargeOxygenTank | |
| Could not make building: VGE_OxygenCanisterFiller | |
| Could not make building: VGE_OxygenCanisterEmptier | |
| Could not make building: VGE_OxygenHarvester | |
| Could not make building: VGE_LifeSupportSystem | |
| Could not make building: VGE_IndustrialOxygenPump | |
| Could not make building: VGE_Agrocell | |
| Could not make building: VGE_TargetingTerminal | |
| Could not make building: VGE_PointDefenseTurret | |
| Could not make building: VGE_AmmoBox_GaussShell | |
| Could not make building: VGE_GaussGun | |
| Could not make building: VGE_JavelinPod | |
| Could not make building: VGE_AnticraftCaster | |
| Could not make building: VGE_CompactStove | |
| Could not make building: VGE_CompactDrugLab | |
| Could not make building: VGE_CompactMachiningTable | |
| Could not make building: VGE_CompactSmithy | |
| Could not make building: VGE_CompactTailor | |
| Could not make building: VGE_CompactRefinery | |
| Could not make building: VGE_CompactFabBench | |
| Could not make building: VGE_GravjumperEngine | |
| Could not make building: VGE_GravhulkEngine | |
| Could not make building: VGE_GravFieldAmplifier | |
| Could not make building: VGE_CrewBunkBed | |
| Could not make building: VGE_MedbayBed | |
| Could not make building: VGE_CrewLockers | |
| Could not make building: VGE_GravshipShelf | |
| Could not make building: VGE_WallFirefoamPopper | |
| Could not make building: VGE_CommsTerminal | |
| Could not make building: VGE_WallOrbitalTradeBeacon | |
| Could not make building: VGE_FauxPlant | |
| Could not make building: VGE_SealantPopper | |
| Could not make building: VGE_PilotCockpit | |
| Could not make building: VGE_PilotBridge | |
| Could not make building: VGE_CopilotConsole | |
| Could not make building: VGE_SmallHeatsink | |
| Could not make building: VGE_LargeHeatsink | |
| Could not make building: VGE_GravheatAbsorber | |
| Could not make building: VGE_EngineeringConsole | |
| Could not make building: VGE_GravcorePowerCoil | |
| Could not make building: VGE_GravshipCapacitor | |
| Could not make building: VGE_SolarPanelling | |
| Could not make building: VGE_GravtechConsole | |
| Could not make building: VGE_VacBarrierDouble | |
| Could not make building: VGE_VacBarrierTriple | |
| Could not make building: VGE_VacBarrierQuintuple | |
| Could not make building: VGE_VacCheckpoint | |
| Could not make building: VHE_TableBarber | |
| Could not make building: VHGE_GasSunLamp | |
| Could not make building: VHGE_GasLamp | |
| Could not make building: VHGE_GasWallLamp | |
| Could not make building: VHGE_GasFloodlight | |
| Could not make building: VHGE_GasOperatedPodLauncher | |
| Could not make building: VHGE_HelixienGenerator | |
| Could not make building: VHGE_IndustrialHelixienGenerator | |
| Could not make building: VHGE_GasPoweredCrematorium | |
| Could not make building: VHGE_GasPoweredSmelter | |
| Could not make building: VHGE_GasPoweredStove | |
| Could not make building: VHGE_GasPoweredSmithy | |
| Could not make building: VHGE_GasPoweredRefinery | |
| Could not make building: VHGE_GasCooler | |
| Could not make building: VHGE_GasHeater | |
| Could not make building: VHGE_HelixienPipe | |
| Could not make building: VHGE_SubterraneanHelixienPipe | |
| Could not make building: VHGE_HelixienPump | |
| Could not make building: VHGE_GasTank | |
| Could not make building: VHGE_GasPipeValve | |
| Could not make building: VNPE_NutrientPastePipe | |
| Could not make building: VNPE_UndergroundNutrientPastePipe | |
| Could not make building: VNPE_NutrientPasteValve | |
| Could not make building: VNPE_NutrientPasteGrinder | |
| Could not make building: VNPE_NutrientPasteTap | |
| Could not make building: VNPE_NutrientPasteFeeder | |
| Could not make building: VNPE_NutrientPasteDripper | |
| Could not make building: VNPE_NutrientPasteVat | |
| Could not make building: VQED_BuriedDeathPit | |
| Could not make building: VQE_Genetron_Basic | |
| Could not make building: VQE_Genetron_ChemfuelPowered | |
| Could not make building: VQE_Genetron_ChemfuelBoosted | |
| Could not make building: VQE_Genetron_ChemfuelCharged | |
| Could not make building: VQE_Genetron_ChemfuelFortified | |
| Could not make building: VQE_Genetron_Geothermal | |
| Could not make building: VQE_Genetron_SteamPowered | |
| Could not make building: VQE_Genetron_ThermalVent | |
| Could not make building: VQE_Genetron_HeatPowered | |
| Could not make building: VQE_Genetron_UraniumPowered | |
| Could not make building: VQE_Genetron_Nuclear | |
| Could not make building: VQE_Genetron_Isotopic | |
| Could not make building: VQE_Genetron_Atomic | |
| Could not make building: VQE_Genetron_WoodFired | |
| Could not make building: VQE_Genetron_WoodFueled | |
| Could not make building: VQE_Genetron_WoodPowered | |
| Could not make building: VQE_Genetron_WoodBlasting | |
| Could not make building: VREA_NeutroPipe | |
| Could not make building: VREA_SubterraneanNeutroPipe | |
| Could not make building: VREA_NeutroTank | |
| Could not make building: VREA_NeutroTap | |
| Could not make building: VREA_NeutroDrain | |
| Could not make building: VREA_AndroidStandSpot | |
| Could not make building: VREA_AndroidStand | |
| Could not make building: VREA_AndroidPartWorkbench | |
| Could not make building: VREA_SubcorePolyanalyzer | |
| Could not make building: VREA_AndroidCreationStation | |
| Could not make building: VREA_AndroidBehavioristStation | |
| Could not make building: VREA_NeutroCasket | |
| Could not make building: VRE_PsychofluidWell | |
| Could not make building: VRE_HemogenPipe | |
| Could not make building: VRE_UndergroundHemogenPipe | |
| Could not make building: VRE_HemogenValve | |
| Could not make building: VRE_HemogenVat | |
| Could not make building: VRE_HemogenTap | |
| Could not make building: VRE_HemogenDrain | |
| Could not make building: VRE_Draincasket | |
| Could not make building: VRE_InvocationMatrix | |
| Could not make building: VRE_HemodynamicAccelerator | |
| Could not make building: VRE_HemogenSolidifier | |
| Could not make building: VRE_SmallHemogenAmplifier | |
| Could not make building: VRE_SmallHemopump | |
| Could not make building: VRE_BurnBarrel | |
| Could not make building: VRecyclingE_LargePollutionPump | |
| Could not make building: VRecyclingE_PollutionFastPump | |
| Could not make building: VRecyclingE_WasteCrate | |
| Could not make building: VRecyclingE_RecyclingWorkbench | |
| Could not make building: VRecyclingE_ElectricRecyclingWorkbench | |
| Could not make building: VRecyclingE_GarbageCompactor | |
| Could not make building: VRecyclingE_AlloypackSplitter | |
| Could not make building: VESWW_RewardDropSpot | |
| Could not make building: VTE_TradingTerminal | |
| Could not make building: VVE_GarageCabinet | |
| Could not make building: VVE_RefuelingPump | |
| Could not make building: VVE_GarageBench | |
| Could not make building: VVE_TankTrap | |
| Could not make building: VVE_GarageDoor | |
| Could not make building: VVE_GarageDoorLarge | |
| Could not make building: VVE_GarageAutoDoor | |
| Could not make building: VVE_GarageAutoDoorLarge | |
| Could not make building: VVE_BangBus_Blueprint | |
| Could not make building: VVE_Bunsen_Blueprint | |
| Could not make building: VVE_Dinghy_Blueprint | |
| Could not make building: VVE_Dirtbike_Blueprint | |
| Could not make building: VVE_Frog_Blueprint | |
| Could not make building: VVE_Highwayman_Blueprint | |
| Could not make building: VVE_Mule_Blueprint | |
| Could not make building: VVE_Prowler_Blueprint | |
| Could not make building: VVE_Roadkill_Blueprint | |
| Could not make building: VVE_Scytheman_Blueprint | |
| Could not make building: VVE_Toad_Blueprint | |
| Could not make building: VVE_Traveller_Blueprint | |
| Could not make building: VVE_Bulldog_Blueprint | |
| Could not make building: VVE_Charley_Blueprint | |
| Could not make building: VVE_Mosquito_Blueprint | |
| Could not make building: VVE_Roadrunner_Blueprint | |
| Could not make building: VVE_Smuggler_Blueprint | |
| Could not make building: VVE_Snatcher_Blueprint | |
| Could not make building: VVE_Tango_Blueprint | |
| Could not make building: VVE_Trawler_Blueprint | |
| Could not make building: VVE_Wagon_Blueprint | |
| Could not make building: VVE_Warbird_Blueprint | |
| Could not make building: VVE_Wisent_Blueprint | |
| Could not make building: TableLoom | |
| Could not make building: TableElecLoom | |
| Could not make building: WB_Storykeeper | |
| Could not make building: Rede | |
| Could not make building: AM_InfernusMechlinkBooster | |
| Could not make building: AM_WarEmpressMechlinkBooster | |
| Could not make building: AM_ApoptosisMechlinkBooster | |
| Could not make building: AM_BeamcasterBandNode | |
| Could not make building: AM_GreaterBandNode | |
| Could not make building: AM_GreaterMechBooster | |
| Could not make building: AM_MechEfficiencyBooster | |
| Could not make building: AM_MechArmorBooster | |
| Could not make building: AM_MechTargettingBooster | |
| Could not make building: AM_MechDisruptor | |
| Could not make building: AM_GreaterRecharger | |
| Could not make building: Romy_RestoredAncientLamp | |
| Could not make building: Romy_AncientPowerCellBlock | |
| Could not make building: AM_SmallGenerator | |
| Could not make building: AM_AncientDismantlingWorkbench | |
| Could not make building: AM_DiningChair | |
| Could not make building: AM_ElectricalBox | |
| Could not make building: AM_VirutalMiner | |
| Could not make building: AM_Entrance_LargeElevator | |
| Could not make building: AM_MaterialElevatorA | |
| Could not make building: AM_MaterialElevatorB | |
| Could not make building: AM_MaterialElevatorC | |
| Could not make building: AM_MaterialElevatorD | |
| Could not make building: AM_Arrow | |
| Could not make building: AM_Bishop | |
| Could not make building: AM_Crown | |
| Could not make building: AM_D2A | |
| Could not make building: AM_Knight | |
| Could not make building: AM_Pawn | |
| Could not make building: AM_Queen | |
| Could not make building: AM_Rook | |
| Could not make building: AM_RFC | |
| Could not make building: AM_DK | |
| Could not make building: AM_ADI | |
| Could not make building: AM_HG | |
| Could not make building: AM_VC | |
| Could not make building: AM_IndicatorLine_Yellow | |
| Could not make building: AM_IndicatorLine | |
| Could not make building: AM_Rail | |
| Could not make building: AM_Crosstie | |
| Could not make building: AM_AncientOperatingTable | |
| Could not make building: DA_TrollRug | |
| Could not make building: DA_LarpahRug | |
| Could not make building: DA_LarpahRugB | |
| Could not make building: DA_DrogRug | |
| Could not make building: EM_DiggingSpot | |
| Could not make building: EM_ShaftDiggingRig | |
| Could not make building: EM_AutomaticDigger | |
| Could not make building: EM_AutomaticDiggerLarge | |
| Could not make building: EM_DryingPile | |
| Could not make building: EM_FiringPile | |
| Could not make building: EM_Kiln | |
| Could not make building: EM_Wall_AdobeBrick | |
| Could not make building: EM_Wall_ClayBrick | |
| Could not make building: EM_Wall_CementBrick | |
| Could not make building: Mashed_Ashlands_GlowingTorchbugLamp | |
| Could not make building: Mashed_Ashlands_GlowingTorchbugWallLamp | |
| Could not make building: Mashed_Ashlands_MazteFermentingBarrel | |
| Could not make building: Mashed_Ashlands_SujammaFermentingBarrel | |
| Could not make building: Mashed_Ashlands_SheinFermentingBarrel | |
| Could not make building: Mashed_Ashlands_FlinFermentingBarrel | |
| Could not make building: Mashed_Ashlands_JazbayFermentingBarrel | |
| Could not make building: Mashed_Ashlands_TorchbugLamp | |
| Could not make building: Mashed_Ashlands_TorchbugWallLamp | |
| Could not make building: Mashed_Ashlands_DarklightTorchbugLamp | |
| Could not make building: Mashed_Ashlands_DarklightTorchbugWallLamp | |
| Could not make building: Mashed_Ashlands_FetcherflyLamp | |
| Could not make building: Mashed_Ashlands_FetcherflyWallLamp | |
| Could not make building: Mashed_Ashlands_FetcherflyHive | |
| Could not make building: AdvancedMultiAnalyzer | |
| Could not make building: ToolCabinetA | |
| Could not make building: ToolCabinetB | |
| Could not make building: ToolCabinetC | |
| Could not make building: KitchenCupboard | |
| Could not make building: SurgicalLamp | |
| Could not make building: SurgicalInstruments | |
| Could not make building: RE_AsariTerminal | |
| Could not make building: VBE_EspressoMachineBuilding | |
| Could not make building: VCHE_ChemfuelPipe | |
| Could not make building: VCHE_UndergroundChemfuelPipe | |
| Could not make building: VCHE_ChemfuelValve | |
| Could not make building: PS_ChemfuelTank | |
| Could not make building: VCHE_ChemfuelTap | |
| Could not make building: VCHE_ChemfuelDrain | |
| Could not make building: VCHE_DeepchemPipe | |
| Could not make building: VCHE_UndergroundDeepchemPipe | |
| Could not make building: VCHE_DeepchemValve | |
| Could not make building: PS_DeepchemTank | |
| Could not make building: PS_DeepchemRefinery | |
| Could not make building: VCHE_DeepchemPumpjack | |
| Could not make building: VCHE_DeepchemTap | |
| Could not make building: VCHE_DeepchemDrain | |
| Could not make building: VCE_BakeryOven_Fueled | |
| Could not make building: VCE_BakeryOven_Electric | |
| Could not make building: VCE_ElectricHauteSection | |
| Could not make building: VCE_StewPot | |
| Could not make building: VCE_SushiPrepTable | |
| Could not make building: VCE_SoyFermenter | |
| Could not make building: VFED_RemoteTrapIED_HighExplosive | |
| Could not make building: VFED_RemoteTrapIED_Incendiary | |
| Could not make building: VFED_RemoteTrapIED_EMP | |
| Could not make building: VFED_RemoteTrapIED_Smoke | |
| Could not make building: VFED_RemoteTrapIED_Firefoam | |
| Could not make building: VFED_RemoteTrapIED_AntigrainWarhead | |
| Could not make building: VFED_TrapIED_Shrapnel | |
| Could not make building: VFED_TrapIED_ArmorPiercing | |
| Could not make building: VFED_TrapIED_Cluster | |
| Could not make building: VFED_RemoteTrapIED_Shrapnel | |
| Could not make building: VFED_RemoteTrapIED_ArmorPiercing | |
| Could not make building: VFED_RemoteTrapIED_Cluster | |
| Could not make building: VFED_Turret_Kontarion | |
| Could not make building: VFED_Turret_Palintone | |
| Could not make building: VFED_Turret_Onager | |
| Could not make building: VFED_AmmoBox_UraniumSlug | |
| Could not make building: VFED_AmmoBox_Autocannon | |
| Could not make building: VFED_AmmoBox_Missile | |
| Could not make building: VFED_BurnoutIntelScraper | |
| Could not make building: VFEP_Box_FoldingGun | |
| Could not make building: VFEP_Box_TearGasGrenadeLauncher | |
| Could not make building: VFEP_Box_SalvagedLaserEradicator | |
| Could not make building: VFEP_Box_Railgun | |
| Could not make building: VFEP_WarcasketFoundry | |
| Could not make building: VFEP_Turret_FieldGun | |
| Could not make building: VFEP_Turret_Cannon | |
| Could not make building: VFEP_Box_Autorifle | |
| Could not make building: VFEP_Box_UraniumSlugRifle | |
| Could not make building: VFEP_Box_Slugthrower | |
| Could not make building: VFEP_Box_Minigun | |
| Could not make building: VFEP_Box_GrenadeLauncher | |
| Could not make building: VFEP_Box_HeavyFlamer | |
| Could not make building: VFEP_Box_CombatKnife | |
| Could not make building: VFEP_Box_Broadsword | |
| Could not make building: VFEP_Box_ChargeLance | |
| Could not make building: VFEP_Box_HandheldCannon | |
| Could not make building: VFEP_Box_ChargeBlaster | |
| Could not make building: VFEP_Box_GravityHammer | |
| Could not make building: VVE_Badger_Blueprint | |
| Could not make building: VVE_BigRig_Blueprint | |
| Could not make building: VVE_Burya_Blueprint | |
| Could not make building: VVE_Cherokee_Blueprint | |
| Could not make building: VVE_Goliath_Blueprint | |
| Could not make building: VVE_Hermano_Blueprint | |
| Could not make building: VVE_Lightning_Blueprint | |
| Could not make building: VVE_Louie_Blueprint | |
| Could not make building: VVE_Marshal_Blueprint | |
| Could not make building: VVE_Nomad_Blueprint | |
| Could not make building: VVE_Paladin_Blueprint | |
| Could not make building: VVE_Springbok_Blueprint | |
| Could not make building: VVE_Udar_Blueprint | |
| Could not make building: CA_ChemfuelStoveLarge | |
| Could not make building: CE_FueledSmithyLarge | |
| Could not make building: CA_InfiniteDeepchemPumpjack | |
| Could not make building: CE_ChemfuelDeepFrier | |
| Could not make building: CE_ChemfuelGrill | |
| Could not make building: CE_ChemfuelPot | |
| Could not make building: CE_AirFryer | |
| Could not make building: CA_GasTurbine | |
| Could not make building: CE_InfiniteChemfuelPump | |
| Could not make building: CA_ChemfuelBrazierDark | |
| Could not make building: CA_SunlampDark | |
| Could not make building: CA_ChemfuelBrazier | |
| Could not make building: CAS_ChemfuelCooler | |
| Could not make building: CAS_ChemfuelHeater | |
| Could not make building: CA_ChemfuelCrematorium | |
| Could not make building: CA_Sunlamp | |
| Could not make building: CA_ChemfuelStandingLamp | |
| Could not make building: CA_ChemfuelSmithy | |
| Could not make building: CA_ChemfuelSmelter | |
| Could not make building: CA_WoodFiredTurbine | |
| Could not make building: CA_ChemfuelTurbine | |
| Could not make building: CA_ChemfuelFloodlight | |
| Could not make building: CE_ChemfuelStove | |
| Could not make building: CAS_ChemfuelWallLight | |
| Could not make building: SCP_ChemDrill | |
| Could not make building: RB_SmoothGravshipHull | |
| Could not make building: RB_GravshipWindowHull | |
| Could not make building: RB_GravshipPanoramaHull | |
| Could not make building: RB_LargeSecurityDoor | |
| Could not make building: RB_FloorLamp | |
| Could not make building: RB_GlassAutodoor | |
| Could not make building: RB_ReinforcedGlassAutodoor | |
| Could not make building: RB_DoubleDoor | |
| Could not make building: RB_DoubleAutodoor | |
| Could not make building: RB_LargeOrnateDoor | |
| Could not make building: RB_CellDoor | |
| Could not make building: RB_OverwallFireplace | |
| Could not make building: RB_Fireplace | |
| Could not make building: RB_OverwallArmor | |
| Could not make building: RB_RusticWall | |
| Could not make building: RB_OrnateWall | |
| Could not make building: RB_ClerestoryWall | |
| Could not make building: RB_ReinforcedClerestoryWall | |
| Could not make building: RB_GlassWall | |
| Could not make building: RB_ReinforcedGlassWall | |
| Could not make building: RB_CellWall | |
| Could not make building: RB_BarriersWall | |
| Could not make building: HRK_RusticEmbrasure | |
| Could not make building: HRK_CastleWallEmbrasure | |
| Could not make building: HRK_ArmoredEmbrasure | |
| Could not make building: EM_FueledAlloyFurnace | |
| Could not make building: EM_ElectricAlloyFurnace | |
| Could not make building: VCE_VegMilkExtractor | |
| Could not make building: VFEI2_AA_ArtificialBlackHive | |
| Could not make building: AA_DarkLargeGlowPod | |
| Could not make building: AA_DarkGlowPodFormation | |
| Could not make building: AA_BlackJellyMorpher | |
| Could not make building: AA_FreezePod | |
| Could not make building: AA_BlackDefiler | |
| Could not make building: AA_BlackJellyWall | |
| Could not make building: AA_FoamBelcher | |
| Could not make building: AA_BioMechDisruptor | |
| Could not make building: AA_BlackCreeper | |
| Could not make building: VFEI2_Thumper_BlackEmpress | |
| Could not make building: AA_DarkGlowPod | |
| Could not make building: AA_BlueGelBattery | |
| Could not make building: AA_HexaGelBattery | |
| Could not make building: AA_HexagelCoreReactor | |
| Could not make building: AG_ForsakenForge | |
| Could not make building: GR_BiomechanicalLabBeacon | |
| Could not make building: GR_MechahybridAntenna | |
| Could not make building: GR_GenePod | |
| Could not make building: GR_ElectroWomb | |
| Could not make building: GR_LargeElectroWomb | |
| Could not make building: GR_TissueGrinder | |
| Could not make building: GR_GeneticsTinkeringTable | |
| Could not make building: GR_GeneticExtractionTable | |
| Could not make building: GR_GeneRecombinator | |
| Could not make building: GR_NutrientVat | |
| Could not make building: GR_TissueGrowingVat | |
| Could not make building: VME_WickerMan | |
| Could not make building: VME_Bonfire | |
| Could not make building: VME_MechanoidEffigy | |
| Could not make building: VME_Obelisk | |
| Could not make building: VME_TaoistSlab_Medium | |
| Could not make building: VME_TaoistSlab_Broad | |
| Could not make building: VME_EsotericismSlab_Medium | |
| Could not make building: VME_EsotericismSlab_Broad | |
| Could not make building: VME_EldritchSlab_Medium | |
| Could not make building: VME_EldritchSlab_Broad | |
| Could not make building: VME_SerketistSlab_Medium | |
| Could not make building: VME_SerketistSlab_Broad | |
| Could not make building: SeedPackingBench | |
| Could not make building: SeedPackingCraftingSpot | |
| Could not make building: GR_GenetrainerBench | |
| Could not make building: PE_TribalBell | |
| Could not make building: PE_SchoolBell | |
| Could not make building: PE_ElectricSchoolBell | |
| Could not make building: PE_LessonStone | |
| Could not make building: PE_LargeBlackboard | |
| Could not make building: PE_Whiteboard | |
| Could not make building: PE_LargeWhiteboard | |
| Could not make building: PE_HoloEducatorScreen | |
| Could not make building: PE_LargeHoloEducatorScreen | |
| Could not make building: TribalCrib | |
| Could not make building: RoyalCrib | |
| Could not make building: PE_StoneSchoolDesk | |
| Could not make building: PE_TouchscreenSchoolDesk | |
| Could not make building: PE_Projector | |
| Could not make building: PE_StrikingBoard | |
| Could not make building: PE_Cadaver | |
| Could not make building: PE_ShootingTarget | |
| Could not make building: TMM_VF_PassengerShuttle_Blueprint | |
| Could not make building: PFS_Shelf | |
| Could not make building: PFS_DisplayPod | |
| Could not make building: BS_AndroidFuelRefinery | |
| Could not make building: BS_AndroidChargingStation | |
| Could not make building: AB_MagmaThermalPlant_Advanced | |
| Could not make building: AM_CubicCrib | |
| Could not make building: PFK_AdaptiveClothingRack | |
| Could not make building: VFEI_BurrowWall | |
| Could not make building: VFED_RemoteTrapIED_ToxGas | |
| Could not make building: HRK_FineEmbrasure | |
| Could not make building: CE_Embrasure | |
| Could not make building: VFEM2_CobblestoneWall_ChunkSandstone | |
| Could not make building: VFEM2_CobblestoneWall_ChunkGranite | |
| Could not make building: VFEM2_CobblestoneWall_ChunkLimestone | |
| Could not make building: VFEM2_CobblestoneWall_ChunkSlate | |
| Could not make building: VFEM2_CobblestoneWall_ChunkMarble | |
| Could not make building: VFEM2_CobblestoneWall_ChunkVacstone | |
| Could not make building: VFEM2_CobblestoneWall_GU_ChunkRoseQuartz | |
| Could not make building: VFEM2_CobblestoneWall_AB_ChunkCragstone | |
| Could not make building: VFEM2_CobblestoneWall_AB_ChunkObsidian | |
| Could not make building: VFEM2_CobblestoneWall_AB_ChunkMudstone | |
| Could not make building: VFEM2_CobblestoneWall_AB_ChunkSlimeStone | |
| Could not make building: VFEM2_CobblestoneWall_EM_ChunkShale | |
| Could not make building: VFEM2_CobblestoneWall_EM_ChunkSiltstone | |
| Could not make building: VFEM2_CobblestoneWall_EM_ChunkSchist | |
| Could not make building: VFEM2_CobblestoneWall_EM_ChunkBasalt | |
| Could not make building: VFEM2_CobblestoneWall_Mashed_Ashlands_ChunkBasalt | |
| Could not get wallable rect | |
| No gene-trackers found. Aborting inheritance prefix. | |
| Stomach has null Part. It should be set before PostAdd. | |
| Tried to restore null body part. | |
| Exception filling window for LudeonTK.Dialog_Debug: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref DDEDEDC2] | |
| at Verse.Hediff_AddedPart.PostAdd (System.Nullable`1[T] dinfo) [0x000a6] in <46372f5dadbf4af8939e608076251180>:0 | |
| - TRANSPILER VREAndroidsMod: IEnumerable`1 VREAndroids.Hediff_AddedPart_PostAdd_Patch:Transpiler(IEnumerable`1 codeInstructions, ILGenerator il) | |
| at Verse.HediffSet.AddDirect (Verse.Hediff hediff, System.Nullable`1[T] dinfo, Verse.DamageWorker+DamageResult damageResult) [0x00151] in <46372f5dadbf4af8939e608076251180>:0 | |
| - TRANSPILER Neronix17.RimEffect.RimWorld: IEnumerable`1 RimEffect.Patch_HediffSet_AddDirect:Transpiler(IEnumerable`1 instructions) | |
| - PREFIX VREAndroidsMod: Boolean VREAndroids.HediffSet_AddDirect_Patch:Prefix(HediffSet __instance, Pawn ___pawn, Hediff hediff) | |
| - PREFIX SimsTraitsMod: Boolean SimsTraits.HediffSet_AddDirect_Patch:Prefix(HediffSet __instance, Pawn ___pawn, Hediff hediff) | |
| - PREFIX VAEInsanityMod: Boolean VAEInsanity.HediffSet_AddDirect_Patch:Prefix(HediffSet __instance, Pawn ___pawn, Hediff hediff) | |
| - PREFIX ReSpliceCharmweavers.Mod: Boolean ReSpliceCharmweavers.HediffSet_AddDirect_Patch:Prefix(HediffSet __instance, Pawn ___pawn, Hediff hediff) | |
| - POSTFIX ReSpliceCoreMod: Void ReSpliceCore.HediffSet_AddDirect_Patch:Postfix(HediffSet __instance, Pawn ___pawn, Hediff hediff) | |
| - POSTFIX vanillaexpanded.aspirations: Void VAspirE.SatisfactionPatches:CheckGeneral(Pawn ___pawn) | |
| - POSTFIX com.VEHighmate: Void VanillaRacesExpandedHighmate.HediffSet_AddDirect_Patch:Postfix(Pawn ___pawn, Hediff hediff) | |
| - POSTFIX ReSpliceCharmweavers.Mod: Void ReSpliceCharmweavers.HediffSet_AddDirect_Patch:Postfix(HediffSet __instance, Pawn ___pawn, Hediff hediff) | |
| at Verse.Pawn_HealthTracker.AddHediff (Verse.Hediff hediff, Verse.BodyPartRecord part, System.Nullable`1[T] dinfo, Verse.DamageWorker+DamageResult result) [0x001ae] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX VREAndroidsMod: Boolean VREAndroids.Pawn_HealthTracker_AddHediff_Patch:Prefix(Pawn_HealthTracker __instance, Pawn ___pawn, Hediff& hediff, BodyPartRecord part, Nullable`1 dinfo, DamageResult result) | |
| - PREFIX SimsTraitsMod: Boolean SimsTraits.Pawn_HealthTracker_AddHediff_Patch:Prefix(Pawn_HealthTracker __instance, Pawn ___pawn, Hediff& hediff, BodyPartRecord part, Nullable`1 dinfo, DamageResult result) | |
| - PREFIX VAEInsanityMod: Boolean VAEInsanity.Pawn_HealthTracker_AddHediff_Patch:Prefix(Pawn_HealthTracker __instance, Pawn ___pawn, Hediff& hediff, BodyPartRecord part, Nullable`1 dinfo, DamageResult result) | |
| - PREFIX ReSpliceCharmweavers.Mod: Boolean ReSpliceCharmweavers.Pawn_HealthTracker_AddHediff_Patch:Prefix(Pawn_HealthTracker __instance, Pawn ___pawn, Hediff& hediff, BodyPartRecord part, Nullable`1 dinfo, DamageResult result) | |
| - PREFIX SmashPhil.VehicleFramework: Boolean Vehicles.Patch_HealthAndStats:VehiclesDontAddHediffs(Pawn ___pawn) | |
| - PREFIX OskarPotocki.VanillaPsycastsExpanded: Boolean VanillaPsycastsExpanded.Pawn_HealthTracker_AddHediff_Patch:Prefix(Pawn_HealthTracker __instance, Pawn ___pawn, Hediff hediff, BodyPartRecord part, Nullable`1 dinfo, DamageResult result) | |
| - PREFIX Helixien.ReGrowthCore: Boolean ReGrowthCore.Pawn_HealthTracker_AddHediff_Patch:Prefix(Pawn_HealthTracker __instance, Pawn ___pawn, Hediff hediff, BodyPartRecord part, Nullable`1 dinfo, DamageResult result) | |
| - POSTFIX legodude17.mvcf: Void MVCF.PatchSets.Trackers.PatchSet_Hediffs:AddHediff_Postfix(Hediff hediff, Pawn_HealthTracker __instance) | |
| at Verse.Pawn_HealthTracker.AddHediff (Verse.HediffDef def, Verse.BodyPartRecord part, System.Nullable`1[T] dinfo, Verse.DamageWorker+DamageResult result) [0x0000e] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.Autotests_ColonyMaker.MakeColony (RimWorld.ColonyMakerFlag[] flags) [0x00956] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.Autotests_ColonyMaker.MakeColony_Full () [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.DebugAutotests.MakeColonyFull () [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at LudeonTK.DebugActionNode.Enter (LudeonTK.Dialog_Debug dialog) [0x00065] in <46372f5dadbf4af8939e608076251180>:0 | |
| at LudeonTK.Dialog_Debug.DoButton (LudeonTK.DebugActionNode node, System.Single columnWidth, System.Boolean highlight) [0x0003e] in <46372f5dadbf4af8939e608076251180>:0 | |
| at LudeonTK.Dialog_Debug.DrawNode (LudeonTK.DebugActionNode node, System.Single columnWidth, System.Boolean highlight) [0x00018] in <46372f5dadbf4af8939e608076251180>:0 | |
| at LudeonTK.DebugTabMenu.ListOptions (System.Int32 highlightedIndex, System.Single columnWidth) [0x00065] in <46372f5dadbf4af8939e608076251180>:0 | |
| at LudeonTK.Dialog_Debug.DoWindowContents (UnityEngine.Rect inRect) [0x00208] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.Window.InnerWindowOnGUI (System.Int32 x) [0x001a6] in <46372f5dadbf4af8939e608076251180>:0 | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Orion | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Orion | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Rikko | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinCheekbones to Rikko | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Celanial | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Celanial | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Susskind | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinBruise to Susskind | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Ferco | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Ferco | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Cass | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Cass | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Qianqian | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Qianqian | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Nose | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Nose | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Jenni | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinRightEye to Jenni | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Onesan | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Onesan | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Viktor | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Viktor | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Diver | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinSmileLines to Diver | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Ben | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinCrowsFeet to Ben | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Four Eyes | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinCheekScar to Four Eyes | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Ad | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinBruise to Ad | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Kate | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinFreckles to Kate | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Heathcliff | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Heathcliff | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Salinas | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinCrowsFeet to Salinas | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Shady | |
| [FA Genetic Heads] SkinTypeDef: assigned AKN_SkinSnoot to Shady | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Iosif | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinCheekbones to Iosif | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Samantha | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Samantha | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Maverick | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinBruise to Maverick | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Sooze | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinFreckles3 to Sooze | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Conley | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Conley | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Hoover | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinForheadWrinkles to Hoover | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Phantum | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinBruise to Phantum | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Nag | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Nag | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Paul | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Paul | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Liefe | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinFreckles2 to Liefe | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Kimmy | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinFreckles3 to Kimmy | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to CJ | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to CJ | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Clayton | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinChinCleft to Clayton | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Just | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinForeheadScar to Just | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Sky | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Sky | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Sireffe | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Sireffe | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Markus | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Markus | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Toni | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinFrownLines to Toni | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Keiko | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinRosyCheeks to Keiko | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Lloyd | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinForheadWrinkles to Lloyd | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Candice | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Candice | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadSquare to Raisa | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinNormal to Raisa | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadPointy to Jenny | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinForeheadScar to Jenny | |
| [FA Genetic Heads] HeadTypeDef: assigned HeadNormal to Carr | |
| [FA Genetic Heads] SkinTypeDef: assigned SkinForheadWrinkles to Carr | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] | |
| [0x00006] in <51fded79cd284d4d911c5949aff4cb21>:0 | |
| at System.Collections.Generic.Dictionary`2[TKey,TValue].FindEntry (TKey key) [0x00008] in <51fded79cd284d4d911c5949aff4cb21>:0 | |
| at System.Collections.Generic.Dictionary`2[TKey,TValue].TryGetValue (TKey key, TValue& value) [0x00000] in <51fded79cd284d4d911c5949aff4cb21>:0 | |
| at Verse.ListerBuildings.TryGetReinstallBlueprint (Verse.Thing building, RimWorld.Blueprint_Install& bp) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.InstallBlueprintUtility.ExistingBlueprintFor (Verse.Thing th) [0x00018] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.InstallBlueprintUtility.CancelBlueprintsFor (Verse.Thing th) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at AnomaliesExpected.MinifiedThing_AE.Tick () [0x00008] in <972e6fca0c004d20ab5d25e3cd75df4b>:0 | |
| at Verse.Thing.DoTick () [0x0007b] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.TickList.Tick () [0x00139] in <46372f5dadbf4af8939e608076251180>:0 | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Salinas threw exception in WorkGiver DoBillsCremate: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref 824A8B8C] | |
| at Verse.ThingFilter.Allows (Verse.Thing t) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.RefuelWorkGiverUtility+<>c__DisplayClass2_0.<FindBestFuel>g__Validator|0 (Verse.Thing x) [0x00027] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest+<>c__DisplayClass2_0.<ClosestThingReachable>g__GlobalValidator|0 (Verse.Thing t) [0x00034] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__ValidateThing|5_1 (Verse.Thing t, System.Single distSquared, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__Process|5_0 (Verse.Thing t, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00047] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThing_Global (Verse.IntVec3 center, System.Collections.IEnumerable searchSet, System.Single maxDistance, System.Predicate`1[T] validator, System.Func`2[T,TResult] priorityGetter, System.Boolean lookInHaulSources) [0x00066] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThingReachable (Verse.IntVec3 root, Verse.Map map, Verse.ThingRequest thingReq, Verse.AI.PathEndMode peMode, Verse.TraverseParms traverseParams, System.Single maxDistance, System.Predicate`1[T] validator, System.Collections.Generic.IEnumerable`1[T] customGlobalSearchSet, System.Int32 searchRegionsMin, System.Int32 searchRegionsMax, System.Boolean forceAllowGlobalSearch, Verse.RegionType traversableRegionTypes, System.Boolean ignoreEntirelyForbiddenRegions, System.Boolean lookInHaulSources) [0x001f3] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX dawnsglow.fixesforsbzfridge: Void FixesForSBZFridge.GenClosest_ClosestThingReachable:Prefix(ThingRequest thingReq, PathEndMode& peMode, TraverseParms traverseParams) | |
| at RimWorld.RefuelWorkGiverUtility.FindBestFuel (Verse.Pawn pawn, Verse.Thing refuelable) [0x00056] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.RefuelWorkGiverUtility.CanRefuel (Verse.Pawn pawn, Verse.Thing t, System.Boolean forced) [0x00134] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX vanillaexpanded.gravship: Boolean VanillaGravshipExpanded.CompBoxRefuel:CanRefuel_Prefix(Thing t, Boolean& __result) | |
| - PREFIX vanillaexpanded.factions.deserters: Boolean VFED.CompBoxRefuel:CanRefuel_Prefix(Thing t, Boolean& __result) | |
| at RimWorld.WorkGiver_DoBill.JobOnThing (Verse.Pawn pawn, Verse.Thing thing, System.Boolean forced) [0x000c3] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX VREAndroidsMod: Void VREAndroids.WorkGiver_DoBill_JobOnThing_Patch:Prefix(Pawn pawn, Thing thing, Boolean forced) | |
| at RimWorld.WorkGiver_Scanner.HasJobOnThing (Verse.Pawn pawn, Verse.Thing t, System.Boolean forced) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.JobGiver_Work+<>c__DisplayClass3_1.<TryIssueJobPackage>g__Validator|0 (Verse.Thing t) [0x00013] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest+<>c__DisplayClass2_0.<ClosestThingReachable>g__GlobalValidator|0 (Verse.Thing t) [0x00034] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__ValidateThing|5_1 (Verse.Thing t, System.Single distSquared, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__Process|5_0 (Verse.Thing t, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00047] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThing_Global (Verse.IntVec3 center, System.Collections.IEnumerable searchSet, System.Single maxDistance, System.Predicate`1[T] validator, System.Func`2[T,TResult] priorityGetter, System.Boolean lookInHaulSources) [0x00066] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThingReachable (Verse.IntVec3 root, Verse.Map map, Verse.ThingRequest thingReq, Verse.AI.PathEndMode peMode, Verse.TraverseParms traverseParams, System.Single maxDistance, System.Predicate`1[T] validator, System.Collections.Generic.IEnumerable`1[T] customGlobalSearchSet, System.Int32 searchRegionsMin, System.Int32 searchRegionsMax, System.Boolean forceAllowGlobalSearch, Verse.RegionType traversableRegionTypes, System.Boolean ignoreEntirelyForbiddenRegions, System.Boolean lookInHaulSources) [0x001f3] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX dawnsglow.fixesforsbzfridge: Void FixesForSBZFridge.GenClosest_ClosestThingReachable:Prefix(ThingRequest thingReq, PathEndMode& peMode, TraverseParms traverseParams) | |
| at RimWorld.JobGiver_Work.TryIssueJobPackage (Verse.Pawn pawn, Verse.AI.JobIssueParams jobParams) [0x00606] in <46372f5dadbf4af8939e608076251180>:0 | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Sooze threw exception in WorkGiver DoBillsCremate: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref 824A8B8C] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] | |
| at Verse.ThingFilter.Allows (Verse.Thing t) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.Bill.IsFixedOrAllowedIngredient (Verse.Thing thing) [0x00079] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX VREAndroidsMod: Boolean VREAndroids.Bill_IsFixedOrAllowedIngredient_Patch:Prefix(Boolean& __result, Bill __instance, Thing thing) | |
| at RimWorld.WorkGiver_DoBill.IsUsableIngredient (Verse.Thing t, RimWorld.Bill bill) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.WorkGiver_DoBill+<>c__DisplayClass23_0.<TryFindBestBillIngredients>b__0 (Verse.Thing t) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.WorkGiver_DoBill+<>c__DisplayClass24_0.<TryFindBestIngredientsHelper>b__0 (Verse.Thing t) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.WorkGiver_DoBill+<>c__DisplayClass24_0.<TryFindBestIngredientsHelper>b__4 (Verse.Region r) [0x0003e] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser+BFSWorker.BreadthFirstTraverseWork (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00054] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser.BreadthFirstTraverse (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00044] in <46372f5dadbf4af8939e608076251180>:0 | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] | |
| at Verse.ThingFilter.Allows (Verse.Thing t) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.Bill.IsFixedOrAllowedIngredient (Verse.Thing thing) [0x00048] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX VREAndroidsMod: Boolean VREAndroids.Bill_IsFixedOrAllowedIngredient_Patch:Prefix(Boolean& __result, Bill __instance, Thing thing) | |
| at RimWorld.WorkGiver_DoBill.IsUsableIngredient (Verse.Thing t, RimWorld.Bill bill) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.WorkGiver_DoBill+<>c__DisplayClass23_0.<TryFindBestBillIngredients>b__0 (Verse.Thing t) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.WorkGiver_DoBill+<>c__DisplayClass24_0.<TryFindBestIngredientsHelper>b__0 (Verse.Thing t) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.WorkGiver_DoBill+<>c__DisplayClass24_0.<TryFindBestIngredientsHelper>b__4 (Verse.Region r) [0x0003e] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser+BFSWorker.BreadthFirstTraverseWork (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00054] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser.BreadthFirstTraverse (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00044] in <46372f5dadbf4af8939e608076251180>:0 | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref EB26FD69] | |
| at Verse.ThingFilter.Allows (Verse.Thing t) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.RefuelWorkGiverUtility+<>c__DisplayClass2_0.<FindBestFuel>g__Validator|0 (Verse.Thing x) [0x00027] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest+<>c__DisplayClass2_0.<ClosestThingReachable>g__GlobalValidator|0 (Verse.Thing t) [0x00034] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__ValidateThing|5_1 (Verse.Thing t, System.Single distSquared, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__Process|5_0 (Verse.Thing t, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00047] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThing_Global (Verse.IntVec3 center, System.Collections.IEnumerable searchSet, System.Single maxDistance, System.Predicate`1[T] validator, System.Func`2[T,TResult] priorityGetter, System.Boolean lookInHaulSources) [0x00066] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThingReachable (Verse.IntVec3 root, Verse.Map map, Verse.ThingRequest thingReq, Verse.AI.PathEndMode peMode, Verse.TraverseParms traverseParams, System.Single maxDistance, System.Predicate`1[T] validator, System.Collections.Generic.IEnumerable`1[T] customGlobalSearchSet, System.Int32 searchRegionsMin, System.Int32 searchRegionsMax, System.Boolean forceAllowGlobalSearch, Verse.RegionType traversableRegionTypes, System.Boolean ignoreEntirelyForbiddenRegions, System.Boolean lookInHaulSources) [0x001f3] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX dawnsglow.fixesforsbzfridge: Void FixesForSBZFridge.GenClosest_ClosestThingReachable:Prefix(ThingRequest thingReq, PathEndMode& peMode, TraverseParms traverseParams) | |
| at RimWorld.RefuelWorkGiverUtility.FindBestFuel (Verse.Pawn pawn, Verse.Thing refuelable) [0x00056] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.RefuelWorkGiverUtility.CanRefuel (Verse.Pawn pawn, Verse.Thing t, System.Boolean forced) [0x00134] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX vanillaexpanded.gravship: Boolean VanillaGravshipExpanded.CompBoxRefuel:CanRefuel_Prefix(Thing t, Boolean& __result) | |
| - PREFIX vanillaexpanded.factions.deserters: Boolean VFED.CompBoxRefuel:CanRefuel_Prefix(Thing t, Boolean& __result) | |
| at RimWorld.WorkGiver_DoBill.JobOnThing (Verse.Pawn pawn, Verse.Thing thing, System.Boolean forced) [0x000c3] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX VREAndroidsMod: Void VREAndroids.WorkGiver_DoBill_JobOnThing_Patch:Prefix(Pawn pawn, Thing thing, Boolean forced) | |
| at RimWorld.WorkGiver_Scanner.HasJobOnThing (Verse.Pawn pawn, Verse.Thing t, System.Boolean forced) [0x00000] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.JobGiver_Work+<>c__DisplayClass3_1.<TryIssueJobPackage>g__Validator|0 (Verse.Thing t) [0x00013] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionProcessorClosestThingReachable.ProcessThing (Verse.Region reg, Verse.Thing t) [0x000a7] in <46372f5dadbf4af8939e608076251180>:0 | |
| - TRANSPILER dawnsglow.fixesforsbzfridge: IEnumerable`1 FixesForSBZFridge.RegionProcessorClosestThingReachable_ProcessThingTranspiler:Transpiler(IEnumerable`1 instructions) | |
| at Verse.RegionProcessorClosestThingReachable.RegionProcessor (Verse.Region reg) [0x0006c] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser+BFSWorker.BreadthFirstTraverseWork (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00054] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser.BreadthFirstTraverse (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00044] in <46372f5dadbf4af8939e608076251180>:0 | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref EB26FD69] Duplicate stacktrace, see ref for original | |
| Paul threw exception in WorkGiver DoBillsMakeWeapons: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref 824A8B8C] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Shady threw exception in WorkGiver DoBillsCremate: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref 824A8B8C] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref FFA3DB98] | |
| at Verse.ThingFilter.Allows (Verse.Thing t) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.RefuelWorkGiverUtility+<>c__DisplayClass2_0.<FindBestFuel>g__Validator|0 (Verse.Thing x) [0x00027] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest+<>c__DisplayClass2_0.<ClosestThingReachable>g__GlobalValidator|0 (Verse.Thing t) [0x00034] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__ValidateThing|5_1 (Verse.Thing t, System.Single distSquared, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00008] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.<ClosestThing_Global>g__Process|5_0 (Verse.Thing t, Verse.GenClosest+<>c__DisplayClass5_0& ) [0x00047] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThing_Global (Verse.IntVec3 center, System.Collections.IEnumerable searchSet, System.Single maxDistance, System.Predicate`1[T] validator, System.Func`2[T,TResult] priorityGetter, System.Boolean lookInHaulSources) [0x00066] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.GenClosest.ClosestThingReachable (Verse.IntVec3 root, Verse.Map map, Verse.ThingRequest thingReq, Verse.AI.PathEndMode peMode, Verse.TraverseParms traverseParams, System.Single maxDistance, System.Predicate`1[T] validator, System.Collections.Generic.IEnumerable`1[T] customGlobalSearchSet, System.Int32 searchRegionsMin, System.Int32 searchRegionsMax, System.Boolean forceAllowGlobalSearch, Verse.RegionType traversableRegionTypes, System.Boolean ignoreEntirelyForbiddenRegions, System.Boolean lookInHaulSources) [0x001f3] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX dawnsglow.fixesforsbzfridge: Void FixesForSBZFridge.GenClosest_ClosestThingReachable:Prefix(ThingRequest thingReq, PathEndMode& peMode, TraverseParms traverseParams) | |
| at RimWorld.RefuelWorkGiverUtility.FindBestFuel (Verse.Pawn pawn, Verse.Thing refuelable) [0x00056] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.RefuelWorkGiverUtility.CanRefuel (Verse.Pawn pawn, Verse.Thing t, System.Boolean forced) [0x00134] in <46372f5dadbf4af8939e608076251180>:0 | |
| - PREFIX vanillaexpanded.gravship: Boolean VanillaGravshipExpanded.CompBoxRefuel:CanRefuel_Prefix(Thing t, Boolean& __result) | |
| - PREFIX vanillaexpanded.factions.deserters: Boolean VFED.CompBoxRefuel:CanRefuel_Prefix(Thing t, Boolean& __result) | |
| at RimWorld.WorkGiver_Refuel.HasJobOnThing (Verse.Pawn pawn, Verse.Thing t, System.Boolean forced) [0x00009] in <46372f5dadbf4af8939e608076251180>:0 | |
| at RimWorld.JobGiver_Work+<>c__DisplayClass3_1.<TryIssueJobPackage>g__Validator|0 (Verse.Thing t) [0x00013] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionProcessorClosestThingReachable.ProcessThing (Verse.Region reg, Verse.Thing t) [0x000a7] in <46372f5dadbf4af8939e608076251180>:0 | |
| - TRANSPILER dawnsglow.fixesforsbzfridge: IEnumerable`1 FixesForSBZFridge.RegionProcessorClosestThingReachable_ProcessThingTranspiler:Transpiler(IEnumerable`1 instructions) | |
| at Verse.RegionProcessorClosestThingReachable.RegionProcessor (Verse.Region reg) [0x0006c] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser+BFSWorker.BreadthFirstTraverseWork (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00054] in <46372f5dadbf4af8939e608076251180>:0 | |
| at Verse.RegionTraverser.BreadthFirstTraverse (Verse.Region root, Verse.RegionEntryPredicate entryCondition, Verse.RegionProcessor regionProcessor, System.Int32 maxRegions, Verse.RegionType traversableRegionTypes) [0x00044] in <46372f5dadbf4af8939e608076251180>:0 | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Conley threw exception in WorkGiver EM_DoBillsAlloyFurnaceOven: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref 824A8B8C] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref D75F7A25] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Conley threw exception in WorkGiver DoBillsMakeWeapons: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref 824A8B8C] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception in BreadthFirstTraverse: System.NullReferenceException: Object reference not set to an instance of an object | |
| [Ref B7EF3149] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value cannot be null. | |
| Parameter name: key | |
| [Ref 4C3DA7C2] Duplicate stacktrace, see ref for original | |
| Exception ticking MinifiedThingAE53481 (at (28, 0, 28)): System.ArgumentNullException: Value can |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment